NPASS Compound

Natural Product: NPC472898

Natural Product ID	NPC472898
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	SFQVTNVBDMIAAA-WEPBDWSQSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3593734
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 109113 0 0 0 0 0 0 0 0999 V2000 5.2009 -2.2476 -1.0605 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2219 -1.3289 -0.4470 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5066 -0.6526 0.6234 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8052 -0.7021 1.3531 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9558 -0.1481 0.5349 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1946 0.0228 1.4151 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6965 -1.3236 1.8921 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2977 0.6375 0.5650 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9113 0.8990 2.4544 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6627 1.1296 0.0579 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1243 -1.9661 1.7996 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9089 -1.2017 -1.1276 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1356 -2.5322 -0.9430 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7255 -2.1574 -0.5403 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6188 -0.7355 -1.1222 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9542 -0.2432 -0.5939 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1483 1.2144 -0.8338 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0653 1.8568 0.0617 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2419 1.5037 -0.6155 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5353 0.0237 -0.5460 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7227 -0.1408 -1.4774 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9342 0.4728 -0.8105 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7509 1.8565 -0.3189 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3756 2.3995 -0.2303 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1769 3.6685 -1.0864 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7422 3.5120 -2.4618 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1839 3.1584 -2.4350 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6971 2.7954 -1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0512 2.1486 -1.2760 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9674 4.0729 -0.2841 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4565 2.1982 -3.3992 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1717 2.9136 1.2062 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3132 -0.4588 0.1657 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4537 -1.1494 -0.1424 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2060 -2.6416 -0.3613 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5928 -3.2649 -0.4924 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2025 -3.2554 0.8805 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8084 -1.9766 1.5640 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5003 -0.9399 0.7239 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0293 -1.5328 2.3772 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7153 -0.3687 3.1131 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7007 -4.3613 1.6035 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5316 -4.5316 -1.0500 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6013 -3.1772 0.7576 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8385 -0.4063 0.8521 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9993 1.6285 -2.1435 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6068 -0.9204 -2.5980 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7523 -1.6962 -1.8803 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6803 -3.0667 -1.6261 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8558 -2.7387 -0.3401 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7681 0.0282 1.1083 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7570 -0.0582 2.2906 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2693 -0.8252 -0.2766 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3811 -2.1005 1.1695 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2887 -1.5268 2.9123 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7968 -1.3188 1.8904 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0734 1.0572 1.2647 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9242 1.4854 -0.0437 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8252 -0.1336 -0.0399 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0614 1.8202 2.0827 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0002 1.1966 -0.8735 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9380 -2.1159 2.7497 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1559 -1.0680 -2.2070 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5886 -2.9909 -0.0180 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2140 -3.1836 -1.8081 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5632 -2.1702 0.5361 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0160 -2.8317 -1.0667 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8928 -0.3855 0.5128 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0988 1.5505 -0.4520 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2088 1.3405 1.0424 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1856 2.9331 0.1163 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0401 1.6646 -1.7224 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5454 0.5006 -2.3871 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9697 -1.1758 -1.6961 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7218 0.3970 -1.6017 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2365 1.8384 0.7127 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0620 3.8069 -1.2431 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4717 4.5783 -0.5573 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1569 2.7765 -3.0322 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5682 4.4946 -2.9751 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7702 4.0722 -2.7488 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3775 1.5530 -0.4257 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8366 2.9688 -1.3527 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1482 1.6472 -2.2729 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4591 4.1154 0.6782 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7942 4.9648 -0.9451 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0632 4.1765 -0.0196 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9014 2.4203 -4.1952 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2876 2.5224 1.6901 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1442 4.0038 1.2827 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0378 2.5967 1.8627 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8156 -0.7809 -1.1474 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6416 -2.8375 -1.2940 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2125 -2.5703 -1.1295 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3000 -3.4032 0.8413 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9845 -2.1180 2.3115 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3362 -2.2903 3.1125 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8771 -1.2913 1.7280 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4050 -0.2406 3.8000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9127 -5.1605 1.0485 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5942 -4.7209 -1.3034 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6420 -3.4151 0.5569 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5029 0.3089 1.3934 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3146 -1.3977 0.8985 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1071 -0.3980 1.4323 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7209 2.5516 -2.2448 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1191 -1.8865 -2.8923 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0686 -0.1520 -3.2076 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4188 -1.0693 -2.9920 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 6 9 1 0 5 10 1 0 4 11 1 0 2 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 28 30 1 0 27 31 1 0 24 32 1 0 22 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 37 42 1 0 36 43 1 0 35 44 1 0 20 45 1 0 17 46 1 0 15 47 1 0 16 12 1 0 20 15 1 0 24 19 1 0 28 23 1 0 39 34 1 0 1 48 1 0 1 49 1 0 1 50 1 0 3 51 1 0 4 52 1 0 5 53 1 0 7 54 1 0 7 55 1 0 7 56 1 0 8 57 1 0 8 58 1 0 8 59 1 0 9 60 1 0 10 61 1 0 11 62 1 0 12 63 1 0 13 64 1 0 13 65 1 0 14 66 1 0 14 67 1 0 16 68 1 0 17 69 1 0 18 70 1 0 18 71 1 0 19 72 1 0 21 73 1 0 21 74 1 0 22 75 1 0 23 76 1 0 25 77 1 0 25 78 1 0 26 79 1 0 26 80 1 0 27 81 1 0 29 82 1 0 29 83 1 0 29 84 1 0 30 85 1 0 30 86 1 0 30 87 1 0 31 88 1 0 32 89 1 0 32 90 1 0 32 91 1 0 34 92 1 0 35 93 1 0 36 94 1 0 37 95 1 0 38 96 1 0 40 97 1 0 40 98 1 0 41 99 1 0 42100 1 0 43101 1 0 44102 1 0 45103 1 0 45104 1 0 45105 1 0 46106 1 0 47107 1 0 47108 1 0 47109 1 0 M END

