NPASS Compound

Natural Product: NPC86020

Natural Product ID	NPC86020
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2S)-2-[(3S,8R,9S,10R,13S,14S,16S,17S)-17-Hydroxy-10,13-Dimethyl-3-[(2R,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)Oxan-2-Yl]Oxy-16-[(2S,3R,4S,5S)-3,4,5-Trihydroxyoxan-2-Yl]Oxy-1,2,3,4,7,8,9,11,12,14,15,16-Dodecahydrocyclopenta[A]Phenanthren-17-Yl]-6-Methylheptan-3-One
IUPAC Name	(2S)-2-[(3S,8R,9S,10R,13S,14S,16S,17S)-17-hydroxy-10,13-dimethyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-16-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptan-3-one
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL507459
PubChem CID	11061584
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 113118 0 0 0 0 0 0 0 0999 V2000 -7.5807 0.8469 -1.2000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6853 2.1967 -0.4995 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5061 3.0973 -1.3979 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3124 2.7695 -0.4196 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3603 1.8462 0.3834 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0099 2.4129 0.4497 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8578 3.4349 -0.2650 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8447 2.0058 1.1881 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2638 1.9905 2.6782 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0758 0.8018 0.9276 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5737 -0.5471 1.0286 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6567 -1.3837 0.0796 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5533 -0.4445 -0.2165 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3161 -0.6852 -1.3751 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8329 -2.0892 -1.4227 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2934 -2.2089 -1.2649 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1649 -1.2644 -1.5395 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5977 -1.5232 -1.3328 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3978 -0.2490 -1.1577 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0208 0.6394 -2.3222 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6112 1.1469 -2.0240 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6123 0.0374 -2.0529 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2080 -0.1904 -3.4958 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4474 0.3444 -1.1937 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8135 1.6809 -1.4286 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3247 1.9421 -0.4794 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3310 0.8436 -0.4135 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2188 0.7027 -1.5826 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7177 -0.5878 -1.0869 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3256 -0.2176 0.1146 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9274 -1.3701 0.8394 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8271 -0.9374 1.9727 C 0 0 2 0 0 0 0 0 0 0 0 0 9.7919 0.0821 1.5147 C 0 0 1 0 0 0 0 0 0 0 0 0 9.5270 0.6448 0.1693 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3083 -0.0719 -0.9434 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6229 -0.1436 -0.5206 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2410 0.7361 -0.1851 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7196 1.1632 2.4275 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4366 -2.0693 2.5261 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8907 -2.1175 1.4823 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8664 -0.8884 0.8630 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4299 -1.6122 1.8873 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7543 -1.2175 2.3949 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6694 -2.4404 2.6280 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9581 -3.0622 1.2879 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6638 -2.9386 0.4813 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5601 -2.9270 1.3532 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0060 -2.3522 0.7088 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8311 -1.9398 3.2070 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6753 -0.6492 3.6952 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9522 0.8961 1.8303 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7726 0.9149 -1.9643 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5310 0.6668 -1.7378 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3666 0.0190 -0.5139 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1830 2.1188 0.4705 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2076 4.1382 -1.1706 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2178 2.8876 -2.4556 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5949 2.9238 -1.2983 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3005 3.7309 0.1339 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8987 2.9487 -1.4213 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4511 0.8899 -0.1766 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8558 1.7335 1.3502 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0544 2.8549 1.2196 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2317 1.4690 2.7878 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4989 1.3911 3.2002 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2806 3.0160 3.0960 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3111 -0.9338 2.0932 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1916 -1.7125 -0.7997 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2549 -2.2662 0.6145 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0707 -0.2790 0.6962 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1053 -0.4513 -2.3742 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5415 -2.6088 -2.3575 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3484 -2.6616 -0.5936 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6699 -3.1693 -0.8880 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9842 -2.1097 -2.2031 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8116 -2.1493 -0.4301 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0056 0.2592 -0.2492 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9577 0.0464 -3.2458 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6876 1.4969 -2.4526 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6136 1.6605 -1.0380 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3185 1.9108 -2.8006 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3509 0.4446 -3.8003 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0369 -1.2726 -3.6633 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1173 0.0498 -4.1179 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7510 0.2771 -0.1273 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4817 1.8106 -2.4678 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5954 2.4541 -1.2294 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0188 2.1852 0.5455 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8337 2.8724 -0.8503 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1107 -0.2246 -2.1815 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0086 1.5786 -2.2677 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3013 0.7885 -1.3639 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5296 0.2925 0.7452 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4505 -2.1077 0.2367 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1182 -0.5266 2.7572 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8155 -0.3770 1.5735 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9577 1.7083 0.0963 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9034 -1.0334 -1.2216 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2944 0.5825 -1.8459 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9188 0.7997 -0.3286 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2204 1.9265 2.0306 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7269 -2.7796 2.5417 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0901 -1.5677 1.5148 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7091 -1.7899 2.7400 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3590 -0.5375 1.8036 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1612 -3.1170 3.3338 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2671 -4.1168 1.4260 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5623 -3.8787 -0.1098 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7272 -2.0296 -0.1143 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1417 -1.4881 1.1829 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5720 -2.5717 3.1423 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4334 -1.4042 4.3221 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0215 0.1830 2.4995 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 6 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 6 19 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 34 37 1 0 33 38 1 0 32 39 1 0 31 40 1 0 11 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 44 49 1 0 43 50 1 0 10 51 1 1 27 10 1 0 37 30 1 0 47 42 1 0 27 13 1 0 24 14 1 0 22 17 1 0 1 52 1 0 1 53 1 0 1 54 1 0 2 55 1 0 3 56 1 0 3 57 1 0 3 58 1 0 4 59 1 0 4 60 1 0 5 61 1 0 5 62 1 0 8 63 1 1 9 64 1 0 9 65 1 0 9 66 1 0 11 67 1 1 12 68 1 0 12 69 1 0 13 70 1 1 14 71 1 6 15 72 1 0 15 73 1 0 16 74 1 0 18 75 1 0 18 76 1 0 19 77 1 1 20 78 1 0 20 79 1 0 21 80 1 0 21 81 1 0 23 82 1 0 23 83 1 0 23 84 1 0 24 85 1 1 25 86 1 0 25 87 1 0 26 88 1 0 26 89 1 0 28 90 1 0 28 91 1 0 28 92 1 0 30 93 1 1 31 94 1 6 32 95 1 1 33 96 1 6 34 97 1 1 35 98 1 0 35 99 1 0 36100 1 0 38101 1 0 39102 1 0 40103 1 0 42104 1 1 43105 1 6 44106 1 1 45107 1 1 46108 1 0 46109 1 0 48110 1 0 49111 1 0 50112 1 0 51113 1 0 M END

