NPASS Compound

Natural Product: NPC481189

Natural Product ID	NPC481189
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	UYMLYHRFNDDUHL-ZEHSGGMZSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	46881048
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 229242 0 0 0 0 0 0 0 0999 V2000 0.7594 5.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3213 4.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3250 2.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8615 1.5254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2760 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3907 1.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0323 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9140 -1.9635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0323 -3.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3442 -4.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7707 -5.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0826 -6.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9679 -7.5787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2798 -9.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1650 -10.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2615 -9.5861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5734 -8.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5413 -7.1152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8853 -6.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2294 -5.6480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1971 -5.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5090 -3.7172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 -2.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7646 -2.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4608 -11.3741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2557 -12.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2977 -13.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2619 -12.5761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2261 -11.4270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5935 -15.0496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1163 -14.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0925 -13.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5479 -13.6666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0116 -16.2854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3365 -16.9430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6847 -17.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8031 -18.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4132 -20.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9049 -20.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7866 -19.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1765 -17.7573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0302 -18.2889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3784 -18.9464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7918 -17.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2473 -17.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2893 -18.2207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8758 -19.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4204 -20.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1768 -20.8642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9804 -21.1589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3286 -21.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4470 -23.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0571 -24.4003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1617 -25.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2663 -27.3930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5488 -24.5571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.4305 -23.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8204 -21.9732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7158 -20.4769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.9593 -19.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9173 -18.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3308 -17.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7862 -16.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8282 -17.8333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.4148 -19.2752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.0298 -15.9155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.2262 -15.6209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5692 -17.9015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.6741 -22.5048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.0223 -23.1623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4357 -21.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.3311 -20.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.2265 -18.7277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.8912 -21.3576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 18.9332 -22.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.5197 -23.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0643 -24.2413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8207 -25.0801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 18.6243 -25.3748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 19.9725 -26.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.0908 -27.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.7009 -28.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.1927 -28.7730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.0744 -27.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.3180 -26.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.4643 -26.1892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 22.5409 -29.4306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 19.8056 -30.1125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.8473 -28.0847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 20.2813 -23.0941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2034 -23.8688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6872 -16.0082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2531 -20.9987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5178 -21.6807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2742 -22.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3162 -23.5985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9028 -25.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4473 -25.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5947 -24.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9428 -23.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2910 -23.0092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1812 -22.8824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7962 -26.2421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0074 -26.5368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6644 -24.2561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5595 -19.6529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0323 0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6094 2.3282 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1459 3.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1975 6.8482 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1502 6.0194 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6895 5.0693 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5934 4.8616 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2485 4.1340 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7254 2.4145 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3613 1.4993 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0813 0.7591 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4680 -0.6337 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7152 1.7078 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3944 -0.1110 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6866 2.3282 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8907 -1.3181 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3917 -0.1160 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1427 -1.1032 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2384 -2.6677 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4995 -3.4889 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6560 -6.1115 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2698 -5.0554 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3327 -3.7171 