NPASS Compound

Natural Product: NPC473020

Natural Product ID	NPC473020
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NTWIHRCNQPXEOZ-KUOIDRQISA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3600662
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 128133 0 0 0 0 0 0 0 0999 V2000 -5.7534 5.2931 -1.4768 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7733 4.9819 -2.5213 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3368 3.7994 -2.5943 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9595 2.7371 -1.6221 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4511 1.5796 -2.4092 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9869 0.3837 -1.6151 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1212 -0.0468 -0.7670 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6276 0.4427 -1.1599 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0662 1.4586 -0.2638 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5614 1.1214 -0.4376 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5141 -0.3769 -0.5980 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9385 -0.8334 -0.7188 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4923 -1.5115 0.4587 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5791 -2.5751 1.0274 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1495 -2.4562 0.6283 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7164 -1.0309 0.5116 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2881 -1.0082 0.0738 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5941 -1.7441 1.1790 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2224 -3.1745 1.0855 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2704 -3.3985 1.3436 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4240 -3.5570 2.8070 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8882 -4.9682 3.1174 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5374 -5.0833 2.7686 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0933 -4.1794 1.7143 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6959 -5.1049 0.6357 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3354 -3.5685 2.3749 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2576 -4.9984 3.9903 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6185 -4.7680 0.7242 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8288 -1.4604 0.6905 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4919 -0.4025 1.2371 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8694 -0.5052 1.7149 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7351 -1.0016 0.5643 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8109 0.1749 -0.3769 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3595 0.5023 -0.7744 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4625 0.5554 0.2103 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9678 -0.5217 -1.8094 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7319 -0.1074 -2.3443 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2161 1.2867 0.3504 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2674 1.9884 -0.1763 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3532 2.1232 0.8364 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2559 3.2723 0.4519 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1706 3.5099 -1.0283 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7801 3.7513 -1.5071 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8201 3.2584 -0.6220 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5193 5.1762 -1.9126 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2638 5.2522 -2.5600 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8042 2.4864 -1.7499 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7826 4.4021 1.1360 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0242 0.9267 0.9878 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9954 -1.3753 0.9897 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1398 -1.0853 2.9154 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7920 -0.3306 1.8126 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0044 -0.7099 1.4667 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8536 -0.6446 -1.9376 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9517 -0.6304 -2.6965 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1238 6.0822 -3.4877 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2317 5.1912 -0.4583 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3963 6.3366 -1.5424 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8972 4.6067 -1.4834 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0673 3.5834 -3.3455 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2283 3.1546 -0.9485 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9255 2.4803 -1.0940 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5848 1.9192 -3.0394 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2269 1.2483 -3.1709 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1432 0.3626 0.2559 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1009 0.3575 -1.2019 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2850 -1.1398 -0.8399 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0260 0.6560 -2.1520 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1650 2.5249 -0.6091 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3824 