NPASS Compound

Natural Product: NPC19400

Natural Product ID	NPC19400
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	KFYOFJUUTSALEH-JLTVVCKYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2036076
PubChem CID	21607803
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135143 0 0 0 0 0 0 0 0999 V2000 -3.3047 0.0618 3.9119 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5441 0.6422 3.8156 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9854 0.8239 2.3503 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0159 1.6688 1.8251 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2943 1.1628 0.7792 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5725 0.0718 1.1362 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2235 0.0818 0.9112 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3849 -0.0525 2.1556 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0388 0.3454 1.7605 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5930 -0.5048 0.6757 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6058 -0.6844 -0.4812 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7742 -1.0043 -0.0464 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1820 -1.6349 -1.4911 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5472 -1.2463 -1.9246 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4800 -0.8070 -0.8228 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7663 0.1975 0.0562 C 0 0 2 0 0 0 0 0 0 0 0 0 3.6231 0.8938 1.0457 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9291 1.3761 0.4629 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6107 0.3027 -0.3360 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6245 -0.1021 -1.4392 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4812 -0.8997 -2.3513 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7724 -0.1557 -2.3781 C 0 0 1 0 0 0 0 0 0 0 0 0 6.7044 0.8014 -1.2122 C 0 0 2 0 0 0 0 0 0 0 0 0 8.0721 0.8109 -0.6681 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7098 2.1366 -1.0770 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7866 -0.2893 -1.3635 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8940 -0.9144 -2.2441 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2958 -1.3903 -0.4711 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2332 -0.8145 0.5641 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3619 -0.1986 -0.1977 C 0 0 1 0 0 0 0 0 0 0 0 0 11.1023 -0.0619 -1.6676 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8456 0.1823 -2.0774 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6761 1.1458 0.4240 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9268 -0.8425 0.5300 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9916 -1.8375 1.2635 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3112 0.6917 -0.2745 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8507 -0.6044 0.2536 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0632 -0.5310 1.7362 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2508 -1.1353 2.1232 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1701 -2.2915 2.8325 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8151 -3.3603 2.1607 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1414 -3.0356 1.9008 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7031 -4.0947 0.9842 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9750 -3.0189 3.1610 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0033 -3.1778 4.3148 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9089 -2.1506 4.1294 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9925 -2.4027 5.1787 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4892 -4.4487 4.3931 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6326 -1.7925 3.2187 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9560 -1.6148 -0.1005 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2569 1.6833 -0.3763 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3091 2.3237 -1.6091 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1070 3.6585 -1.3946 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2323 4.4906 -2.4720 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8630 5.0128 -2.8515 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8064 3.8029 -3.6926 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0586 3.0903 -3.2466 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6922 2.0809 -2.1956 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7206 0.8120 -2.8174 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6985 2.4464 -4.2917 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1756 4.7841 -4.5971 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3193 -0.5603 4.6979 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4614 1.6836 4.2722 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2837 0.1288 4.4272 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9807 1.3343 2.4243 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7365 1.9854 0.3206 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9586 1.0524 0.4441 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3775 -1.0836 2.5201 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6730 0.6894 2.9463 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6970 0.2386 2.6506 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9876 1.4207 1.4755 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5688 0.3236 -0.9860 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8275 -2.0045 0.4327 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4309 -0.9276 -0.9369 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0784 -2.7056 -1.1853 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5145 -1.5612 -2.4024 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5216 -0.4503 -2.7123 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0226 -2.1241 -2.4207 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7938 -1.7143 -0.2796 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3479 0.9776 -0.6277 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0747 1.8349 1.3511 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7701 0.3396 2.0067 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5922 1.6534 1.3022 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7563 2.3045 -0.1321 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2765 0.7976 -1.9899 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5808 -1.9683 -2.0859 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9837 -0.8988 -3.3655 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8408 0.3808 -3.3579 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3721 1.7792 -1.6277 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1396 0.7757 0.4351 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9129 2.8864 -1.3658 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2335 2.6206 -0.2385 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3312 2.0372 -1.9845 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5417 -2.0637 -0.0868 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9579 -2.0211 -1.1366 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6008 -1.6738 1.1623 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7486 -0.1325 1.2791 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2702 -0.8256 -0.0486 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4416 -1.0251 -2.1383 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8621 0.6878 -2.0402 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8758 1.5065 1.0994 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6603 1.1618 0.9351 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7415 1.9093 -0.4047 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9883 -1.7731 -0.0846 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8827 -0.7798 1.0752 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1403 -0.9884 1.2770 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1634 -2.6251 0.5330 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9247 -1.7064 1.8399 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2298 -2.2094 1.9774 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7487 0.5759 -1.2311 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7721 -0.8240 -0.3174 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2539 -1.1583 2.1811 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1221 -2.5673 3.0522 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1902 -2.0677 1.3577 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8914 -4.4192 0.2831 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5196 -3.7004 0.3438 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0022 -5.0121 1.5378 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6464 -3.8724 3.1724 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5150 -2.9391 5.2606 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3221 -1.1285 4.2771 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8808 -3.3863 5.3017 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8330 -5.0726 3.7263 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1251 -1.0535 2.8124 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9965 -1.8036 -1.0703 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5747 1.9475 -2.3259 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8464 5.4100 -2.2368 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3652 4.2270 -3.4644 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2688 5.2769 -1.9625 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0413 5.9144 -3.5095 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0836 3.0771 -4.0727 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7954 3.7886 -2.7936 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4558 2.0278 -1.3826 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3918 0.2131 -2.4239 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1787 1.6677 -3.9092 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1276 5.7091 -4.2041 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 6 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 30 33 1 0 19 34 1 1 10 35 1 1 5 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 44 49 1 0 37 50 1 0 36 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 54 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 57 60 1 0 56 61 1 0 38 3 1 0 46 40 1 0 58 52 1 0 12 7 1 0 20 15 1 0 27 22 1 0 16 10 1 0 23 19 1 0 32 26 1 0 1 62 1 0 2 63 1 0 2 64 1 0 3 65 1 1 5 66 1 6 7 67 1 6 8 68 1 0 8 69 1 0 9 70 1 0 9 71 1 0 11 72 1 6 12 73 1 0 12 74 1 0 13 75 1 0 13 76 1 0 14 77 1 0 14 78 1 0 15 79 1 1 16 80 1 6 17 81 1 0 17 82 1 0 18 83 1 0 18 84 1 0 20 85 1 6 21 86 1 0 21 87 1 0 22 88 1 6 23 89 1 6 24 90 1 1 25 91 1 0 25 92 1 0 25 93 1 0 28 94 1 0 28 95 1 0 29 96 1 0 29 97 1 0 30 98 1 6 31 99 1 0 31100 1 0 33101 1 0 33102 1 0 33103 1 0 34104 1 0 34105 1 0 34106 1 0 35107 1 0 35108 1 0 35109 1 0 36110 1 6 37111 1 6 38112 1 1 40113 1 1 42114 1 6 43115 1 0 43116 1 0 43117 1 0 44118 1 6 45119 1 1 46120 1 1 47121 1 0 48122 1 0 49123 1 0 50124 1 0 52125 1 6 54126 1 1 55127 1 0 55128 1 0 55129 1 0 56130 1 6 57131 1 1 58132 1 1 59133 1 0 60134 1 0 61135 1 0 M END

