NPASS Compound

Natural Product: NPC477808

Natural Product ID	NPC477808
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	[(2R,3R,4S,5R,6R)-4-hydroxy-5-[(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-(hydroxymethyl)-2-[(1S,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxyoxan-3-yl] acetate
IUPAC Name	[(2R,3R,4S,5R,6R)-4-hydroxy-5-[(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-(hydroxymethyl)-2-[(1S,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxyoxan-3-yl] acetate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44575242
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 158167 0 0 0 0 0 0 0 0999 V2000 14.1938 -0.2048 -1.0251 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6876 -0.0335 -1.0658 C 0 0 1 0 0 0 0 0 0 0 0 0 12.0761 -1.4069 -0.8990 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6071 -1.3353 -0.5753 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2785 -0.0356 0.1705 C 0 0 2 0 0 0 0 0 0 0 0 0 9.1104 -0.3135 1.1154 C 0 0 2 0 0 0 0 0 0 0 0 0 8.3780 0.9951 1.0866 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8476 1.6457 -0.1660 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8159 0.8602 -0.7498 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6053 1.7768 -1.0125 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5711 2.0040 0.0522 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8769 0.8694 0.9954 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1810 1.2029 2.2779 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7059 1.3537 2.0443 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2903 2.0548 0.8228 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1705 1.9029 -0.3981 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8498 3.0072 -1.3812 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3996 3.1819 -1.4975 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4770 2.6652 -0.7157 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8432 1.7848 0.4520 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9126 2.0915 1.5768 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2004 3.4006 1.4269 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2675 3.3792 0.2296 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0575 2.9413 -0.9763 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8077 2.5413 0.3818 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0320 3.1450 0.4207 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9577 2.8194 -0.7297 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4728 1.3954 -0.6400 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.9800 1.0915 0.7442 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0107 1.5359 1.8071 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6219 2.8578 1.6307 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9044 0.5834 2.0920 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4930 -0.6941 2.2409 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1821 -0.2765 0.8449 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5325 -0.5459 1.1876 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1419 -1.2647 0.0012 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3113 -2.4600 -0.3165 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7172 -3.0542 0.9281 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5062 -2.6491 2.1630 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5212 -1.2883 2.3442 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8394 -3.3057 3.3488 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5180 -3.0056 4.5324 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8525 -4.4605 0.8309 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2858 -2.0422 -1.1604 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2932 -2.6774 -2.3960 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0384 -3.4351 -2.6680 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2197 -2.8955 -3.8176 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0700 -2.5343 -5.0199 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5258 -2.3614 -4.6342 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6080 -1.7445 -3.3931 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1199 -1.5434 -5.5951 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9735 -3.4757 -6.0386 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5194 -1.7873 -3.3668 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2351 -4.8153 -2.8469 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4516 -1.5768 0.3373 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4209 -0.8831 -0.3377 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2430 -1.7191 -1.2936 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.1911 -2.5702 -0.4799 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.0710 -2.2459 0.9988 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.1863 -0.7546 1.1521 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.1550 -0.1294 0.5220 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1660 -0.3411 2.6167 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1711 -0.9194 3.3563 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2006 -2.8541 1.6013 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8053 -3.9001 -0.6337 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0022 -0.8548 -2.0725 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4792 0.5466 -1.0453 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0785 3.6734 -0.6189 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4682 4.5253 -1.6228 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8259 4.5738 -2.6948 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6583 5.4247 -1.4981 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6425 0.3310 0.0795 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4797 -0.4806 0.5134 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6709 -0.6193 2.4919 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3558 0.4041 0.9079 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2923 0.9363 -0.0032 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4982 -1.1488 -1.5501 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7153 0.6879 -1.4457 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4716 -0.3325 0.0411 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3723 0.3962 -2.0586 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1705 -1.9270 -1.8737 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5738 -2.0063 -0.1341 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3124 -2.2093 0.0759 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -1.4412 -1.4987 