NPASS Compound

Natural Product: NPC469348

Natural Product ID	NPC469348
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HUBNBJFMVUTHNC-KUYDPMQHSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1076251
PubChem CID	46879595
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 134142 0 0 0 0 0 0 0 0999 V2000 11.2866 -2.9652 -1.2636 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4457 -1.9372 -0.5741 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2158 -0.6619 -0.3291 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3270 0.5026 -0.6671 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9139 0.3798 -0.2427 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6383 0.3270 1.2162 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3314 1.0618 1.3731 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0995 1.6655 0.0241 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2448 1.5133 -0.7383 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0038 0.8931 -0.6493 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2953 0.1372 0.4449 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1457 0.2117 1.6815 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3583 0.9184 2.7676 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0147 0.2974 3.0423 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2472 -0.0423 1.7688 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9111 0.7162 0.6688 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0908 0.6133 -0.5773 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8597 1.5013 -0.3046 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1003 0.6566 0.7054 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1657 0.3819 0.5067 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0707 -0.4185 1.3611 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3409 -1.1356 2.4628 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1433 -1.1835 2.2583 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7675 0.1385 1.9030 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3865 1.1011 3.0371 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7246 -1.2780 0.4773 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1251 -1.0626 0.4418 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4864 -0.4749 -0.9498 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4897 -1.4231 -1.6225 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6341 -1.7390 -0.6905 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0271 -2.4409 0.5198 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6813 -2.2931 0.5542 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7478 -2.1009 1.7995 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5394 -0.7912 2.2080 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4725 -2.5977 -1.3937 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7876 -2.1476 -1.4874 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1835 -1.9070 -2.9327 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6881 -1.7346 -2.9667 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2798 -1.5592 -1.5884 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8487 -2.6446 -0.6469 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5969 -3.1455 -0.9815 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8242 -3.8281 -0.7297 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1051 -0.2788 -1.0783 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2867 -2.8740 -3.5301 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7921 -2.9258 -3.7726 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8457 -0.9473 -2.8398 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7123 0.7568 -0.9900 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9191 1.9743 -1.0399 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1798 2.7117 0.3028 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6250 4.1057 0.0478 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5520 4.5661 -1.3727 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0621 3.5358 -2.3348 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1251 2.2647 -1.7700 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4783 3.9021 -2.7411 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2605 5.0391 -1.7127 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9132 5.0442 0.8284 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1609 1.9920 0.9872 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4952 -1.1514 2.1965 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5006 2.1027 2.2905 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7089 0.9876 2.0709 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3599 -0.7731 -0.8090 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2797 -1.5616 -1.4723 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0635 -2.9883 -2.3647 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3760 -2.8085 -1.1468 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9974 -3.9906 -0.9091 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0848 -2.3332 0.3959 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6226 -0.6187 0.7020 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0496 -0.6718 -1.0870 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8284 1.4328 -0.3203 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3659 0.6070 -1.7984 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5241 -0.6964 1.6100 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8237 2.7459 0.1398 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3557 0.2056 -1.4443 