NPASS Compound

Natural Product: NPC234160

Natural Product ID	NPC234160
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	QNOJYUZTGHGWKF-XGZDQIIWSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3600663
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 129134 0 0 0 0 0 0 0 0999 V2000 -11.6263 3.4335 0.6438 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4419 3.0369 -0.1502 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5784 2.1824 0.3515 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3479 1.7161 -0.3698 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4635 0.2586 -0.5035 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5942 -0.5903 0.0285 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8833 -2.0429 -0.2196 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4165 -0.1853 0.8293 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4296 -1.1083 2.0662 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0009 -1.4552 2.3366 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2320 -0.6804 1.3566 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1343 0.7443 1.8554 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1544 -0.6594 0.1556 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.6965 0.1895 -0.9685 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2617 -0.1947 -1.3250 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4170 -0.2294 -0.1201 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9273 -0.2732 -0.3422 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5925 -1.5021 -1.0982 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4923 0.9030 -1.1594 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0029 0.9487 -1.3747 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8220 0.5659 -0.1674 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0622 0.4753 1.0814 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8115 -0.2935 2.1521 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0434 1.9143 1.6764 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3110 -0.0991 1.0101 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5517 -1.3400 1.8063 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0416 -1.4035 2.0848 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9131 -1.2411 0.8925 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1373 -2.6112 0.3127 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5978 -0.5624 -0.3743 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9254 -0.3465 -0.4989 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8836 -1.1912 0.2732 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5772 -2.6339 0.0816 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9355 -2.8593 -1.2746 C 0 0 1 0 0 0 0 0 0 0 0 0 4.4027 -1.8183 -2.2641 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7208 -2.1003 -3.5811 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3497 -1.8839 -3.4960 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2223 -0.5396 -1.8734 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3741 -4.1003 -1.7310 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6820 -3.0559 1.0478 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1485 -0.8413 -0.2306 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9610 -0.2654 0.7301 C 0 0 1 0 0 0 0 0 0 0 0 0 8.1554 -1.1684 0.9355 C 0 0 1 0 0 0 0 0 0 0 0 0 9.3484 -0.7572 0.1053 C 0 0 2 0 0 0 0 0 0 0 0 0 9.6583 0.7094 0.3358 C 0 0 1 0 0 0 0 0 0 0 0 0 8.4412 1.4225 0.8979 C 0 0 1 0 0 0 0 0 0 0 0 0 8.6149 2.9058 0.7757 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7326 3.3523 -0.5214 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8100 3.3019 -1.5209 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6728 2.8129 -1.3406 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1467 3.8384 -2.8702 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3063 1.0025 0.2677 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6706 0.8082 1.2692 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1182 -1.0375 -1.2328 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5591 -1.2389 2.2625 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4853 -0.1688 -2.0922 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2377 3.6054 -1.5034 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5417 4.4622 1.0512 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5318 3.3425 -0.0107 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7895 2.7597 1.5012 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7446 1.7796 1.3390 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4362 2.1783 -1.3880 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4310 2.1050 0.0514 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3297 -0.1159 -1.0828 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9902 -2.1258 -1.3392 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0747 -2.7132 0.0596 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8773 -2.3255 0.1834 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3998 0.8548 1.1210 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8882 -0.4697 2.8770 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0876 -1.9654 1.9473 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8004 -2.5245 2.4234 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7645 -1.0384 3.3627 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1901 0.9980 2.3346 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3364 1.5045 1.0877 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9229 0.9343 2.6464 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3713 -1.6642 -0.2486 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8333 1.2672 -0.8642 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3117 -1.0753 -1.9513 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9199 0.6466 -1.9911 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5683 0.7753 0.3927 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3739 -1.4913 -1.6358 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6746 -2.4548 -0.5899 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3364 -1.5470 -1.9530 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8958 1.8761 -0.7536 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9165 0.8742 -2.2029 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2577 0.3075 -2.2653 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2138 1.9837 -1.7219 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5923 1.3983 -0.0989 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4573 0.0086 3.1710 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8012 -1.3664 1.9975 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8565 0.0687 2.1104 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0067 2.3922 1.4508 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8263 1.8203 2.7587 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2413 2.5155 1.2436 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9605 0.6797 1.5300 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1540 -2.2664 1.3623 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0695 -1.2594 2.8025 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2451 -0.7070 2.9142 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2081 -2.4293 2.5294 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0549 -2.7016 -0.7620 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4273 -3.3786 0.7492 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1444 -3.0484 0.5794 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2265 0.7262 -0.3429 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8089 -0.9353 1.3499 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4862 -3.2907 0.1987 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8295 -2.9088 -1.2303 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4934 -2.0626 -2.4526 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8372 -3.1833 -3.8705 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1235 -1.4531 -4.3862 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8089 -2.6613 -3.7222 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4455 -4.7723 -1.0104 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9216 -2.5687 1.8861 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4019 -0.2278 1.6805 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9220 -2.2268 0.6303 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2043 -1.3782 0.4495 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9821 1.1351 -0.6215 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3236 1.1355 1.9874 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7171 3.4307 1.2400 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4639 3.2122 1.4308 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0837 3.3148 -3.1988 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3374 3.6082 -3.5764 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3218 4.9295 -2.7422 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1816 -0.0292 1.3935 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4938 -0.3541 -1.5680 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5082 -1.5782 2.2568 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1764 0.2887 -2.8988 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2112 4.0509 -1.6120 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3450 2.8672 -2.3171 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9781 4.4174 -1.7194 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 6 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 6 21 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 34 39 1 0 33 40 1 0 32 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 2 0 49 51 1 0 46 52 1 0 45 53 1 0 44 54 1 0 43 55 1 0 14 56 1 0 2 57 1 0 13 8 1 0 28 16 1 0 38 31 1 0 52 42 1 0 28 11 1 0 25 17 1 0 1 58 1 0 1 59 1 0 1 60 1 0 3 61 1 0 4 62 1 0 4 63 1 0 5 64 1 0 7 65 1 0 7 66 1 0 7 67 1 0 8 68 1 1 9 69 1 0 9 70 1 0 10 71 1 0 10 72 1 0 12 73 1 0 12 74 1 0 12 75 1 0 13 76 1 6 14 77 1 1 15 78 1 0 15 79 1 0 16 80 1 1 18 81 1 0 18 82 1 0 18 83 1 0 19 84 1 0 19 85 1 0 20 86 1 0 20 87 1 0 21 88 1 1 23 89 1 0 23 90 1 0 23 91 1 0 24 92 1 0 24 93 1 0 24 94 1 0 25 95 1 1 26 96 1 0 26 97 1 0 27 98 1 0 27 99 1 0 29100 1 0 29101 1 0 29102 1 0 31103 1 1 32104 1 1 33105 1 6 34106 1 1 35107 1 6 36108 1 0 36109 1 0 37110 1 0 39111 1 0 40112 1 0 42113 1 1 43114 1 6 44115 1 1 45116 1 6 46117 1 1 47118 1 0 47119 1 0 51120 1 0 51121 1 0 51122 1 0 53123 1 0 54124 1 0 55125 1 0 56126 1 0 57127 1 0 57128 1 0 57129 1 0 M END

