NPASS Compound

Natural Product: NPC476067

Natural Product ID	NPC476067
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3Beta-[(O-Beta-D-Glucopyranosyl-(1->4)-O-Beta-D-Glucopyranosyl-(1->6)-Beta-Dglucopyranosyl)Oxy)]-17Alpha-Hydroxy-16Beta-[(O-(3-O-3,4-Dimethoxybenzoyl-Beta-D-Xylopyranosyl)-(1->3)-2-O-Acetyl-Alpha-L-Arabinopyranosyl)Oxy]Cholest-5-En-22-One
IUPAC Name	[(2S,3R,4S,5R)-2-[(2S,3R,4S,5S)-3-acetyloxy-5-hydroxy-2-[[(3S,8R,9S,10R,13S,14S,16S,17S)-17-hydroxy-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]oxan-2-yl]oxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]oxy]oxan-4-yl]oxy-3,5-dihydroxyoxan-4-yl] 3,4-dimethoxybenzoate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL524310
PubChem CID	44575970
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 197206 0 0 0 0 0 0 0 0999 V2000 8.1079 -0.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7961 0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4842 2.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3288 0.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8616 0.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3944 -0.1110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4730 -1.6090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3907 1.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3870 2.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2760 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0323 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0323 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7062 -2.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4086 -3.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8351 -3.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1470 -1.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5736 -1.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6883 -2.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3764 -3.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9499 -4.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6380 -5.6918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7527 -6.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1793 -6.2320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4912 -4.7648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6784 -6.2844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3826 -7.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5646 -6.6853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9554 -7.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1641 -8.7326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9821 -9.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5913 -9.0942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1872 -10.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3924 -12.2002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0966 -13.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2786 -12.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6694 -13.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8781 -14.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6961 -15.5720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3053 -15.0101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9012 -16.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1063 -18.1161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6073 -18.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8160 -19.5492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6340 -20.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2432 -19.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0345 -18.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2165 -17.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3303 -17.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6261 -15.7765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7441 -19.8584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8391 -21.7447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5202 -20.8736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5823 -15.9729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1684 -13.2154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0735 -11.3291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8683 -10.0570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4545 -7.2995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3595 -5.4132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2617 -2.7574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8615 -1.5254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2158 2.5838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6659 3.7974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6823 4.4549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7870 5.9513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4566 6.7901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8048 6.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9094 4.6362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3383 8.0036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3971 7.3216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5154 8.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8636 9.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9682 10.6890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7247 11.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6235 10.8703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7282 9.3739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1570 12.7413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5783 12.0593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0701 12.2161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9518 11.0026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6802 13.5864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1720 13.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7821 15.1136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9004 16.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4086 16.1703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7985 14.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5105 17.6974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6288 18.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2739 15.2704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8840 16.6407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3554 9.3495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1741 4.6117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0558 3.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4457 2.0279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5476 3.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3907 -1.0037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4198 -2.1099 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5751 -0.3308 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6897 -1.1310 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2633 1.1364 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1723 3.7590 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9514 2.6037 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9899 2.1611 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4595 -0.9816 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8404 1.9310 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1735 -1.2664 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5497 1.6681 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5054 2.0074 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0243 3.5739 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6157 2.9787 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0625 1.4143 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5922 2.1163 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5177 0.9588 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5207 2.1683 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4026 -0.1399 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5010 -3.9528 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1916 -2.4721 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7714 -5.1399 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7735 -4.6079 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5233 -4.6881 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7204 -2.2172 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7556 -0.3667 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2108 0.1653 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1149 -1.8303 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8431 -6.9639 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1526 -5.4832 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4569 -8.0200 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5707 -7.6190 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2054 -7.7318 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2860 -3.4927 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9401 -5.1530 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0231 -8.2427 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5805 -5.5532 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4438 -5.8289 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6366 -8.4464 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2109 -10.5164 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5467 -11.5621 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9152 -10.1333 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6700 -13.9882 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4399 -11.3576 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1577 -11.7448 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3506 -14.3623 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6802 -16.7041 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0669 -17.7880 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7355 -15.9000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7380 -16.5695 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2426 -19.0856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6181 -21.6047 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9314 -21.3780 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6079 -18.8889 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6547 -16.3967 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0058 -17.8051 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4209 -14.5044 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9493 -21.1305 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5433 -23.0691 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8863 -22.2331 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1189 -17.3995 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0288 -14.4441 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5677 -11.1983 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0735 -11.3291 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3149 -8.5282 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8538 -5.2824 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9194 -1.4092 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7036 -2.3438 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1128 -1.7931 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2798 -2.0138 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5497 -2.9926 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1734 -0.0582 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0925 3.3340 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2685 3.0742 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2424 5.5884 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2933 8.0891 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2966 5.9757 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3909 7.5132 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8381 8.0298 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7567 7.7403 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2770 7.7508 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4570 10.5063 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7666 12.6068 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1153 10.7135 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2097 12.2510 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6568 12.7676 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0537 12.5297 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5269 17.3838 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3067 14.6432 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7472 20.1245 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8424 19.7926 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4153 18.0292 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4941 18.0110 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2543 16.0306 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5137 17.2508 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1279 10.6352 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0393 3.7118 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7044 2.0632 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3908 5.0468 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8870 -0.8991 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 25 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 48 50 1 0 50 51 1 0 47 52 1 0 46 53 1 0 45 54 1 0 39 55 1 0 38 56 1 0 37 57 1 0 31 58 1 0 30 59 1 0 29 60 1 0 22 61 1 0 14 62 1 0 11 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 67 70 1 0 66 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 75 78 1 0 74 79 1 0 79 80 1 0 80 81 2 0 80 82 1 0 82 83 2 0 83 84 1 0 84 85 2 0 85 86 1 0 86 87 2 0 85 88 1 0 88 89 1 0 84 90 1 0 90 91 1 0 73 92 1 0 65 93 1 0 93 94 1 0 94 95 2 0 94 96 1 0 10 97 1 0 14 10 1 0 87 82 1 0 18 13 1 0 22 17 1 0 26 21 1 0 33 28 1 0 41 36 1 0 49 44 1 0 69 64 1 0 77 72 1 0 1 98 1 0 1 99 1 0 1100 1 0 2101 1 0 3102 1 0 3103 1 0 3104 1 0 4105 1 0 4106 1 0 5107 1 0 5108 1 0 8109 1 0 9110 1 0 9111 1 0 9112 1 0 11113 1 0 12114 1 0 12115 1 0 13116 1 0 15117 1 0 15118 1 0 16119 1 0 16120 1 0 17121 1 0 18122 1 0 19123 1 0 19124 1 0 20125 1 0 23126 1 0 23127 1 0 24128 1 0 24129 1 0 25130 1 0 26131 1 0 26132 1 0 28133 1 0 29134 1 0 30135 1 0 31136 1 0 32137 1 0 34138 1 0 34139 1 0 36140 1 0 37141 1 0 38142 1 0 39143 1 0 40144 1 0 42145 1 0 42146 1 0 44147 1 0 45148 1 0 46149 1 0 47150 1 0 48151 1 0 50152 1 0 50153 1 0 51154 1 0 52155 1 0 53156 1 0 54157 1 0 55158 1 0 56159 1 0 57160 1 0 58161 1 0 59162 1 0 60163 1 0 61164 1 0 61165 1 0 61166 1 0 62167 1 0 62168 1 0 62169 1 0 64170 1 0 65171 1 0 66172 1 0 67173 1 0 68174 1 0 68175 1 0 70176 1 0 72177 1 0 73178 1 0 74179 1 0 75180 1 0 76181 1 0 76182 1 0 78183 1 0 83184 1 0 86185 1 0 87186 1 0 89187 1 0 89188 1 0 89189 1 0 91190 1 0 91191 1 0 91192 1 0 92193 1 0 96194 1 0 96195 1 0 96196 1 0 97197 1 0 M END

