NPASS Compound

Natural Product: NPC476889

Natural Product ID	NPC476889
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Icterogenin
IUPAC Name	(4R,4aS,6aR,6aS,6bR,8aR,9S,12aR,14bR)-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-4-[(Z)-2-methylbut-2-enoyl]oxy-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid
Synonyms	Icterogenin
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	45268134
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 93 97 0 0 0 0 0 0 0 0999 V2000 -8.2014 2.3595 1.6742 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9096 0.9750 2.0863 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8519 0.3374 1.6068 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6249 -1.0545 2.0692 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9301 0.9547 0.6592 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0804 2.1291 0.2367 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8528 0.2483 0.1981 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8840 0.7207 -0.7180 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0443 -0.1255 -1.9615 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6321 -1.5609 -1.7732 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3759 -1.6776 -0.8912 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7006 -0.3313 -1.0011 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4928 0.6971 -0.2030 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7935 2.0147 -0.4599 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3637 2.0483 -0.0507 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4683 0.9065 -0.6217 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3415 -0.3073 -0.4326 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1076 -1.3439 0.2115 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4476 -1.4609 0.8344 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3719 -0.5143 0.0902 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8574 0.8588 -0.0675 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8249 1.5790 -1.0243 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2457 1.4855 -0.5913 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6829 0.0506 -0.3789 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7917 -0.6751 0.5797 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1171 -2.1719 0.3904 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6044 -2.4351 0.4775 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3544 -1.1957 0.8234 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0741 -1.0747 1.7861 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1379 -0.0645 -0.1561 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8780 -0.5342 -1.4235 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8414 1.1653 0.2946 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2084 0.8271 0.4424 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9936 -0.3884 2.0206 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8913 1.7198 1.1639 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5375 1.2492 -2.1288 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5065 0.3612 1.2404 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5564 0.1582 1.8993 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3216 0.2502 1.9596 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6851 -2.3940 -1.1236 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3496 -2.1170 -3.1538 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1365 2.7096 2.1504 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3798 2.3743 0.5739 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3564 3.0088 1.9831 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5615 0.4710 2.7860 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4752 -1.7165 1.7851 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5539 -1.1139 3.1834 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7257 -1.5065 1.6027 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1312 1.7613 -1.0128 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1556 -0.1494 -2.1651 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5949 0.3578 -2.8290 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6502 -1.9596 0.1232 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7184 -2.4294 -1.3973 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7597 -0.0477 -2.0543 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0116 2.3712 -1.4791 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3322 2.7556 0.2062 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3417 2.1334 1.0299 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0530 3.0067 -0.4738 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5970 -2.2058 0.2873 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7992 -2.4969 0.6037 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4615 -1.3517 1.9091 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3975 -0.9597 -0.9308 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5967 2.6673 -1.0538 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7229 1.1191 -2.0198 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4608 2.1531 0.2351 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8600 1.8508 -1.4659 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4686 -0.4384 -1.3830 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6711 -2.5682 -0.5263 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6880 -2.6677 1.3119 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9487 -2.8242 -0.5151 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8675 -3.2205 1.2103 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3085 -1.3409 -1.9264 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8710 -0.9549 -1.1046 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9857 0.3193 -2.1016 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8293 1.9031 -0.5468 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5332 1.6018 1.2348 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6888 0.8590 -0.4004 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0262 -0.2460 2.5926 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4573 -1.2554 2.5907 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6955 0.4488 2.2395 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2682 1.4150 1.9926 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9212 1.8934 1.5410 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5636 2.7315 0.8473 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9606 0.4431 -2.7217 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5072 1.4762 -2.4998 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0302 2.2337 -2.2040 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2565 0.2508 2.9540 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3184 -2.9853 -0.2593 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0811 -3.1157 -1.8625 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5334 -1.7286 -0.8398 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7002 -3.1610 -3.2613 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9150 -1.5399 -3.9403 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2786 -2.0017 -3.4345 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 28 30 1 0 30 31 1 6 30 32 1 0 32 33 1 0 25 34 1 1 21 35 1 1 16 36 1 6 13 37 1 1 37 38 2 0 37 39 1 0 10 40 1 0 10 41 1 0 13 8 1 0 17 12 1 0 21 16 1 0 25 20 1 0 30 24 1 0 1 42 1 0 1 43 1 0 1 44 1 0 2 45 1 0 4 46 1 0 4 47 1 0 4 48 1 0 8 49 1 6 9 50 1 0 9 51 1 0 11 52 1 0 11 53 1 0 12 54 1 6 14 55 1 0 14 56 1 0 15 57 1 0 15 58 1 0 18 59 1 0 19 60 1 0 19 61 1 0 20 62 1 6 22 63 1 0 22 64 1 0 23 65 1 0 23 66 1 0 24 67 1 6 26 68 1 0 26 69 1 0 27 70 1 0 27 71 1 0 31 72 1 0 31 73 1 0 31 74 1 0 32 75 1 0 32 76 1 0 33 77 1 0 34 78 1 0 34 79 1 0 34 80 1 0 35 81 1 0 35 82 1 0 35 83 1 0 36 84 1 0 36 85 1 0 36 86 1 0 39 87 1 0 40 88 1 0 40 89 1 0 40 90 1 0 41 91 1 0 41 92 1 0 41 93 1 0 M END

