NPASS Compound

Natural Product: NPC475319

Natural Product ID	NPC475319
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	AADIIQJBIMAADJ-FPJHVOQKSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL503408
PubChem CID	10843362
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 132140 0 0 0 0 0 0 0 0999 V2000 -7.3731 -3.7048 2.8499 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5633 -3.6406 1.6825 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1684 -3.1508 2.0702 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3893 -3.1056 0.9515 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7392 -1.8970 0.8259 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7799 -1.7975 -0.1284 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5011 -1.5721 0.3689 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6159 -2.7155 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3169 -2.5212 -1.0727 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9738 -1.1669 -1.1767 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5964 -0.2691 -0.0364 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9351 -0.2261 0.0894 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2110 -0.5837 1.2928 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5608 -1.2919 1.0870 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2106 -0.7252 -0.1519 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4334 -1.3195 -1.3148 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9310 -0.8364 -2.6375 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4089 -0.6673 -2.6929 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0110 -0.9739 -3.6655 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0699 -0.1134 -1.5085 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6159 -1.0488 -0.3632 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6219 -0.7396 0.6738 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8892 -0.9509 -0.1792 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5547 -0.2012 -1.4517 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2013 1.1479 -1.1355 C 0 0 2 0 0 0 0 0 0 0 0 0 7.6291 1.8891 -2.3700 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4041 0.6960 -0.3095 C 0 0 2 0 0 0 0 0 0 0 0 0 8.0112 -0.4331 0.3660 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6943 1.7630 0.7350 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8131 2.6815 0.3686 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0283 2.0120 -0.1909 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6988 0.5709 -0.4959 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4861 0.5122 -1.1530 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2333 2.1482 0.7178 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5556 1.2922 -1.3232 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4421 -0.4364 -2.4352 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8820 -0.8687 0.6832 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4017 -0.6622 2.0259 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3053 -1.9143 2.8763 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2656 -1.8013 3.8039 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6759 -0.1062 2.1641 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6152 0.9521 3.0335 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2556 0.5914 4.2615 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7053 1.4256 5.2286 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0731 2.8667 5.0036 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7846 3.3166 3.5921 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2471 2.2251 2.6128 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0240 2.6233 1.3197 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4580 4.5096 3.3599 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2635 3.6370 5.8551 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3987 0.2261 -0.0350 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8388 0.0667 -1.3567 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6989 -0.2181 -2.1707 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1730 -0.8888 -3.2937 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1224 -1.5760 -4.0983 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6485 -2.2356 -5.2080 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8537 0.1784 -4.1350 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9363 0.8766 -3.3890 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5894 1.2062 -1.9375 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8549 1.2246 -1.2928 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2096 2.0674 -4.0597 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3849 -0.4766 -5.2444 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9654 -4.3581 3.4837 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5492 -4.6050 1.1705 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0569 -2.8695 1.0675 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8059 -4.0099 2.7579 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2600 -1.6966 1.8006 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6581 -1.6202 1.5107 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1128 -3.1437 0.9722 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2982 -3.5777 -0.2474 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1041 -3.3364 -1.0112 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1925 -2.7296 -2.0341 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8933 0.7584 -0.3185 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1102 0.4357 0.9623 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3894 0.2948 -0.7702 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5643 -1.1381 1.9938 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5027 0.4148 1.7584 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2088 -1.1780 2.0020 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3275 -2.3584 0.9237 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0634 0.3746 -0.0870 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6848 -2.4226 -1.2635 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6680 -1.5890 -3.4229 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4917 0.1246 -2.9787 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7411 -2.0860 -0.7682 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6265 -1.4476 1.5296 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5615 0.2997 0.9906 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9443 -2.0415 -0.4269 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0448 -0.6119 -2.3510 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6049 1.7716 -0.4710 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7245 1.8863 -2.5202 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3450 2.9788 -2.2880 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1789 1.5229 -3.3048 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8043 2.3928 0.9482 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9170 1.2653 1.7231 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1319 3.1780 1.3349 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4338 3.5152 -0.2559 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2838 2.4911 -1.1606 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4809 0.2154 -1.2038 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7430 -0.0906 0.3980 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6920 3.1471 0.6508 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9582 1.3352 0.5113 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8497 1.9595 1.7555 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5494 1.3669 -1.7762 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1976 1.9249 -2.0083 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5915 1.6651 -0.2899 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5808 0.6575 -2.3455 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7843 -0.8945 -3.3590 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6787 -0.5991 -2.4265 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6101 -1.4403 0.0351 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6670 0.0419 2.5635 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2894 -2.0101 3.4364 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0459 -0.8259 3.9079 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5717 1.1254 3.3434 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0745 1.1456 6.2349 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5940 1.2847 5.1778 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1287 2.9898 5.2553 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6878 3.3912 3.4584 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3603 2.1574 2.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8232 3.1334 1.0009 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3908 4.7089 2.4002 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5457 4.0871 5.3748 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4668 -0.8573 -1.4883 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9696 -1.6300 -3.0008 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5795 -2.3366 -3.4984 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3865 -0.8277 -4.5025 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3826 -3.2076 -5.2462 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1217 0.9285 -4.4795 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8383 0.2024 -3.3942 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0722 2.1776 -1.8714 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5473 1.6288 -1.8413 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9042 1.8930 -4.7668 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0148 -1.2024 -4.9684 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 25 27 1 0 27 28 1 1 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 20 35 1 1 10 36 1 6 5 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 38 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 37 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 57 62 1 0 39 3 1 0 47 42 1 0 59 52 1 0 12 7 1 0 21 15 1 0 28 23 1 0 16 10 1 0 24 20 1 0 33 27 1 0 1 63 1 0 2 64 1 0 2 65 1 0 3 66 1 1 5 67 1 1 7 68 1 1 8 69 1 0 8 70 1 0 9 71 1 0 9 72 1 0 11 73 1 6 12 74 1 0 12 75 1 0 13 76 1 0 13 77 1 0 14 78 1 0 14 79 1 0 15 80 1 1 16 81 1 6 17 82 1 0 17 83 1 0 21 84 1 6 22 85 1 0 22 86 1 0 23 87 1 6 24 88 1 6 25 89 1 1 26 90 1 0 26 91 1 0 26 92 1 0 29 93 1 0 29 94 1 0 30 95 1 0 30 96 1 0 31 97 1 0 32 98 1 0 32 99 1 0 34100 1 0 34101 1 0 34102 1 0 35103 1 0 35104 1 0 35105 1 0 36106 1 0 36107 1 0 36108 1 0 37109 1 6 38110 1 1 39111 1 1 40112 1 0 42113 1 1 44114 1 0 44115 1 0 45116 1 1 46117 1 1 47118 1 6 48119 1 0 49120 1 0 50121 1 0 52122 1 1 54123 1 1 55124 1 0 55125 1 0 56126 1 0 57127 1 6 58128 1 1 59129 1 6 60130 1 0 61131 1 0 62132 1 0 M END

