NPASS Compound

Natural Product: NPC24960

Natural Product ID	NPC24960
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NGIWZTHACNOTTF-GOWFBADFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL445811
PubChem CID	11342375
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 96102 0 0 0 0 0 0 0 0999 V2000 -2.8448 -3.6223 2.8646 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2456 -2.4131 2.4961 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2201 -1.2696 2.7805 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7121 -0.0550 2.4591 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6098 0.8443 1.9935 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6496 0.9648 0.5922 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2593 2.1752 0.1218 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3676 2.8438 -0.6525 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0513 4.2107 -1.1360 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8727 4.5271 -2.2283 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6265 4.4341 -1.5709 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6390 3.5847 -0.8574 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0407 2.1435 -0.8257 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5864 1.6739 -2.1627 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9889 1.1979 -0.3550 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2793 -0.2335 -0.7367 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1410 -1.1751 -0.4974 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1926 -0.6448 -0.9616 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3480 0.6660 -0.2216 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3769 1.6207 -0.8448 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6532 3.0465 -0.4292 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2676 3.8563 -1.3623 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7852 0.9517 -0.3611 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3537 -0.3900 0.1361 C 0 0 1 0 0 0 0 0 0 0 0 0 2.3552 -1.4194 -0.4230 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2071 -2.1068 -1.4430 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7986 -3.5210 -1.7229 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5567 -2.0032 -0.7619 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5340 -0.5957 -0.5318 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7202 -2.2662 -1.6336 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9715 -1.7962 -0.8784 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9968 -2.6305 0.3823 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7471 -2.4826 1.1785 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5836 -2.5636 0.4792 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2291 -2.2950 1.2031 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1672 -0.5306 -2.4417 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9943 0.8089 2.6008 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5907 -0.5818 2.4749 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4935 -1.5381 2.0141 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9061 -2.8571 2.1009 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6963 -0.6418 1.6486 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0023 1.2253 3.9232 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8416 -4.2108 2.0558 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0046 -2.4009 1.4257 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3781 -2.2512 3.1627 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5285 -1.3342 3.8735 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2091 1.8651 2.3159 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9814 2.8723 0.9519 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2438 2.9366 0.0529 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7454 2.2131 -1.4814 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3302 4.9515 -0.3310 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5503 3.8239 -2.3756 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5113 4.4273 -2.6801 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3844 5.5044 -1.2878 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6419 3.9436 0.2200 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1427 2.4432 -2.7014 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7569 1.3612 -2.8490 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2468 0.7913 -2.0571 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9492 1.2512 0.7528 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1268 -0.5904 -0.1322 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5939 -0.3600 -1.7935 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3462 -2.1390 -0.9648 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0264 -1.3276 0.6157 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0519 0.5103 0.8360 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4932 1.5776 -1.9342 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7109 3.2991 -0.6098 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3133 3.2187 0.5959 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1575 3.4172 -2.3694 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0536 4.9200 -1.2961 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2063 1.7291 0.2759 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0617 1.0545 -1.4305 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4252 -0.4185 1.2200 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0710 -2.1459 0.3450 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2612 -1.4709 -2.3484 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0065 -3.8104 -2.7801 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4434 -4.1832 -1.1052 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7358 -3.7201 -1.4991 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6947 -1.6639 -2.5642 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8152 -3.3200 -1.9334 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8668 -0.7234 -0.6674 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8873 -2.0405 -1.4725 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1340 -3.6981 0.0383 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7817 -1.4571 1.6445 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8060 -3.1816 2.0420 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4039 -3.1542 1.8900 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0366 -1.3890 1.8129 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0500 -2.0959 0.5086 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2961 -1.5759 -2.8432 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1599 -0.2308 -2.8033 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9793 0.0528 -2.8877 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6393 1.4950 2.0253 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8917 -0.9116 3.4804 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2875 -1.3262 0.9446 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1187 -3.1182 3.0384 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4962 -0.9929 2.1455 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9989 0.4410 4.5540 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 6 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 19 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 26 28 1 0 28 29 1 1 28 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 18 36 1 6 5 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 38 41 1 0 37 42 1 0 39 3 1 0 13 7 1 0 20 15 1 0 29 24 1 0 22 12 1 0 34 28 1 0 25 18 1 0 1 43 1 0 2 44 1 0 2 45 1 0 3 46 1 1 5 47 1 1 7 48 1 1 8 49 1 0 8 50 1 0 9 51 1 1 10 52 1 0 11 53 1 0 11 54 1 0 12 55 1 1 14 56 1 0 14 57 1 0 14 58 1 0 15 59 1 1 16 60 1 0 16 61 1 0 17 62 1 0 17 63 1 0 19 64 1 1 20 65 1 6 21 66 1 0 21 67 1 0 22 68 1 0 22 69 1 0 23 70 1 0 23 71 1 0 24 72 1 1 25 73 1 1 26 74 1 6 27 75 1 0 27 76 1 0 27 77 1 0 30 78 1 0 30 79 1 0 31 80 1 0 31 81 1 0 32 82 1 6 33 83 1 0 33 84 1 0 35 85 1 0 35 86 1 0 35 87 1 0 36 88 1 0 36 89 1 0 36 90 1 0 37 91 1 6 38 92 1 1 39 93 1 6 40 94 1 0 41 95 1 0 42 96 1 0 M END

