NPASS Compound

Natural Product: NPC480555

Natural Product ID	NPC480555
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	OLAMGHNQGZIWHZ-WUTVBGSCSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44576182
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 134142 0 0 0 0 0 0 0 0999 V2000 12.4493 1.5081 1.4656 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0194 1.2156 1.0820 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0956 2.3703 1.3190 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1823 2.6471 0.1424 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6806 1.3383 -0.3650 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7357 1.4782 -1.5355 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5456 1.4212 -2.8239 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9296 0.2438 -1.4385 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4337 -0.4049 -0.1444 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2503 -1.1255 0.4636 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1784 -0.9485 -0.5735 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7803 -0.9974 -0.0813 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5444 -2.3576 0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0991 -2.4876 0.8291 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1308 -1.8270 0.1924 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2559 -2.0867 0.6089 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1106 -2.3187 -0.6051 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3016 -2.3891 -1.8720 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5457 -1.1634 -2.0738 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4013 -0.8495 -0.8726 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9106 0.5055 -0.3449 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8601 -0.7780 -1.2491 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1752 0.4603 -2.0072 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6165 0.6664 -2.2861 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4843 0.4499 -1.0704 C 0 0 2 0 0 0 0 0 0 0 0 0 5.2397 1.4319 0.0172 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1609 -1.4213 -0.6917 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4148 -1.9404 -0.6384 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0267 -1.4410 0.6895 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0523 0.0397 0.5938 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.6824 0.5207 -0.6568 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5943 -0.3437 -1.8597 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5381 0.2751 -2.8006 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8386 1.6157 -3.0233 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2260 -1.6431 -1.6913 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0323 0.7775 -0.3782 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3671 2.0960 -0.5391 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4253 2.2461 -1.5952 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5990 3.0782 -1.1350 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.1556 4.3404 -0.4202 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8720 4.0904 0.2961 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6915 4.9523 1.5254 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7440 6.2984 1.1706 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8241 2.7210 0.6301 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1056 5.4211 -1.2887 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4648 2.3436 -0.3305 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9306 2.8629 -2.7583 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7387 0.5650 0.6669 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2654 -1.9738 0.8945 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3357 -2.8279 2.0190 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3970 -2.3105 2.9191 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0886 -3.3642 3.7573 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3312 -4.6143 2.9721 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0062 -5.0324 2.3633 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9604 -5.3834 3.3681 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6575 -4.0704 1.4538 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1976 -4.3300 1.9243 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3990 -3.6390 4.9318 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9153 -1.3560 3.8094 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8205 0.7237 0.5765 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6536 0.4205 -0.6637 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9454 0.8268 -0.3727 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0229 0.5667 1.3117 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5427 1.7495 2.5386 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9249 2.2701 0.8267 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7146 0.2990 1.6613 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4627 2.0971 2.2077 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6467 3.2767 1.6250 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3070 3.2170 0.5503 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6879 3.2185 -0.6325 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1805 2.4147 -1.5448 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1524 2.3401 -2.9673 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8339 1.3471 -3.6688 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1794 0.5006 -2.8611 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9622 -0.4381 -2.2845 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2941 -1.0640 -0.3056 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9992 -0.8034 1.4686 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5146 -2.2090 0.4939 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3082 -1.6816 -1.3924 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5312 -0.2390 0.6784 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8603 -3.1391 -0.1553 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1578 -2.3602 1.4802 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8508 -3.2019 1.6329 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6660 -1.2468 1.2372 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2529 -2.9840 1.2863 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5725 -3.3186 -0.4869 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9392 -2.4649 -2.7741 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3699 -3.2658 -1.8818 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0424 -0.2867 -2.4154 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2342 -1.3817 -2.9151 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0791 0.3493 0.1250 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5915 0.8750 0.4291 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7478 1.2200 -1.1743 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0295 -1.6431 -1.9558 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6590 0.3675 -3.0116 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7947 1.3966 -1.5019 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7627 1.6964 -2.6556 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9588 -0.0246 -3.0685 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1411 0.9920 1.0397 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9865 2.2376 0.0983 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2607 1.9627 -0.1943 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4292 -3.0669 -0.5293 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2653 -1.7516 1.4507 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5491 0.4708 1.5097 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2640 1.5323 -0.9320 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5357 -0.2603 -2.5015 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6633 -0.2559 -3.7687 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5203 0.1342 -2.3919 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0631 1.7745 -3.9692 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5029 2.7299 -0.8690 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8077 1.2656 -1.9214 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1744 3.3974 -2.0277 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9354 4.5738 0.3631 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0373 4.3223 -0.3911 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7113 4.7515 1.9945 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5407 4.7443 2.2072 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2868 6.8528 1.8685 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3397 6.2394 -0.7629 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6480 2.8610 0.4738 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9823 3.8490 -2.6208 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3861 0.4580 1.6058 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3629 -2.8445 2.5061 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2214 -1.8527 2.2993 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0901 -2.9669 4.0688 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7096 -5.4173 3.6265 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2161 -5.9599 1.7759 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1517 -5.9170 2.8364 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4595 -6.0420 4.1347 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4977 -4.5228 3.8735 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9032 -4.8373 1.1213 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0101 -4.1701 5.5098 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7102 -0.9852 4.3117 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2314 1.7340 -0.9538 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6243 -0.0085 -0.6394 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 40 45 1 0 39 46 1 0 38 47 1 0 30 48 1 0 29 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 54 56 1 0 53 57 1 0 52 58 1 0 51 59 1 0 9 60 1 0 5 61 1 6 61 62 1 0 62 2 1 0 60 5 1 0 25 8 1 0 35 28 1 0 44 37 1 0 56 50 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 1 3 67 1 0 3 68 1 0 4 69 1 0 4 70 1 0 6 71 1 1 7 72 1 0 7 73 1 0 7 74 1 0 8 75 1 6 9 76 1 6 10 77 1 0 10 78 1 0 11 79 1 6 12 80 1 1 13 81 1 0 13 82 1 0 14 83 1 0 16 84 1 0 16 85 1 0 17 86 1 1 18 87 1 0 18 88 1 0 19 89 1 0 19 90 1 0 21 91 1 0 21 92 1 0 21 93 1 0 22 94 1 6 23 95 1 0 23 96 1 0 24 97 1 0 24 98 1 0 26 99 1 0 26100 1 0 26101 1 0 28102 1 1 29103 1 1 30104 1 1 31105 1 6 32106 1 6 33107 1 0 33108 1 0 34109 1 0 37110 1 6 38111 1 6 39112 1 6 40113 1 1 41114 1 6 42115 1 0 42116 1 0 43117 1 0 45118 1 0 46119 1 0 47120 1 0 48121 1 0 50122 1 1 51123 1 6 52124 1 1 53125 1 1 54126 1 6 55127 1 0 55128 1 0 55129 1 0 57130 1 0 58131 1 0 59132 1 0 62133 1 0 62134 1 0 M END

