NPASS Compound

Natural Product: NPC6295

Natural Product ID	NPC6295
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	MTIGBMJVOSJZQH-BXJGAQDJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL469461
PubChem CID	11803795
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 136144 0 0 0 0 0 0 0 0999 V2000 11.8945 1.8386 -1.3380 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4813 0.5949 -2.1078 C 0 0 1 0 0 0 0 0 0 0 0 0 11.6919 -0.6087 -1.2265 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4462 -1.3236 -0.8409 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1982 -0.5155 -0.8369 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5155 -0.5150 0.5439 C 0 0 1 0 0 0 0 0 0 0 0 0 9.3214 0.2432 1.5500 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2450 0.1938 0.1467 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0658 -0.3643 -1.2766 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7840 -1.2151 -1.1643 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0394 -0.3767 -0.2195 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7458 -0.7928 0.3195 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8290 -1.4792 -0.6319 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4059 -1.2544 -0.1989 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2299 -0.9630 1.2492 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2485 -0.7981 1.5351 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7686 0.3211 0.6749 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1200 1.5428 0.7265 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1263 1.4653 1.8493 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9840 0.2211 1.7564 C 0 0 1 0 0 0 0 0 0 0 0 0 2.4518 -0.0680 3.1867 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1229 0.5085 0.8522 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1593 1.4341 1.3926 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4510 0.8340 1.8185 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0407 -0.1994 0.9280 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2223 -1.4606 1.7262 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0624 0.6420 1.1500 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0394 0.3648 0.2153 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0376 -0.5816 0.8073 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2926 0.1323 1.1798 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9162 0.7575 -0.0594 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7553 1.1439 -0.9596 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1362 2.1999 -1.9375 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1661 1.7157 -2.7384 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6932 1.5612 -0.1232 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6134 1.8983 0.3270 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9406 1.8521 -0.0809 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8186 1.7536 1.1596 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2572 3.0978 1.6605 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.7902 3.9805 0.5503 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6296 3.2834 -0.7755 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.9058 4.2993 -1.8688 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7068 3.7358 -3.1280 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3245 2.8807 -0.9059 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1233 4.3304 0.7604 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1961 3.7175 2.3000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9096 0.9298 0.8253 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0020 1.0767 2.1581 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3386 -1.6534 -0.0648 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0169 -2.8759 0.4975 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2951 -3.6864 0.7296 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0438 -3.7324 -0.5862 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1153 -4.3391 -1.6317 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8055 -3.5659 -1.6268 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8864 -4.1647 -2.6761 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1962 -3.5644 -0.3804 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7071 -4.1600 -2.8729 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1498 -4.5389 -0.4228 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9956 -4.9487 1.1832 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1608 -1.1186 -1.5739 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3176 0.7824 -1.2577 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0136 0.7705 -2.4720 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2992 1.5545 -0.3304 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0280 2.5052 -1.1206 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6234 2.4635 -1.9115 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0643 0.5767 -3.0381 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3550 -1.3148 -1.8042 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2699 -0.3339 -0.3310 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6254 -1.8206 0.1556 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2880 -2.1788 -1.5513 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3804 -1.5857 0.7773 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2094 0.7064 1.0625 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7089 0.9817 2.1096 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7569 -0.4498 2.3248 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4280 1.2670 0.1390 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9539 0.4364 -2.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0055 -2.2397 -0.8871 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3025 -1.1202 -2.1782 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9732 0.6520 -0.6730 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8029 -1.4450 1.2397 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0189 -2.5881 -0.5344 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0015 -1.2067 -1.6932 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9852 -0.4965 -0.8865 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8041 -2.1890 -0.4005 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5726 -1.8588 1.8158 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3415 -0.5436 2.6209 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7418 -1.7329 1.2728 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9255 -0.0686 -0.3536 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5295 2.4157 0.9459 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6098 1.7750 -0.2429 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7559 2.3860 1.7614 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6079 1.5409 2.8254 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5323 -0.4526 3.7126 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6500 0.9181 3.6565 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2900 -0.7622 3.2265 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6953 0.9967 -0.0759 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3948 2.2622 0.6704 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7496 1.9825 2.2930 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3350 0.4869 2.8885 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1963 1.6774 1.8836 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1435 -1.2801 2.3573 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2908 -2.3741 1.1271 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4130 -1.5349 2.4797 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5951 -0.0917 -0.7130 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6063 -1.0730 1.7197 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0194 -0.6109 1.5545 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5475 0.0539 -0.6048 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4682 0.2263 -1.5220 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2562 2.4270 -2.5676 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4406 3.1418 -1.4085 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9610 1.9104 -3.6666 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0657 0.8888 -0.6525 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2417 1.2326 1.9305 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0753 2.9517 2.3881 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1834 4.9210 0.5064 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3621 2.4597 -0.8925 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1810 5.1567 -1.7830 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9459 4.6688 -1.8182 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2457 2.8623 -2.9953 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3777 5.0458 