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5671 -1.1557 0.6849 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6088 1.5709 2.0066 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2093 2.6660 0.0878 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6963 2.6455 -1.7009 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3678 0.8502 -1.5716 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7396 2.9650 0.5587 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3392 0.3744 2.9975 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5895 2.1265 2.7295 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2138 0.3656 2.2413 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3531 1.9730 2.9342 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3299 3.1691 1.0440 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9561 0.9544 -0.9422 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3175 3.9521 -1.0209 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3174 2.6964 -2.3652 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0334 3.8146 -2.3327 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1148 1.3155 1.6973 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4277 2.0996 2.5665 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8989 4.2570 1.2631 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6757 3.6334 2.3651 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0244 4.4438 0.0857 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9647 3.7105 -1.8080 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6003 2.0278 -1.4526 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9286 4.2759 0.3678 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4975 2.9629 -1.6972 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3220 1.3113 -1.3444 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9312 1.6580 0.9196 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6335 1.5662 2.7583 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5046 0.8077 3.1118 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1251 0.4808 1.3412 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9375 -0.7569 3.1249 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0643 0.4331 1.3483 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1361 -0.4775 -0.8151 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8682 -3.2319 -0.9027 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6286 -2.8799 1.0347 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5237 -3.1037 2.0488 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7964 -2.9581 3.4401 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7664 -4.4151 3.2124 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1554 -2.1715 4.9274 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6940 -4.6213 0.3402 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1517 -3.3971 -2.4056 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3932 -3.3415 -1.7493 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5244 -3.6852 -4.1536 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6825 -1.5750 -5.4175 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0729 -3.3339 -4.6703 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5935 -1.5620 -6.4464 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1664 -3.3672 -6.6042 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0604 -0.9525 -3.4254 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4333 -5.3278 -2.5253 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8597 -0.1726 -1.0204 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6507 -2.3480 -1.9449 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2431 -2.4857 -0.7849 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1591 -2.6633 1.4569 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1599 -0.4672 0.6828 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3176 0.7716 2.6193 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1897 -0.5529 3.0625 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8293 -1.6143 3.9766 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5991 -3.5382 1.0349 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0993 -4.1631 -1.5645 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5446 -0.6500 -2.9452 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3466 -0.2621 -0.5316 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2486 5.3149 -2.4289 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2323 5.1285 -0.5887 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2411 6.4447 -1.3901 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1428 0.0484 -0.8638 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5431 0.1772 -0.1390 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8611 -0.3147 0.9250 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9123 -0.8057 -0.4295 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3669 -0.5561 0.3766 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6657 -1.1873 1.3764 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2044 0.0207 3.2853 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7591 -0.4237 2.5453 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4805 -1.6828 2.7937 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7959 1.8411 -0.4219 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1882 1.3203 0.5564 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 29 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 38 43 1 0 37 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 48 52 1 0 47 53 1 0 46 54 1 0 36 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 60 62 1 0 62 63 1 0 59 64 1 0 58 65 1 0 57 66 1 0 28 67 1 0 27 68 1 0 68 69 1 0 69 70 2 0 69 71 1 0 20 72 1 6 12 73 1 6 6 74 1 0 5 75 1 1 75 76 1 0 76 2 1 0 9 5 1 0 61 56 1 0 12 7 1 0 16 11 1 0 20 15 1 0 24 19 1 0 31 26 1 0 40 35 1 0 50 45 1 0 1 77 1 0 1 78 1 0 1 79 1 0 2 80 1 6 3 81 1 0 3 82 1 0 4 83 1 0 4 84 1 0 6 85 1 6 7 86 1 1 8 87 1 1 10 88 1 0 10 89 1 0 11 90 1 1 13 91 1 0 13 92 1 0 14 93 1 0 14 94 1 0 15 95 1 1 16 96 1 6 17 97 1 0 17 98 1 0 18 99 1 0 21100 1 0 21101 1 0 22102 1 0 22103 1 0 23104 1 6 24105 1 0 24106 1 0 26107 1 1 27108 1 6 28109 1 6 29110 1 1 30111 1 1 32112 1 0 32113 1 0 33114 1 0 35115 1 1 36116 1 6 37117 1 6 38118 1 1 39119 1 6 41120 1 0 41121 1 0 42122 1 0 43123 1 0 45124 1 1 46125 1 1 47126 1 6 48127 1 6 49128 1 1 51129 1 0 52130 1 0 53131 1 0 54132 1 0 56133 1 6 57134 1 6 58135 1 6 59136 1 1 60137 1 6 62138 1 0 62139 1 0 63140 1 0 64141 1 0 65142 1 0 66143 1 0 67144 1 0 71145 1 0 71146 1 0 71147 1 0 72148 1 0 72149 1 0 72150 1 0 73151 1 0 73152 1 0 73153 1 0 74154 1 0 74155 1 0 74156 1 0 76157 1 0 76158 1 0 M END

