NPASS Compound

Natural Product: NPC472940

Natural Product ID	NPC472940
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HZCCGGOBXSVZRJ-XRLJWPMHSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3594158
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 80 83 0 0 0 0 0 0 0 0999 V2000 8.6573 0.9398 -0.0055 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6747 -0.0469 0.2184 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5529 0.4654 1.0025 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3178 0.4839 0.5532 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9723 -0.0116 -0.7845 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2000 -1.2862 -0.7792 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8783 -1.2925 -0.1029 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9193 -0.2735 -0.6796 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7372 -0.5812 -2.1839 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2657 -0.5042 -2.4719 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2411 0.3069 -1.3315 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5293 -0.3366 -0.1622 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0613 -1.7676 -0.0670 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2409 0.4446 1.0752 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1325 1.0636 1.1396 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0753 0.4389 0.1685 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6729 0.0640 -1.0309 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5848 -0.5409 -1.9761 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2368 -0.6029 -3.1761 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8748 -1.0483 -1.4575 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3795 0.0746 -0.5339 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4787 0.2688 0.6321 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5013 -0.8949 1.6023 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9274 1.4829 1.4259 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2567 2.0307 0.9761 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2407 0.9543 0.7139 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3236 1.0021 1.2460 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8340 -0.1374 -0.2010 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5720 0.0213 -1.5429 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1695 -1.5046 0.2951 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0757 1.7548 -1.4834 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0095 -1.1996 1.3751 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8530 0.9911 2.3890 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6685 1.4240 2.9581 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8251 1.0523 -0.9789 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4478 -0.5554 -0.7192 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2008 -0.8421 0.8557 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5273 0.9240 1.2164 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8160 -0.0305 -1.5121 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3230 0.8275 -1.2248 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8019 -2.1138 -0.2768 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1282 -1.6902 -1.8437 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4496 -2.3283 -0.2999 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3030 0.7557 -0.5460 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2792 0.1513 -2.7950 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0833 -1.6037 -2.4101 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1811 -1.5090 -2.5477 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0792 0.0861 -3.4174 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3227 -2.1412 0.9415 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0449 -1.8498 -0.1597 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5133 -2.3903 -0.8510 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3575 -0.2475 1.9494 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9886 1.2501 1.2128 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5214 0.9754 2.1703 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0851 2.1407 0.8930 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7023 -1.9839 -0.8823 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6385 -1.1563 -2.2474 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3273 0.9951 -1.1576 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1453 -1.8336 1.1732 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4610 -0.9384 2.1314 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7469 -0.6326 2.4034 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9495 1.2780 2.5356 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1554 2.2794 1.2565 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0992 2.5750 -0.0008 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6055 2.7723 1.7005 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9990 0.6698 -2.2330 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6600 -0.9725 -2.0322 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5574 0.4966 -1.3865 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6632 -1.3748 1.3032 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3432 -2.2199 0.3085 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9797 -2.0111 -0.3106 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7214 2.1717 -0.6886 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6257 1.9253 -2.4425 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8552 2.3732 -1.4884 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0792 -1.3270 1.7135 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4951 -2.0683 1.8944 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6807 -0.2456 1.8149 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5850 1.8069 2.2465 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3107 0.2177 3.0155 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6648 1.1846 3.9150 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 3 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 1 12 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 2 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 28 30 1 0 11 31 1 6 7 32 1 0 3 33 1 0 33 34 1 0 12 8 1 0 22 16 1 0 17 11 1 0 28 21 1 0 1 35 1 0 2 36 1 0 2 37 1 0 4 38 1 0 5 39 1 0 5 40 1 0 6 41 1 0 6 42 1 0 7 43 1 1 8 44 1 6 9 45 1 0 9 46 1 0 10 47 1 0 10 48 1 0 13 49 1 0 13 50 1 0 13 51 1 0 14 52 1 0 14 53 1 0 15 54 1 0 15 55 1 0 20 56 1 0 20 57 1 0 21 58 1 6 23 59 1 0 23 60 1 0 23 61 1 0 24 62 1 0 24 63 1 0 25 64 1 0 25 65 1 0 29 66 1 0 29 67 1 0 29 68 1 0 30 69 1 0 30 70 1 0 30 71 1 0 31 72 1 0 31 73 1 0 31 74 1 0 32 75 1 0 32 76 1 0 32 77 1 0 33 78 1 0 33 79 1 0 34 80 1 0 M END

Standard InCHIKey	HZCCGGOBXSVZRJ-XRLJWPMHSA-N
Standard InCHI	InChI=1S/C30H46O4/c1-19(8-7-9-20(17-31)18-32)21-10-15-30(6)26-22(11-14-29(21,30)5)28(4)13-12-25(34)27(2,3)24(28)16-23(26)33/h9,19,21,24,31-32H,7-8,10-18H2,1-6H3/t19-,21-,24+,28-,29-,30+/m1/s1
SMILES	OCC(=CCC[C@H]([C@H]1CC[C@@]2([C@]1(C)CCC1=C2C(=O)C[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C)CO

