NPASS drugs

Drug Information

Drug ID:	NPD4249
Drug Name:	Epoprostenol Sodium
Molecular Formula:	C20H32O5.Na
Canonical SMILES:	CCCCC[C@@H](/C=C/[C@H]1[C@H](O)C[C@H]2[C@@H]1C/C(=C/CCCC(=O)[O-])/O2)O.[Na+]
Standard InCHI:	"InChI=1S/C20H32O5.Na/c1-2-3-4-7-14(21)10-11-16-17-12-15(8-5-6-9-20(23)24)25-19(17)13-18(16)22;/h8,10-11,14,16-19,21-22H,2-7,9,12-13H2,1H3,(H,23,24);/q;+1/p-1/b11-10+,15-8-;/t14-,16+,17+,18+,19-;/m0./s1"
Standard InCHIKey:	LMHIPJMTZHDKEW-XQYLJSSYSA-M
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4249

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	79130
0.1-0.2	128868
0.2-0.3	3592
0.3-0.4	130
0.4-0.5	14
0.5-0.6	0
0.6-0.7	0
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC316627
Intermediate Similarity	0.7759	NPC316629
Intermediate Similarity	0.7759	NPC611618

Drug Structure

NPD4249 OpenBabel08211704332D 28 28 0 0 1 0 0 0 0 0999 V2000 -1.5157 -4.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5157 -4.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0157 -4.0622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5157 -3.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7352 1.0768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4262 2.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0157 -2.3301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0661 0.3337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0954 2.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5157 -1.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0157 -0.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3448 -0.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1793 1.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5157 -1.4641 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0880 0.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5157 0.2680 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5212 0.3725 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9225 1.1815 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3133 1.3506 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7863 3.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0157 -0.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5000 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8082 3.9300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4555 4.4653 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 0.6812 1.4552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7676 -5.6480 0.0000 Na 0 3 0 0 0 15 0 0 0 0 0 0 -0.5157 0.2680 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 7 1 0 0 0 0 5 6 1 0 0 0 0 5 8 1 0 0 0 0 6 9 1 0 0 0 0 8 15 2 0 0 0 0 9 20 1 0 0 0 0 10 11 2 0 0 0 0 10 14 1 0 0 0 0 12 15 1 0 0 0 0 13 18 1 0 0 0 0 14 7 1 1 0 0 0 14 21 1 0 0 0 0 15 25 1 0 0 0 0 16 11 1 1 0 0 0 16 17 1 0 0 0 0 16 18 1 0 0 0 0 17 12 1 6 0 0 0 17 19 1 0 0 0 0 18 22 1 6 0 0 0 19 13 1 6 0 0 0 19 25 1 0 0 0 0 20 23 2 0 0 0 0 20 24 1 0 0 0 0 21 27 1 0 0 0 0 22 28 1 0 0 0 0 M CHG 2 24 -1 26 1 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	351.22
ALogP	-3.5908
MLogP	3.11
XLogP	2.495
HDA	5
HBD	2
Rotatable Bonds	14
TPSA	89.82
RO5 Violation	0