Standard InCHIKey	NQDDCCOUDFVXKO-AMDOWXPWSA-N
Standard InCHI	InChI=1S/C38H62O13/c1-18(2)6-9-25(40)19(3)38(47)28(51-34-32(45)29(42)26(41)17-48-34)15-24-22-8-7-20-14-21(10-12-36(20,4)23(22)11-13-37(24,38)5)49-35-33(46)31(44)30(43)27(16-39)50-35/h7,18-19,21-24,26-35,39,41-47H,6,8-17H2,1-5H3/t19-,21+,22-,23+,24+,26+,27-,28+,29+,30-,31+,32-,33-,34+,35-,36+,37+,38-/m1/s1
SMILES	CC(C)CCC(=O)[C@@H](C)[C@]1([C@H](C[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O[C@H]1[C@@H]([C@H]([C@H](CO1)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	726.42	Volume:	723.465 ? Van der Waals volume.
Dense:	1.004	LogP:	3.629 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.914 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.864 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	33.0
TPSA:	215.83 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	8.0	Rings:	6.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.147	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.7	Fsp³:	0.921
MCE-18:	120.822 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.838	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.198	Promiscuous compounds:	0.034

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.044	MDCK Permeability:	-5.163
Pgp-inhibitor:	0.0	Pgp-substrate:	0.408
PAMPA:	0.995 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.036
50% Bioavailability (F50%):	0.897

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.011
Plasma Protein Binding (PPB):	71.554%	Volume Distribution (VD):	-0.393
Fu:	23.649% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.038
BSEP inhibitor:	0.02

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.036	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.995
HLM stability:	0.971 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.8

Half-life (T1/2):

2.337

ADMET: Toxicity

hERG Blockers:	0.016	hERG Blockers (10um):	0.115
Human Hepatotoxicity (H-HT):	0.522	Drug-induced Liver Injury (DILI):	0.586
AMES Toxicity:	0.87	Rat Oral Acute Toxicity:	0.013
Maximum Recommended Daily Dose:	0.067	Skin Sensitization:	1.0
Carcinogencity:	0.142	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.127
Drug-induced Neurotoxicity:	0.002	Ototoxicity:	0.993
Hematotoxicity:	0.705	Drug-induced Nephrotoxicity:	0.64
Genotoxicity:	0.069	RPMI-8226 Immunitoxicity:	0.279
A549 Cytotoxicity:	0.734	Hek293 Cytotoxicity:	0.398
BCF:	1.24 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.376 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.758 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.001 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	bulbs	n.a.	n.a.	PMID[12398536]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	n.a.	bulb	n.a.	PMID[12398536]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	bulbs	n.a.	n.a.	PMID[15497941]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	0.12	ug.mL-1	PMID[20733045]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC86020 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19063
0.1-0.2	25330
0.2-0.3	4309
0.3-0.4	1006
0.4-0.5	114
0.5-0.6	21
0.6-0.7	10
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8352	Intermediate Similarity	NPC156789
0.7835	Intermediate Similarity	NPC160084
0.7835	Intermediate Similarity	NPC473474
0.6869	Remote Similarity	NPC475187
0.6848	Remote Similarity	NPC475632
0.6429	Remote Similarity	NPC71385
0.6316	Remote Similarity	NPC299855
0.6239	Remote Similarity	NPC473711
0.6239	Remote Similarity	NPC112708
0.6145	Remote Similarity	NPC207617
0.6145	Remote Similarity	NPC607440
0.6134	Remote Similarity	NPC189704
0.6134	Remote Similarity	NPC475121
0.5935	Remote Similarity	NPC475299
0.5854	Remote Similarity	NPC476067
0.5618	Remote Similarity	NPC158088
0.5567	Remote Similarity	NPC474569
0.5455	Remote Similarity	NPC486386
0.5444	Remote Similarity	NPC22140
0.5444	Remote Similarity	NPC243728
0.5408	Remote Similarity	NPC272015
0.5377	Remote Similarity	NPC42482
0.5377	Remote Similarity	NPC40440
0.5357	Remote Similarity	NPC254255
0.5326	Remote Similarity	NPC282669
0.5242	Remote Similarity	NPC230670
0.5159	Remote Similarity	NPC96194
0.5152	Remote Similarity	NPC181845
0.5128	Remote Similarity	NPC167183
0.5093	Remote Similarity	NPC486388
0.5055	Remote Similarity	NPC473890
0.5045	Remote Similarity	NPC482556
0.5043	Remote Similarity	NPC218571
0.5043	Remote Similarity	NPC487615

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC86020 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6773
0.1-0.2	2178
0.2-0.3	181
0.3-0.4	16
0.4-0.5	2
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data