Standard InCHIKey	KFYOFJUUTSALEH-JLTVVCKYSA-N
Standard InCHI	InChI=1S/C45H74O16/c1-19-9-14-45(54-18-19)20(2)30-28(61-45)16-27-25-8-7-23-15-24(10-12-43(23,5)26(25)11-13-44(27,30)6)57-42-39(60-41-36(52)34(50)32(48)22(4)56-41)37(53)38(29(17-46)58-42)59-40-35(51)33(49)31(47)21(3)55-40/h19-42,46-53H,7-18H2,1-6H3/t19-,20-,21-,22-,23-,24-,25+,26-,27-,28-,29+,30-,31-,32-,33+,34+,35+,36+,37-,38+,39+,40-,41-,42+,43-,44-,45+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2)CC[C@@H]2[C@@H]3CC[C@]3([C@H]2C[C@H]2[C@@H]3[C@H](C)[C@]3(O2)CC[C@@H](CO3)C)C)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	870.5	Volume:	850.511 ? Van der Waals volume.
Dense:	1.024	LogP:	2.621 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.452 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.956 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	48.0
TPSA:	235.68 ? Topological Polar Surface Area.	H-Bond Acceptor:	16.0
H-Bond Donor:	8.0	Rings:	9.0
Heavy Atoms:	16.0

MedChem Properties

QED Drug-Likeness Score:	0.169	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.662	Fsp³:	1.0
MCE-18:	230.667 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.736	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.022 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.303	Promiscuous compounds:	0.034

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.112	MDCK Permeability:	-4.945
Pgp-inhibitor:	0.0	Pgp-substrate:	0.863
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.184	30% Bioavailability (F30%):	0.863
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.032
Plasma Protein Binding (PPB):	61.194%	Volume Distribution (VD):	-0.37
Fu:	29.18% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.269
BSEP inhibitor:	0.317

