NPASS Compound

Natural Product: NPC481418

Natural Product ID	NPC481418
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	IHSYMUOQDGPYKS-NHFRSVBPSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 92 98 0 0 0 0 0 0 0 0999 V2000 7.2381 -0.6342 -3.0020 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1013 0.3282 -1.8111 C 0 0 2 0 0 0 0 0 0 0 0 0 7.4176 -0.3189 -0.5129 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3075 -0.4779 0.4564 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0139 0.1763 0.1268 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0050 -0.7417 -0.5130 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5873 -2.1512 -0.7021 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8970 -0.8888 0.4614 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4819 -0.2506 1.7115 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2698 0.3925 2.4070 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0933 -0.1101 1.6115 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1152 0.7805 1.6693 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7166 0.7422 3.0616 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6352 1.9845 3.0453 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7139 1.7954 2.0343 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5914 3.0108 2.0122 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7703 2.7584 1.1358 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5487 1.9306 -0.0739 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6244 0.7315 0.1452 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3079 1.3349 0.6756 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0577 2.4915 -0.2834 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1767 0.3686 0.6948 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5976 0.1495 -0.6933 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6956 -0.5867 -0.7195 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6878 -0.0219 0.2200 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0476 1.3771 -0.1759 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5041 0.0007 -0.9882 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0830 -1.2460 -0.8267 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1209 -1.4740 -1.9132 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0604 -2.5252 -1.3618 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3265 -3.3552 -0.3280 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8694 -3.4693 -0.5823 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2060 -2.3180 -0.9090 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8814 -4.6499 -0.4058 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5303 -3.3464 -2.3748 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7491 -0.3369 -2.3429 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2660 4.0079 0.7348 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4323 0.6386 1.3301 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2616 1.3206 -0.6163 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7949 1.0606 -1.8610 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2625 -1.1026 -3.2385 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9816 -1.4035 -2.6768 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6392 -0.1194 -3.8869 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8984 1.1058 -2.0120 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7902 -1.3598 -0.7618 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3328 0.1449 -0.0335 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0932 -1.5626 0.6971 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6695 -0.0814 1.4529 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6154 -0.3978 -1.4703 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8808 -2.6373 -1.4384 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5088 -2.7520 0.2128 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5613 -2.1414 -1.1838 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5581 -1.9122 0.6425 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8741 -1.0626 2.3519 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2258 0.0180 3.4676 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3381 1.4748 2.4750 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8683 -1.1644 1.8460 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2509 1.8178 1.5375 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0278 0.9045 3.8560 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3022 -0.1728 3.2250 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0151 2.8689 2.9233 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1088 2.0049 4.0481 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3727 0.9791 2.4752 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0657 3.9649 1.8482 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9845 3.1039 3.0721 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5656 2.2383 1.7457 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2516 2.5476 -0.9439 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5787 1.5583 -0.3789 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1287 0.1646 0.9762 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2929 2.1490 -1.3130 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0274 2.8427 -0.3009 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6739 3.3816 -0.0411 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5673 -0.6160 1.0284 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2981 -0.4492 -1.2961 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4847 1.1215 -1.2480 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5948 -1.6720 -0.5306 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1059 -0.4734 -1.7590 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5684 1.3132 -1.1548 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1423 1.9572 -0.3479 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6705 1.9299 0.5256 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5109 -1.3180 0.1959 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5935 -1.9741 -2.7786 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8947 -1.9754 -0.8702 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5762 -2.9990 0.7004 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6948 -4.2382 -1.3711 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3950 -3.8724 0.3515 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7591 -4.6448 -0.8617 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9423 -2.7828 -3.0850 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3329 0.1042 -3.1096 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9311 4.1631 -0.1820 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1191 0.4819 -2.5280 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8911 2.0664 -2.3688 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 19 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 30 35 1 0 29 36 1 0 17 37 1 0 9 38 1 0 5 39 1 6 39 40 1 0 40 2 1 0 38 5 1 0 25 8 1 0 33 28 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 41 1 0 1 42 1 0 1 43 1 0 2 44 1 6 3 45 1 0 3 46 1 0 4 47 1 0 4 48 1 0 6 49 1 6 7 50 1 0 7 51 1 0 7 52 1 0 8 53 1 1 9 54 1 1 10 55 1 0 10 56 1 0 11 57 1 1 12 58 1 6 13 59 1 0 13 60 1 0 14 61 1 0 14 62 1 0 15 63 1 1 16 64 1 0 16 65 1 0 17 66 1 1 18 67 1 0 18 68 1 0 19 69 1 1 21 70 1 0 21 71 1 0 21 72 1 0 22 73 1 1 23 74 1 0 23 75 1 0 24 76 1 0 24 77 1 0 26 78 1 0 26 79 1 0 26 80 1 0 28 81 1 1 29 82 1 6 30 83 1 1 31 84 1 1 32 85 1 0 32 86 1 0 34 87 1 0 35 88 1 0 36 89 1 0 37 90 1 0 40 91 1 0 40 92 1 0 M END