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1617 -7.6169 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4734 -6.0131 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3945 -8.0422 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0746 -10.3180 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7652 -8.8373 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3471 -10.9731 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7606 -9.6385 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6498 -11.0350 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7714 -7.2163 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8853 -8.8461 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3119 -6.1881 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8294 -7.8173 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1459 -5.1745 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0824 -4.1807 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6962 -5.2368 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9245 -6.4963 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7070 -2.8146 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8998 -4.2791 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1991 -1.6649 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3747 -3.4737 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5042 -0.6262 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4377 -11.7226 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5413 -14.5639 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4109 -13.5403 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1128 -11.6119 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7033 -11.6875 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3828 -14.8414 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7735 -11.9672 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5899 -12.5876 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9941 -15.5948 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5196 -18.2010 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0982 -16.1587 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6373 -17.8701 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9577 -20.5473 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6703 -21.8227 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6893 -20.3256 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6512 -20.2584 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3000 -17.3477 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4908 -16.3029 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8088 -15.7072 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3676 -19.8193 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8589 -21.4599 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2814 -22.3606 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7421 -20.3746 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2812 -22.0860 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6567 -24.9379 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6893 -26.1829 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6580 -25.7920 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6145 -28.0505 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3332 -24.5415 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2759 -21.6104 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3979 -21.0726 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0357 -19.7726 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8693 -16.7797 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3477 -15.3199 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.2465 -18.3216 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 16.8513 -16.7363 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.4481 -16.4038 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3582 -14.6367 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2829 -16.4291 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2951 -24.4743 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9439 -21.5636 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.8274 -20.1195 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8587 -20.5103 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.5630 -18.0468 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 19.8148 -21.2230 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 20.0195 -23.8522 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.5028 -25.6758 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.9253 -26.5765 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 20.5587 -24.6516 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.9251 -26.3019 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 18.3006 -29.1538 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 20.7793 -30.2149 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 23.1164 -28.6385 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 24.5615 -25.8819 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 24.1568 -27.9642 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 22.4792 -25.4771 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 22.6456 -30.9269 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 18.5620 -30.9513 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.7687 -29.5826 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 21.5249 -22.2553 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9428 -25.3460 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8192 -15.0241 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3578 -22.4951 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3507 -21.3376 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3393 -22.5015 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3643 -25.3779 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8858 -26.8378 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6177 -25.4213 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7598 -24.9247 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2853 -22.3186 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3957 -21.5128 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2635 -25.9303 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8754 -27.5209 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9507 -25.7285 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2990 -21.1301 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6313 3.9636 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3806 5.2364 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 29 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 49 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 65 68 1 0 64 69 1 0 63 70 1 0 59 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 73 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 78 81 1 0 81 82 1 0 82 83 1 0 83 84 1 0 84 85 1 0 85 86 1 0 86 87 1 0 86 88 1 0 85 89 1 0 84 90 1 0 83 91 1 0 77 92 1 0 54 93 1 0 46 94 1 0 41 95 1 0 40 96 1 0 96 97 1 0 97 98 1 0 98 99 1 0 99100 1 0 100101 1 0 101102 1 0 102103 1 0 101104 1 0 100105 1 0 99106 1 0 98107 1 0 39108 1 0 9109 1 0 5110 1 1 110111 1 0 111 2 1 0 109 5 1 0 25 8 1 0 34 28 1 0 43 38 1 0 50 45 1 0 60 53 1 0 67 62 1 0 79 72 1 0 88 82 1 0 104 97 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1112 1 0 1113 1 0 1114 1 0 2115 1 6 3116 1 0 3117 1 0 4118 1 0 4119 1 0 6120 1 6 7121 1 0 7122 1 0 7123 1 0 8124 1 1 9125 1 1 10126 1 0 10127 1 0 11128 1 1 12129 1 6 13130 1 0 13131 1 0 14132 1 0 14133 1 0 15134 1 1 16135 1 0 16136 1 0 17137 1 1 18138 1 0 18139 1 0 19140 1 0 19141 1 0 21142 1 0 21143 1 0 21144 1 0 22145 1 1 23146 1 0 23147 1 0 24148 1 0 24149 1 0 26150 1 0 26151 1 0 26152 1 0 28153 1 1 29154 1 6 30155 1 0 30156 1 0 31157 1 0 33158 1 1 34159 1 6 35160 1 0 37161 1 0 37162 1 0 38163 1 6 39164 1 1 40165 1 6 41166 1 1 42167 1 6 45168 1 6 46169 1 1 47170 1 0 47171 1 0 49172 1 6 50173 1 1 51174 1 0 53175 1 1 54176 1 6 55177 1 1 56178 1 0 56179 1 0 57180 1 0 59181 1 1 60182 1 6 62183 1 6 63184 1 1 64185 1 6 65186 1 6 66187 1 0 66188 1 0 68189 1 0 69190 1 0 70191 1 0 72192 1 6 73193 1 6 74194 1 0 74195 1 0 75196 1 0 77197 1 6 78198 1 1 79199 1 6 80200 1 0 82201 1 1 83202 1 6 84203 1 6 85204 1 1 86205 1 6 87206 1 0 87207 1 0 87208 1 0 89209 1 0 90210 1 0 91211 1 0 92212 1 0 93213 1 0 94214 1 0 95215 1 0 97216 1 6 98217 1 1 99218 1 6 100219 1 1 101220 1 6 102221 1 0 102222 1 0 103223 1 0 105224 1 0 106225 1 0 107226 1 0 108227 1 0 111228 1 0 111229 1 0 M END

