NPASS Compound

Natural Product: NPC325828

Natural Product ID	NPC325828
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GUSVHVVOABZHAH-ZREXOAHZSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1078617
PubChem CID	46883013
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 116123 0 0 0 0 0 0 0 0999 V2000 7.4022 2.1120 2.5495 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0595 2.2072 2.1969 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6443 1.0798 1.2760 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3046 1.1724 0.9257 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8525 0.0671 0.2276 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5816 0.2246 -0.2800 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6346 -0.6386 0.2559 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6831 0.2231 1.0576 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3321 0.9364 0.2311 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9864 0.0826 -0.8417 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5444 -1.3544 -0.7690 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9527 -1.4871 -0.7657 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1383 -2.1369 0.3457 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3493 -1.4528 0.9850 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1785 -0.9744 -0.1540 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4503 0.2486 -0.7413 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1759 0.5465 -2.0320 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6008 0.9330 -1.7219 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3520 -0.1327 -0.9674 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4900 -0.4683 0.2566 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4082 -1.3109 1.0373 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6751 -0.4413 0.9968 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5698 0.3588 -0.2850 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8779 -0.0080 -0.9491 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3373 1.1382 -1.7757 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7233 -0.2848 0.2813 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8323 -1.1733 0.9461 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9601 -1.0552 0.0195 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2424 -0.3175 0.0333 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2411 0.7087 1.1208 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9853 1.5468 0.9318 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8368 0.8061 1.1037 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2344 0.0929 2.4952 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6302 -1.3314 -1.8186 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4566 0.6127 -2.1787 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7574 -0.3397 -0.8935 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8016 0.7125 -1.1961 C 0 0 2 0 0 0 0 0 0 0 0 0 6.5559 0.9744 0.0901 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5211 0.0002 0.1891 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8092 0.4745 0.1263 C 0 0 2 0 0 0 0 0 0 0 0 0 9.3552 0.0090 -1.0712 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7174 0.2759 -1.0296 C 0 0 2 0 0 0 0 0 0 0 0 0 11.2367 0.3759 -2.4481 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0227 -0.8070 -3.1337 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3765 -0.8280 -0.2408 C 0 0 2 0 0 0 0 0 0 0 0 0 10.6070 -1.0064 1.0516 C 0 0 1 0 0 0 0 0 0 0 0 0 9.6591 0.1403 1.3128 C 0 0 1 0 0 0 0 0 0 0 0 0 10.4133 1.2368 1.7416 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9732 -2.2482 1.1146 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7293 -0.5851 -0.0272 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1404 1.8465 -1.6502 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4457 -1.4889 -0.5155 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8616 2.9932 2.5699 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8476 3.2083 1.7400 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4947 2.1915 3.1506 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7521 0.1384 1.8557 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8032 -0.7594 0.9631 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1901 -1.2681 1.0074 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2628 -0.3078 1.9378 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3244 1.0321 1.5238 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1189 1.8660 -0.1966 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1078 1.3267 0.9542 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8929 -1.8237 -1.7384 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3925 -1.2939 -1.7843 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1951 -2.5499 -0.5521 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5524 -3.1215 -0.0318 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4012 -2.4546 1.1304 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9440 -2.2532 1.5101 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0881 -0.7178 1.7418 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1930 -1.7710 -0.9257 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7247 1.0930 -0.0503 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2057 -0.2950 -2.7275 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7166 1.4670 -2.4804 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1157 1.0198 -2.7224 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6907 1.9224 -1.2568 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3487 0.5114 0.7668 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5705 -2.3127 0.6478 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0668 -1.3051 2.1039 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6743 0.2764 1.8433 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4890 1.4500 -0.1026 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8383 -0.9233 -1.5318 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0872 2.1403 -1.3561 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3907 1.0786 -2.1167 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7340 1.0919 -2.7309 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0594 -1.9287 0.7231 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8386 -1.5463 -0.9908 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5204 0.1416 -0.9345 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0748 -1.0384 0.2637 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0971 1.4313 1.0395 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0069 2.3285 1.7196 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0834 2.0441 -0.0353 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8165 0.7486 3.1856 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6599 -0.9270 2.5215 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1860 0.1027 2.8915 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1941 -2.0921 -1.2748 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7424 -1.8216 -2.2345 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1869 -0.9427 -2.7218 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7024 1.6954 -2.2926 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6522 0.5601 -2.2074 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8166 0.0308 -3.0297 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1744 -0.6089 -1.8127 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4398 0.3283 -1.9930 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0621 1.9594 -0.0233 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7704 1.5782 0.0210 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9349 1.2611 -0.5229 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3103 0.6342 -2.4487 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6318 1.1845 -2.9339 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5377 -0.6553 -3.9953 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2520 -1.7698 -0.8293 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3580 -0.9942 1.8744 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0300 -0.1681 2.1778 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1796 0.9393 2.2923 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1394 -2.6963 0.2448 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0814 -1.2357 0.6156 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7438 2.5830 -1.9029 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6490 -2.0483 -1.3035 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 30 33 1 0 19 34 1 6 10 35 1 6 5 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 37 51 1 0 36 52 1 0 38 3 1 0 47 40 1 0 12 7 1 0 20 15 1 0 27 22 1 0 16 10 1 0 23 19 1 0 32 26 1 0 1 53 1 0 2 54 1 0 2 55 1 0 3 56 1 1 5 57 1 1 7 58 1 1 8 59 1 0 8 60 1 0 9 61 1 0 9 62 1 0 11 63 1 6 12 64 1 0 12 65 1 0 13 66 1 0 13 67 1 0 14 68 1 0 14 69 1 0 15 70 1 6 16 71 1 1 17 72 1 0 17 73 1 0 18 74 1 0 18 75 1 0 20 76 1 1 21 77 1 0 21 78 1 0 22 79 1 1 23 80 1 1 24 81 1 6 25 82 1 0 25 83 1 0 25 84 1 0 28 85 1 0 28 86 1 0 29 87 1 0 29 88 1 0 30 89 1 1 31 90 1 0 31 91 1 0 33 92 1 0 33 93 1 0 33 94 1 0 34 95 1 0 34 96 1 0 34 97 1 0 35 98 1 0 35 99 1 0 35100 1 0 36101 1 6 37102 1 6 38103 1 6 40104 1 6 42105 1 1 43106 1 0 43107 1 0 44108 1 0 45109 1 6 46110 1 1 47111 1 1 48112 1 0 49113 1 0 50114 1 0 51115 1 0 52116 1 0 M END

