NPASS Compound

Natural Product: NPC2983

Natural Product ID	NPC2983
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Meliastatin 1
IUPAC Name	(5R,9R,10R,13S,14S,16S,17S)-16-hydroxy-17-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one
Synonyms	Meliastatin 1
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL465433
PubChem CID	637062
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 81 84 0 0 0 0 0 0 0 0999 V2000 4.1067 -0.8944 -1.6513 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0214 -0.1112 -0.8809 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7068 -0.7523 -1.0019 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2506 -0.9192 -2.4650 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9746 -1.9419 -3.0741 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2254 -1.2165 -2.4071 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5224 -1.0803 -0.9622 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4749 -0.0010 -0.5807 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4378 1.2197 -1.4150 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3199 0.3384 0.8202 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0707 0.7918 1.1505 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1165 0.5401 0.1166 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8890 -0.7430 -0.5732 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9143 -1.5264 -0.8286 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3351 -1.2738 -0.4740 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5166 0.1969 -0.3238 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5262 0.6921 0.6750 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6310 -0.0438 1.9943 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8006 2.1468 0.9910 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7675 2.7921 0.0525 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0332 2.0215 0.1489 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0487 2.5898 0.4597 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9246 0.5708 -0.1580 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5734 0.4355 -1.5537 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7618 -0.2660 0.7551 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1635 -2.4341 -0.3927 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5879 -0.2631 0.5575 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9456 0.3387 0.6385 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9888 -0.4157 0.9792 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3555 0.1593 1.0678 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7633 0.5764 -0.2185 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2985 -0.8848 1.6015 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3882 1.3996 1.9384 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1463 -1.9300 -1.2599 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0629 -0.4073 -1.3665 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9866 -0.8060 -2.7240 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1312 0.9567 -1.0655 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7483 -1.6856 -0.4619 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3705 0.0440 -2.9776 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0729 -1.8053 -4.0512 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8379 -0.6111 -3.0851 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3514 -2.2627 -2.7785 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0834 2.1309 -0.8263 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1675 1.1953 -2.3162 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4214 1.5961 -1.7623 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6243 -0.5381 1.4489 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9824 1.2088 1.1133 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1001 1.8317 1.5507 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3875 0.1748 2.0515 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1208 1.3056 -0.7187 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8050 -2.4980 -1.3677 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0423 -1.7154 -1.2308 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5203 -1.8482 0.4561 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1764 0.6384 -1.3144 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1300 -1.0256 1.9853 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2176 0.5998 2.8207 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6944 -0.1811 2.2751 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1340 2.3167 2.0281 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8307 2.7118 0.8955 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3774 2.7961 -0.9720 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9073 3.8369 0.3940 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4602 1.0823 -1.5999 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8545 -0.6050 -1.7653 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8482 0.7973 -2.3026 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3931 -1.2595 0.9894 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9828 0.2389 1.7402 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7970 -0.4220 0.3258 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4428 -3.0869 -1.0614 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2210 -2.3710 0.6420 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1437 -3.0116 -0.4092 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9260 0.0902 1.3297 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6583 -1.3858 0.6739 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0698 1.3730 0.4220 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8163 -1.4503 1.1883 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7094 0.3039 -0.3048 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2284 -0.8868 0.9616 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5680 -0.6741 2.6508 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8388 -1.8964 1.5943 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0558 2.2418 1.3243 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4641 1.5909 2.1788 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8508 1.2600 2.8779 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 1 6 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 1 17 19 1 0 19 20 1 0 20 21 1 0 21 22 2 0 21 23 1 0 23 24 1 0 23 25 1 0 7 26 1 1 2 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 30 32 1 0 30 33 1 0 8 3 1 0 17 12 1 0 13 7 1 0 23 16 1 0 1 34 1 0 1 35 1 0 1 36 1 0 2 37 1 6 3 38 1 1 4 39 1 6 5 40 1 0 6 41 1 0 6 42 1 0 9 43 1 0 9 44 1 0 9 45 1 0 10 46 1 0 10 47 1 0 11 48 1 0 11 49 1 0 12 50 1 6 14 51 1 0 15 52 1 0 15 53 1 0 16 54 1 6 18 55 1 0 18 56 1 0 18 57 1 0 19 58 1 0 19 59 1 0 20 60 1 0 20 61 1 0 24 62 1 0 24 63 1 0 24 64 1 0 25 65 1 0 25 66 1 0 25 67 1 0 26 68 1 0 26 69 1 0 26 70 1 0 27 71 1 0 27 72 1 0 28 73 1 0 29 74 1 0 31 75 1 0 32 76 1 0 32 77 1 0 32 78 1 0 33 79 1 0 33 80 1 0 33 81 1 0 M END

Standard InCHIKey	OYVJTMFTUKBWID-LKJGIETFSA-N
Standard InCHI	InChI=1S/C30H48O3/c1-19(10-9-15-26(2,3)33)25-22(31)18-30(8)21-11-12-23-27(4,5)24(32)14-16-28(23,6)20(21)13-17-29(25,30)7/h9,11,15,19-20,22-23,25,31,33H,10,12-14,16-18H2,1-8H3/b15-9+/t19-,20+,22+,23+,25-,28-,29+,30-/m1/s1
SMILES	C[C@@H]([C@@H]1[C@@H](O)C[C@]2([C@@]1(C)CC[C@H]1C2=CC[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C/C=C/C(O)(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	456.36	Volume:	511.671 ? Van der Waals volume.
Dense:	0.892	LogP:	4.188 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.739 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.917 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	22.0
TPSA:	57.53 ? Topological Polar Surface Area.	H-Bond Acceptor:	3.0
H-Bond Donor:	2.0	Rings:	4.0
Heavy Atoms:	3.0