1.4518 0.7690 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2764 1.6576 -1.3674 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9530 1.5264 0.3578 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0706 -1.5354 -1.6018 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3971 -2.1058 0.1177 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7631 -2.5671 2.1180 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8992 -3.6139 0.7089 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1513 -2.8105 -0.4597 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0186 -1.5129 -0.8278 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0602 0.0275 0.0824 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2840 -1.2950 2.1163 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2704 -3.3785 -0.0463 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4186 -3.5634 3.2339 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7090 -2.9021 3.3958 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5399 -5.7609 2.7021 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0617 -5.0703 4.2320 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6851 -6.1743 2.4890 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2290 -4.8622 -0.3576 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5785 -6.1732 0.8936 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7770 -4.9356 0.4797 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0893 -3.2832 1.6461 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8276 -4.3902 2.9797 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0511 -2.8102 3.1252 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8531 -5.7428 4.1477 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8170 -4.6247 -0.3811 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5941 -5.0816 1.1319 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8244 -5.4929 0.7801 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8492 0.1068 2.0444 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2189 0.5889 1.8743 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1922 -1.8576 0.0735 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4214 -0.0046 -1.2773 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3810 1.4783 -1.3649 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7252 -0.5995 -2.6243 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7995 -1.5269 -1.3780 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7235 0.8542 -2.5248 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6288 1.4767 -1.0897 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8530 2.3417 1.8132 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2914 3.0092 0.7398 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7749 4.4370 -1.2472 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6589 3.1499 -2.4555 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4980 5.8910 -1.0779 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2690 5.5412 -2.6382 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2462 4.6524 -3.3356 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0198 1.7581 -1.1269 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0890 5.2329 0.7083 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8440 0.5019 1.8861 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0921 -1.2994 1.9511 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4817 -0.7974 3.5879 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8941 -0.9798 2.7054 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8688 0.2979 2.0241 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6059 0.4143 1.9298 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5659 -0.9552 2.3181 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5356 -0.4338 -2.7825 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5806 -1.7086 -2.0708 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9884 0.0493 -2.1049 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1745 -0.3285 -3.2372 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1672 6.4369 -3.9639 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5199 6.9095 -2.8520 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8518 5.7173 -4.2261 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 23 27 1 0 20 28 1 0 18 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 33 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 42 47 1 0 41 48 1 0 40 49 1 0 32 50 1 0 31 51 1 0 16 52 1 0 13 53 1 0 11 54 1 0 6 55 1 0 2 56 1 0 12 8 1 0 16 11 1 0 20 15 1 0 24 19 1 0 35 30 1 0 44 39 1 0 1 57 1 0 1 58 1 0 1 59 1 0 3 60 1 0 4 61 1 0 4 62 1 0 5 63 1 0 5 64 1 0 7 65 1 0 7 66 1 0 7 67 1 0 8 68 1 0 9 69 1 0 9 70 1 0 10 71 1 0 10 72 1 0 12 73 1 0 13 74 1 0 14 75 1 0 14 76 1 0 15 77 1 0 17 78 1 0 17 79 1 0 18 80 1 0 19 81 1 0 21 82 1 0 21 83 1 0 22 84 1 0 22 85 1 0 23 86 1 0 25 87 1 0 25 88 1 0 25 89 1 0 26 90 1 0 26 91 1 0 26 92 1 0 27 93 1 0 28 94 1 0 28 95 1 0 28 96 1 0 30 97 1 0 31 98 1 0 32 99 1 0 33100 1 0 34101 1 0 36102 1 0 36103 1 0 37104 1 0 39105 1 0 40106 1 0 41107 1 0 42108 1 0 43109 1 0 45110 1 0 45111 1 0 46112 1 0 47113 1 0 48114 1 0 49115 1 0 50116 1 0 51117 1 0 52118 1 0 52119 1 0 52120 1 0 53121 1 0 54122 1 0 54123 1 0 54124 1 0 55125 1 0 56126 1 0 56127 1 0 56128 1 0 M END

