NPASS Compound

Natural Product: NPC475643

Natural Product ID	NPC475643
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	DLGSQLHEUYGBDG-QCIIDQQFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL510078
PubChem CID	44584284
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 185194 0 0 0 0 0 0 0 0999 V2000 -6.5792 5.3678 -0.0380 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5036 4.6686 -0.5677 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4424 4.8897 -2.0477 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4127 4.2432 -2.6743 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7373 2.9935 -3.2263 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2513 2.1366 -2.2988 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4728 1.0667 -1.9898 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0971 1.0277 -0.5185 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9094 0.3171 -0.4336 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9368 0.9118 0.3618 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5637 -0.0885 1.4060 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7744 -1.2449 0.8392 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3596 -0.8594 -0.0546 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5226 0.6408 -0.1705 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7696 1.2901 -0.5285 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0974 1.2745 1.0484 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8091 0.2670 1.9723 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6201 -0.5987 1.0465 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6098 -1.5379 0.3495 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3880 -2.1645 -0.7881 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5696 -2.9318 -0.2855 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4739 -2.0694 0.5635 C 0 0 1 0 0 0 0 0 0 0 0 0 3.5858 -1.5100 1.6582 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5516 -1.0480 2.6678 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3740 -2.3648 2.7806 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4786 -2.8278 1.3359 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9243 -2.5045 1.0603 C 0 0 2 0 0 0 0 0 0 0 0 0 7.4992 -3.3992 -0.0149 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5463 -2.8407 2.4203 C 0 0 1 0 0 0 0 0 0 0 0 0 6.6139 -2.1888 3.2730 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5210 -4.1924 2.6388 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8226 -4.6193 3.9043 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8592 -2.1688 2.6524 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9258 -2.4861 1.6460 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2244 -1.7691 2.0031 C 0 0 2 0 0 0 0 0 0 0 0 0 11.0980 -0.2920 2.0725 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7332 0.4316 1.0236 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4910 0.6034 -0.0879 C 0 0 2 0 0 0 0 0 0 0 0 0 11.9433 1.9796 -0.0818 O 0 0 0 0 0 0 0 0 0 0 0 0 13.0451 2.0203 -0.9260 C 0 0 2 0 0 0 0 0 0 0 0 0 13.7828 3.3359 -0.7085 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8988 4.3639 -0.9862 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5741 1.9364 -2.3452 C 0 0 2 0 0 0 0 0 0 0 0 0 11.7262 0.7017 -2.5342 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7475 0.4865 -1.3916 C 0 0 1 0 0 0 0 0 0 0 0 0 10.2497 -0.7924 -1.5414 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9708 0.8478 -3.7159 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6832 1.8094 -3.1830 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2955 -2.2170 1.0581 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1117 -1.0148 -0.2647 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0180 -1.3603 -1.4593 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0653 0.3243 0.2012 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3723 0.4877 -0.3278 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4054 -0.4385 -1.5233 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1278 -0.2851 -2.2655 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1652 -1.2459 -1.9784 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5156 -0.3443 -2.3609 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5452 -1.2340 -2.0638 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5782 -2.0361 -3.2341 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4311 -3.0798 -3.2303 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.4365 -3.6300 -4.6706 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8734 -2.6642 -5.5663 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8641 -2.6596 -2.9550 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.8944 -1.1614 -2.9561 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.8969 -0.5775 -1.9557 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.5163 -0.7910 -0.7062 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7071 -0.5930 -4.2107 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2692 -3.1022 -1.6882 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2592 -0.0201 0.8074 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0110 0.7627 1.9054 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7634 0.3717 3.0425 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6379 1.3165 3.4369 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3814 1.9931 4.5996 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4932 3.2205 4.3668 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1526 4.0822 3.4819 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8881 1.1847 5.7254 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3598 -0.1669 5.3846 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7700 -0.1560 4.0147 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4944 -1.5028 3.6611 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4413 -0.6237 6.3498 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8512 1.0528 6.7539 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7049 3.2162 -4.3501 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4274 4.5658 -4.2350 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7673 4.7335 -2.7504 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5524 5.8902 -2.6842 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5919 4.4701 -4.9532 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0459 3.1844 -5.6028 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3775 4.8100 0.0956 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6482 3.6194 -0.3067 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5723 5.0960 -0.1105 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2005 6.0030 -2.1602 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7723 2.6313 -3.6602 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5400 1.0948 -2.5709 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9776 1.9748 -0.0204 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3727 1.8094 0.8415 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1500 0.3216 2.3383 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5551 -0.5398 1.7419 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5208 -1.9093 0.3095 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4441 -1.8679 1.7120 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2155 0.7856 -1.0472 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6095 2.3965 -0.3746 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0244 1.2060 -1.6053 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9429 1.9607 0.7255 