Standard InCHIKey	UQBDEGMOSPAEDQ-BZDGVTJVSA-N
Standard InCHI	InChI=1S/C52H82O24/c1-20-8-13-52(66-19-20)21(2)32-28(76-52)15-27-25-7-6-23-14-24(9-11-50(23,4)26(25)10-12-51(27,32)5)68-48-43(67-22(3)56)40(64)41(31(18-55)71-48)72-49-44(74-46-38(62)35(59)33(57)29(16-53)69-46)42(34(58)30(17-54)70-49)73-47-39(63)36(60)37(61)45(65)75-47/h6,20-21,24-49,53-55,57-65H,7-19H2,1-5H3/t20-,21-,24-,25+,26-,27-,28-,29+,30+,31+,32-,33+,34+,35-,36+,37+,38+,39-,40-,41-,42-,43+,44+,45+,46-,47-,48+,49-,50-,51-,52+/m0/s1
SMILES	C[C@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O[C@@H]9[C@H]([C@@H]([C@H]([C@@H](O9)O)O)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)OC(=O)C)C)C)C)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1090.52	Volume:	1028.076 ? Van der Waals volume.
Dense:	1.061	LogP:	0.513 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.305 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.067 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	55.0
TPSA:	361.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	12.0	Rings:	10.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.071	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.299	Fsp³:	0.942
MCE-18:	263.02 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.823	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.341	Promiscuous compounds:	0.129

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.582	MDCK Permeability:	-5.145
Pgp-inhibitor:	0.0	Pgp-substrate:	0.977
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.316
20% Bioavailability (F20%):	0.343	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.071
Plasma Protein Binding (PPB):	64.885%	Volume Distribution (VD):	-0.458
Fu:	26.559% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.005
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.005	CYP3A4-substrate:	0.708
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.111
HLM stability:	0.007 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.281

Half-life (T1/2):