Standard InCHIKey	AADIIQJBIMAADJ-FPJHVOQKSA-N
Standard InCHI	InChI=1S/C44H70O18/c1-18-7-10-44(56-16-18)19(2)30-26(62-44)12-24-22-6-5-20-11-21(8-9-42(20,3)23(22)13-29(48)43(24,30)4)57-41-38(61-40-36(54)34(52)32(50)27(14-45)58-40)37(33(51)28(15-46)59-41)60-39-35(53)31(49)25(47)17-55-39/h18-28,30-41,45-47,49-54H,5-17H2,1-4H3/t18?,19-,20+,21-,22+,23-,24-,25+,26-,27+,28+,30-,31-,32+,33+,34-,35+,36+,37-,38+,39-,40-,41+,42-,43+,44+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]2[C@@H]3CC(=O)[C@]3([C@H]2C[C@H]2[C@@H]3[C@H](C)[C@]3(O2)CCC(CO3)C)C)C)[C@@H]([C@H]([C@@H]1O)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	886.46	Volume:	848.159 ? Van der Waals volume.
Dense:	1.045	LogP:	0.804 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.691 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.692 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	49.0
TPSA:	272.98 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.133	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.757	Fsp³:	0.977
MCE-18:	231.034 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.704	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.216	Promiscuous compounds:	0.095