Standard InCHIKey	UYMLYHRFNDDUHL-ZEHSGGMZSA-N
Standard InCHI	InChI=1S/C72H118O39/c1-24-8-13-72(97-20-24)25(2)40-34(111-72)15-31-29-7-6-27-14-28(9-11-70(27,4)30(29)10-12-71(31,40)5)99-57-38(19-76)103-64(53(57)91)96-23-39-45(83)58(107-67-50(88)47(85)43(81)35(16-73)101-67)54(92)68(104-39)105-55-33(78)22-95-65(52(55)90)108-59-44(82)36(17-74)102-69(61(59)110-63-48(86)42(80)32(77)21-94-63)106-56-37(18-75)100-62(93)60(51(56)89)109-66-49(87)46(84)41(79)26(3)98-66/h24-69,73-93H,6-23H2,1-5H3/t24-,25-,26-,27-,28-,29+,30-,31-,32-,33+,34-,35+,36+,37+,38-,39+,40-,41-,42-,43+,44+,45+,46+,47-,48+,49+,50+,51-,52+,53+,54+,55-,56-,57-,58-,59-,60+,61+,62+,63-,64+,65-,66-,67-,68-,69-,70-,71-,72+/m0/s1
SMILES	C[C@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC[C@H]6C[C@H](CC[C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@H](CO)O[C@H]([C@@H]3O)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)O[C@H]3[C@@H](CO[C@H]([C@@H]3O)O[C@H]3[C@@H]([C@@H](CO)O[C@H]([C@@H]3O[C@H]3[C@@H]([C@H]([C@H](CO3)O)O)O)O[C@H]3[C@@H](CO)O[C@H]([C@@H]([C@H]3O)O[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O)O)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1606.73	Volume:	1476.896 ? Van der Waals volume.
Dense:	1.088	LogP:	-0.809 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.174 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.158 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	21.0	Rigid Bonds:	77.0
TPSA:	590.97 ? Topological Polar Surface Area.	H-Bond Acceptor:	39.0
H-Bond Donor:	21.0	Rings:	14.0
Heavy Atoms:	39.0

MedChem Properties

QED Drug-Likeness Score:	0.051	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.873	Fsp³:	1.0
MCE-18:	374.528 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.589	Fluc inhibitor:	0.333 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.467	Promiscuous compounds:	0.102

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-8.084	MDCK Permeability:	-4.37
Pgp-inhibitor:	0.0	Pgp-substrate:	0.998
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.973
20% Bioavailability (F20%):	0.428	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.0
Plasma Protein Binding (PPB):	20.908%	Volume Distribution (VD):	-0.44
Fu:	49.416% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.003
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.791

Half-life (T1/2):