Standard InCHIKey	NTWIHRCNQPXEOZ-KUOIDRQISA-N
Standard InCHI	InChI=1S/C42H72O14/c1-20(2)10-9-13-42(8,52)21-11-15-40(6)28(21)22(45)16-26-39(5)14-12-27(46)38(3,4)35(39)23(17-41(26,40)7)53-36-33(51)31(49)34(25(19-44)55-36)56-37-32(50)30(48)29(47)24(18-43)54-37/h10,21-37,43-52H,9,11-19H2,1-8H3/t21-,22+,23-,24+,25+,26+,27-,28-,29+,30-,31+,32+,33+,34+,35-,36+,37+,39+,40+,41+,42-/m0/s1
SMILES	CC(=CCCC(C)(C1CCC2(C1C(CC3C2(CC(C4C3(CCC(C4(C)C)O)C)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)CO)O)O)O)O)O)C)O)C)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	800.49	Volume:	804.076 ? Van der Waals volume.
Dense:	0.996	LogP:	1.246 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.231 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.432 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	33.0
TPSA:	239.22 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	10.0	Rings:	6.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.11	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.012	Fsp³:	0.952
MCE-18:	135.585 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.003	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.018 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.122 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.221	Promiscuous compounds:	0.018

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.297	MDCK Permeability:	-5.09
Pgp-inhibitor:	0.0	Pgp-substrate:	0.998
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.991
20% Bioavailability (F20%):	0.834	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.005	MRP1:	1.0
Plasma Protein Binding (PPB):	41.628%	Volume Distribution (VD):	-0.499
Fu:	41.73% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.081	BCRP inhibitor:	0.01
BSEP inhibitor:	0.01

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.947	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.598	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.001
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.566

Half-life (T1/2):

2.995

ADMET: Toxicity

hERG Blockers:	0.038	hERG Blockers (10um):	0.339
Human Hepatotoxicity (H-HT):	0.532	Drug-induced Liver Injury (DILI):	0.101
AMES Toxicity:	0.343	Rat Oral Acute Toxicity:	0.069
Maximum Recommended Daily Dose:	0.088	Skin Sensitization:	0.056
Carcinogencity:	0.059	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.005
Drug-induced Neurotoxicity:	0.269	Ototoxicity:	1.0
Hematotoxicity:	0.014	Drug-induced Nephrotoxicity:	0.041
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.061
A549 Cytotoxicity:	0.027	Hek293 Cytotoxicity:	0.51
BCF:	1.323 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.045 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.956 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.573 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33292	red ginseng	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[26087936]
NPO33292	red ginseng	Species	n.a.	n.a.	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT319	Cell line	B16	Mus musculus	Activity	=	95.0	%	PMID[19075057]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC473020 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22447
0.1-0.2	22806
0.2-0.3	4005
0.3-0.4	509
0.4-0.5	44
0.5-0.6	20
0.6-0.7	14
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9054	High Similarity	NPC47566
0.9054	High Similarity	NPC129372
0.8072	Intermediate Similarity	NPC472252
0.8072	Intermediate Similarity	NPC245280
0.7586	Intermediate Similarity	NPC16520
0.7586	Intermediate Similarity	NPC211879
0.7586	Intermediate Similarity	NPC189852
0.7586	Intermediate Similarity	NPC155010
0.7564	Intermediate Similarity	NPC140446
0.7471	Intermediate Similarity	NPC231340
0.7209	Intermediate Similarity	NPC473199
0.7033	Intermediate Similarity	NPC286969
0.6988	Remote Similarity	NPC609286
0.6706	Remote Similarity	NPC309425
0.6628	Remote Similarity	NPC114874
0.6548	Remote Similarity	NPC136816
0.6548	Remote Similarity	NPC7341
0.6279	Remote Similarity	NPC472989
0.6235	Remote Similarity	NPC88000
0.6235	Remote Similarity	NPC4831
0.6235	Remote Similarity	NPC472023
0.6207	Remote Similarity	NPC472899
0.6207	Remote Similarity	NPC472898
0.6092	Remote Similarity	NPC82955
0.6	Remote Similarity	NPC127801
0.6	Remote Similarity	NPC152584
0.5977	Remote Similarity	NPC131466
0.5938	Remote Similarity	NPC601606
0.5889	Remote Similarity	NPC472901
0.5806	Remote Similarity	NPC165033
0.5806	Remote Similarity	NPC273879
0.5758	Remote Similarity	NPC208594
0.5699	Remote Similarity	NPC8039
0.5699	Remote Similarity	NPC120123
0.5591	Remote Similarity	NPC274833
0.5579	Remote Similarity	NPC229801
0.5567	Remote Similarity	NPC288694
0.5513	Remote Similarity	NPC80530
0.5513	Remote Similarity	NPC273410
0.5437	Remote Similarity	NPC160816
0.5253	Remote Similarity	NPC307167
0.5222	Remote Similarity	NPC66654
0.5122	Remote Similarity	NPC322313
0.5122	Remote Similarity	NPC102253
0.5122	Remote Similarity	NPC236237
0.5046	Remote Similarity	NPC6931

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC473020 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7704
0.1-0.2	1373
0.2-0.3	62
0.3-0.4	10
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5122	Remote Similarity	NPD7525	Registered

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data