Calculated Properties

Physi-Chem Properties

Molecular Weight:	470.34	Volume:	517.825 ? Van der Waals volume.
Dense:	0.908	LogP:	3.438 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.634 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.593 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	23.0
TPSA:	74.6 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	2.0	Rings:	4.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.48	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.861	Fsp³:	0.8
MCE-18:	79.407 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.642	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.562	Promiscuous compounds:	0.567

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.72	MDCK Permeability:	-4.561
Pgp-inhibitor:	0.93	Pgp-substrate:	0.001
PAMPA:	0.536 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.017	30% Bioavailability (F30%):	0.06
50% Bioavailability (F50%):	0.819

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.089	MRP1:	0.923
Plasma Protein Binding (PPB):	73.828%	Volume Distribution (VD):	0.313
Fu:	25.85% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	0.996	BCRP inhibitor:	0.116
BSEP inhibitor:	0.999

ADMET: Metabolism

CYP1A2-inhibitor:	0.002	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.31	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.023
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.998
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

6.871

Half-life (T1/2):

0.813

ADMET: Toxicity

hERG Blockers:	0.009	hERG Blockers (10um):	0.063
Human Hepatotoxicity (H-HT):	0.595	Drug-induced Liver Injury (DILI):	0.064
AMES Toxicity:	0.301	Rat Oral Acute Toxicity:	0.098
Maximum Recommended Daily Dose:	0.303	Skin Sensitization:	0.99
Carcinogencity:	0.896	Eye Corrosion:	0.007
Eye Irritation:	0.562	Respiratory Toxicity:	0.499
Drug-induced Neurotoxicity:	0.033	Ototoxicity:	0.77
Hematotoxicity:	0.784	Drug-induced Nephrotoxicity:	0.876
Genotoxicity:	0.342	RPMI-8226 Immunitoxicity:	0.067
A549 Cytotoxicity:	0.098	Hek293 Cytotoxicity:	0.427
BCF:	0.839 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.65 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.397 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.53 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33020	ganoderma leucocontextum	Species	Ganodermataceae	Eukaryota	fruiting bodies	Tibetan	n.a.	PMID[26287401]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Individual protein	1
Cell line	2
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1088	Individual protein	3-hydroxy-3-methylglutaryl-coenzyme A reductase	Sus scrofa	IC50	=	12600.0	nM	PMID[1919590]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT111	Cell line	K562	Homo sapiens	IC50	=	41600.0	nM	PMID[19140696]
NPT306	Cell line	PC-3	Homo sapiens	IC50	>	200000.0	nM	PMID[17958396]
NPT2	Others	Unspecified	n.a.	IC50	>	50000.0	nM	PMID[2553871]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC472940 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22231
0.1-0.2	24397
0.2-0.3	2845
0.3-0.4	295
0.4-0.5	53
0.5-0.6	21
0.6-0.7	7
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9286	High Similarity	NPC41539
0.8136	Intermediate Similarity	NPC472931
0.8103	Intermediate Similarity	NPC90965
0.7097	Intermediate Similarity	NPC99909
0.7077	Intermediate Similarity	NPC318332
0.6923	Remote Similarity	NPC8571
0.6769	Remote Similarity	NPC69454
0.6462	Remote Similarity	NPC311092
0.6324	Remote Similarity	NPC472930
0.6308	Remote Similarity	NPC275740
0.6308	Remote Similarity	NPC86319
0.6308	Remote Similarity	NPC605549
0.597	Remote Similarity	NPC4166
0.5775	Remote Similarity	NPC472932
0.5571	Remote Similarity	NPC162703
0.5441	Remote Similarity	NPC484799
0.5342	Remote Similarity	NPC601194
0.5286	Remote Similarity	NPC259286
0.5286	Remote Similarity	NPC83216
0.5286	Remote Similarity	NPC484085
0.5278	Remote Similarity	NPC472942
0.527	Remote Similarity	NPC456
0.527	Remote Similarity	NPC472941
0.527	Remote Similarity	NPC202814
0.5263	Remote Similarity	NPC478297
0.5217	Remote Similarity	NPC110021
0.5217	Remote Similarity	NPC474083
0.5217	Remote Similarity	NPC170793
0.5217	Remote Similarity	NPC482426
0.5211	Remote Similarity	NPC142253
0.5211	Remote Similarity	NPC3511
0.52	Remote Similarity	NPC489798
0.5143	Remote Similarity	NPC482424

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC472940 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7321
0.1-0.2	1690
0.2-0.3	138
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data