NPASS drugs

Drug Information

Drug ID:	NPD6902
Drug Name:	Calcipotriene
Molecular Formula:	C27H40O3
Canonical SMILES:	O[C@H]1C[C@H](O)C(=C)/C(=CC=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@@H](/C=C/[C@H](C2CC2)O)C)C)/C1
Standard InCHI:	"InChI=1S/C27H40O3/c1-17(6-13-25(29)20-8-9-20)23-11-12-24-19(5-4-14-27(23,24)3)7-10-21-15-22(28)16-26(30)18(21)2/h6-7,10,13,17,20,22-26,28-30H,2,4-5,8-9,11-12,14-16H2,1,3H3/b13-6+,19-7+,21-10-/t17-,22-,23-,24+,25-,26+,27-/m1/s1"
Standard InCHIKey:	LWQQLNNNIPYSNX-UROSTWAQSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD6902

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	102202
0.1-0.2	102466
0.2-0.3	6702
0.3-0.4	299
0.4-0.5	43
0.5-0.6	5
0.6-0.7	21
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7797	NPC316856
Intermediate Similarity	0.7797	NPC607632
Remote Similarity	0.6774	NPC63893
Remote Similarity	0.6774	NPC324772
Remote Similarity	0.6774	NPC611865
Remote Similarity	0.6667	NPC320525
Remote Similarity	0.6667	NPC320548
Remote Similarity	0.6364	NPC23466
Remote Similarity	0.629	NPC153043
Remote Similarity	0.629	NPC49422
Remote Similarity	0.629	NPC58258
Remote Similarity	0.629	NPC220569
Remote Similarity	0.629	NPC67059
Remote Similarity	0.629	NPC220672
Remote Similarity	0.629	NPC104448
Remote Similarity	0.629	NPC120474
Remote Similarity	0.629	NPC9161
Remote Similarity	0.629	NPC178317
Remote Similarity	0.629	NPC5386
Remote Similarity	0.629	NPC287442
Remote Similarity	0.629	NPC146946
Remote Similarity	0.629	NPC611829
Remote Similarity	0.6269	NPC324848
Remote Similarity	0.5758	NPC325017
Remote Similarity	0.5556	NPC611620
Remote Similarity	0.5075	NPC269877
Remote Similarity	0.5075	NPC491268
Remote Similarity	0.5075	NPC611772

Drug Structure

NPD6902 OpenBabel08211710072D 33 36 0 0 1 0 0 0 0 0999 V2000 -2.0303 -0.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5878 -0.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3904 1.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6984 4.5188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6494 4.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3364 1.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6581 1.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0814 2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7213 0.4612 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3301 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4415 3.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7431 0.6691 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7505 2.8986 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1962 2.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9282 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7287 2.6907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7942 0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0377 1.7396 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 3.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 18 2 0 0 0 0 4 5 1 0 0 0 0 4 14 1 0 0 0 0 5 19 1 0 0 0 0 6 13 2 0 0 0 0 6 17 1 0 0 0 0 7 10 1 0 0 0 0 7 19 2 0 0 0 0 8 9 1 0 0 0 0 8 20 1 0 0 0 0 9 20 1 0 0 0 0 10 21 2 0 0 0 0 11 12 1 0 0 0 0 11 23 1 0 0 0 0 12 24 1 0 0 0 0 14 27 1 0 0 0 0 15 21 1 0 0 0 0 15 22 1 0 0 0 0 16 22 1 0 0 0 0 16 26 1 0 0 0 0 17 1 1 6 0 0 0 17 23 1 0 0 0 0 18 21 1 0 0 0 0 18 26 1 0 0 0 0 19 24 1 0 0 0 0 20 25 1 0 0 0 0 22 28 1 6 0 0 0 23 27 1 1 0 0 0 24 27 1 1 0 0 0 25 13 1 1 0 0 0 25 29 1 0 0 0 0 26 30 1 1 0 0 0 27 3 1 1 0 0 0 28 31 1 0 0 0 0 29 32 1 0 0 0 0 30 33 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000292
DrugBank	DB02300
ChEMBL	CHEMBL1200666
IUPHAR/BPS	2778
PharmaGKB	PA448714
KEGG Drug	D01125
PubChem CID	5288783
ChEBI	50749
CAS Number	112965-21-6

Drug Properties

Molecular Weight	412.3
ALogP	0.5599
MLogP	4.1
XLogP	5.82
HDA	3
HBD	3
Rotatable Bonds	10
TPSA	60.69
RO5 Violation	1