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4174 1.9374 1.6107 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5299 0.8541 2.5905 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1217 -0.2959 2.5974 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0660 0.1020 0.3056 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4248 -2.3490 1.0824 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6987 -1.4403 -1.5639 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7296 -2.9136 -1.2952 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3020 -3.8929 0.1774 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1816 -3.1894 -1.2030 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0424 -2.3881 2.0798 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1875 -0.2052 2.3842 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0519 -0.8509 3.6358 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7244 -3.0872 3.3121 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3750 -3.9294 1.2467 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1619 -1.4755 0.8484 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6322 -4.0134 -0.4087 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2408 -4.0868 0.4272 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8975 -2.7544 -0.8195 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8367 -4.3117 4.2145 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7902 -5.7365 3.9850 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1198 -4.2085 4.6799 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1873 -2.4160 3.6950 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6976 -1.0568 2.6627 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1779 -3.5697 1.7038 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6549 -2.1760 0.6484 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5665 -2.1711 3.0195 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1308 0.0898 2.4107 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4571 -0.0196 3.0025 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4370 0.0504 -0.1538 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7427 1.1807 -0.7042 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0167 3.3915 0.3873 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7150 3.3723 -1.3026 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1348 4.7474 -1.8669 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9523 2.8012 -2.5954 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3505 -0.2257 -2.5599 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9110 1.2287 -1.4529 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9356 -0.9358 -2.4867 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7779 0.0130 -4.1702 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1485 0.9741 -2.9149 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9287 -2.2427 0.0209 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2574 -1.6746 1.1853 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4613 -3.3214 1.3051 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4340 -0.5427 -1.0250 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8906 -1.5142 -0.9020 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5198 -0.1568 0.3118 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2491 -2.4345 -1.4633 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8805 -0.8081 -1.7800 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8073 -1.0795 -2.1822 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5619 1.5155 -0.4914 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5023 -1.4320 -1.0353 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2596 -0.3038 -3.3873 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4724 -1.1737 -2.7120 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3717 -1.8959 -1.2271 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2207 -3.9145 -2.5422 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4068 -3.9152 -4.9922 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0783 -4.5151 -4.7742 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5466 -2.7958 -6.4893 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5422 -3.0115 -3.7388 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9060 -0.7812 -2.6179 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8469 0.5113 -2.2166 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4986 0.1265 -0.2727 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2648 0.3025 -4.0570 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6434 -3.8814 -1.5049 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2991 -0.1421 0.5491 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8780 -1.0572 1.0614 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3727 -0.5093 2.6833 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3542 2.4494 4.9279 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3927 3.7853 5.3198 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4972 2.9485 4.0282 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7102 4.0703 2.5795 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0258 1.7300 6.2128 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1889 -0.8986 5.4138 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7852 0.3591 3.9588 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8350 -2.1163 4.3705 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4446 -0.0321 7.1449 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4286 0.2427 6.5985 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5189 2.4461 -4.3914 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7638 5.3961 -4.5240 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3590 3.8762 -2.3995 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3611 6.4625 -1.9018 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3635 4.6681 -4.3745 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4271 2.4656 -6.1690 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 29 31 1 1 31 32 1 0 29 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 44 47 1 0 43 48 1 0 35 49 1 0 22 50 1 6 13 51 1 6 8 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 60 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 64 67 1 0 63 68 1 0 53 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 73 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 77 80 1 0 76 81 1 0 5 82 1 0 82 83 1 0 83 84 1 0 84 85 1 0 83 86 1 0 82 87 1 0 84 3 1 0 55 7 1 0 65 58 1 0 78 71 1 0 15 10 1 0 23 18 1 0 30 25 1 0 45 38 1 0 19 13 1 0 26 22 1 0 1 88 1 0 2 89 1 0 2 90 1 0 3 91 1 1 5 92 1 6 7 93 1 6 8 94 1 1 10 95 1 1 11 96 1 0 11 97 1 0 12 98 1 0 12 99 1 0 14100 1 6 15101 1 0 15102 1 0 16103 1 0 16104 1 0 17105 1 0 17106 1 0 18107 1 6 19108 1 1 20109 1 0 20110 1 0 21111 1 0 21112 1 0 23113 1 1 24114 1 0 24115 1 0 25116 1 1 26117 1 1 27118 1 6 28119 1 0 28120 1 0 28121 1 0 32122 1 0 32123 1 0 32124 1 0 33125 1 0 33126 1 0 34127 1 0 34128 1 0 35129 1 1 36130 1 0 36131 1 0 38132 1 6 40133 1 1 41134 1 0 41135 1 0 42136 1 0 43137 1 6 44138 1 6 45139 1 1 46140 1 0 47141 1 0 48142 1 0 49143 1 0 49144 1 0 49145 1 0 50146 1 0 50147 1 0 50148 1 0 51149 1 0 51150 1 0 51151 1 0 53152 1 6 54153 1 1 55154 1 6 56155 1 0 58156 1 1 60157 1 1 61158 1 0 61159 1 0 62160 1 0 63161 1 6 64162 1 1 65163 1 6 66164 1 0 67165 1 0 68166 1 0 69167 1 0 69168 1 0 71169 1 6 73170 1 1 74171 1 0 74172 1 0 75173 1 0 76174 1 1 77175 1 6 78176 1 1 79177 1 0 80178 1 0 81179 1 0 82180 1 6 83181 1 6 84182 1 1 85183 1 0 86184 1 0 87185 1 0 M END