Standard InCHIKey	OLAMGHNQGZIWHZ-WUTVBGSCSA-N
Standard InCHI	InChI=1S/C45H72O17/c1-19-8-13-45(55-18-19)20(2)30-27(62-45)15-26-24-7-6-22-14-23(9-11-43(22,4)25(24)10-12-44(26,30)5)57-42-39(61-40-35(52)33(50)31(48)21(3)56-40)37(54)38(29(17-47)59-42)60-41-36(53)34(51)32(49)28(16-46)58-41/h6,19-21,23-42,46-54H,7-18H2,1-5H3/t19-,20-,21-,23-,24+,25-,26-,27-,28+,29+,30-,31-,32+,33+,34-,35+,36+,37-,38+,39+,40-,41-,42+,43-,44-,45+/m0/s1
SMILES	C[C@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H](CC[C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	884.48	Volume:	856.665 ? Van der Waals volume.
Dense:	1.032	LogP:	2.115 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.073 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.945 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	48.0
TPSA:	255.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.148	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.688	Fsp³:	0.956
MCE-18:	229.091 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.731	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.242	Promiscuous compounds:	0.012

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.273	MDCK Permeability:	-5.001
Pgp-inhibitor:	0.0	Pgp-substrate:	0.701
PAMPA:	0.985 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.077	30% Bioavailability (F30%):	0.991
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.009
Plasma Protein Binding (PPB):	63.99%	Volume Distribution (VD):	-0.37
Fu:	27.631% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.409
BSEP inhibitor:	0.04

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.999	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.888
HLM stability:	0.084 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.297

Half-life (T1/2):