Standard InCHIKey	IHSYMUOQDGPYKS-NHFRSVBPSA-N
Standard InCHI	InChI=1S/C32H52O8/c1-16-7-10-32(38-14-16)17(2)26-24(40-32)13-22-20-6-5-18-11-19(33)12-25(31(18,4)21(20)8-9-30(22,26)3)39-29-28(36)27(35)23(34)15-37-29/h16-29,33-36H,5-15H2,1-4H3/t16-,17+,18+,19-,20-,21+,22+,23+,24+,25-,26+,27+,28-,29+,30+,31+,32+/m1/s1
SMILES	C[C@@H]1CC[C@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC[C@H]6C[C@H](C[C@H]([C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@H](CO3)O)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	564.37	Volume:	572.455 ? Van der Waals volume.
Dense:	0.986	LogP:	4.063 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.14 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.562 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	2.0	Rigid Bonds:	36.0
TPSA:	117.84 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	4.0	Rings:	7.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.404	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.905	Fsp³:	1.0
MCE-18:	170.5 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.757	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.054 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.18	Promiscuous compounds:	0.039

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.606	MDCK Permeability:	-5.103
Pgp-inhibitor:	0.027	Pgp-substrate:	0.607
PAMPA:	0.919 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.059
20% Bioavailability (F20%):	0.741	30% Bioavailability (F30%):	0.834
50% Bioavailability (F50%):	0.997

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.118	MRP1:	0.473
Plasma Protein Binding (PPB):	76.533%	Volume Distribution (VD):	-0.291
Fu:	20.555% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.998	BCRP inhibitor:	0.514
BSEP inhibitor:	0.45

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.026
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.942
HLM stability:	0.238 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

5.242

Half-life (T1/2):

1.843

ADMET: Toxicity

hERG Blockers:	0.081	hERG Blockers (10um):	0.326
Human Hepatotoxicity (H-HT):	0.662	Drug-induced Liver Injury (DILI):	0.712
AMES Toxicity:	0.675	Rat Oral Acute Toxicity:	0.203
Maximum Recommended Daily Dose:	0.765	Skin Sensitization:	1.0
Carcinogencity:	0.876	Eye Corrosion:	0.004
Eye Irritation:	0.256	Respiratory Toxicity:	0.442
Drug-induced Neurotoxicity:	0.04	Ototoxicity:	0.834
Hematotoxicity:	0.094	Drug-induced Nephrotoxicity:	0.825
Genotoxicity:	0.042	RPMI-8226 Immunitoxicity:	0.192
A549 Cytotoxicity:	0.941	Hek293 Cytotoxicity:	0.879
BCF:	2.135 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.76 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.801 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.41 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40087	Cordyline manners-suttoniae	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[31596585]
NPO40087	Cordyline manners-suttoniae	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Ratio IC50	1

