NPASS drugs

Drug Information

Drug ID:	NPD4245
Drug Name:	Drostanolone
Molecular Formula:	C20H32O2
Canonical SMILES:	O=C1C[C@@H]2CC[C@@H]3[C@@H]([C@]2(C[C@H]1C)C)CC[C@]1([C@H]3CC[C@@H]1O)C
Standard InCHI:	InChI=1S/C20H32O2/c1-12-11-20(3)13(10-17(12)21)4-5-14-15-6-7-18(22)19(15,2)9-8-16(14)20/h12-16,18,22H,4-11H2,1-3H3/t12-,13+,14+,15+,16+,18+,19+,20+/m1/s1
Standard InCHIKey:	IKXILDNPCZPPRV-RFMGOVQKSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD4245

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	154
0.1-0.2	1749
0.2-0.3	8833
0.3-0.4	9042
0.4-0.5	4165
0.5-0.6	4079
0.6-0.7	2225
0.7-0.8	513
0.8-0.85	68
0.85-0.9	48
0.9-0.95	11
0.95-1	3

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9846	NPC321732
High Similarity	0.9846	NPC324607
High Similarity	0.9701	NPC310766
High Similarity	0.9275	NPC472854
High Similarity	0.9265	NPC156277
High Similarity	0.9265	NPC151018
High Similarity	0.9265	NPC320549
High Similarity	0.9265	NPC58057
High Similarity	0.9254	NPC327728
High Similarity	0.9254	NPC6120

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD4245 OpenBabel08211704332D 23 26 0 0 1 0 0 0 0 0999 V2000 -5.0578 0.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0003 -1.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5142 0.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6769 2.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8387 2.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6746 0.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6749 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6761 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8379 -0.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3524 2.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3518 0.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1894 1.4497 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5148 2.4178 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8384 1.4506 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0003 0.9671 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6763 0.9666 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1897 2.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8382 -0.4836 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5145 1.4502 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0583 2.9183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8387 -1.4502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5575 -2.0966 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4 5 1 0 0 0 0 4 13 1 0 0 0 0 6 7 1 0 0 0 0 6 15 1 0 0 0 0 7 18 1 0 0 0 0 8 9 1 0 0 0 0 8 16 1 0 0 0 0 9 19 1 0 0 0 0 10 13 1 0 0 0 0 10 17 1 0 0 0 0 11 12 1 0 0 0 0 11 20 1 0 0 0 0 12 1 1 1 0 0 0 12 17 1 0 0 0 0 13 20 1 6 0 0 0 14 5 1 1 0 0 0 14 15 1 0 0 0 0 14 16 1 0 0 0 0 15 19 1 6 0 0 0 16 20 1 6 0 0 0 17 21 2 0 0 0 0 18 19 1 6 0 0 0 18 22 1 0 0 0 0 19 2 1 6 0 0 0 20 3 1 6 0 0 0 22 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000840
DrugBank	DB00858
ChEMBL	CHEMBL1582
IUPHAR/BPS
PharmaGKB	PA164760855
KEGG Drug
PubChem CID
ChEBI	34838
CAS Number	58-19-5

Drug Properties

Molecular Weight	304.24
ALogP	0.5367
MLogP	3.44
XLogP	4.791
HDA	2
HBD	1
Rotatable Bonds	4
TPSA	37.3
RO5 Violation	0