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.787
HLM stability:	0.042 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.236

Half-life (T1/2):

3.15

ADMET: Toxicity

hERG Blockers:	0.056	hERG Blockers (10um):	0.262
Human Hepatotoxicity (H-HT):	0.406	Drug-induced Liver Injury (DILI):	0.904
AMES Toxicity:	0.624	Rat Oral Acute Toxicity:	0.005
Maximum Recommended Daily Dose:	0.013	Skin Sensitization:	1.0
Carcinogencity:	0.03	Eye Corrosion:	0.0
Eye Irritation:	0.004	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.997
Hematotoxicity:	0.138	Drug-induced Nephrotoxicity:	0.636
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.19
A549 Cytotoxicity:	0.453	Hek293 Cytotoxicity:	0.688
BCF:	2.237 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.78 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.855 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.404 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32523	solanum violaceum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22413887]
NPO32523	solanum violaceum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23511021]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	7
Inhibition	1

Activity Type	# Activity
Cell line	5
Non-molecular	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT65	Cell line	HepG2	Homo sapiens	IC50	=	5.33	ug.mL-1	DrugMatrix in vitro pharmacology data
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	11.57	ug.mL-1	Open TG-GATES in vivo data: Hematology
NPT81	Cell line	A549	Homo sapiens	IC50	=	7.27	ug.mL-1	PMID[12502328]
NPT1031	Cell line	Ca9-22	Homo sapiens	IC50	=	6.76	ug.mL-1	PMID[23628332]
NPT82	Cell line	MDA-MB-231	Homo sapiens	IC50	=	8.04	ug.mL-1	PMID[25437304]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	3.32	ug.mL-1	PMID[22413887]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	2.84	ug.mL-1	PMID[22413887]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Inhibition	=	38.9	%	PMID[22413887]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC19400 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28306
0.1-0.2	18821
0.2-0.3	2159
0.3-0.4	340
0.4-0.5	95
0.5-0.6	66
0.6-0.7	39
0.7-0.8	1
0.8-0.85	3
0.85-0.9	1
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9634	High Similarity	NPC6295
0.8721	High Similarity	NPC485595
0.8261	Intermediate Similarity	NPC471464
0.8235	Intermediate Similarity	NPC477451
0.8	Intermediate Similarity	NPC195297
0.7912	Intermediate Similarity	NPC160426
0.7849	Intermediate Similarity	NPC470433
0.7849	Intermediate Similarity	NPC46190
0.7849	Intermediate Similarity	NPC171073
0.7791	Intermediate Similarity	NPC297348
0.7791	Intermediate Similarity	NPC249204
0.7791	Intermediate Similarity	NPC48339
0.7791	Intermediate Similarity	NPC141769
0.7791	Intermediate Similarity	NPC477547
0.7604	Intermediate Similarity	NPC480555
0.7604	Intermediate Similarity	NPC150372
0.7586	Intermediate Similarity	NPC325828
0.7582	Intermediate Similarity	NPC107962
0.7444	Intermediate Similarity	NPC206003
0.7444	Intermediate Similarity	NPC473610
0.7423	Intermediate Similarity	NPC128572
0.7374	Intermediate Similarity	NPC269297
0.7374	Intermediate Similarity	NPC222202
0.7363	Intermediate Similarity	NPC211354
0.73	Intermediate Similarity	NPC475333
0.73	Intermediate Similarity	NPC224098
0.73	Intermediate Similarity	NPC208383
0.7216	Intermediate Similarity	NPC248746
0.7157	Intermediate Similarity	NPC480554
0.7143	Intermediate Similarity	NPC250393
0.7113	Intermediate Similarity	NPC475643
0.7019	Intermediate Similarity	NPC480553
0.6923	Remote Similarity	NPC234352
0.6907	Remote Similarity	NPC475351
0.6809	Remote Similarity	NPC107188
0.68	Remote Similarity	NPC42171
0.68	Remote Similarity	NPC274200
0.6796	Remote Similarity	NPC32361
0.6774	Remote Similarity	NPC222731
0.6731	Remote Similarity	NPC194207
0.6731	Remote Similarity	NPC22779
