NPASS Compound

Natural Product: NPC472988

Natural Product ID	NPC472988
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	TUMCLUKPDAUYFA-GUHGQFERSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3594356
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 132137 0 0 0 0 0 0 0 0999 V2000 6.0438 5.8447 -1.0426 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7925 5.3013 -1.3620 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9229 3.8169 -1.2916 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7317 3.1414 -1.5858 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8337 1.8935 -0.9210 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5964 1.2829 -0.8755 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9934 1.2388 0.3594 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8425 2.2390 0.2967 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2564 1.8497 -0.6240 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5792 0.3704 -0.6663 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0215 -0.2856 0.5174 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5107 -0.1312 0.6694 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3024 -1.1742 -0.0837 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8414 -0.3672 2.1485 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4144 -1.7004 0.6270 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9062 -1.6697 1.0025 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6332 -1.0528 -0.1932 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0831 0.2811 -0.5294 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8267 0.9056 -1.6680 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2521 1.1971 -1.1409 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8696 1.8614 -2.1912 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8439 -0.1252 -0.8682 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0735 -0.8444 0.2070 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1985 -0.2746 1.5646 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8843 -2.1330 0.2154 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2760 -1.4994 0.3925 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2548 -0.2331 -0.4348 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2492 -0.3646 -1.5327 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6408 -0.4787 -0.9899 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0438 0.7257 -0.1925 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4606 0.5810 0.3001 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7891 0.6149 1.5607 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7704 0.8018 2.6128 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.2099 0.4621 1.9590 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2746 0.8355 -2.2940 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9516 -1.4582 -2.5256 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5867 -2.0672 -1.2780 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0960 -0.1439 -1.9927 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9348 1.0736 -1.5114 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5529 1.8680 -2.6660 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9777 3.2591 -2.2302 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2228 3.1970 -1.6574 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5830 1.9471 -3.6553 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9416 0.7273 -0.6104 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1547 -0.6369 -0.6000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9130 -1.1344 0.6410 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0226 -1.6834 1.3052 C 0 0 2 0 0 0 0 0 0 0 0 0 6.5653 -1.9320 2.7064 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4218 -2.4237 3.6279 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4371 -1.8538 4.3245 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7201 -0.6484 4.1989 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2720 -2.6725 5.2917 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2699 -0.9173 1.1912 C 0 0 2 0 0 0 0 0 0 0 0 0 8.6129 -0.5356 -0.2511 C 0 0 1 0 0 0 0 0 0 0 0 0 7.5207 -1.0254 -1.1423 C 0 0 1 0 0 0 0 0 0 0 0 0 7.5357 -2.3808 -1.3723 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7230 0.8407 -0.3898 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3272 -1.7830 1.5765 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1075 6.0653 -0.0933 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4564 5.6823 -2.3445 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1112 5.6159 -0.5470 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2153 3.5396 -0.2594 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1096 2.1794 0.1149 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6764 1.6607 1.1231 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3008 3.2078 0.0934 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4206 2.2880 1.3258 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0317 2.2307 -1.6505 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1447 2.4656 -0.3503 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4071 0.2477 1.4214 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7649 -2.1405 -0.1996 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6308 -0.8185 -1.0661 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2232 -1.4393 0.4861 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4923 0.4320 2.5628 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2435 -1.3673 2.3274 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8907 -0.2816 2.7069 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0479 -2.2367 1.5043 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2250 -2.3498 -0.2237 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9470 -1.0251 1.9020 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3016 -2.6786 1.1589 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3026 0.9602 0.3506 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4349 1.8808 -1.9867 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9592 0.2760 -2.5490 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2030 1.8386 -0.2521 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5452 1.5665 -3.0794 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7668 -0.7266 -1.8005 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1545 0.2502 1.7620 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4101 0.3812 1.9259 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2112 -1.1423 2.2948 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6288 -2.7906 1.0684 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8743 -2.6430 -0.7428 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4466 -1.3106 1.4689 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9910 -2.2438 0.0536 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5348 0.6827 0.1449 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3919 -0.6014 -1.8300 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7944 -1.3897 -0.3727 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4105 0.8283 0.7133 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0318 1.6153 -0.8263 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2485 0.4398 -0.4496 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0982 1.6687 2.4110 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2536 0.9304 3.6166 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1275 -0.0976 2.7113 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8635 0.9265 1.1713 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4466 0.8252 2.9594 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4104 -0.6505 1.9023 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4468 0.6347 -3.2463 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1221 -1.2299 -3.2207 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8719 -1.5340 -3.1815 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8048 -2.4508 -2.1122 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1933 -1.8486 -2.1790 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5775 -2.2931 -1.6880 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8819 -3.0568 -0.8048 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5489 0.5858 -2.5368 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4499 -1.0839 -1.9615 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0029 -0.1980 -2.6629 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5597 0.1484 -1.9811 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4018 1.3272 -3.0920 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0008 3.8978 -3.1373 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2648 3.6117 -0.7624 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7894 2.7448 -4.2154 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4300 -1.1208 -1.3241 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1744 -2.7470 0.8752 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1252 -0.9386 3.1087 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6146 -2.5614 2.6822 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8409 -3.4282 4.7113 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9979 -2.0389 5.8100 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5373 -3.1524 5.9577 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2401 0.0137 1.7607 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5701 -0.9827 -0.5702 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6342 -0.4683 -2.1099 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3790 -2.7209 -1.7233 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3305 1.0246 -1.1370 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1369 -2.6551 1.1559 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 11 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 22 23 1 0 23 24 1 1 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 2 3 32 33 1 0 32 34 1 0 28 35 1 6 28 36 1 0 17 37 1 6 10 38 1 6 5 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 39 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 2 0 50 52 1 0 47 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 53 58 1 0 41 3 1 0 55 45 1 0 12 7 1 0 23 17 1 0 18 10 1 0 27 22 1 0 1 59 1 0 2 60 1 0 2 61 1 0 3 62 1 1 5 63 1 1 7 64 1 1 8 65 1 0 8 66 1 0 9 67 1 0 9 68 1 0 11 69 1 1 13 70 1 0 13 71 1 0 13 72 1 0 14 73 1 0 14 74 1 0 14 75 1 0 15 76 1 0 15 77 1 0 16 78 1 0 16 79 1 0 18 80 1 1 19 81 1 0 19 82 1 0 20 83 1 1 21 84 1 0 22 85 1 6 24 86 1 0 24 87 1 0 24 88 1 0 25 89 1 0 25 90 1 0 26 91 1 0 26 92 1 0 27 93 1 1 29 94 1 0 29 95 1 0 30 96 1 0 30 97 1 0 31 98 1 0 33 99 1 0 33100 1 0 33101 1 0 34102 1 0 34103 1 0 34104 1 0 35105 1 0 36106 1 0 36107 1 0 36108 1 0 37109 1 0 37110 1 0 37111 1 0 38112 1 0 38113 1 0 38114 1 0 39115 1 6 40116 1 6 41117 1 6 42118 1 0 43119 1 0 45120 1 6 47121 1 6 48122 1 0 48123 1 0 52124 1 0 52125 1 0 52126 1 0 53127 1 1 54128 1 6 55129 1 6 56130 1 0 57131 1 0 58132 1 0 M END