Standard InCHIKey	GUSVHVVOABZHAH-ZREXOAHZSA-N
Standard InCHI	InChI=1S/C39H64O13/c1-18-7-12-39(47-17-18)19(2)28-25(52-39)14-24-22-6-5-20-13-21(8-10-37(20,3)23(22)9-11-38(24,28)4)48-35-33(46)31(44)34(27(16-41)50-35)51-36-32(45)30(43)29(42)26(15-40)49-36/h18-36,40-46H,5-17H2,1-4H3/t18-,19+,20-,21+,22-,23+,24+,25+,26-,27-,28+,29-,30+,31-,32-,33-,34-,35-,36+,37+,38+,39-/m1/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]2[C@@H]3CC[C@]3([C@H]2C[C@H]2[C@@H]3[C@H](C)[C@]3(O2)CC[C@H](CO3)C)C)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	740.43	Volume:	728.921 ? Van der Waals volume.
Dense:	1.016	LogP:	2.718 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.465 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.015 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	42.0
TPSA:	196.99 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	7.0	Rings:	8.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.194	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.202	Fsp³:	1.0
MCE-18:	200.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.747	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.041 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.245	Promiscuous compounds:	0.013

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.056	MDCK Permeability:	-5.073
Pgp-inhibitor:	0.021	Pgp-substrate:	0.222
PAMPA:	0.71 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.012
20% Bioavailability (F20%):	0.094	30% Bioavailability (F30%):	0.956
50% Bioavailability (F50%):	0.986

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.068	MRP1:	0.053
Plasma Protein Binding (PPB):	60.39%	Volume Distribution (VD):	-0.442
Fu:	34.128% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.278
BSEP inhibitor:	0.505

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.241	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.002
CYP3A4-inhibitor:	0.999	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.96
HLM stability:	0.003 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.47

Half-life (T1/2):