Standard InCHIKey	SFQVTNVBDMIAAA-WEPBDWSQSA-N
Standard InCHI	InChI=1S/C36H62O11/c1-17(13-20(39)30(44)33(4,5)45)18-9-12-35(7)25(18)19(38)14-23-34(6)11-10-24(40)32(2,3)29(34)21(15-36(23,35)8)46-31-28(43)27(42)26(41)22(16-37)47-31/h13,18-31,37-45H,9-12,14-16H2,1-8H3/b17-13+/t18-,19-,20-,21+,22-,23-,24+,25+,26-,27+,28-,29+,30+,31-,34-,35-,36-/m1/s1
SMILES	CC(=CC(C(C(C)(C)O)O)O)C1CCC2(C1C(CC3C2(CC(C4C3(CCC(C4(C)C)O)C)OC5C(C(C(C(O5)CO)O)O)O)C)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	670.43	Volume:	682.486 ? Van der Waals volume.
Dense:	0.982	LogP:	1.497 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.242 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.187 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	27.0
TPSA:	200.53 ? Topological Polar Surface Area.	H-Bond Acceptor:	11.0
H-Bond Donor:	9.0	Rings:	5.0
Heavy Atoms:	11.0

MedChem Properties

QED Drug-Likeness Score:	0.139	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.797	Fsp³:	0.944
MCE-18:	118.286 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.005	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.011 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.028 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.144	Promiscuous compounds:	0.028

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.755	MDCK Permeability:	-5.131
Pgp-inhibitor:	0.0	Pgp-substrate:	0.994
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.915
20% Bioavailability (F20%):	0.292	30% Bioavailability (F30%):	0.951
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.399	MRP1:	0.999
Plasma Protein Binding (PPB):	46.819%	Volume Distribution (VD):	-0.405
Fu:	38.677% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.23	BCRP inhibitor:	0.01
BSEP inhibitor:	0.006

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.042	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.917	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.008	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.128
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.573

Half-life (T1/2):

2.717

ADMET: Toxicity

hERG Blockers:	0.054	hERG Blockers (10um):	0.448
Human Hepatotoxicity (H-HT):	0.576	Drug-induced Liver Injury (DILI):	0.039
AMES Toxicity:	0.341	Rat Oral Acute Toxicity:	0.098
Maximum Recommended Daily Dose:	0.444	Skin Sensitization:	0.002
Carcinogencity:	0.093	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.006
Drug-induced Neurotoxicity:	0.153	Ototoxicity:	0.999
Hematotoxicity:	0.014	Drug-induced Nephrotoxicity:	0.143
Genotoxicity:	0.004	RPMI-8226 Immunitoxicity:	0.048
A549 Cytotoxicity:	0.015	Hek293 Cytotoxicity:	0.667
BCF:	1.292 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.894 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.756 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.437 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Flower buds	n.a.	n.a.	PMID[12880307]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Stems	n.a.	n.a.	PMID[17663584]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[18186611]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Steamed Roots	n.a.	n.a.	PMID[26200131]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5
Activity	1

Activity Type	# Activity
Cell line	5
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	>	10000.0	nM	PMID[15711537]
NPT681	Cell line	PC-12	Rattus norvegicus	Activity	=	9.9	%	PMID[26200131]
NPT81	Cell line	A549	Homo sapiens	IC50	>	10000.0	nM	DrugMatrix in vitro pharmacology data
NPT83	Cell line	MCF7	Homo sapiens	IC50	>	10000.0	nM	PMID[23434131]
NPT660	Cell line	SW480	Homo sapiens	IC50	>	10000.0	nM	PMID[9873631]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	10000.0	nM	PMID[26200131]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC472898 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19951
0.1-0.2	24904
0.2-0.3	4539
0.3-0.4	397
0.4-0.5	30
0.5-0.6	16
0.6-0.7	13
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC472899
0.8333	Intermediate Similarity	NPC136816
0.7838	Intermediate Similarity	NPC7341
0.7436	Intermediate Similarity	NPC472901
0.7273	Intermediate Similarity	NPC472989
0.7179	Intermediate Similarity	NPC609286
0.675	Remote Similarity	NPC47566
0.675	Remote Similarity	NPC129372
0.6667	Remote Similarity	NPC140446
0.6552	Remote Similarity	NPC288694
0.65	Remote Similarity	NPC131466
0.6463	Remote Similarity	NPC309425
0.642	Remote Similarity	NPC82955
0.6386	Remote Similarity	NPC114874
0.6207	Remote Similarity	NPC473020
0.6067	Remote Similarity	NPC472252
0.6067	Remote Similarity	NPC245280
0.6047	Remote Similarity	NPC274833
0.6044	Remote Similarity	NPC601606
0.5934	Remote Similarity	NPC231340
0.5843	Remote Similarity	NPC229801
0.5761	Remote Similarity	NPC127801
0.5761	Remote Similarity	NPC152584
0.5699	Remote Similarity	NPC16520
0.5699	Remote Similarity	NPC211879
0.5699	Remote Similarity	NPC189852
0.5699	Remote Similarity	NPC155010
0.5521	Remote Similarity	NPC208594
0.5484	Remote Similarity	NPC307167
0.5326	Remote Similarity	NPC473199
0.5258	Remote Similarity	NPC286969
0.52	Remote Similarity	NPC160816
0.5176	Remote Similarity	NPC280825
0.5176	Remote Similarity	NPC473198
0.5052	Remote Similarity	NPC210759

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC472898 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7314
0.1-0.2	1764
0.2-0.3	70
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data