Standard InCHIKey	TUMCLUKPDAUYFA-GUHGQFERSA-N
Standard InCHI	InChI=1S/C44H74O14/c1-22(2)11-10-15-44(9,53)24-12-17-43(8)31(24)25(47)19-29-41(6)16-14-30(40(4,5)28(41)13-18-42(29,43)7)57-39-37(35(51)32(48)26(20-45)55-39)58-38-36(52)34(50)33(49)27(56-38)21-54-23(3)46/h11,24-39,45,47-53H,10,12-21H2,1-9H3/t24-,25+,26+,27+,28-,29+,30-,31-,32+,33+,34-,35-,36+,37+,38-,39-,41-,42+,43+,44+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@@H]3[C@@](CCC=C(C)C)(O)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@H](COC(=O)C)[C@H]([C@@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	826.51	Volume:	836.031 ? Van der Waals volume.
Dense:	0.989	LogP:	2.501 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.147 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.616 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	34.0
TPSA:	225.06 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	8.0	Rings:	6.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.085	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.921	Fsp³:	0.932
MCE-18:	134.4 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.901	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.21	Promiscuous compounds:	0.347

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.768	MDCK Permeability:	-5.171
Pgp-inhibitor:	0.0	Pgp-substrate:	0.079
PAMPA:	0.986 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.633
20% Bioavailability (F20%):	0.153	30% Bioavailability (F30%):	0.995
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.117	MRP1:	0.032
Plasma Protein Binding (PPB):	60.303%	Volume Distribution (VD):	-0.55
Fu:	32.029% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.029
BSEP inhibitor:	0.01

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.573	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.888
HLM stability:	0.042 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.704

Half-life (T1/2):