Standard InCHIKey	DLGSQLHEUYGBDG-QCIIDQQFSA-N
Standard InCHI	InChI=1S/C58H98O29/c1-22(20-77-51-44(71)40(67)36(63)30(16-59)80-51)8-13-58(76-5)23(2)35-29(87-58)15-28-26-7-6-24-14-25(9-11-56(24,3)27(26)10-12-57(28,35)4)79-55-50(86-54-47(74)43(70)39(66)33(19-62)83-54)48(75)49(85-53-46(73)42(69)38(65)32(18-61)82-53)34(84-55)21-78-52-45(72)41(68)37(64)31(17-60)81-52/h22-55,59-75H,6-21H2,1-5H3/t22-,23+,24-,25+,26-,27+,28+,29+,30-,31-,32-,33-,34-,35+,36-,37-,38-,39-,40+,41+,42+,43+,44-,45-,46-,47-,48+,49-,50-,51-,52-,53+,54+,55-,56+,57+,58-/m1/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@H](O[C@H]3CC[C@]4([C@@H](C3)CC[C@@H]3[C@@H]4CC[C@]4([C@H]3C[C@H]3[C@@H]4[C@H](C)[C@@](O3)(OC)CC[C@H](CO[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)C)C)C)O[C@@H]([C@H]([C@@H]2O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)CO[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1258.62	Volume:	1181.076 ? Van der Waals volume.
Dense:	1.066	LogP:	-0.35 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.634 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.94 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	20.0	Rigid Bonds:	54.0
TPSA:	454.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	29.0
H-Bond Donor:	17.0	Rings:	10.0
Heavy Atoms:	29.0

MedChem Properties

QED Drug-Likeness Score:	0.051	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.328	Fsp³:	1.0
MCE-18:	201.379 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.595	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.476	Promiscuous compounds:	0.028

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.144	MDCK Permeability:	-5.02
Pgp-inhibitor:	0.0	Pgp-substrate:	0.473
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.999
20% Bioavailability (F20%):	0.207	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.009	MRP1:	0.001
Plasma Protein Binding (PPB):	37.504%	Volume Distribution (VD):	-0.38
Fu:	45.26% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.71	CYP3A4-substrate:	0.01
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.065
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.054

Half-life (T1/2):

4.446

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.763	Drug-induced Liver Injury (DILI):	0.989
AMES Toxicity:	0.995	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.022	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.419	Drug-induced Nephrotoxicity:	0.988
Genotoxicity:	0.012	RPMI-8226 Immunitoxicity:	0.254
A549 Cytotoxicity:	0.974	Hek293 Cytotoxicity:	0.729
BCF:	1.363 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.383 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.573 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.752 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO28933	Smilax medica	Species	Staphylinidae	Eukaryota	n.a.	n.a.	n.a.	PMID[16252913]
NPO28933	Smilax medica	Species	Staphylinidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO28933	Smilax medica	Species	Staphylinidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	3