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.145	MDCK Permeability:	-5.15
Pgp-inhibitor:	0.0	Pgp-substrate:	0.417
PAMPA:	0.994 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.002	30% Bioavailability (F30%):	0.954
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.004
Plasma Protein Binding (PPB):	45.057%	Volume Distribution (VD):	-0.491
Fu:	48.662% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.27
BSEP inhibitor:	0.56

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.011	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.478	CYP3A4-substrate:	0.976
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.034
HLM stability:	0.161 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.503

Half-life (T1/2):

2.891

ADMET: Toxicity

hERG Blockers:	0.014	hERG Blockers (10um):	0.043
Human Hepatotoxicity (H-HT):	0.62	Drug-induced Liver Injury (DILI):	0.922
AMES Toxicity:	0.728	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.006	Skin Sensitization:	1.0
Carcinogencity:	0.038	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.23	Drug-induced Nephrotoxicity:	0.73
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.201
A549 Cytotoxicity:	0.453	Hek293 Cytotoxicity:	0.683
BCF:	0.953 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.242 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.488 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.681 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757713]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	bark	n.a.	n.a.	PMID[15165156]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	6

Activity Type	# Activity
Organism	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	MIC	=	100.0	ug.mL-1	PMID[25987378]
NPT20	Organism	Candida albicans	Candida albicans	MIC	>	100.0	ug.mL-1	PMID[18720971]
NPT5427	Organism	Hanseniaspora uvarum	Hanseniaspora uvarum	MIC	>	100.0	ug.mL-1	PMID[17309301]
NPT772	Organism	Pichia anomala	Wickerhamomyces anomalus	MIC	=	100.0	ug.mL-1	PMID[18720971]
NPT5426	Organism	Debaryomyces hansenii	Debaryomyces hansenii	MIC	>	100.0	ug.mL-1	PubChem BioAssay data set
NPT5425	Organism	Pichia nakazawae	Pichia nakazawae	MIC	>	100.0	ug.mL-1	PMID[20359789]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475319 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25822
0.1-0.2	20980
0.2-0.3	2529
0.3-0.4	340
0.4-0.5	80
0.5-0.6	49
0.6-0.7	36
0.7-0.8	0
0.8-0.85	3
0.85-0.9	2
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9192	High Similarity	NPC233433
0.88	High Similarity	NPC108072
0.8585	High Similarity	NPC220836
0.8438	Intermediate Similarity	NPC475351
0.8302	Intermediate Similarity	NPC94086
0.8302	Intermediate Similarity	NPC473817
0.7767	Intermediate Similarity	NPC97700
0.7767	Intermediate Similarity	NPC30856
0.7708	Intermediate Similarity	NPC206003
0.7708	Intermediate Similarity	NPC473610
0.7404	Intermediate Similarity	NPC51172
0.7404	Intermediate Similarity	NPC49032
0.73	Intermediate Similarity	NPC215408
0.7282	Intermediate Similarity	NPC202898
0.7273	Intermediate Similarity	NPC132080
0.7143	Intermediate Similarity	NPC92890
0.7115	Intermediate Similarity	NPC473601
0.7064	Intermediate Similarity	NPC116756
0.7	Intermediate Similarity	NPC232037
0.6964	Remote Similarity	NPC92297
