NPASS Compound

Natural Product: NPC475570

Natural Product ID	NPC475570
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Lantanilic Acid
IUPAC Name	n.a.
Synonyms	Lantanilic Acid
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL508444
PubChem CID	44584761
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 93 98 0 0 0 0 0 0 0 0999 V2000 -0.9996 -13.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4100 -13.0738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6704 -11.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0800 -11.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2291 -12.0477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3405 -9.6063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7500 -9.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2500 -9.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0000 -7.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1491 -8.7584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1491 -6.8300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2500 -6.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7500 -6.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -7.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -7.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -6.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6491 -0.9642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6491 0.9642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4000 -0.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 2.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2500 -9.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -9.0933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -10.3923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5590 -14.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4091 -14.0998 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4865 -14.9963 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5126 -12.1772 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4786 -10.6324 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0105 -10.5705 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9895 -10.5705 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5865 -9.7743 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2981 -9.7226 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2461 -7.7354 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3321 -10.0164 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2981 -5.8659 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2461 -7.8530 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3321 -5.5720 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5865 -5.8142 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1715 -4.9972 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3361 -5.1144 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0905 -8.3073 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0363 -9.2208 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6683 -6.0070 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2730 -7.5922 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2500 -3.8971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1047 -1.1017 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4095 -2.0850 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2500 -1.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -1.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4991 -2.6503 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7947 -1.3259 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1595 -4.4101 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0363 -5.3695 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9673 -2.2864 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6491 -3.5623 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2054 -1.6620 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6491 0.9642 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8482 -0.6575 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4895 2.7762 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 1.8121 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7981 -1.9284 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7461 0.0588 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1608 -2.3825 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7981 1.9284 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9916 2.3124 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7461 -0.0588 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8547 -2.7954 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2116 -1.6364 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 3.8971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -5.1962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7044 -3.8718 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5377 -6.5965 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5866 -11.8342 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7081 -15.0021 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5949 -15.1870 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5232 -12.8889 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 2 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 9 11 1 0 9 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 6 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 30 34 1 0 34 35 1 0 30 36 1 1 17 37 1 6 14 38 1 1 38 39 2 0 38 40 1 0 2 41 1 0 14 7 1 0 22 17 1 0 31 26 1 0 18 13 1 0 27 21 1 0 35 27 1 0 1 42 1 0 1 43 1 0 1 44 1 0 3 45 1 0 7 46 1 6 8 47 1 0 8 48 1 0 10 49 1 0 10 50 1 0 10 51 1 0 11 52 1 0 11 53 1 0 11 54 1 0 12 55 1 0 12 56 1 0 13 57 1 1 15 58 1 0 15 59 1 0 16 60 1 0 16 61 1 0 19 62 1 0 20 63 1 0 20 64 1 0 21 65 1 6 23 66 1 0 23 67 1 0 23 68 1 0 24 69 1 0 24 70 1 0 25 71 1 0 25 72 1 0 26 73 1 6 28 74 1 0 28 75 1 0 29 76 1 0 29 77 1 0 32 78 1 0 32 79 1 0 32 80 1 0 33 81 1 0 33 82 1 0 33 83 1 0 35 84 1 0 35 85 1 0 36 86 1 0 37 87 1 0 37 88 1 0 37 89 1 0 40 90 1 0 41 91 1 0 41 92 1 0 41 93 1 0 M END

Standard InCHIKey	HGMVESCHSMFWDD-FFHSXQEQSA-N
Standard InCHI	InChI=1S/C35H52O6/c1-21(2)17-27(36)41-26-19-29(3,4)18-23-22-9-10-25-32(8,31(22,7)13-15-34(23,26)28(37)38)12-11-24-30(5,6)35(39)16-14-33(24,25)20-40-35/h9,17,23-26,39H,10-16,18-20H2,1-8H3,(H,37,38)/t23-,24-,25-,26+,31+,32+,33+,34-,35+/m0/s1
SMILES	CC(=CC(=O)O[C@@H]1CC(C)(C)C[C@@H]2[C@]1(CC[C@@]1(C2=CC[C@H]2[C@@]1(C)CC[C@@H]1[C@@]32CC[C@](C1(C)C)(OC3)O)C)C(=O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	568.38	Volume:	604.773 ? Van der Waals volume.
Dense:	0.94	LogP:	3.921 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.256 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.862 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	32.0
TPSA:	93.06 ? Topological Polar Surface Area.	H-Bond Acceptor:	6.0
H-Bond Donor:	2.0	Rings:	7.0
Heavy Atoms:	6.0

