NPASS drugs

Drug Information

Drug ID:	NPD4244
Drug Name:	Mesterolone
Molecular Formula:	C20H32O2
Canonical SMILES:	O=C1C[C@H](C)[C@]2([C@H](C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C)C
Standard InCHI:	"InChI=1S/C20H32O2/c1-12-10-14(21)11-13-4-5-15-16-6-7-18(22)19(16,2)9-8-17(15)20(12,13)3/h12-13,15-18,22H,4-11H2,1-3H3/t12-,13-,15-,16-,17-,18-,19-,20-/m0/s1"
Standard InCHIKey:	UXYRZJKIQKRJCF-TZPFWLJSSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4244

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	86573
0.1-0.2	115029
0.2-0.3	9855
0.3-0.4	236
0.4-0.5	30
0.5-0.6	10
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6667	NPC324607
Remote Similarity	0.6667	NPC321732
Remote Similarity	0.6667	NPC187953
Remote Similarity	0.6667	NPC599778
Remote Similarity	0.5769	NPC323563
Remote Similarity	0.52	NPC281540
Remote Similarity	0.52	NPC159654
Remote Similarity	0.52	NPC167995
Remote Similarity	0.52	NPC326080
Remote Similarity	0.52	NPC118937
Remote Similarity	0.52	NPC92062
Remote Similarity	0.5192	NPC322671
Remote Similarity	0.5192	NPC547133
Remote Similarity	0.5185	NPC273820

Drug Structure

NPD4244 OpenBabel08211704332D 23 26 0 0 1 0 0 0 0 0999 V2000 3.3515 0.0367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 1.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5142 -0.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6769 -2.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8387 -2.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6746 -0.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6749 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6761 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8379 0.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1894 -1.4497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3524 -2.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3518 -0.9661 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5148 -2.4178 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1897 -2.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8384 -1.4506 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0003 -0.9671 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6763 -0.9666 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8382 0.4836 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5145 -1.4502 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0583 -2.9183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8387 1.4502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5575 2.0966 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 12 1 0 0 0 0 4 5 1 0 0 0 0 4 13 1 0 0 0 0 6 7 1 0 0 0 0 6 16 1 0 0 0 0 7 18 1 0 0 0 0 8 9 1 0 0 0 0 8 17 1 0 0 0 0 9 19 1 0 0 0 0 10 12 1 0 0 0 0 10 14 1 0 0 0 0 11 13 1 0 0 0 0 11 14 1 0 0 0 0 12 20 1 1 0 0 0 13 20 1 6 0 0 0 14 21 2 0 0 0 0 15 5 1 1 0 0 0 15 16 1 0 0 0 0 15 17 1 0 0 0 0 16 19 1 6 0 0 0 17 20 1 6 0 0 0 18 19 1 6 0 0 0 18 22 1 0 0 0 0 19 2 1 6 0 0 0 20 3 1 6 0 0 0 22 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	304.24
ALogP	0.0889
MLogP	3.44
XLogP	5.006
HDA	2
HBD	1
Rotatable Bonds	4
TPSA	37.3
RO5 Violation	1