0.6697	Remote Similarity	NPC480556
0.6667	Remote Similarity	NPC97700
0.6667	Remote Similarity	NPC184617
0.6667	Remote Similarity	NPC30856
0.6636	Remote Similarity	NPC224314
0.6635	Remote Similarity	NPC475625
0.6593	Remote Similarity	NPC485594
0.6465	Remote Similarity	NPC113044
0.6465	Remote Similarity	NPC283829
0.6465	Remote Similarity	NPC161676
0.6452	Remote Similarity	NPC177834
0.6429	Remote Similarity	NPC125324
0.6429	Remote Similarity	NPC470432
0.6429	Remote Similarity	NPC230507
0.6422	Remote Similarity	NPC232054
0.6383	Remote Similarity	NPC294686
0.6373	Remote Similarity	NPC92890
0.6275	Remote Similarity	NPC602423
0.6262	Remote Similarity	NPC232037
0.6239	Remote Similarity	NPC132080
0.6154	Remote Similarity	NPC300557
0.6087	Remote Similarity	NPC473774
0.6087	Remote Similarity	NPC481419
0.6087	Remote Similarity	NPC481417
0.604	Remote Similarity	NPC141433
0.6019	Remote Similarity	NPC13193
0.6019	Remote Similarity	NPC116756
0.6	Remote Similarity	NPC51172
0.6	Remote Similarity	NPC83137
0.6	Remote Similarity	NPC49032
0.596	Remote Similarity	NPC306131
0.596	Remote Similarity	NPC200802
0.5909	Remote Similarity	NPC470864
0.5905	Remote Similarity	NPC477809
0.59	Remote Similarity	NPC264101
0.5833	Remote Similarity	NPC475319
0.5825	Remote Similarity	NPC14704
0.5761	Remote Similarity	NPC144790
0.5761	Remote Similarity	NPC149400
0.5745	Remote Similarity	NPC481420
0.5745	Remote Similarity	NPC481421
0.5726	Remote Similarity	NPC477808
0.5714	Remote Similarity	NPC473601
0.5701	Remote Similarity	NPC124677
0.5688	Remote Similarity	NPC115165
0.5684	Remote Similarity	NPC24960
0.568	Remote Similarity	NPC329807
0.567	Remote Similarity	NPC181845
0.5664	Remote Similarity	NPC233433
0.5652	Remote Similarity	NPC470866
0.56	Remote Similarity	NPC474399
0.5577	Remote Similarity	NPC70204
0.5556	Remote Similarity	NPC6806
0.5547	Remote Similarity	NPC481189
0.5504	Remote Similarity	NPC329727
0.549	Remote Similarity	NPC54619
0.5455	Remote Similarity	NPC73243
0.5455	Remote Similarity	NPC244086
0.5455	Remote Similarity	NPC84956
0.5446	Remote Similarity	NPC309278
0.5439	Remote Similarity	NPC476112
0.5439	Remote Similarity	NPC307534
0.54	Remote Similarity	NPC291203
0.54	Remote Similarity	NPC131693
0.54	Remote Similarity	NPC475436
0.54	Remote Similarity	NPC217205
0.5385	Remote Similarity	NPC215408
0.5368	Remote Similarity	NPC277715
0.5364	Remote Similarity	NPC475182
0.5357	Remote Similarity	NPC247037
0.5339	Remote Similarity	NPC94086
0.5339	Remote Similarity	NPC473817
0.5333	Remote Similarity	NPC220836
0.5333	Remote Similarity	NPC94272
0.5278	Remote Similarity	NPC202898
0.5259	Remote Similarity	NPC477811
0.5243	Remote Similarity	NPC121453
0.5233	Remote Similarity	NPC248944
0.5233	Remote Similarity	NPC7479
0.5233	Remote Similarity	NPC257296
0.5221	Remote Similarity	NPC475550
0.5217	Remote Similarity	NPC249265
0.52	Remote Similarity	NPC481424
0.52	Remote Similarity	NPC481422
0.5182	Remote Similarity	NPC469348
0.5182	Remote Similarity	NPC122819
0.5179	Remote Similarity	NPC294129
0.5175	Remote Similarity	NPC473518
0.5172	Remote Similarity	NPC23808
0.5172	Remote Similarity	NPC87998
0.513	Remote Similarity	NPC232611
0.5115	Remote Similarity	NPC329820
0.5096	Remote Similarity	NPC128123
0.5093	Remote Similarity	NPC305423
0.5086	Remote Similarity	NPC108072
0.5043	Remote Similarity	NPC470862

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC19400 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7823
0.1-0.2	1248
0.2-0.3	63
0.3-0.4	10
0.4-0.5	1
0.5-0.6	3
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7586	Intermediate Similarity	NPD8171	Phase 2
0.6429	Remote Similarity	NPD8170	Phase 2
0.5233	Remote Similarity	NPD6928	Phase 2
0.5182	Remote Similarity	NPD8449	Approved
0.5155	Remote Similarity	NPD7991	Discontinued

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data