Standard InCHIKey	QNOJYUZTGHGWKF-XGZDQIIWSA-N
Standard InCHI	InChI=1S/C44H72O13/c1-22(2)11-10-12-23(3)25-13-17-44(9)32(25)26(47)19-30-42(7)16-15-31(41(5,6)29(42)14-18-43(30,44)8)56-40-38(36(51)33(48)27(20-45)54-40)57-39-37(52)35(50)34(49)28(55-39)21-53-24(4)46/h11-12,25-40,45,47-52H,10,13-21H2,1-9H3/b23-12-/t25-,26-,27-,28-,29+,30-,31+,32+,33-,34-,35+,36+,37-,38-,39+,40+,42+,43-,44-/m1/s1
SMILES	CC(=CC/C=C(/C)[C@H]1CC[C@]2(C)[C@@H]1[C@@H](C[C@@H]1[C@@]3(C)CC[C@@H](C(C)(C)[C@@H]3CC[C@@]21C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](COC(=O)C)O1)O)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	808.5	Volume:	824.605 ? Van der Waals volume.
Dense:	0.98	LogP:	3.372 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.928 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.412 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	35.0
TPSA:	204.83 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	7.0	Rings:	6.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.096	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.902	Fsp³:	0.886
MCE-18:	129.88 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.961	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.248	Promiscuous compounds:	0.322