Activity Type	# Activity
Organism	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT554	Organism	Candida glabrata	Candida glabrata	Activity	>	200.0	ug ml-1	PMID[18247554]
NPT20	Organism	Candida albicans	Candida albicans	Activity	>	200.0	ug ml-1	PMID[18247554]
NPT186	Organism	Candida tropicalis	Candida tropicalis	Activity	>	200.0	ug ml-1	PMID[23025331]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475643 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26968
0.1-0.2	19664
0.2-0.3	2646
0.3-0.4	352
0.4-0.5	124
0.5-0.6	58
0.6-0.7	28
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9	High Similarity	NPC160426
0.8438	Intermediate Similarity	NPC128572
0.7474	Intermediate Similarity	NPC211354
0.7474	Intermediate Similarity	NPC107188
0.7423	Intermediate Similarity	NPC6295
0.7128	Intermediate Similarity	NPC297348
0.7128	Intermediate Similarity	NPC249204
0.7128	Intermediate Similarity	NPC48339
0.7128	Intermediate Similarity	NPC141769
0.7128	Intermediate Similarity	NPC477547
0.7113	Intermediate Similarity	NPC19400
0.6916	Remote Similarity	NPC116756
0.6852	Remote Similarity	NPC194207
0.6852	Remote Similarity	NPC22779
0.6837	Remote Similarity	NPC206003
0.6837	Remote Similarity	NPC473610
0.6804	Remote Similarity	NPC477451
0.6789	Remote Similarity	NPC470864
0.6699	Remote Similarity	NPC475351
0.6634	Remote Similarity	NPC107962
0.6598	Remote Similarity	NPC325828
0.6549	Remote Similarity	NPC232054
0.6491	Remote Similarity	NPC470866
0.6449	Remote Similarity	NPC471464
0.6364	Remote Similarity	NPC234352
0.625	Remote Similarity	NPC125324
0.625	Remote Similarity	NPC485595
0.619	Remote Similarity	NPC195297
0.6182	Remote Similarity	NPC97700
0.6182	Remote Similarity	NPC30856
0.6161	Remote Similarity	NPC309278
0.6147	Remote Similarity	NPC51172
0.6147	Remote Similarity	NPC49032
0.61	Remote Similarity	NPC177834
0.6078	Remote Similarity	NPC250393
0.6058	Remote Similarity	NPC264101
0.604	Remote Similarity	NPC291203
0.604	Remote Similarity	NPC217205
0.6018	Remote Similarity	NPC475625
0.5965	Remote Similarity	NPC232611
0.5946	Remote Similarity	NPC480555
0.5946	Remote Similarity	NPC150372
0.5893	Remote Similarity	NPC184617
0.5882	Remote Similarity	NPC294686
0.5862	Remote Similarity	NPC470862
0.5812	Remote Similarity	NPC132080
0.5714	Remote Similarity	NPC128123
0.5702	Remote Similarity	NPC475319
0.5676	Remote Similarity	NPC470433
0.5676	Remote Similarity	NPC46190
0.5676	Remote Similarity	NPC171073
0.5625	Remote Similarity	NPC92890
0.5619	Remote Similarity	NPC222731
0.5603	Remote Similarity	NPC475333
0.5603	Remote Similarity	NPC224098
0.5603	Remote Similarity	NPC208383
0.5588	Remote Similarity	NPC485594
0.5586	Remote Similarity	NPC473601
0.5556	Remote Similarity	NPC232037
0.5546	Remote Similarity	NPC480553
0.5462	Remote Similarity	NPC83137
0.5446	Remote Similarity	NPC202898
0.5405	Remote Similarity	NPC113044
0.5405	Remote Similarity	NPC283829
0.5405	Remote Similarity	NPC161676
0.5385	Remote Similarity	NPC269297
0.5385	Remote Similarity	NPC222202
0.5378	Remote Similarity	NPC480554
0.537	Remote Similarity	NPC54619
0.5327	Remote Similarity	NPC474399
0.5323	Remote Similarity	NPC480556
0.5304	Remote Similarity	NPC274200
0.5304	Remote Similarity	NPC300557
0.5299	Remote Similarity	NPC115165
0.5289	Remote Similarity	NPC233433
0.525	Remote Similarity	NPC108072
0.5243	Remote Similarity	NPC24960
0.5238	Remote Similarity	NPC181845
0.5217	Remote Similarity	NPC248746
0.5217	Remote Similarity	NPC477809
0.5214	Remote Similarity	NPC98018
0.5214	Remote Similarity	NPC284104
0.5214	Remote Similarity	NPC103616
0.5172	Remote Similarity	NPC42171
0.5135	Remote Similarity	NPC215408
0.5135	Remote Similarity	NPC485601
0.513	Remote Similarity	NPC485603
0.513	Remote Similarity	NPC602423
0.5128	Remote Similarity	NPC151134
0.5126	Remote Similarity	NPC470863
0.5088	Remote Similarity	NPC485605
0.5085	Remote Similarity	NPC73243
0.5085	Remote Similarity	NPC244086
0.5085	Remote Similarity	NPC84956
0.5044	Remote Similarity	NPC141433
0.504	Remote Similarity	NPC470867
0.5039	Remote Similarity	NPC224314

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475643 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7714
0.1-0.2	1360
0.2-0.3	68
0.3-0.4	3
0.4-0.5	3
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6598	Remote Similarity	NPD8171	Phase 2
0.5648	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data