Standard InCHIKey	NGIWZTHACNOTTF-GOWFBADFSA-N
Standard InCHI	InChI=1S/C33H54O9/c1-16-7-10-33(39-15-16)17(2)26-23(42-33)13-22-20-6-5-18-11-19(35)12-25(32(18,4)21(20)8-9-31(22,26)3)41-30-29(38)28(37)27(36)24(14-34)40-30/h16-30,34-38H,5-15H2,1-4H3/t16-,17+,18+,19-,20-,21+,22+,23+,24-,25-,26+,27-,28+,29-,30+,31+,32+,33-/m1/s1
SMILES	OC[C@H]1O[C@@H](O[C@@H]2C[C@H](O)C[C@H]3[C@@]2(C)[C@H]2CC[C@]4([C@H]([C@@H]2CC3)C[C@H]2[C@@H]4[C@H](C)[C@]3(O2)CC[C@H](CO3)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	594.38	Volume:	598.541 ? Van der Waals volume.
Dense:	0.993	LogP:	3.109 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.569 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.81 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	3.0	Rigid Bonds:	36.0
TPSA:	138.07 ? Topological Polar Surface Area.	H-Bond Acceptor:	9.0
H-Bond Donor:	5.0	Rings:	7.0
Heavy Atoms:	9.0

MedChem Properties

QED Drug-Likeness Score:	0.334	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.913	Fsp³:	1.0
MCE-18:	173.182 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.73	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.04 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.203	Promiscuous compounds:	0.025

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.603	MDCK Permeability:	-5.059
Pgp-inhibitor:	0.016	Pgp-substrate:	0.42
PAMPA:	0.849 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.03
20% Bioavailability (F20%):	0.261	30% Bioavailability (F30%):	0.906
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.01	MRP1:	0.028
Plasma Protein Binding (PPB):	62.031%	Volume Distribution (VD):	-0.409
Fu:	35.005% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.83
BSEP inhibitor:	0.528

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.017
CYP3A4-inhibitor:	0.999	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.999
HLM stability:	0.018 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.456

Half-life (T1/2):

