NPASS Compound

Natural Product: NPC190939

Natural Product ID	NPC190939
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(25R)-3Beta-[(O-Beta-D-Glucopyranosyl-(1->3)-O-Beta-D-Glucopyranosyl-(1->2)-O-[Beta-D-Xylopyranosyl-(1->3)]-O-Beta-D-Glucopyranosyl-(1->4)-Beta-D-Galactopyranosyl)-Oxy]-26-[(Beta-D-Glucopyranosyl)Oxy]-2Alpha-Hydroxycholesta-5,17-Diene-16,22-Dione
IUPAC Name	(2R,3R,8R,9S,10R,13S,14S,17Z)-3-[(2R,3R,4R,5R,6R)-5-[(2S,3R,4S,5R,6R)-3-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-hydroxy-10,13-dimethyl-17-[(6R)-6-methyl-3-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-ylidene]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-16-one
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL506498
PubChem CID	11007753
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 194203 0 0 0 0 0 0 0 0999 V2000 13.6862 3.3524 -2.4798 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3493 2.8789 -1.8297 C 0 0 2 0 0 0 0 0 0 0 0 0 11.7907 3.9207 -0.9780 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5431 3.7754 -0.2241 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4213 2.8226 0.8547 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3408 2.9070 1.7791 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4451 1.8043 1.1038 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5153 1.3177 0.3519 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3091 1.7513 -1.0561 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2739 1.9800 -1.8381 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8636 1.8390 -1.3185 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2724 1.2420 -0.1218 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0520 0.3473 -0.3312 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1522 1.0271 -1.2770 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8031 0.3815 -1.1721 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4141 -0.2942 -0.1454 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0171 -0.8972 -0.1397 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2206 0.1598 0.6704 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1052 0.8338 1.6265 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2565 0.0533 2.2271 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2055 -0.4758 1.1132 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3646 -1.9711 1.4172 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4796 0.2322 1.0495 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5030 -0.4604 1.9381 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8781 0.1807 1.9299 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3800 0.4091 0.5522 C 0 0 2 0 0 0 0 0 0 0 0 0 7.6057 -0.8860 -0.1495 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5400 2.0526 1.0985 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9319 -0.3948 1.1238 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0160 -0.2137 0.2926 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8544 -1.4455 0.2414 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3125 -0.9381 0.0852 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1548 0.0513 -1.1300 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4065 1.2274 -0.6652 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2854 2.4367 -0.3988 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4210 3.4453 0.0892 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8151 0.9054 0.6110 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3931 0.2619 -1.7273 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5806 -0.6845 -2.6586 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9433 -1.4204 -2.4699 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6342 -2.8100 -2.8684 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7902 -2.7200 -4.1294 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7385 -1.4045 -4.8043 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7763 -1.1973 -5.8834 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4187 -0.1003 -6.6887 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6198 -0.2753 -3.9678 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5188 -3.2689 -3.9522 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6826 -3.6866 -2.9464 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5913 -4.7364 -2.0449 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7667 -4.7311 -1.0791 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.5602 -6.0102 -1.1351 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6684 -7.2153 -0.9030 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3334 -6.8949 -1.5513 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5019 -5.9878 -2.6139 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5503 -7.3981 0.4613 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1592 -6.2055 -2.3727 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3276 -4.5329 0.2205 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3382 -1.1090 -1.2051 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4172 -0.2629 -1.1879 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4636 -0.4577 -0.1641 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.1706 0.8673 0.1523 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.2103 1.6464 -1.1634 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8248 1.8752 -1.7060 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4111 3.3106 -1.7732 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3658 3.9135 -0.5113 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9394 1.0892 -0.9240 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9033 0.8534 -2.0687 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4815 1.5190 1.1181 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1533 1.8990 2.2555 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4961 1.6264 3.5556 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.3788 2.1505 4.6683 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.1883 3.3510 4.3453 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.0813 3.9006 2.9750 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.8758 5.4227 3.0563 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0132 5.9148 1.7721 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1722 3.3259 2.1509 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.5530 3.1702 4.7046 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6357 2.2936 5.8557 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2754 0.2838 3.8504 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3437 -1.4472 -0.5540 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6530 -0.2650 1.2134 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6169 -2.1886 -0.9412 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5102 1.0935 2.4763 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5182 1.5463 -1.2313 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4968 1.4936 -0.2397 O 0 0 0 0 0 0 0 0 0 0 0 0 13.7182 0.1815 0.1552 C 0 0 1 0 0 0 0 0 0 0 0 0 15.1707 -0.2172 -0.0290 C 0 0 1 0 0 0 0 0 0 0 0 0 15.2691 -1.7109 0.2010 C 0 0 2 0 0 0 0 0 0 0 0 0 14.7270 -1.9993 1.5860 C 0 0 1 0 0 0 0 0 0 0 0 0 13.4101 -1.3425 1.8443 C 0 0 1 0 0 0 0 0 0 0 0 0 13.1066 -1.4241 3.3175 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8520 -0.9039 3.6046 O 0 0 0 0 0 0 0 0 0 0 0 0 13.3836 0.0126 1.4820 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5230 -3.3940 1.6365 O 0 0 0 0 0 0 0 0 0 0 0 0 16.6388 -2.0355 0.1703 O 0 0 0 0 0 0 0 0 0 0 0 0 15.5940 0.0109 -1.3410 O 0 0 0 0 0 0 0 0 0 0 0 0 13.8699 2.6380 -3.2970 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4787 3.3578 -1.7154 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5367 4.3489 -2.9484 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6831 2.8336 -2.7649 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6456 4.8503 -1.6371 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5740 4.3333 -0.2445 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6420 3.9543 -0.8059 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5040 4.8485 0.3771 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5435 2.9076 -1.4613 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5692 1.2283 -2.2092 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0094 2.0298 0.6326 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3644 -0.6079 -0.7614 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9869 2.0802 -0.8840 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5229 1.0560 -2.3235 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1763 0.5477 -2.0742 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9775 -1.8780 0.2933 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6208 -0.8935 -1.1558 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0765 0.8685 -0.1579 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4646 1.1416 2.5161 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8961 -0.7855 2.8355 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8294 0.7453 2.8617 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8708 -2.0925 2.4267 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0340 -2.4765 0.6971 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4035 -2.5141 1.4111 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3590 1.2510 1.4967 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1247 -0.3927 2.9763 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5947 -1.5337 1.7006 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5012 -0.6194 2.4123 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7825 1.0960 2.5517 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6287 -1.2780 0.0616 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4856 -0.8253 -1.2621 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8492 -1.6191 0.1735 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9616 2.2580 0.3251 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5722 0.1128 -0.6924 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7511 -2.1335 1.0716 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9475 -1.7467 -0.2534 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5198 -0.6195 -1.7921 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6087 1.5359 -1.3684 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0120 2.1279 0.3719 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7296 2.7379 -1.3582 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7876 3.6610 -0.6579 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7534 -1.4645 -2.5518 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6550 -0.9052 -3.1658 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9405 -3.2172 -2.0666 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3037 -3.4279 -4.8530 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7468 -1.3912 -5.3683 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8074 -1.1414 -5.5327 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7686 -2.0689 -6.6094 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2067 0.3288 -7.0804 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5374 -4.2366 -3.7660 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6563 -4.5965 -1.4453 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4852 -3.9170 -1.3292 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3287 -5.9812 -0.3500 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1635 -8.0983 -1.3456 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7565 -7.7859 -1.8333 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7266 -6.3606 -0.7707 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0264 -8.2035 0.7278 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0237 -6.6532 -2.1967 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7514 -5.1015 0.8944 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8027 -0.1902 -2.2271 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9635 -0.8129 0.7954 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2234 0.6136 0.3559 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7504 2.5898 -1.0519 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7090 1.4559 -2.7389 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4240 3.4478 -2.2132 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2162 3.8601 -2.3422 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8754 4.7640 -0.4896 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8423 1.1726 -2.0972 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2057 1.6272 2.2984 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5124 2.1731 3.6249 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1161 1.3264 4.9228 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8360 4.1556 5.0647 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0900 3.7877 2.4808 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6809 5.8990 3.6622 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8907 5.6659 3.4987 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2199 6.4310 1.4795 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8339 3.8159 5.3912 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0299 3.0568 5.6775 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6851 0.2862 4.6682 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2077 -1.1400 -0.9001 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6620 -0.8663 1.9728 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4062 -3.1435 -0.7291 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5621 1.4136 2.8349 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8671 1.5379 3.2035 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6175 0.0314 2.3695 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5703 1.2615 -0.6909 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6470 0.7234 -1.9726 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0456 -0.4716 -0.4524 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7936 0.3538 0.6639 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7316 -2.2482 -0.5979 H 0 0 0 0 0 0 0 0 0 0 0 0 15.5102 -1.7322 2.3149 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6071 -1.8842 1.3054 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2214 -2.4629 3.7057 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8704 -0.8110 3.8537 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1543 -1.5351 3.2824 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4007 -3.7812 1.3396 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1917 -1.2479 -0.0613 H 0 0 0 0 0 0 0 0 0 0 0 0 16.5536 0.2308 -1.3246 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 5 7 1 0 7 8 2 0 8 9 1 0 9 10 2 0 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 1 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 19 28 1 0 18 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 34 37 1 0 33 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 43 46 1 0 42 47 1 0 41 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 52 55 1 0 51 56 1 0 50 57 1 0 40 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 63 66 1 0 62 67 1 0 61 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 73 76 1 0 72 77 1 0 71 78 1 0 70 79 1 0 60 80 1 0 32 81 1 0 31 82 1 0 7 83 1 0 2 84 1 0 84 85 1 0 85 86 1 0 86 87 1 0 87 88 1 0 88 89 1 0 89 90 1 0 90 91 1 0 91 92 1 0 90 93 1 0 89 94 1 0 88 95 1 0 87 96 1 0 26 8 1 0 37 30 1 0 46 39 1 0 54 49 1 0 66 59 1 0 76 69 1 0 93 86 1 0 26 12 1 0 23 13 1 0 21 16 1 0 1 97 1 0 1 98 1 0 1 99 1 0 2100 1 6 3101 1 0 3102 1 0 4103 1 0 4104 1 0 11105 1 0 11106 1 0 12107 1 1 13108 1 6 14109 1 0 14110 1 0 15111 1 0 17112 1 0 17113 1 0 18114 1 6 19115 1 1 20116 1 0 20117 1 0 22118 1 0 22119 1 0 22120 1 0 23121 1 1 24122 1 0 24123 1 0 25124 1 0 25125 1 0 27126 1 0 27127 1 0 27128 1 0 28129 1 0 30130 1 6 31131 1 1 32132 1 6 33133 1 6 34134 1 6 35135 1 0 35136 1 0 36137 1 0 39138 1 6 40139 1 6 41140 1 1 42141 1 6 43142 1 6 44143 1 0 44144 1 0 45145 1 0 47146 1 0 49147 1 1 50148 1 6 51149 1 1 52150 1 6 53151 1 0 53152 1 0 55153 1 0 56154 1 0 57155 1 0 59156 1 6 60157 1 1 61158 1 1 62159 1 1 63160 1 6 64161 1 0 64162 1 0 65163 1 0 67164 1 0 69165 1 1 70166 1 6 71167 1 1 72168 1 1 73169 1 6 74170 1 0 74171 1 0 75172 1 0 77173 1 0 78174 1 0 79175 1 0 80176 1 0 81177 1 0 82178 1 0 83179 1 0 83180 1 0 83181 1 0 84182 1 0 84183 1 0 86184 1 6 87185 1 1 88186 1 6 89187 1 1 90188 1 6 91189 1 0 91190 1 0 92191 1 0 94192 1 0 95193 1 0 96194 1 0 M END