2.475

ADMET: Toxicity

hERG Blockers:	0.01	hERG Blockers (10um):	0.056
Human Hepatotoxicity (H-HT):	0.56	Drug-induced Liver Injury (DILI):	0.698
AMES Toxicity:	0.66	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.005	Skin Sensitization:	1.0
Carcinogencity:	0.128	Eye Corrosion:	0.0
Eye Irritation:	0.005	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.988
Hematotoxicity:	0.239	Drug-induced Nephrotoxicity:	0.952
Genotoxicity:	0.071	RPMI-8226 Immunitoxicity:	0.103
A549 Cytotoxicity:	0.335	Hek293 Cytotoxicity:	0.107
BCF:	1.302 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.036 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.911 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.964 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Flower buds	n.a.	n.a.	PMID[12880307]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Stems	n.a.	n.a.	PMID[17663584]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[18186611]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Steamed Roots	n.a.	n.a.	PMID[26200131]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1
IC50	5

Activity Type	# Activity
Cell line	5
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT681	Cell line	PC-12	Rattus norvegicus	Activity	=	13.4	%	PMID[26200131]
NPT116	Cell line	HL-60	Homo sapiens	IC50	>	10000.0	nM	PMID[10924160]
NPT81	Cell line	A549	Homo sapiens	IC50	>	10000.0	nM	PMID[26186257]
NPT83	Cell line	MCF7	Homo sapiens	IC50	>	10000.0	nM	PMID[20439614]
NPT660	Cell line	SW480	Homo sapiens	IC50	>	10000.0	nM	PMID[18303848]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	10000.0	nM	PMID[26200131]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC472988 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19941
0.1-0.2	24128
0.2-0.3	4317
0.3-0.4	1100
0.4-0.5	308
0.5-0.6	29
0.6-0.7	19
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC38217
0.8452	Intermediate Similarity	NPC8039
0.8452	Intermediate Similarity	NPC120123
0.7889	Intermediate Similarity	NPC194842
0.7634	Intermediate Similarity	NPC234160
0.7333	Intermediate Similarity	NPC165033
0.7333	Intermediate Similarity	NPC273879
0.7294	Intermediate Similarity	NPC88000
0.7294	Intermediate Similarity	NPC4831
0.7294	Intermediate Similarity	NPC472023
0.701	Intermediate Similarity	NPC208650
0.6961	Remote Similarity	NPC135369
0.6869	Remote Similarity	NPC220427
0.6698	Remote Similarity	NPC241381
0.6667	Remote Similarity	NPC14946
0.6667	Remote Similarity	NPC63368
0.6574	Remote Similarity	NPC146868
0.6535	Remote Similarity	NPC65167
0.6526	Remote Similarity	NPC208477
0.6514	Remote Similarity	NPC488294
0.6505	Remote Similarity	NPC159005
0.6489	Remote Similarity	NPC312553
0.6383	Remote Similarity	NPC472897
0.6383	Remote Similarity	NPC472896
0.6277	Remote Similarity	NPC159036
0.6186	Remote Similarity	NPC473199
0.6122	Remote Similarity	NPC69737
0.6061	Remote Similarity	NPC472252
0.6061	Remote Similarity	NPC245280
0.6034	Remote Similarity	NPC488291
0.5938	Remote Similarity	NPC611039
0.5882	Remote Similarity	NPC16520
0.5882	Remote Similarity	NPC211879
0.5882	Remote Similarity	NPC189852
0.5882	Remote Similarity	NPC155010
0.5833	Remote Similarity	NPC246124
0.5833	Remote Similarity	NPC488293
0.5769	Remote Similarity	NPC286969
0.5758	Remote Similarity	NPC472987
0.5702	Remote Similarity	NPC488292
0.5686	Remote Similarity	NPC269627
0.5644	Remote Similarity	NPC181467
0.5631	Remote Similarity	NPC231340
0.56	Remote Similarity	NPC16573
0.5521	Remote Similarity	NPC31907
0.5474	Remote Similarity	NPC234287
0.5306	Remote Similarity	NPC47566
0.5306	Remote Similarity	NPC129372
0.5304	Remote Similarity	NPC610948
0.5263	Remote Similarity	NPC280825
0.5221	Remote Similarity	NPC472718
0.5221	Remote Similarity	NPC607354
0.5189	Remote Similarity	NPC276758
0.5167	Remote Similarity	NPC606950
0.5143	Remote Similarity	NPC488574
0.5104	Remote Similarity	NPC473198
0.5098	Remote Similarity	NPC252253
0.5043	Remote Similarity	NPC180183
0.5042	Remote Similarity	NPC146652

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC472988 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7001
0.1-0.2	2084
0.2-0.3	58
0.3-0.4	6
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data