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3727 1.6444 -1.1644 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1465 -0.9299 0.1430 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9551 0.8766 3.6984 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2663 1.9970 2.5015 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1295 -0.6084 3.6996 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4537 1.0367 3.6578 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4654 -1.1330 1.5845 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0621 1.7978 0.8908 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5693 0.8695 -1.5126 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6855 -0.4301 -0.6548 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2820 1.6767 -1.2024 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2268 2.4064 0.2149 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6169 0.7985 -0.4130 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8243 0.2378 1.8161 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5420 -0.6826 3.4640 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6857 -2.2014 2.5531 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4752 -2.0168 1.5783 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5882 -1.4617 3.2613 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8786 2.0900 2.9178 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2918 1.3168 2.8908 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4854 0.6604 4.0249 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3177 -0.3226 1.2110 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5321 -0.7155 -1.5507 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9732 -2.4158 -1.7871 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2362 -0.8661 -0.3872 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1974 -3.5660 0.4017 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8674 -2.1962 1.6632 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5178 -2.8357 2.6032 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3703 -0.7235 3.1826 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9679 -1.2150 -0.9594 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7397 -0.9690 -3.3252 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9707 -0.8176 -3.5601 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3962 -1.6850 -1.7232 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7844 -2.3279 0.4107 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2910 -4.7804 -0.5752 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5971 -3.6356 0.0522 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3849 -3.8147 -1.6973 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8202 -0.0555 -0.4201 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0648 -2.6295 -4.0925 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5546 -3.2779 -4.3285 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4944 -0.2194 -2.8291 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1842 2.6741 -1.5443 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2595 2.7425 0.9196 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6871 4.2075 0.3906 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1978 5.4758 -1.4569 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4487 3.4860 -3.2569 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7891 3.3469 -3.6536 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6238 4.9962 -2.8279 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1608 3.5705 -1.9290 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7216 5.1676 -0.8822 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1957 4.8564 1.7736 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7759 1.6489 0.2697 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5537 -1.6390 2.5889 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8587 -1.8424 1.4105 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1823 -1.1648 3.0402 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1974 2.9491 1.9023 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1802 1.4659 2.9465 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3477 0.2165 2.5357 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2341 1.8079 1.5780 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7493 -2.5222 -1.6988 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6229 -1.1787 -2.4357 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 21 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 30 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 40 42 1 0 39 43 1 0 38 44 1 0 37 45 1 0 29 46 1 0 28 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 51 55 1 0 50 56 1 0 49 57 1 0 12 58 1 0 7 59 1 0 6 60 1 0 5 61 1 0 61 62 1 0 62 2 1 0 9 5 1 0 12 7 1 0 16 11 1 0 24 15 1 0 24 19 1 0 32 27 1 0 41 36 1 0 53 48 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 0 3 67 1 0 3 68 1 0 4 69 1 0 4 70 1 0 6 71 1 0 8 72 1 0 10 73 1 0 10 74 1 0 11 75 1 0 13 76 1 0 13 77 1 0 14 78 1 0 14 79 1 0 15 80 1 0 16 81 1 0 17 82 1 0 17 83 1 0 18 84 1 0 18 85 1 0 20 86 1 0 21 87 1 0 22 88 1 0 22 89 1 0 23 90 1 0 23 91 1 0 25 92 1 0 25 93 1 0 25 94 1 0 27 95 1 0 28 96 1 0 29 97 1 0 30 98 1 0 31 99 1 0 33100 1 0 33101 1 0 34102 1 0 36103 1 0 37104 1 0 38105 1 0 39106 1 0 40107 1 0 42108 1 0 42109 1 0 42110 1 0 43111 1 0 44112 1 0 45113 1 0 46114 1 0 48115 1 0 49116 1 0 50117 1 0 51118 1 0 52119 1 0 54120 1 0 54121 1 0 54122 1 0 55123 1 0 56124 1 0 57125 1 0 58126 1 0 58127 1 0 58128 1 0 59129 1 0 60130 1 0 60131 1 0 60132 1 0 62133 1 0 62134 1 0 M END