Standard InCHIKey	PIACQCAHKHMXIA-QACVDFGUSA-N
Standard InCHI	InChI=1S/C62H98O34/c1-21(19-85-55-47(81)43(77)39(73)32(14-63)88-55)5-8-27(68)22(2)37-28(69)12-26-24-7-6-23-11-31(29(70)13-62(23,4)25(24)9-10-61(26,37)3)87-57-49(83)45(79)51(36(18-67)92-57)93-60-54(53(42(76)35(17-66)91-60)95-56-46(80)38(72)30(71)20-86-56)96-59-50(84)52(41(75)34(16-65)90-59)94-58-48(82)44(78)40(74)33(15-64)89-58/h6,21,24-26,29-36,38-60,63-67,70-84H,5,7-20H2,1-4H3/b37-22+/t21-,24-,25+,26+,29-,30-,31-,32-,33-,34-,35-,36-,38+,39-,40-,41-,42-,43+,44+,45-,46-,47-,48-,49-,50-,51+,52+,53+,54-,55-,56+,57-,58+,59+,60+,61+,62+/m1/s1
SMILES	C[C@H](CCC(=O)/C(=C/1C(=O)C[C@H]2[C@@H]3CC=C4C[C@H]([C@@H](C[C@]4(C)[C@H]3CC[C@]12C)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)/C)CO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1386.59	Volume:	1283.665 ? Van der Waals volume.
Dense:	1.08	LogP:	-1.631 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-0.451 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.308 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	22.0	Rigid Bonds:	59.0
TPSA:	549.5 ? Topological Polar Surface Area.	H-Bond Acceptor:	34.0
H-Bond Donor:	20.0	Rings:	10.0
Heavy Atoms:	34.0