2.745

ADMET: Toxicity

hERG Blockers:	0.032	hERG Blockers (10um):	0.093
Human Hepatotoxicity (H-HT):	0.681	Drug-induced Liver Injury (DILI):	0.99
AMES Toxicity:	0.925	Rat Oral Acute Toxicity:	0.033
Maximum Recommended Daily Dose:	0.038	Skin Sensitization:	1.0
Carcinogencity:	0.344	Eye Corrosion:	0.0
Eye Irritation:	0.004	Respiratory Toxicity:	0.007
Drug-induced Neurotoxicity:	0.003	Ototoxicity:	0.993
Hematotoxicity:	0.227	Drug-induced Nephrotoxicity:	0.735
Genotoxicity:	0.017	RPMI-8226 Immunitoxicity:	0.175
A549 Cytotoxicity:	0.899	Hek293 Cytotoxicity:	0.889
BCF:	1.81 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.436 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.546 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.99 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19645463]
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6867	Asparagus curillus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6867	Asparagus curillus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO6867	Asparagus curillus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO6867	Asparagus curillus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	4.9	ug.mL-1	PMID[19645463]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC325828 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27185
0.1-0.2	19436
0.2-0.3	2585
0.3-0.4	360
0.4-0.5	145
0.5-0.6	78
0.6-0.7	35
0.7-0.8	0
0.8-0.85	4
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8902	High Similarity	NPC107962
0.8642	High Similarity	NPC250393
0.8434	Intermediate Similarity	NPC107188
0.8132	Intermediate Similarity	NPC97700
0.8132	Intermediate Similarity	NPC184617
0.8132	Intermediate Similarity	NPC30856
0.7952	Intermediate Similarity	NPC234352
0.7931	Intermediate Similarity	NPC6295
0.7882	Intermediate Similarity	NPC206003
0.7882	Intermediate Similarity	NPC473610
0.7831	Intermediate Similarity	NPC297348
0.7831	Intermediate Similarity	NPC249204
0.7831	Intermediate Similarity	NPC48339
0.7831	Intermediate Similarity	NPC141769
0.7831	Intermediate Similarity	NPC477547
0.7586	Intermediate Similarity	NPC19400
0.7551	Intermediate Similarity	NPC132080
0.7442	Intermediate Similarity	NPC477451
0.7419	Intermediate Similarity	NPC92890
0.7386	Intermediate Similarity	NPC211354
0.7363	Intermediate Similarity	NPC160426
0.732	Intermediate Similarity	NPC475625
0.732	Intermediate Similarity	NPC116756
0.7283	Intermediate Similarity	NPC475351
0.7245	Intermediate Similarity	NPC232037
0.7176	Intermediate Similarity	NPC485594
0.7172	Intermediate Similarity	NPC470864
0.7143	Intermediate Similarity	NPC470432
0.7143	Intermediate Similarity	NPC230507
0.7011	Intermediate Similarity	NPC177834
0.6907	Remote Similarity	NPC128572
0.6875	Remote Similarity	NPC477809
0.6863	Remote Similarity	NPC233433
0.6827	Remote Similarity	NPC470866
0.6774	Remote Similarity	NPC125324
0.6768	Remote Similarity	NPC115165
0.6705	Remote Similarity	NPC181845
0.6703	Remote Similarity	NPC121453
0.6702	Remote Similarity	NPC195297
0.6633	Remote Similarity	NPC6806
0.6602	Remote Similarity	NPC83137
0.6598	Remote Similarity	NPC475643
0.6596	Remote Similarity	NPC485595
0.6556	Remote Similarity	NPC294686
0.6552	Remote Similarity	NPC24960
0.6465	Remote Similarity	NPC471464
0.6422	Remote Similarity	NPC220836
0.6381	Remote Similarity	NPC477811
0.63	Remote Similarity	NPC51172
0.63	Remote Similarity	NPC49032
0.6286	Remote Similarity	NPC476112
0.6286	Remote Similarity	NPC307534
0.6238	Remote Similarity	NPC480555
0.6238	Remote Similarity	NPC150372
0.6237	Remote Similarity	NPC222731