4.459

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.591	Drug-induced Liver Injury (DILI):	0.998
AMES Toxicity:	0.994	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.001	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.765	Drug-induced Nephrotoxicity:	0.998
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.673
A549 Cytotoxicity:	0.996	Hek293 Cytotoxicity:	0.868
BCF:	1.105 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.337 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.669 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.567 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40067	Chlorophytum orchidastrum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20028106]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT393	Cell line	HCT-116	Homo sapiens	IC50	=	7000.0	nM	PMID[20028106]
NPT139	Cell line	HT-29	Homo sapiens	IC50	=	7000.0	nM	PMID[20028106]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC481189 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	32428
0.1-0.2	15018
0.2-0.3	1853
0.3-0.4	390
0.4-0.5	79
0.5-0.6	58
0.6-0.7	23
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
0.9593	High Similarity	NPC329727
0.9587	High Similarity	NPC329807
0.8527	High Similarity	NPC329820
0.7333	Intermediate Similarity	NPC330026
0.7302	Intermediate Similarity	NPC132080
0.7063	Intermediate Similarity	NPC232037
0.6884	Remote Similarity	NPC481190
0.688	Remote Similarity	NPC97700
0.688	Remote Similarity	NPC30856
0.6803	Remote Similarity	NPC475351
0.6746	Remote Similarity	NPC184617
0.6742	Remote Similarity	NPC470866
0.6544	Remote Similarity	NPC220836
0.6439	Remote Similarity	NPC83137
0.6364	Remote Similarity	NPC470864
0.6336	Remote Similarity	NPC475625
0.6336	Remote Similarity	NPC116756
0.6324	Remote Similarity	NPC94086
0.6324	Remote Similarity	NPC473817
0.6316	Remote Similarity	NPC476112
0.6316	Remote Similarity	NPC307534
0.623	Remote Similarity	NPC206003
0.623	Remote Similarity	NPC473610
0.6202	Remote Similarity	NPC51172
0.6202	Remote Similarity	NPC49032
0.6183	Remote Similarity	NPC115165
0.6148	Remote Similarity	NPC233433
0.6094	Remote Similarity	NPC473601
0.6061	Remote Similarity	NPC475319
0.5915	Remote Similarity	NPC210569
0.5854	Remote Similarity	NPC234352
0.5789	Remote Similarity	NPC128572
0.5781	Remote Similarity	NPC6295
0.576	Remote Similarity	NPC250393
0.5735	Remote Similarity	NPC473518
0.5725	Remote Similarity	NPC470862
0.5704	Remote Similarity	NPC480556
0.5693	Remote Similarity	NPC232611
0.5683	Remote Similarity	NPC84111
0.5683	Remote Similarity	NPC287483
0.5683	Remote Similarity	NPC470865
0.5659	Remote Similarity	NPC125324
0.5645	Remote Similarity	NPC177834
0.5597	Remote Similarity	NPC471464
0.5578	Remote Similarity	NPC305771
0.5578	Remote Similarity	NPC94072
0.5578	Remote Similarity	NPC169816
0.5556	Remote Similarity	NPC151134
0.5547	Remote Similarity	NPC211354
0.5547	Remote Similarity	NPC107188
0.5547	Remote Similarity	NPC19400
0.554	Remote Similarity	NPC108072
0.5532	Remote Similarity	NPC31896
0.552	Remote Similarity	NPC325828
0.5481	Remote Similarity	NPC300557
0.5473	Remote Similarity	NPC263359
0.5462	Remote Similarity	NPC107962
0.5455	Remote Similarity	NPC160426
0.5448	Remote Similarity	NPC473505
0.5433	Remote Similarity	NPC477451
0.5374	Remote Similarity	NPC15918
0.5369	Remote Similarity	NPC244431
0.5352	Remote Similarity	NPC480553
0.5347	Remote Similarity	NPC470867
0.5333	Remote Similarity	NPC602423
0.5324	Remote Similarity	NPC470863
0.529	Remote Similarity	NPC98018
0.529	Remote Similarity	NPC284104
0.529	Remote Similarity	NPC103616
0.5276	Remote Similarity	NPC297348
0.5276	Remote Similarity	NPC249204
0.5276	Remote Similarity	NPC48339
0.5276	Remote Similarity	NPC141769
0.5276	Remote Similarity	NPC477547
0.5245	Remote Similarity	NPC477811
0.5238	Remote Similarity	NPC224314
0.5211	Remote Similarity	NPC480554
0.5203	Remote Similarity	NPC273002
0.5177	Remote Similarity	NPC475333
0.5177	Remote Similarity	NPC224098
0.5177	Remote Similarity	NPC309278
0.5177	Remote Similarity	NPC208383
0.5168	Remote Similarity	NPC79900
0.5152	Remote Similarity	NPC264101
0.5149	Remote Similarity	NPC195297
0.5101	Remote Similarity	NPC477808
0.5034	Remote Similarity	NPC262050

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC481189 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8195
0.1-0.2	915
0.2-0.3	31
0.3-0.4	7
0.4-0.5	1
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.552	Remote Similarity	NPD8171	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data