MedChem Properties

QED Drug-Likeness Score:	0.035	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.814	Fsp³:	0.903
MCE-18:	207.39 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.57	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.431	Promiscuous compounds:	0.419

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.918	MDCK Permeability:	-4.969
Pgp-inhibitor:	0.0	Pgp-substrate:	0.954
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.998
20% Bioavailability (F20%):	0.024	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.001
Plasma Protein Binding (PPB):	46.578%	Volume Distribution (VD):	-0.314
Fu:	32.566% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.58	CYP3A4-substrate:	0.643
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.622
HLM stability:	0.011 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.138

Half-life (T1/2):

3.904

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.841	Drug-induced Liver Injury (DILI):	0.956
AMES Toxicity:	0.999	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.009	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.936	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.02	RPMI-8226 Immunitoxicity:	0.393
A549 Cytotoxicity:	0.995	Hek293 Cytotoxicity:	0.758
BCF:	0.325 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.067 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.57 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.599 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	leaves	n.a.	n.a.	PMID[11170659]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	leaves	n.a.	n.a.	PMID[12502329]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC190939 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23358
0.1-0.2	23069
0.2-0.3	2746
0.3-0.4	561
0.4-0.5	84
0.5-0.6	20
0.6-0.7	8
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9314	High Similarity	NPC197003
0.787	Intermediate Similarity	NPC308459
0.7672	Intermediate Similarity	NPC248202
0.7273	Intermediate Similarity	NPC208832
0.7241	Intermediate Similarity	NPC256983
0.7154	Intermediate Similarity	NPC263359
0.7131	Intermediate Similarity	NPC32707
0.7049	Intermediate Similarity	NPC210569
0.6911	Remote Similarity	NPC79900
0.6614	Remote Similarity	NPC244431
0.6557	Remote Similarity	NPC167183
0.6475	Remote Similarity	NPC31896
0.6231	Remote Similarity	NPC305771
0.6231	Remote Similarity	NPC94072
0.6231	Remote Similarity	NPC169816
0.6	Remote Similarity	NPC15918
0.5862	Remote Similarity	NPC306991
0.5504	Remote Similarity	NPC84111
0.5504	Remote Similarity	NPC287483
0.5504	Remote Similarity	NPC470865
0.5469	Remote Similarity	NPC92710
0.5448	Remote Similarity	NPC273002
0.5433	Remote Similarity	NPC470861
0.5379	Remote Similarity	NPC470866
0.5349	Remote Similarity	NPC218571
0.5349	Remote Similarity	NPC487615
0.5308	Remote Similarity	NPC470862
0.5276	Remote Similarity	NPC51520
0.5276	Remote Similarity	NPC303069
0.5267	Remote Similarity	NPC132080
0.5221	Remote Similarity	NPC220836
0.5154	Remote Similarity	NPC232611
0.5152	Remote Similarity	NPC477811
0.5116	Remote Similarity	NPC470863
0.5039	Remote Similarity	NPC115165
0.5038	Remote Similarity	NPC232037

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC190939 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7503
0.1-0.2	1566
0.2-0.3	75
0.3-0.4	5
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data