Standard InCHIKey	HUBNBJFMVUTHNC-KUYDPMQHSA-N
Standard InCHI	InChI=1S/C45H72O17/c1-19-9-14-44(55-18-19)22(4)45(54)29(62-44)16-27-25-8-7-23-15-24(10-12-42(23,5)26(25)11-13-43(27,45)6)58-41-38(61-40-35(52)33(50)31(48)21(3)57-40)36(53)37(28(17-46)59-41)60-39-34(51)32(49)30(47)20(2)56-39/h15,19-22,24-41,46-54H,7-14,16-18H2,1-6H3/t19-,20+,21+,22-,24+,25-,26+,27+,28-,29+,30+,31+,32-,33-,34-,35-,36+,37-,38-,39+,40+,41-,42+,43+,44-,45-/m1/s1
SMILES	CC1CCC2(C(C3(C(O2)CC4C3(CCC5C4CCC6=CC(CCC56C)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)O)C)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	884.48	Volume:	856.665 ? Van der Waals volume.
Dense:	1.032	LogP:	0.966 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.707 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.366 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	48.0
TPSA:	255.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.157	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.837	Fsp³:	0.956
MCE-18:	236.727 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.008	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.018 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.349 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.377	Promiscuous compounds:	0.007

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.506	MDCK Permeability:	-4.748
Pgp-inhibitor:	0.0	Pgp-substrate:	0.999
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.945
20% Bioavailability (F20%):	0.857	30% Bioavailability (F30%):	0.992
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	1.0
Plasma Protein Binding (PPB):	55.49%	Volume Distribution (VD):	-0.443
Fu:	22.556% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.044	BCRP inhibitor:	0.003
BSEP inhibitor:	0.065

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.991	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.913	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.018	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.003
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.342

Half-life (T1/2):

4.354

ADMET: Toxicity

hERG Blockers:	0.148	hERG Blockers (10um):	0.668
Human Hepatotoxicity (H-HT):	0.594	Drug-induced Liver Injury (DILI):	0.252
AMES Toxicity:	0.507	Rat Oral Acute Toxicity:	0.436
Maximum Recommended Daily Dose:	0.567	Skin Sensitization:	0.004
Carcinogencity:	0.091	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.015
Drug-induced Neurotoxicity:	0.573	Ototoxicity:	1.0
Hematotoxicity:	0.012	Drug-induced Nephrotoxicity:	0.012
Genotoxicity:	0.007	RPMI-8226 Immunitoxicity:	0.217
A549 Cytotoxicity:	0.084	Hek293 Cytotoxicity:	0.896
BCF:	1.415 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.001 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.876 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.598 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO12084	Dioscorea bulbifera	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1007/s00299-005-0945-9]
NPO12084	Dioscorea bulbifera	Species	Dioscoreaceae	Eukaryota	rhizomes	n.a.	n.a.	PMID[19842682]
NPO12084	Dioscorea bulbifera	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12084	Dioscorea bulbifera	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO12084	Dioscorea bulbifera	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12084	Dioscorea bulbifera	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO12084	Dioscorea bulbifera	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1
Activity	1

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT659	Cell line	SMMC-7721	Homo sapiens	IC50	=	4850.0	nM	PMID[12828466]
NPT181	Cell line	Bel-7402	Homo sapiens	Activity	=	92.6	%	PMID[12828466]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC469348 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24941
0.1-0.2	22225
0.2-0.3	2357
0.3-0.4	257
0.4-0.5	43
0.5-0.6	27
0.6-0.7	3
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8229	Intermediate Similarity	NPC469347
0.7879	Intermediate Similarity	NPC124677
0.6698	Remote Similarity	NPC274200
0.6571	Remote Similarity	NPC40440
0.6111	Remote Similarity	NPC42482
0.5766	Remote Similarity	NPC470433
0.5766	Remote Similarity	NPC46190
0.5766	Remote Similarity	NPC171073
0.5614	Remote Similarity	NPC480555
0.5614	Remote Similarity	NPC150372
0.5603	Remote Similarity	NPC486386
0.5566	Remote Similarity	NPC474399
0.5508	Remote Similarity	NPC254255
0.547	Remote Similarity	NPC269297
0.547	Remote Similarity	NPC222202
0.5439	Remote Similarity	NPC248746
0.5424	Remote Similarity	NPC475333
0.5424	Remote Similarity	NPC224098
0.5424	Remote Similarity	NPC208383
0.5333	Remote Similarity	NPC480554
0.5285	Remote Similarity	NPC167183
0.5246	Remote Similarity	NPC480553
0.5182	Remote Similarity	NPC19400
0.5167	Remote Similarity	NPC32361
0.5167	Remote Similarity	NPC13193
0.5128	Remote Similarity	NPC42171
0.5124	Remote Similarity	NPC194207
0.5124	Remote Similarity	NPC22779
0.5094	Remote Similarity	NPC165439
0.5044	Remote Similarity	NPC485595
0.5044	Remote Similarity	NPC6295
0.5039	Remote Similarity	NPC480556

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC469348 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7802
0.1-0.2	1247
0.2-0.3	94
0.3-0.4	6
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data