0.1509 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2115 4.6739 2.0519 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6344 1.1856 1.4706 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7783 1.2527 2.7460 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5785 -2.7609 1.5190 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8789 -3.1524 1.5063 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2983 -2.7007 -0.8745 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9370 -5.4117 -1.4129 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0409 -2.5289 -1.9498 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0617 -3.7311 -3.6894 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8478 -3.8729 -2.3912 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0085 -5.2595 -2.7445 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5170 -4.9025 -3.5073 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1905 -5.0083 0.4418 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7209 -4.8871 2.1482 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6262 -0.0597 -3.0892 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8879 1.7450 -2.9484 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 40 45 1 0 39 46 1 0 38 47 1 0 30 48 1 0 29 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 54 56 1 0 53 57 1 0 52 58 1 0 51 59 1 0 9 60 1 0 5 61 1 6 61 62 1 0 62 2 1 0 60 5 1 0 25 8 1 0 35 28 1 0 44 37 1 0 56 50 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 6 3 67 1 0 3 68 1 0 4 69 1 0 4 70 1 0 6 71 1 1 7 72 1 0 7 73 1 0 7 74 1 0 8 75 1 6 9 76 1 6 10 77 1 0 10 78 1 0 11 79 1 6 12 80 1 1 13 81 1 0 13 82 1 0 14 83 1 0 14 84 1 0 15 85 1 1 16 86 1 0 16 87 1 0 17 88 1 6 18 89 1 0 18 90 1 0 19 91 1 0 19 92 1 0 21 93 1 0 21 94 1 0 21 95 1 0 22 96 1 6 23 97 1 0 23 98 1 0 24 99 1 0 24100 1 0 26101 1 0 26102 1 0 26103 1 0 28104 1 6 29105 1 1 30106 1 1 31107 1 6 32108 1 6 33109 1 0 33110 1 0 34111 1 0 37112 1 6 38113 1 1 39114 1 1 40115 1 6 41116 1 1 42117 1 0 42118 1 0 43119 1 0 45120 1 0 46121 1 0 47122 1 0 48123 1 0 50124 1 1 51125 1 1 52126 1 6 53127 1 1 54128 1 6 55129 1 0 55130 1 0 55131 1 0 57132 1 0 58133 1 0 59134 1 0 62135 1 0 62136 1 0 M END

Standard InCHIKey	MTIGBMJVOSJZQH-BXJGAQDJSA-N
Standard InCHI	InChI=1S/C45H74O17/c1-19-8-13-45(55-18-19)20(2)30-27(62-45)15-26-24-7-6-22-14-23(9-11-43(22,4)25(24)10-12-44(26,30)5)57-42-39(61-40-35(52)33(50)31(48)21(3)56-40)37(54)38(29(17-47)59-42)60-41-36(53)34(51)32(49)28(16-46)58-41/h19-42,46-54H,6-18H2,1-5H3/t19-,20-,21-,22+,23-,24+,25-,26-,27-,28+,29+,30-,31-,32+,33+,34-,35+,36+,37-,38-,39+,40-,41-,42+,43-,44-,45+/m0/s1
SMILES	C[C@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC[C@@H]6C[C@H](CC[C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@H]([C@@H](CO)O3)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[11141122]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT916	Cell line	SK-MEL	Homo sapiens	IC50	=	6.7	ug.mL-1	PMID[11141122]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC6295 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28880
0.1-0.2	17905
0.2-0.3	2371
0.3-0.4	450
0.4-0.5	104
0.5-0.6	74
0.6-0.7	37
0.7-0.8	1
0.8-0.85	10
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9634	High Similarity	NPC19400
0.8427	Intermediate Similarity	NPC485595
0.8372	Intermediate Similarity	NPC477451
0.8333	Intermediate Similarity	NPC195297
0.8242	Intermediate Similarity	NPC160426
0.814	Intermediate Similarity	NPC297348
0.814	Intermediate Similarity	NPC249204
0.814	Intermediate Similarity	NPC48339
0.814	Intermediate Similarity	NPC141769
0.814	Intermediate Similarity	NPC477547
0.8	Intermediate Similarity	NPC471464
0.7931	Intermediate Similarity	NPC325828
0.7917	Intermediate Similarity	NPC480555
0.7917	Intermediate Similarity	NPC150372
0.7912	Intermediate Similarity	NPC107962
0.7778	Intermediate Similarity	NPC206003
0.7778	Intermediate Similarity	NPC473610
0.7732	Intermediate Similarity	NPC128572
0.7692	Intermediate Similarity	NPC211354
0.7604	Intermediate Similarity	NPC470433
0.7604	Intermediate Similarity	NPC46190
0.7604	Intermediate Similarity	NPC171073
0.7423	Intermediate Similarity	NPC475643
0.7308	Intermediate Similarity	NPC480553
0.7253	Intermediate Similarity	NPC234352
0.7216	Intermediate Similarity	NPC475351
0.7157	Intermediate Similarity	NPC269297
0.7157	Intermediate Similarity	NPC222202
0.7128	Intermediate Similarity	NPC107188
0.7115	Intermediate Similarity	NPC480554
0.7087	Intermediate Similarity	NPC475333