3.054

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.656	Drug-induced Liver Injury (DILI):	0.999
AMES Toxicity:	0.999	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.253	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.728	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.335	RPMI-8226 Immunitoxicity:	0.502
A549 Cytotoxicity:	0.999	Hek293 Cytotoxicity:	0.958
BCF:	0.979 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.342 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.66 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.773 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	rhizomes	Kangwon Province of Korea	2002-MAY	PMID[16562835]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	20900	nM	PMID[16562835]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477808 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22970
0.1-0.2	23258
0.2-0.3	2930
0.3-0.4	487
0.4-0.5	82
0.5-0.6	79
0.6-0.7	31
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8455	Intermediate Similarity	NPC477811
0.7798	Intermediate Similarity	NPC300557
0.7615	Intermediate Similarity	NPC602423
0.7568	Intermediate Similarity	NPC480555
0.7568	Intermediate Similarity	NPC150372
0.7563	Intermediate Similarity	NPC477807
0.735	Intermediate Similarity	NPC480553
0.7297	Intermediate Similarity	NPC470433
0.7297	Intermediate Similarity	NPC46190
0.7297	Intermediate Similarity	NPC171073
0.7179	Intermediate Similarity	NPC480554
0.7155	Intermediate Similarity	NPC309278
0.7069	Intermediate Similarity	NPC269297
0.7069	Intermediate Similarity	NPC222202
0.7009	Intermediate Similarity	NPC475333
0.7009	Intermediate Similarity	NPC224098
0.7009	Intermediate Similarity	NPC208383
0.6949	Remote Similarity	NPC194207
0.6949	Remote Similarity	NPC22779
0.693	Remote Similarity	NPC477809
0.6911	Remote Similarity	NPC480556
0.6792	Remote Similarity	NPC181845
0.6783	Remote Similarity	NPC248746
0.6726	Remote Similarity	NPC113044
0.6726	Remote Similarity	NPC283829
0.6726	Remote Similarity	NPC161676
0.6721	Remote Similarity	NPC31896
0.672	Remote Similarity	NPC224314
0.6667	Remote Similarity	NPC232054
0.6484	Remote Similarity	NPC210569
0.6462	Remote Similarity	NPC305771
0.6462	Remote Similarity	NPC94072
0.6462	Remote Similarity	NPC169816
0.6441	Remote Similarity	NPC42171
0.6404	Remote Similarity	NPC470432
0.6404	Remote Similarity	NPC230507
0.6339	Remote Similarity	NPC206003
0.6339	Remote Similarity	NPC473610
0.6311	Remote Similarity	NPC13193
0.6293	Remote Similarity	NPC14704
0.6231	Remote Similarity	NPC15918
0.6179	Remote Similarity	NPC32361
0.6167	Remote Similarity	NPC6806
0.6116	Remote Similarity	NPC475182
0.6102	Remote Similarity	NPC475351
0.6098	Remote Similarity	NPC475550
0.6066	Remote Similarity	NPC102016
0.6066	Remote Similarity	NPC95051
0.5983	Remote Similarity	NPC6295
0.597	Remote Similarity	NPC263359
0.5935	Remote Similarity	NPC97700
0.5935	Remote Similarity	NPC184617
0.5935	Remote Similarity	NPC30856
0.5827	Remote Similarity	NPC218571
0.5827	Remote Similarity	NPC487615
0.5806	Remote Similarity	NPC73243
0.5806	Remote Similarity	NPC244086
0.5806	Remote Similarity	NPC84956
0.5736	Remote Similarity	NPC132080
0.5735	Remote Similarity	NPC244431
0.5726	Remote Similarity	NPC19400
0.5714	Remote Similarity	NPC125324
0.5714	Remote Similarity	NPC247037
0.5659	Remote Similarity	NPC23808
0.5659	Remote Similarity	NPC87998
0.5645	Remote Similarity	NPC249553
0.5645	Remote Similarity	NPC124677
0.5635	Remote Similarity	NPC475319
0.5583	Remote Similarity	NPC94272
0.5583	Remote Similarity	NPC485595
0.5581	Remote Similarity	NPC249265
0.5537	Remote Similarity	NPC141433
0.5528	Remote Similarity	NPC473601
0.552	Remote Similarity	NPC51172
0.552	Remote Similarity	NPC49032
0.552	Remote Similarity	NPC182900
0.5515	Remote Similarity	NPC79900
0.5514	Remote Similarity	NPC100451
0.5512	Remote Similarity	NPC115165
0.5504	Remote Similarity	NPC232037
0.5496	Remote Similarity	NPC233433
0.5492	Remote Similarity	NPC305423
0.5492	Remote Similarity	NPC160426
0.5476	Remote Similarity	NPC150057
0.5476	Remote Similarity	NPC147753
0.5462	Remote Similarity	NPC470864
0.5455	Remote Similarity	NPC308140
0.5431	Remote Similarity	NPC297348
0.5431	Remote Similarity	NPC249204
0.5431	Remote Similarity	NPC48339
0.5431	Remote Similarity	NPC141769
0.5431	Remote Similarity	NPC477547
0.5426	Remote Similarity	NPC473518
0.5426	Remote Similarity	NPC116756
0.542	Remote Similarity	NPC476112
0.542	Remote Similarity	NPC83137
0.542	Remote Similarity	NPC307534
0.541	Remote Similarity	NPC195297
0.5372	Remote Similarity	NPC107962
0.5333	Remote Similarity	NPC211354
0.5328	Remote Similarity	NPC220836
0.5299	Remote Similarity	NPC325828
0.5276	Remote Similarity	NPC471464
0.5259	Remote Similarity	NPC470866
0.5245	Remote Similarity	NPC481190
0.5234	Remote Similarity	NPC128572
0.521	Remote Similarity	NPC477451
0.5185	Remote Similarity	NPC167183
0.5182	Remote Similarity	NPC248202
0.5159	Remote Similarity	NPC98696
0.5159	Remote Similarity	NPC40440
0.5149	Remote Similarity	NPC256983
0.5126	Remote Similarity	NPC234352
0.5115	Remote Similarity	NPC486386
0.5113	Remote Similarity	NPC108072
0.5111	Remote Similarity	NPC287885
0.5109	Remote Similarity	NPC94086
0.5109	Remote Similarity	NPC473817
0.5103	Remote Similarity	NPC330026
0.5101	Remote Similarity	NPC481189
0.5078	Remote Similarity	NPC122819
0.5076	Remote Similarity	NPC475625
0.5075	Remote Similarity	NPC470862
0.5038	Remote Similarity	NPC232611
0.5038	Remote Similarity	NPC254255
0.5036	Remote Similarity	NPC473505
0.5035	Remote Similarity	NPC32707

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477808 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7480
0.1-0.2	1598
0.2-0.3	64
0.3-0.4	4
0.4-0.5	1
0.5-0.6	3
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5476	Remote Similarity	NPD8450	Suspended
0.5299	Remote Similarity	NPD8171	Phase 2
0.5078	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data