Activity Type	# Activity
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	Ratio IC50	=	3.0	n.a.	PMID[31596585]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC481418 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25107
0.1-0.2	22604
0.2-0.3	1829
0.3-0.4	160
0.4-0.5	80
0.5-0.6	51
0.6-0.7	16
0.7-0.8	0
0.8-0.85	5
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8442	Intermediate Similarity	NPC481423
0.8158	Intermediate Similarity	NPC473774
0.8158	Intermediate Similarity	NPC481419
0.8158	Intermediate Similarity	NPC481417
0.8052	Intermediate Similarity	NPC24960
0.6977	Remote Similarity	NPC473616
0.6905	Remote Similarity	NPC481424
0.6905	Remote Similarity	NPC481422
0.6875	Remote Similarity	NPC88962
0.6351	Remote Similarity	NPC248944
0.6351	Remote Similarity	NPC7479
0.6351	Remote Similarity	NPC257296
0.625	Remote Similarity	NPC177834
0.6235	Remote Similarity	NPC481420
0.6235	Remote Similarity	NPC481421
0.6222	Remote Similarity	NPC250393
0.618	Remote Similarity	NPC485591
0.6067	Remote Similarity	NPC13190
0.6044	Remote Similarity	NPC312678
0.6044	Remote Similarity	NPC253268
0.6022	Remote Similarity	NPC264101
0.5714	Remote Similarity	NPC475351
0.5714	Remote Similarity	NPC227260
0.5686	Remote Similarity	NPC294129
0.5684	Remote Similarity	NPC485590
0.5657	Remote Similarity	NPC473601
0.5641	Remote Similarity	NPC296734
0.5517	Remote Similarity	NPC144790
0.5517	Remote Similarity	NPC149400
0.551	Remote Similarity	NPC70204
0.549	Remote Similarity	NPC471464
0.5455	Remote Similarity	NPC277715
0.5437	Remote Similarity	NPC128572
0.5412	Remote Similarity	NPC473830
0.5385	Remote Similarity	NPC97700
0.5385	Remote Similarity	NPC30856
0.5333	Remote Similarity	NPC115165
0.5269	Remote Similarity	NPC481425
0.5269	Remote Similarity	NPC481426
0.5258	Remote Similarity	NPC306131
0.5258	Remote Similarity	NPC211354
0.5258	Remote Similarity	NPC200802
0.5258	Remote Similarity	NPC107188
0.5244	Remote Similarity	NPC481427
0.5234	Remote Similarity	NPC475625
0.5227	Remote Similarity	NPC473469
0.5213	Remote Similarity	NPC297348
0.5213	Remote Similarity	NPC325828
0.5213	Remote Similarity	NPC249204
0.5213	Remote Similarity	NPC48339
0.5213	Remote Similarity	NPC141769
0.5213	Remote Similarity	NPC477547
0.519	Remote Similarity	NPC24556
0.5185	Remote Similarity	NPC232037
0.5169	Remote Similarity	NPC204881
0.5158	Remote Similarity	NPC294686
0.5158	Remote Similarity	NPC234352
0.5152	Remote Similarity	NPC215408
0.5106	Remote Similarity	NPC296936
0.5104	Remote Similarity	NPC477451
0.5098	Remote Similarity	NPC485605
0.5093	Remote Similarity	NPC473518
0.5091	Remote Similarity	NPC476112
0.5091	Remote Similarity	NPC307534
0.5062	Remote Similarity	NPC273290
0.5062	Remote Similarity	NPC232044
0.506	Remote Similarity	NPC305808
0.5059	Remote Similarity	NPC161035
0.5059	Remote Similarity	NPC170438
0.5052	Remote Similarity	NPC222731
0.5049	Remote Similarity	NPC202898
0.5045	Remote Similarity	NPC132080

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC481418 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7519
0.1-0.2	1563
0.2-0.3	62
0.3-0.4	2
0.4-0.5	2
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6351	Remote Similarity	NPD6928	Phase 2
0.5213	Remote Similarity	NPD8171	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data