0.6211	Remote Similarity	NPC264101
0.6207	Remote Similarity	NPC277715
0.6162	Remote Similarity	NPC473601
0.6154	Remote Similarity	NPC473518
0.6147	Remote Similarity	NPC94086
0.6147	Remote Similarity	NPC473817
0.6117	Remote Similarity	NPC475319
0.6095	Remote Similarity	NPC232611
0.6058	Remote Similarity	NPC475550
0.6	Remote Similarity	NPC202898
0.5981	Remote Similarity	NPC470862
0.598	Remote Similarity	NPC300557
0.5941	Remote Similarity	NPC470433
0.5941	Remote Similarity	NPC46190
0.5941	Remote Similarity	NPC171073
0.5905	Remote Similarity	NPC269297
0.5905	Remote Similarity	NPC222202
0.5889	Remote Similarity	NPC473774
0.5889	Remote Similarity	NPC481419
0.5889	Remote Similarity	NPC481417
0.5872	Remote Similarity	NPC31896
0.5865	Remote Similarity	NPC98018
0.5865	Remote Similarity	NPC284104
0.5865	Remote Similarity	NPC103616
0.5816	Remote Similarity	NPC215408
0.58	Remote Similarity	NPC113044
0.58	Remote Similarity	NPC283829
0.58	Remote Similarity	NPC14704
0.58	Remote Similarity	NPC161676
0.5784	Remote Similarity	NPC602423
0.578	Remote Similarity	NPC480553
0.5755	Remote Similarity	NPC470863
0.5752	Remote Similarity	NPC477807
0.5673	Remote Similarity	NPC249553
0.5612	Remote Similarity	NPC54619
0.5596	Remote Similarity	NPC480554
0.5583	Remote Similarity	NPC481190
0.5567	Remote Similarity	NPC474399
0.5556	Remote Similarity	NPC475333
0.5556	Remote Similarity	NPC32361
0.5556	Remote Similarity	NPC144790
0.5556	Remote Similarity	NPC149400
0.5556	Remote Similarity	NPC248944
0.5556	Remote Similarity	NPC7479
0.5556	Remote Similarity	NPC257296
0.5556	Remote Similarity	NPC224098
0.5556	Remote Similarity	NPC208383
0.5543	Remote Similarity	NPC481420
0.5543	Remote Similarity	NPC481421
0.552	Remote Similarity	NPC481189
0.5517	Remote Similarity	NPC210569
0.5505	Remote Similarity	NPC194207
0.5505	Remote Similarity	NPC22779
0.5495	Remote Similarity	NPC84111
0.5495	Remote Similarity	NPC287483
0.5495	Remote Similarity	NPC470865
0.5429	Remote Similarity	NPC248746
0.5403	Remote Similarity	NPC329807
0.5392	Remote Similarity	NPC141433
0.5361	Remote Similarity	NPC291203
0.5361	Remote Similarity	NPC217205
0.5354	Remote Similarity	NPC329727
0.5351	Remote Similarity	NPC470867
0.5351	Remote Similarity	NPC262050
0.5345	Remote Similarity	NPC224314
0.5327	Remote Similarity	NPC151134
0.5315	Remote Similarity	NPC108072
0.5299	Remote Similarity	NPC477808
0.5285	Remote Similarity	NPC330026
0.5273	Remote Similarity	NPC309278
0.5263	Remote Similarity	NPC232054
0.5259	Remote Similarity	NPC480556
0.5214	Remote Similarity	NPC473505
0.5213	Remote Similarity	NPC481418
0.5181	Remote Similarity	NPC227260
0.5149	Remote Similarity	NPC306131
0.5149	Remote Similarity	NPC200802
0.5124	Remote Similarity	NPC305771
0.5124	Remote Similarity	NPC94072
0.5124	Remote Similarity	NPC169816
0.51	Remote Similarity	NPC40749
0.5093	Remote Similarity	NPC42171
0.5093	Remote Similarity	NPC274200
0.5093	Remote Similarity	NPC182900
0.5088	Remote Similarity	NPC92297
0.5051	Remote Similarity	NPC131693
0.5051	Remote Similarity	NPC475436
0.505	Remote Similarity	NPC128123

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC325828 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7686
0.1-0.2	1358
0.2-0.3	81
0.3-0.4	20
0.4-0.5	1
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Drug ID	Developmental Stage
1.0	High Similarity	NPD8171	Phase 2
0.8353	Intermediate Similarity	NPD8170	Phase 2
0.5556	Remote Similarity	NPD6928	Phase 2
0.5435	Remote Similarity	NPD7991	Discontinued

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data