MedChem Properties

QED Drug-Likeness Score:	0.215	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.475	Fsp³:	0.829
MCE-18:	171.844 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.559	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.233	Promiscuous compounds:	0.265

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.416	MDCK Permeability:	-5.009
Pgp-inhibitor:	0.092	Pgp-substrate:	0.55
PAMPA:	0.859 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.007
20% Bioavailability (F20%):	0.912	30% Bioavailability (F30%):	0.218
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.289	MRP1:	0.999
Plasma Protein Binding (PPB):	95.188%	Volume Distribution (VD):	0.077
Fu:	4.076% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.758	BCRP inhibitor:	0.037
BSEP inhibitor:	0.977

ADMET: Metabolism

CYP1A2-inhibitor:	0.295	CYP1A2-substrate:	0.686
CYP2C19-inhibitor:	0.993	CYP2C19-substrate:	0.552
CYP2C9-inhibitor:	0.107	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.013
CYP3A4-inhibitor:	0.923	CYP3A4-substrate:	0.511
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.098
HLM stability:	0.863 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.743

Half-life (T1/2):

1.17

ADMET: Toxicity

hERG Blockers:	0.039	hERG Blockers (10um):	0.059
Human Hepatotoxicity (H-HT):	0.488	Drug-induced Liver Injury (DILI):	0.371
AMES Toxicity:	0.118	Rat Oral Acute Toxicity:	0.617
Maximum Recommended Daily Dose:	0.863	Skin Sensitization:	0.967
Carcinogencity:	0.513	Eye Corrosion:	0.003
Eye Irritation:	0.099	Respiratory Toxicity:	0.464
Drug-induced Neurotoxicity:	0.033	Ototoxicity:	0.469
Hematotoxicity:	0.238	Drug-induced Nephrotoxicity:	0.926
Genotoxicity:	0.915	RPMI-8226 Immunitoxicity:	0.069
A549 Cytotoxicity:	0.038	Hek293 Cytotoxicity:	0.37
BCF:	1.19 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.055 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.692 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.05 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO6442	Lippia turbinata	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11170663]
NPO6442	Lippia turbinata	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	1

Activity Type	# Activity
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT88	Organism	Mycobacterium tuberculosis	Mycobacterium tuberculosis	MIC	>	128000.0	nM	PMID[1517737]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475570 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	16714
0.1-0.2	29388
0.2-0.3	3342
0.3-0.4	347
0.4-0.5	50
0.5-0.6	5
0.6-0.7	7
0.7-0.8	0
0.8-0.85	3
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8553	High Similarity	NPC473576
0.8442	Intermediate Similarity	NPC473483
0.8101	Intermediate Similarity	NPC607691
0.8	Intermediate Similarity	NPC110861
0.6941	Remote Similarity	NPC268954
0.6941	Remote Similarity	NPC44170
0.6883	Remote Similarity	NPC474963
0.6667	Remote Similarity	NPC475156
0.6667	Remote Similarity	NPC476890
0.6506	Remote Similarity	NPC93744
0.6506	Remote Similarity	NPC476888
0.5862	Remote Similarity	NPC603645
0.5556	Remote Similarity	NPC476889
0.5517	Remote Similarity	NPC600880
0.5227	Remote Similarity	NPC474727
0.5111	Remote Similarity	NPC23241

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475570 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5130
0.1-0.2	3983
0.2-0.3	35
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data