0.7087	Intermediate Similarity	NPC224098
0.7087	Intermediate Similarity	NPC208383
0.7019	Intermediate Similarity	NPC194207
0.7019	Intermediate Similarity	NPC22779
0.7	Intermediate Similarity	NPC248746
0.6961	Remote Similarity	NPC97700
0.6961	Remote Similarity	NPC184617
0.6961	Remote Similarity	NPC30856
0.6923	Remote Similarity	NPC485594
0.6915	Remote Similarity	NPC250393
0.6915	Remote Similarity	NPC222731
0.6762	Remote Similarity	NPC475625
0.6735	Remote Similarity	NPC125324
0.6702	Remote Similarity	NPC294686
0.6697	Remote Similarity	NPC232054
0.6667	Remote Similarity	NPC480556
0.6667	Remote Similarity	NPC92890
0.6604	Remote Similarity	NPC32361
0.6602	Remote Similarity	NPC42171
0.6602	Remote Similarity	NPC274200
0.66	Remote Similarity	NPC113044
0.66	Remote Similarity	NPC283829
0.66	Remote Similarity	NPC161676
0.6514	Remote Similarity	NPC132080
0.646	Remote Similarity	NPC224314
0.6442	Remote Similarity	NPC300557
0.6296	Remote Similarity	NPC13193
0.6296	Remote Similarity	NPC116756
0.6286	Remote Similarity	NPC51172
0.6286	Remote Similarity	NPC49032
0.6273	Remote Similarity	NPC83137
0.625	Remote Similarity	NPC177834
0.625	Remote Similarity	NPC602423
0.6239	Remote Similarity	NPC232037
0.6238	Remote Similarity	NPC470432
0.6238	Remote Similarity	NPC230507
0.619	Remote Similarity	NPC477809
0.6182	Remote Similarity	NPC470864
0.6176	Remote Similarity	NPC141433
0.6111	Remote Similarity	NPC475319
0.6	Remote Similarity	NPC473601
0.6	Remote Similarity	NPC24960
0.5983	Remote Similarity	NPC477808
0.5979	Remote Similarity	NPC181845
0.5963	Remote Similarity	NPC115165
0.5929	Remote Similarity	NPC233433
0.5913	Remote Similarity	NPC470866
0.59	Remote Similarity	NPC474399
0.5895	Remote Similarity	NPC473774
0.5895	Remote Similarity	NPC481419
0.5895	Remote Similarity	NPC481417
0.5833	Remote Similarity	NPC6806
0.581	Remote Similarity	NPC14704
0.5784	Remote Similarity	NPC306131
0.5784	Remote Similarity	NPC54619
0.5784	Remote Similarity	NPC200802
0.5781	Remote Similarity	NPC481189
0.5728	Remote Similarity	NPC264101
0.5727	Remote Similarity	NPC73243
0.5727	Remote Similarity	NPC244086
0.5727	Remote Similarity	NPC84956
0.5714	Remote Similarity	NPC309278
0.57	Remote Similarity	NPC291203
0.57	Remote Similarity	NPC217205
0.5684	Remote Similarity	NPC277715
0.5669	Remote Similarity	NPC329807
0.5636	Remote Similarity	NPC475182
0.5625	Remote Similarity	NPC247037
0.5619	Remote Similarity	NPC94272
0.5583	Remote Similarity	NPC220836
0.5579	Remote Similarity	NPC144790
0.5579	Remote Similarity	NPC149400
0.5567	Remote Similarity	NPC481420
0.5567	Remote Similarity	NPC481421
0.5545	Remote Similarity	NPC124677
0.5534	Remote Similarity	NPC121453
0.5517	Remote Similarity	NPC477811
0.5496	Remote Similarity	NPC329727
0.5487	Remote Similarity	NPC475550
0.5478	Remote Similarity	NPC249265
0.5439	Remote Similarity	NPC473518
0.5431	Remote Similarity	NPC476112
0.5431	Remote Similarity	NPC23808
0.5431	Remote Similarity	NPC87998
0.5431	Remote Similarity	NPC307534
0.5421	Remote Similarity	NPC70204
0.5391	Remote Similarity	NPC232611
0.5385	Remote Similarity	NPC128123
0.5345	Remote Similarity	NPC108072
0.5333	Remote Similarity	NPC94086
0.5333	Remote Similarity	NPC473817
0.5299	Remote Similarity	NPC470862
0.5243	Remote Similarity	NPC131693
0.5243	Remote Similarity	NPC475436
0.5234	Remote Similarity	NPC215408
0.5234	Remote Similarity	NPC485601
0.5229	Remote Similarity	NPC305423
0.5221	Remote Similarity	NPC151134
0.521	Remote Similarity	NPC308140
0.521	Remote Similarity	NPC31896
0.5175	Remote Similarity	NPC98018
0.5175	Remote Similarity	NPC284104
0.5175	Remote Similarity	NPC103616
0.5135	Remote Similarity	NPC202898
0.5116	Remote Similarity	NPC481190
0.5113	Remote Similarity	NPC329820
0.5086	Remote Similarity	NPC470863
0.5056	Remote Similarity	NPC248944
0.5056	Remote Similarity	NPC7479
0.5056	Remote Similarity	NPC257296
0.5049	Remote Similarity	NPC481424
0.5049	Remote Similarity	NPC481422
0.5048	Remote Similarity	NPC210157
0.5044	Remote Similarity	NPC469348
0.5044	Remote Similarity	NPC122819
0.5043	Remote Similarity	NPC294129

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC6295 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7900
0.1-0.2	1164
0.2-0.3	72
0.3-0.4	7
0.4-0.5	2
0.5-0.6	2
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7931	Intermediate Similarity	NPD8171	Phase 2
0.6735	Remote Similarity	NPD8170	Phase 2
0.5056	Remote Similarity	NPD6928	Phase 2
0.5044	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data