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.783	MDCK Permeability:	-5.145
Pgp-inhibitor:	0.0	Pgp-substrate:	0.058
PAMPA:	0.987 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.726
20% Bioavailability (F20%):	0.127	30% Bioavailability (F30%):	0.996
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.093	MRP1:	0.041
Plasma Protein Binding (PPB):	70.581%	Volume Distribution (VD):	-0.433
Fu:	22.532% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.087
BSEP inhibitor:	0.003

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.001
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.039	CYP3A4-substrate:	0.971
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.939
HLM stability:	0.655 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.86

Half-life (T1/2):

2.456

ADMET: Toxicity

hERG Blockers:	0.014	hERG Blockers (10um):	0.08
Human Hepatotoxicity (H-HT):	0.554	Drug-induced Liver Injury (DILI):	0.887
AMES Toxicity:	0.741	Rat Oral Acute Toxicity:	0.008
Maximum Recommended Daily Dose:	0.009	Skin Sensitization:	0.999
Carcinogencity:	0.134	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.993
Hematotoxicity:	0.384	Drug-induced Nephrotoxicity:	0.945
Genotoxicity:	0.207	RPMI-8226 Immunitoxicity:	0.084
A549 Cytotoxicity:	0.354	Hek293 Cytotoxicity:	0.212
BCF:	1.618 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.301 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.038 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.182 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33292	red ginseng	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[26087936]
NPO33292	red ginseng	Species	n.a.	n.a.	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT319	Cell line	B16	Mus musculus	Activity	=	95.0	%	PMID[19674905]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC234160 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20341
0.1-0.2	24265
0.2-0.3	3930
0.3-0.4	1012
0.4-0.5	259
0.5-0.6	25
0.6-0.7	17
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8415	Intermediate Similarity	NPC159036
0.7634	Intermediate Similarity	NPC472988
0.7634	Intermediate Similarity	NPC38217
0.7229	Intermediate Similarity	NPC280825
0.6813	Remote Similarity	NPC312553
0.6804	Remote Similarity	NPC208650
0.6765	Remote Similarity	NPC135369
0.6739	Remote Similarity	NPC472987
0.6667	Remote Similarity	NPC220427
0.6509	Remote Similarity	NPC241381
0.6471	Remote Similarity	NPC14946
0.6471	Remote Similarity	NPC63368
0.6389	Remote Similarity	NPC146868
0.6337	Remote Similarity	NPC65167
0.633	Remote Similarity	NPC488294
0.6316	Remote Similarity	NPC208477
0.6311	Remote Similarity	NPC159005
0.6277	Remote Similarity	NPC8039
0.6277	Remote Similarity	NPC120123
0.625	Remote Similarity	NPC473198
0.6222	Remote Similarity	NPC473200
0.5918	Remote Similarity	NPC69737
0.59	Remote Similarity	NPC194842
0.5876	Remote Similarity	NPC16573
0.5833	Remote Similarity	NPC472897
0.5833	Remote Similarity	NPC472896
0.58	Remote Similarity	NPC288694
0.5761	Remote Similarity	NPC234287
0.5726	Remote Similarity	NPC488291
0.5648	Remote Similarity	NPC246124
0.5537	Remote Similarity	NPC488293
0.549	Remote Similarity	NPC269627
0.5446	Remote Similarity	NPC181467
0.54	Remote Similarity	NPC165033
0.54	Remote Similarity	NPC273879
0.5391	Remote Similarity	NPC488292
0.5315	Remote Similarity	NPC472718
0.5312	Remote Similarity	NPC31907
0.5263	Remote Similarity	NPC88000
0.5263	Remote Similarity	NPC4831
0.5263	Remote Similarity	NPC472023
0.5221	Remote Similarity	NPC472716
0.5214	Remote Similarity	NPC209798
0.5208	Remote Similarity	NPC7341
0.5133	Remote Similarity	NPC123796
0.505	Remote Similarity	NPC252253

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC234160 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7091
0.1-0.2	1994
0.2-0.3	61
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data