MedChem Properties

QED Drug-Likeness Score:	0.476	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.041	Fsp³:	0.833
MCE-18:	85.309 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.835	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.367	Promiscuous compounds:	0.308

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.893	MDCK Permeability:	-4.802
Pgp-inhibitor:	0.992	Pgp-substrate:	0.0
PAMPA:	0.017 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.022	30% Bioavailability (F30%):	0.049
50% Bioavailability (F50%):	0.761

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.204
Plasma Protein Binding (PPB):	84.127%	Volume Distribution (VD):	-0.153
Fu:	17.903% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.233
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.818	CYP1A2-substrate:	0.006
CYP2C19-inhibitor:	0.999	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	1.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.997
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.891 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

11.095

Half-life (T1/2):

0.472

ADMET: Toxicity

hERG Blockers:	0.084	hERG Blockers (10um):	0.237
Human Hepatotoxicity (H-HT):	0.688	Drug-induced Liver Injury (DILI):	0.267
AMES Toxicity:	0.111	Rat Oral Acute Toxicity:	0.345
Maximum Recommended Daily Dose:	0.824	Skin Sensitization:	0.741
Carcinogencity:	0.86	Eye Corrosion:	0.0
Eye Irritation:	0.041	Respiratory Toxicity:	0.691
Drug-induced Neurotoxicity:	0.227	Ototoxicity:	0.811
Hematotoxicity:	0.69	Drug-induced Nephrotoxicity:	0.729
Genotoxicity:	0.944	RPMI-8226 Immunitoxicity:	0.104
A549 Cytotoxicity:	0.283	Hek293 Cytotoxicity:	0.67
BCF:	1.321 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.736 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.377 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.606 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO18596	Melia dubia	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12502333]
NPO18596	Melia dubia	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18596	Melia dubia	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	1
GI50	6

Activity Type	# Activity
Cell line	7

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT168	Cell line	P388	Mus musculus	ED50	=	2.5	ug ml-1	PubChem BioAssay data set
NPT83	Cell line	MCF7	Homo sapiens	GI50	=	1.9	ug.mL-1	PubChem BioAssay data set
NPT395	Cell line	SF-268	Homo sapiens	GI50	=	1.9	ug.mL-1	PMID[23816880]
NPT575	Cell line	KM-20L2	Homo sapiens	GI50	=	1.9	ug.mL-1	PMID[23816880]
NPT397	Cell line	NCI-H460	Homo sapiens	GI50	=	1.9	ug.mL-1	PMID[24249037]
NPT1081	Cell line	BXPC-3	Homo sapiens	GI50	=	1.9	ug.mL-1	PMID[24287561]
NPT90	Cell line	DU-145	Homo sapiens	GI50	=	1.9	ug.mL-1	PMID[24079775]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC2983 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21540
0.1-0.2	24105
0.2-0.3	3775
0.3-0.4	363
0.4-0.5	34
0.5-0.6	25
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7966	Intermediate Similarity	NPC82902
0.7937	Intermediate Similarity	NPC107243
0.7903	Intermediate Similarity	NPC320026
0.7419	Intermediate Similarity	NPC469994
0.7377	Intermediate Similarity	NPC474218
0.7143	Intermediate Similarity	NPC171441
0.7077	Intermediate Similarity	NPC317590
0.6716	Remote Similarity	NPC154101
0.6338	Remote Similarity	NPC57416
0.6286	Remote Similarity	NPC218383
0.6286	Remote Similarity	NPC474327
0.597	Remote Similarity	NPC90652
0.597	Remote Similarity	NPC155255
0.597	Remote Similarity	NPC260992
0.5846	Remote Similarity	NPC470078
0.5735	Remote Similarity	NPC470052
0.5735	Remote Similarity	NPC470417
0.5714	Remote Similarity	NPC486521
0.5714	Remote Similarity	NPC262870
0.5634	Remote Similarity	NPC67831
0.5634	Remote Similarity	NPC174051
0.5571	Remote Similarity	NPC318390
0.5493	Remote Similarity	NPC471224
0.5405	Remote Similarity	NPC273669
0.5405	Remote Similarity	NPC484802
0.5405	Remote Similarity	NPC118647
0.5373	Remote Similarity	NPC1319
0.5256	Remote Similarity	NPC484792
0.5217	Remote Similarity	NPC470223
0.5195	Remote Similarity	NPC121566
0.5195	Remote Similarity	NPC100955
0.5135	Remote Similarity	NPC479667
0.5132	Remote Similarity	NPC73506
0.5072	Remote Similarity	NPC247220
0.5063	Remote Similarity	NPC189282
0.5063	Remote Similarity	NPC237402

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC2983 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7384
0.1-0.2	1664
0.2-0.3	101
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data