Standard InCHIKey	IFTKRNDDDZUSKQ-PWVPXDFOSA-N
Standard InCHI	InChI=1S/C66H100O31/c1-27(2)9-13-36(69)28(3)66(83)44(95-63-57(90-29(4)68)56(38(71)24-87-63)97-61-54(81)55(37(70)23-86-61)96-58(82)30-10-14-39(84-7)40(19-30)85-8)21-35-33-12-11-31-20-32(15-17-64(31,5)34(33)16-18-65(35,66)6)91-62-53(80)50(77)47(74)43(94-62)26-89-60-52(79)49(76)46(73)42(93-60)25-88-59-51(78)48(75)45(72)41(22-67)92-59/h10-11,14,19,27-28,32-35,37-38,41-57,59-63,67,70-81,83H,9,12-13,15-18,20-26H2,1-8H3/t28-,32+,33-,34+,35+,37-,38+,41-,42-,43-,44+,45-,46-,47-,48+,49+,50+,51-,52-,53-,54-,55+,56+,57-,59-,60-,61+,62-,63+,64+,65+,66-/m1/s1
SMILES	CC(C)CCC(=O)C(C)C1(C(CC2C1(CCC3C2CC=C4C3(CCC(C4)OC5C(C(C(C(O5)COC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O)O)O)O)C)C)OC8C(C(C(CO8)O)OC9C(C(C(CO9)O)OC(=O)C1=CC(=C(C=C1)OC)OC)O)OC(=O)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1388.62	Volume:	1318.569 ? Van der Waals volume.
Dense:	1.053	LogP:	0.436 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.097 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.638 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	25.0	Rigid Bonds:	59.0
TPSA:	463.65 ? Topological Polar Surface Area.	H-Bond Acceptor:	31.0
H-Bond Donor:	14.0	Rings:	10.0
Heavy Atoms:	31.0