0.6891	Remote Similarity	NPC305771
0.6891	Remote Similarity	NPC94072
0.6891	Remote Similarity	NPC169816
0.6731	Remote Similarity	NPC125324
0.6727	Remote Similarity	NPC115165
0.6697	Remote Similarity	NPC128572
0.6639	Remote Similarity	NPC15918
0.6638	Remote Similarity	NPC470866
0.6636	Remote Similarity	NPC184617
0.6555	Remote Similarity	NPC273002
0.6408	Remote Similarity	NPC250393
0.6296	Remote Similarity	NPC160426
0.6275	Remote Similarity	NPC297348
0.6275	Remote Similarity	NPC249204
0.6275	Remote Similarity	NPC48339
0.6275	Remote Similarity	NPC141769
0.6275	Remote Similarity	NPC477547
0.625	Remote Similarity	NPC151134
0.6207	Remote Similarity	NPC470864
0.6198	Remote Similarity	NPC473505
0.6174	Remote Similarity	NPC475625
0.6174	Remote Similarity	NPC473518
0.6161	Remote Similarity	NPC300557
0.6154	Remote Similarity	NPC476112
0.6154	Remote Similarity	NPC307534
0.6132	Remote Similarity	NPC211354
0.6132	Remote Similarity	NPC107188
0.6121	Remote Similarity	NPC232611
0.6117	Remote Similarity	NPC325828
0.6111	Remote Similarity	NPC6295
0.6061	Remote Similarity	NPC481189
0.6058	Remote Similarity	NPC234352
0.605	Remote Similarity	NPC31896
0.6018	Remote Similarity	NPC471464
0.6	Remote Similarity	NPC477451
0.5982	Remote Similarity	NPC602423
0.5962	Remote Similarity	NPC177834
0.5954	Remote Similarity	NPC329807
0.5913	Remote Similarity	NPC98018
0.5913	Remote Similarity	NPC284104
0.5913	Remote Similarity	NPC103616
0.5882	Remote Similarity	NPC83137
0.5872	Remote Similarity	NPC107962
0.5833	Remote Similarity	NPC19400
0.578	Remote Similarity	NPC264101
0.5778	Remote Similarity	NPC329727
0.5763	Remote Similarity	NPC309278
0.5725	Remote Similarity	NPC330026
0.5714	Remote Similarity	NPC210569
0.5702	Remote Similarity	NPC475643
0.5635	Remote Similarity	NPC477808
0.5574	Remote Similarity	NPC84111
0.5574	Remote Similarity	NPC287483
0.5574	Remote Similarity	NPC470865
0.5574	Remote Similarity	NPC477811
0.547	Remote Similarity	NPC249553
0.547	Remote Similarity	NPC182900
0.544	Remote Similarity	NPC262050
0.5401	Remote Similarity	NPC329820
0.5372	Remote Similarity	NPC475333
0.5372	Remote Similarity	NPC224098
0.5372	Remote Similarity	NPC208383
0.5366	Remote Similarity	NPC470862
0.5339	Remote Similarity	NPC274200
0.5299	Remote Similarity	NPC481190
0.5253	Remote Similarity	NPC161035
0.5253	Remote Similarity	NPC170438
0.5234	Remote Similarity	NPC480556
0.5227	Remote Similarity	NPC263359
0.5194	Remote Similarity	NPC477807
0.5185	Remote Similarity	NPC485594
0.5182	Remote Similarity	NPC294686
0.5164	Remote Similarity	NPC470863
0.5161	Remote Similarity	NPC218571
0.5161	Remote Similarity	NPC487615
0.513	Remote Similarity	NPC485595
0.5118	Remote Similarity	NPC232054
0.5115	Remote Similarity	NPC79900
0.5089	Remote Similarity	NPC474399
0.5086	Remote Similarity	NPC195297
0.5082	Remote Similarity	NPC51520
0.5082	Remote Similarity	NPC303069
0.5041	Remote Similarity	NPC480555
0.5041	Remote Similarity	NPC150372

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475319 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7617
0.1-0.2	1469
0.2-0.3	56
0.3-0.4	4
0.4-0.5	2
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6117	Remote Similarity	NPD8171	Phase 2
0.5818	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data