3.166

ADMET: Toxicity

hERG Blockers:	0.023	hERG Blockers (10um):	0.066
Human Hepatotoxicity (H-HT):	0.467	Drug-induced Liver Injury (DILI):	0.966
AMES Toxicity:	0.875	Rat Oral Acute Toxicity:	0.005
Maximum Recommended Daily Dose:	0.007	Skin Sensitization:	1.0
Carcinogencity:	0.049	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.172	Drug-induced Nephrotoxicity:	0.655
Genotoxicity:	0.002	RPMI-8226 Immunitoxicity:	0.276
A549 Cytotoxicity:	0.736	Hek293 Cytotoxicity:	0.724
BCF:	1.818 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.487 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.739 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.101 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40795	Balanites aegyptica	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[1812210]
NPO40795	Balanites aegyptica	Species	n.a.	n.a.	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT168	Cell line	P388	Mus musculus	ED50	=	0.21	ug ml-1	PMID[1812210]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC480555 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24495
0.1-0.2	21768
0.2-0.3	2642
0.3-0.4	701
0.4-0.5	96
0.5-0.6	68
0.6-0.7	30
0.7-0.8	0
0.8-0.85	8
0.85-0.9	10
0.9-0.95	3
0.95-1	4

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC150372
0.9667	High Similarity	NPC470433
0.9667	High Similarity	NPC46190
0.9667	High Similarity	NPC171073
0.9184	High Similarity	NPC480553
0.9062	High Similarity	NPC269297
0.9062	High Similarity	NPC222202
0.898	High Similarity	NPC480554
0.8969	High Similarity	NPC475333
0.8969	High Similarity	NPC224098
0.8969	High Similarity	NPC208383
0.8936	High Similarity	NPC248746
0.8878	High Similarity	NPC194207
0.8878	High Similarity	NPC22779
0.8511	High Similarity	NPC113044
0.8511	High Similarity	NPC283829
0.8511	High Similarity	NPC161676
0.8454	Intermediate Similarity	NPC42171
0.8447	Intermediate Similarity	NPC232054
0.8381	Intermediate Similarity	NPC480556
0.8265	Intermediate Similarity	NPC300557
0.8131	Intermediate Similarity	NPC224314
0.8105	Intermediate Similarity	NPC470432
0.8105	Intermediate Similarity	NPC230507
0.8061	Intermediate Similarity	NPC602423
0.798	Intermediate Similarity	NPC477809
0.7917	Intermediate Similarity	NPC6295
0.7912	Intermediate Similarity	NPC181845
0.7864	Intermediate Similarity	NPC32361
0.7864	Intermediate Similarity	NPC13193
0.7604	Intermediate Similarity	NPC19400
0.7576	Intermediate Similarity	NPC14704
0.7568	Intermediate Similarity	NPC477808
0.7549	Intermediate Similarity	NPC6806
0.7404	Intermediate Similarity	NPC73243
0.7404	Intermediate Similarity	NPC244086
0.7404	Intermediate Similarity	NPC84956
0.7374	Intermediate Similarity	NPC94272
0.7374	Intermediate Similarity	NPC485595
0.7358	Intermediate Similarity	NPC309278
0.7308	Intermediate Similarity	NPC475182
0.7264	Intermediate Similarity	NPC247037
0.7212	Intermediate Similarity	NPC124677
0.7129	Intermediate Similarity	NPC195297
0.7103	Intermediate Similarity	NPC475550
0.7091	Intermediate Similarity	NPC477811
0.7064	Intermediate Similarity	NPC249265
0.7	Intermediate Similarity	NPC23808
0.7	Intermediate Similarity	NPC87998
0.6961	Remote Similarity	NPC141433
0.6893	Remote Similarity	NPC305423
0.6726	Remote Similarity	NPC308140
0.6636	Remote Similarity	NPC122819
0.66	Remote Similarity	NPC477451
0.6571	Remote Similarity	NPC160426
0.6422	Remote Similarity	NPC471464
0.6408	Remote Similarity	NPC306131
0.6408	Remote Similarity	NPC200802
0.64	Remote Similarity	NPC297348