MedChem Properties

QED Drug-Likeness Score:	0.04	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.553	Fsp³:	0.833
MCE-18:	278.248 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.006	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.458 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.373	Promiscuous compounds:	0.002

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.451	MDCK Permeability:	-5.16
Pgp-inhibitor:	0.0	Pgp-substrate:	1.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.995	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	43.926%	Volume Distribution (VD):	-0.474
Fu:	31.369% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.016	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.983	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.452

Half-life (T1/2):

3.974

ADMET: Toxicity

hERG Blockers:	0.037	hERG Blockers (10um):	0.387
Human Hepatotoxicity (H-HT):	0.251	Drug-induced Liver Injury (DILI):	0.457
AMES Toxicity:	0.753	Rat Oral Acute Toxicity:	0.122
Maximum Recommended Daily Dose:	0.319	Skin Sensitization:	0.001
Carcinogencity:	0.01	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.506	Ototoxicity:	1.0
Hematotoxicity:	0.001	Drug-induced Nephrotoxicity:	0.012
Genotoxicity:	0.018	RPMI-8226 Immunitoxicity:	0.245
A549 Cytotoxicity:	0.014	Hek293 Cytotoxicity:	0.98
BCF:	0.246 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.793 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.046 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.198 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	bulbs	n.a.	n.a.	PMID[12398536]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	n.a.	bulb	n.a.	PMID[12398536]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	bulbs	n.a.	n.a.	PMID[15497941]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	0.46	ug.mL-1	PMID[20799726]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC476067 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	13643
0.1-0.2	31765
0.2-0.3	3954
0.3-0.4	464
0.4-0.5	11
0.5-0.6	4
0.6-0.7	5
0.7-0.8	0
0.8-0.85	3
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.879	High Similarity	NPC189704
0.879	High Similarity	NPC475121
0.8306	Intermediate Similarity	NPC299855
0.8047	Intermediate Similarity	NPC473711
0.8047	Intermediate Similarity	NPC112708
0.782	Intermediate Similarity	NPC475299
0.771	Intermediate Similarity	NPC96194
0.7578	Intermediate Similarity	NPC71385
0.7541	Intermediate Similarity	NPC160084
0.7541	Intermediate Similarity	NPC473474
0.7049	Intermediate Similarity	NPC156789
0.7037	Intermediate Similarity	NPC230670
0.6744	Remote Similarity	NPC57353
0.625	Remote Similarity	NPC475187
0.6136	Remote Similarity	NPC195972
0.6124	Remote Similarity	NPC482556
0.609	Remote Similarity	NPC482555
0.5854	Remote Similarity	NPC86020
0.5248	Remote Similarity	NPC482558
0.5077	Remote Similarity	NPC475632
0.5035	Remote Similarity	NPC482554

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC476067 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5363
0.1-0.2	3696
0.2-0.3	86
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data