Drug Information| Drug ID:   | NPD6695 |
| Drug Name:   | Maxacalcitol |
| Molecular Formula:   | C26H42O4 |
| Canonical SMILES:   | O[C@H]1C[C@H](O)C(=C)/C(=CC=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@@H](OCCC(O)(C)C)C)C)/C1 |
| Standard InCHI:   | "InChI=1S/C26H42O4/c1-17-20(15-21(27)16-24(17)28)9-8-19-7-6-12-26(5)22(10-11-23(19)26)18(2)30-14-13-25(3,4)29/h8-9,18,21-24,27-29H,1,6-7,10-16H2,2-5H3/b19-8+,20-9-/t18-,21+,22+,23-,24-,26+/m0/s1" |
| Standard InCHIKey:   | DTXXSJZBSTYZKE-ZDQKKZTESA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6695Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6212 | NPC63893 |
| Remote Similarity | 0.6212 | NPC324772 |
| Remote Similarity | 0.6212 | NPC611865 |
| Remote Similarity | 0.6119 | NPC320525 |
| Remote Similarity | 0.6119 | NPC316856 |
| Remote Similarity | 0.6119 | NPC320548 |
| Remote Similarity | 0.6119 | NPC607632 |
| Remote Similarity | 0.5857 | NPC23466 |
| Remote Similarity | 0.5775 | NPC324848 |
| TTD   | DNAP001372 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 6398761 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 418.31 |
| ALogP   | -0.3033 |
| MLogP   | 3.88 |
| XLogP   | 4.378 |
| HDA   | 4 |
| HBD   | 3 |
| Rotatable Bonds   | 13 |
| TPSA   | 69.92 |
| RO5 Violation   | 0 |