0.64	Remote Similarity	NPC249204
0.64	Remote Similarity	NPC48339
0.64	Remote Similarity	NPC141769
0.64	Remote Similarity	NPC477547
0.6364	Remote Similarity	NPC165439
0.6339	Remote Similarity	NPC486386
0.6296	Remote Similarity	NPC98696
0.6296	Remote Similarity	NPC40440
0.6293	Remote Similarity	NPC31896
0.6286	Remote Similarity	NPC107962
0.6238	Remote Similarity	NPC325828
0.6228	Remote Similarity	NPC254255
0.6216	Remote Similarity	NPC128572
0.62	Remote Similarity	NPC485594
0.6161	Remote Similarity	NPC102016
0.6161	Remote Similarity	NPC95051
0.6154	Remote Similarity	NPC206003
0.6154	Remote Similarity	NPC287885
0.6154	Remote Similarity	NPC473610
0.6095	Remote Similarity	NPC211354
0.5982	Remote Similarity	NPC249553
0.5946	Remote Similarity	NPC475643
0.5946	Remote Similarity	NPC265275
0.5935	Remote Similarity	NPC210569
0.5905	Remote Similarity	NPC222731
0.5897	Remote Similarity	NPC218571
0.5897	Remote Similarity	NPC487615
0.5872	Remote Similarity	NPC70204
0.5772	Remote Similarity	NPC477807
0.5766	Remote Similarity	NPC475351
0.5729	Remote Similarity	NPC100451
0.5714	Remote Similarity	NPC294686
0.5714	Remote Similarity	NPC234352
0.5702	Remote Similarity	NPC182900
0.5669	Remote Similarity	NPC305771
0.5669	Remote Similarity	NPC94072
0.5669	Remote Similarity	NPC169816
0.5652	Remote Similarity	NPC150057
0.5652	Remote Similarity	NPC147753
0.5648	Remote Similarity	NPC107188
0.5614	Remote Similarity	NPC469348
0.5603	Remote Similarity	NPC97700
0.5603	Remote Similarity	NPC184617
0.5603	Remote Similarity	NPC30856
0.5575	Remote Similarity	NPC42482
0.5575	Remote Similarity	NPC486388
0.5521	Remote Similarity	NPC235126
0.5521	Remote Similarity	NPC242419
0.5495	Remote Similarity	NPC125324
0.5495	Remote Similarity	NPC15249
0.5495	Remote Similarity	NPC306991
0.5495	Remote Similarity	NPC25455
0.5478	Remote Similarity	NPC92890
0.547	Remote Similarity	NPC294129
0.5463	Remote Similarity	NPC250393
0.5462	Remote Similarity	NPC475625
0.5455	Remote Similarity	NPC83137
0.5433	Remote Similarity	NPC15918
0.5426	Remote Similarity	NPC263359
0.5392	Remote Similarity	NPC277715
0.5299	Remote Similarity	NPC274200
0.5294	Remote Similarity	NPC144790
0.5294	Remote Similarity	NPC149400
0.5285	Remote Similarity	NPC132080
0.5263	Remote Similarity	NPC470748
0.5191	Remote Similarity	NPC244431
0.5189	Remote Similarity	NPC486114
0.5175	Remote Similarity	NPC475670
0.5172	Remote Similarity	NPC473601
0.5172	Remote Similarity	NPC197231
0.5169	Remote Similarity	NPC51172
0.5169	Remote Similarity	NPC49032
0.5167	Remote Similarity	NPC115165
0.5133	Remote Similarity	NPC295980
0.513	Remote Similarity	NPC600116
0.51	Remote Similarity	NPC486119
0.5094	Remote Similarity	NPC24960
0.5089	Remote Similarity	NPC54619
0.5086	Remote Similarity	NPC112274
0.5086	Remote Similarity	NPC19888
0.5082	Remote Similarity	NPC116756
0.5046	Remote Similarity	NPC272015
0.5043	Remote Similarity	NPC161738
0.5042	Remote Similarity	NPC48886
0.5042	Remote Similarity	NPC94881
0.5041	Remote Similarity	NPC232037
0.5041	Remote Similarity	NPC63609
0.5041	Remote Similarity	NPC475319

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC480555 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7689
0.1-0.2	1378
0.2-0.3	72
0.3-0.4	6
0.4-0.5	1
0.5-0.6	2
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6636	Remote Similarity	NPD8449	Approved
0.6238	Remote Similarity	NPD8171	Phase 2
0.5652	Remote Similarity	NPD8450	Suspended
0.5636	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data