Drug Information| Drug ID:   | NPD7750 |
| Drug Name:   | CEP-4186 |
| Molecular Formula:   | C32H50O4 |
| Canonical SMILES:   | CCOC([C@@H]([C@H]1CC[C@@H]2[C@]1(C)CCC/C/2=CC=C/1C[C@@H](O)C[C@@H](C1=C)O)C)C#CCC(CC)(CC)O |
| Standard InCHI:   | "InChI=1S/C32H50O4/c1-7-32(35,8-2)19-11-13-30(36-9-3)23(5)27-16-17-28-24(12-10-18-31(27,28)6)14-15-25-20-26(33)21-29(34)22(25)4/h14-15,23,26-30,33-35H,4,7-10,12,16-21H2,1-3,5-6H3/b24-14+,25-15-/t23-,26-,27-,28+,29+,30?,31-/m1/s1" |
| Standard InCHIKey:   | WDIVIMUPISTHIC-BZQMTDSRSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7750Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6027 | NPC316856 |
| Remote Similarity | 0.6027 | NPC607632 |
| Remote Similarity | 0.589 | NPC63893 |
| Remote Similarity | 0.589 | NPC324772 |
| Remote Similarity | 0.589 | NPC611865 |
| Remote Similarity | 0.5811 | NPC320525 |
| Remote Similarity | 0.5811 | NPC320548 |
| Remote Similarity | 0.5789 | NPC23466 |
| Remote Similarity | 0.5714 | NPC324848 |
| Molecular Weight   | 498.37 |
| ALogP   | 0.2389 |
| MLogP   | 4.54 |
| XLogP   | 6.365 |
| HDA   | 4 |
| HBD   | 3 |
| Rotatable Bonds   | 16 |
| TPSA   | 69.92 |
| RO5 Violation   | 1 |