2.932

ADMET: Toxicity

hERG Blockers:	0.052	hERG Blockers (10um):	0.148
Human Hepatotoxicity (H-HT):	0.638	Drug-induced Liver Injury (DILI):	0.847
AMES Toxicity:	0.607	Rat Oral Acute Toxicity:	0.052
Maximum Recommended Daily Dose:	0.331	Skin Sensitization:	1.0
Carcinogencity:	0.604	Eye Corrosion:	0.0
Eye Irritation:	0.054	Respiratory Toxicity:	0.027
Drug-induced Neurotoxicity:	0.006	Ototoxicity:	0.972
Hematotoxicity:	0.062	Drug-induced Nephrotoxicity:	0.641
Genotoxicity:	0.006	RPMI-8226 Immunitoxicity:	0.131
A549 Cytotoxicity:	0.541	Hek293 Cytotoxicity:	0.725
BCF:	1.719 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.496 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.691 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.157 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	bulbs	n.a.	n.a.	PMID[12398536]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	n.a.	bulb	n.a.	PMID[12398536]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	bulbs	n.a.	n.a.	PMID[15497941]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	1.6	ug.mL-1	PMID[9677277]
NPT924	Cell line	HSC-2	Homo sapiens	IC50	=	34.6	ug.mL-1	PMID[20702006]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC24960 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25777
0.1-0.2	20798
0.2-0.3	2803
0.3-0.4	298
0.4-0.5	88
0.5-0.6	50
0.6-0.7	29
0.7-0.8	0
0.8-0.85	1
0.85-0.9	3
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8784	High Similarity	NPC473774
0.8784	High Similarity	NPC481419
0.8784	High Similarity	NPC481417
0.8052	Intermediate Similarity	NPC481418
0.7439	Intermediate Similarity	NPC481424
0.7439	Intermediate Similarity	NPC481422
0.7294	Intermediate Similarity	NPC473616
0.6923	Remote Similarity	NPC473830
0.6914	Remote Similarity	NPC277715
0.6824	Remote Similarity	NPC481423
0.6747	Remote Similarity	NPC481420
0.6747	Remote Similarity	NPC481421
0.6585	Remote Similarity	NPC204881
0.6552	Remote Similarity	NPC297348
0.6552	Remote Similarity	NPC325828
0.6552	Remote Similarity	NPC249204
0.6552	Remote Similarity	NPC48339
0.6552	Remote Similarity	NPC141769
0.6552	Remote Similarity	NPC477547
0.6477	Remote Similarity	NPC294686
0.6477	Remote Similarity	NPC234352
0.6267	Remote Similarity	NPC248944
0.6267	Remote Similarity	NPC7479
0.6267	Remote Similarity	NPC257296
0.6264	Remote Similarity	NPC206003
0.6264	Remote Similarity	NPC473610
0.6222	Remote Similarity	NPC477451
0.6196	Remote Similarity	NPC211354
0.6196	Remote Similarity	NPC107188
0.6154	Remote Similarity	NPC222731
0.6136	Remote Similarity	NPC485594
0.6067	Remote Similarity	NPC181845
0.6064	Remote Similarity	NPC107962
0.6	Remote Similarity	NPC144790
0.6	Remote Similarity	NPC149400
0.6	Remote Similarity	NPC6295
0.5938	Remote Similarity	NPC195297
0.5876	Remote Similarity	NPC160426
0.5816	Remote Similarity	NPC475351
0.5758	Remote Similarity	NPC473601
0.5714	Remote Similarity	NPC481425
0.5714	Remote Similarity	NPC481426
0.5698	Remote Similarity	NPC473469
0.5684	Remote Similarity	NPC306131
0.5684	Remote Similarity	NPC200802
0.5684	Remote Similarity	NPC19400
0.5652	Remote Similarity	NPC177834
0.5641	Remote Similarity	NPC227260
0.5638	Remote Similarity	NPC250393
0.5579	Remote Similarity	NPC121453
0.557	Remote Similarity	NPC296734
0.5534	Remote Similarity	NPC128572
0.5521	Remote Similarity	NPC54619
0.551	Remote Similarity	NPC485595
0.5481	Remote Similarity	NPC97700
0.5481	Remote Similarity	NPC184617
0.5481	Remote Similarity	NPC30856
0.5455	Remote Similarity	NPC88962
0.5455	Remote Similarity	NPC70204
0.5429	Remote Similarity	NPC115165
0.5426	Remote Similarity	NPC131693
0.5426	Remote Similarity	NPC475436
0.5376	Remote Similarity	NPC296936
0.5354	Remote Similarity	NPC125324
0.5248	Remote Similarity	NPC113044
0.5248	Remote Similarity	NPC283829
0.5248	Remote Similarity	NPC161676
0.5243	Remote Similarity	NPC475643
0.5238	Remote Similarity	NPC473205
0.5192	Remote Similarity	NPC477809
0.5185	Remote Similarity	NPC473518
0.5182	Remote Similarity	NPC83137
0.5181	Remote Similarity	NPC481427
0.5143	Remote Similarity	NPC300557
0.5135	Remote Similarity	NPC132080
0.5125	Remote Similarity	NPC24556
0.5098	Remote Similarity	NPC14704
0.5094	Remote Similarity	NPC480555
0.5094	Remote Similarity	NPC150372
0.505	Remote Similarity	NPC470432
0.505	Remote Similarity	NPC230507
0.5049	Remote Similarity	NPC485605
0.5048	Remote Similarity	NPC92890
0.5047	Remote Similarity	NPC294129
0.5046	Remote Similarity	NPC475625
0.5046	Remote Similarity	NPC473776

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC24960 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7521
0.1-0.2	1537
0.2-0.3	83
0.3-0.4	5
0.4-0.5	1
0.5-0.6	1
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6552	Remote Similarity	NPD8171	Phase 2
0.6267	Remote Similarity	NPD6928	Phase 2
0.567	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data