Standard InCHIKey	NZQARWYKOBSGNY-GGIHXLTRSA-N
Standard InCHI	InChI=1S/C35H52O6/c1-9-21(2)28(38)41-27-19-30(3,4)18-23-22-10-11-25-31(5)14-13-26(37)32(6,20-36)24(31)12-15-34(25,8)33(22,7)16-17-35(23,27)29(39)40/h9-10,23-25,27,36H,11-20H2,1-8H3,(H,39,40)/b21-9-/t23-,24-,25-,27-,31+,32-,33-,34-,35+/m1/s1
SMILES	C/C=C(/C)\C(=O)O[C@@H]1CC(C[C@H]2[C@]1(CC[C@@]3(C2=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCC(=O)[C@]5(C)CO)C)C)C)C(=O)O)(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	568.38	Volume:	610.693 ? Van der Waals volume.
Dense:	0.931	LogP:	3.972 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.364 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.833 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	5.0	Rigid Bonds:	30.0
TPSA:	100.9 ? Topological Polar Surface Area.	H-Bond Acceptor:	6.0
H-Bond Donor:	2.0	Rings:	5.0
Heavy Atoms:	6.0

MedChem Properties

QED Drug-Likeness Score:	0.217	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.197	Fsp³:	0.8
MCE-18:	109.333 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.828	Fluc inhibitor:	0.003 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.01 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.382	Promiscuous compounds:	0.102

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.373	MDCK Permeability:	-5.084
Pgp-inhibitor:	0.174	Pgp-substrate:	0.001
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.406	30% Bioavailability (F30%):	0.161
50% Bioavailability (F50%):	0.988

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.684	MRP1:	0.987
Plasma Protein Binding (PPB):	95.626%	Volume Distribution (VD):	-0.076
Fu:	4.245% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.991	BCRP inhibitor:	0.16
BSEP inhibitor:	0.997

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.002
CYP2C19-inhibitor:	0.961	CYP2C19-substrate:	0.158
CYP2C9-inhibitor:	0.071	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.273
CYP3A4-inhibitor:	0.838	CYP3A4-substrate:	0.968
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.027
HLM stability:	0.04 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.521

Half-life (T1/2):

0.809

ADMET: Toxicity

hERG Blockers:	0.01	hERG Blockers (10um):	0.013
Human Hepatotoxicity (H-HT):	0.633	Drug-induced Liver Injury (DILI):	0.846
AMES Toxicity:	0.367	Rat Oral Acute Toxicity:	0.436
Maximum Recommended Daily Dose:	0.349	Skin Sensitization:	0.99
Carcinogencity:	0.923	Eye Corrosion:	0.008
Eye Irritation:	0.169	Respiratory Toxicity:	0.63
Drug-induced Neurotoxicity:	0.05	Ototoxicity:	0.558
Hematotoxicity:	0.83	Drug-induced Nephrotoxicity:	0.989
Genotoxicity:	0.987	RPMI-8226 Immunitoxicity:	0.061
A549 Cytotoxicity:	0.106	Hek293 Cytotoxicity:	0.131
BCF:	0.889 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.943 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.689 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.873 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33642	Combretum sundaicum	Species	Combretaceae	Eukaryota	leaves, flowers	Bac Son, Lang Son Province, Vietnam	1997-JUL	PMID[19572612]
NPO33642	Combretum sundaicum	Species	Combretaceae	Eukaryota	leaves	Bac Son, Lang Son Province, Vietnam	1997-JUL	PMID[19572612]
NPO33642	Combretum sundaicum	Species	Combretaceae	Eukaryota	flowers	Bac Son, Lang Son Province, Vietnam	1997-JUL	PMID[19572612]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Ki	1
IC50	4

Activity Type	# Activity
Individual protein	1
Cell line	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2796	Individual protein	Apoptosis regulator Bcl-X	Homo sapiens	Ki	=	7600	nM	PMID[19572612]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT393	Cell line	HCT-116	Homo sapiens	IC50	=	5800	nM	PMID[19572612]
NPT137	Cell line	L1210	Mus musculus	IC50	=	6800	nM	PMID[19572612]
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	11300	nM	PMID[19572612]
NPT91	Cell line	KB	Homo sapiens	IC50	=	15000	nM	PMID[19572612]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC476889 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19428
0.1-0.2	25427
0.2-0.3	4170
0.3-0.4	621
0.4-0.5	182
0.5-0.6	19
0.6-0.7	3
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.84	Intermediate Similarity	NPC476890
0.7662	Intermediate Similarity	NPC603645
0.7273	Intermediate Similarity	NPC600880
0.7089	Intermediate Similarity	NPC93744
0.7089	Intermediate Similarity	NPC476888
0.7027	Intermediate Similarity	NPC158141
0.679	Remote Similarity	NPC40918
0.6667	Remote Similarity	NPC473483
0.6076	Remote Similarity	NPC173089
0.5926	Remote Similarity	NPC148964
0.5783	Remote Similarity	NPC6255
0.5663	Remote Similarity	NPC488521
0.5618	Remote Similarity	NPC473576
0.5556	Remote Similarity	NPC475570
0.5402	Remote Similarity	NPC23241
0.5301	Remote Similarity	NPC120840
0.5269	Remote Similarity	NPC268954
0.5269	Remote Similarity	NPC44170
0.5185	Remote Similarity	NPC267691
0.5181	Remote Similarity	NPC38754
0.5122	Remote Similarity	NPC480946
0.5122	Remote Similarity	NPC130577
0.5122	Remote Similarity	NPC142415
0.5122	Remote Similarity	NPC102683
0.5116	Remote Similarity	NPC296164
0.506	Remote Similarity	NPC270768
0.506	Remote Similarity	NPC59263
0.506	Remote Similarity	NPC210106

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC476889 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5693
0.1-0.2	3408
0.2-0.3	44
0.3-0.4	4
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data