NPASS Compound

Natural Product: NPC237402

Natural Product ID	NPC237402
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	IMIFPTNQMZAQRL-GFYVDCOPSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	42639332
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 89 93 0 0 0 0 0 0 0 0999 V2000 3.4565 -3.7048 -0.6147 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1470 -2.5540 -1.2522 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7045 -1.2937 -0.9219 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8359 -1.0490 0.4009 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8905 -0.2662 1.1471 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1784 1.1427 0.5722 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6875 1.0359 0.7267 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4370 2.1260 0.0418 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5351 2.0440 -1.4357 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2067 0.7738 -1.9035 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4658 3.1901 -1.8716 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3245 2.1801 -2.1034 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9199 3.3591 0.4463 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0420 -0.2404 0.4533 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5278 -0.5126 1.4415 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2674 -1.7606 2.2556 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2560 -1.9684 2.1647 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7292 -0.6895 1.4817 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7457 0.3692 2.5471 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0214 -0.7663 0.8347 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0545 -1.4287 1.3091 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3879 -1.5531 0.7179 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6208 -0.5851 -0.3836 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0465 -0.1405 -0.5052 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8899 -0.4210 0.7116 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7641 -0.8348 -1.6727 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1745 1.3257 -0.7953 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0327 2.0208 -0.2996 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2184 1.9734 -1.7276 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8625 1.3299 -1.6933 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6354 0.5937 -0.3913 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8150 1.4417 0.8124 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2370 -0.0472 -0.4493 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2172 0.9467 -0.7886 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1805 0.6646 -0.3455 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4130 -0.5343 0.4731 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3412 -1.8237 -0.3462 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0351 -4.6551 -0.8388 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3517 -3.6906 0.4642 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4830 -3.8908 -1.1606 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1489 -2.7103 -2.3722 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2501 -2.6826 -1.0024 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1884 -1.9508 0.9803 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3903 -0.1387 2.1821 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7516 1.9266 1.2121 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9640 1.2036 -0.4876 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8424 1.1680 1.8470 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4979 2.1296 0.4318 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4606 0.1388 -2.4634 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9935 0.9844 -2.6720 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7160 0.2224 -1.1000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0221 2.9136 -2.7864 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2305 3.3175 -1.0659 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9068 4.1063 -2.0727 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4079 1.7572 -2.9998 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0790 3.5938 0.0106 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2302 0.3313 2.1631 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4511 -1.5514 3.3472 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8280 -2.6387 1.9492 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4641 -2.8709 1.5948 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7189 -2.0844 3.1562 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4930 1.3816 2.2084 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2455 0.0599 3.5008 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8291 0.4609 2.8740 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8948 -1.9538 2.2691 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1963 -1.5337 1.4881 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4658 -2.5979 0.2913 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3877 -1.1118 -1.3606 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8703 0.1105 0.5206 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5145 0.0058 1.6410 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1090 -1.5066 0.8000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6205 -0.2747 -2.6196 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3320 -1.8420 -1.8223 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8615 -0.8702 -1.4905 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1107 3.0600 -1.5295 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6089 1.9096 -2.7805 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8473 0.5356 -2.4940 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0511 2.0583 -1.9023 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2708 0.8477 1.6315 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4586 2.3509 0.6356 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8744 1.8539 1.2272 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3467 -0.8240 -1.2310 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5130 1.9347 -0.3625 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2578 1.1158 -1.9079 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6334 1.5461 0.1715 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8092 0.5499 -1.2801 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5863 -1.6590 -1.4136 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7004 -2.2508 -0.3584 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9324 -2.6288 0.1397 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 9 11 1 0 9 12 1 0 8 13 1 0 7 14 1 0 5 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 1 18 20 1 0 20 21 2 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 24 27 1 0 27 28 2 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 1 31 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 6 14 4 1 0 36 15 1 0 36 18 1 0 33 20 1 0 31 23 1 0 1 38 1 0 1 39 1 0 1 40 1 0 2 41 1 0 2 42 1 0 4 43 1 1 5 44 1 1 6 45 1 0 6 46 1 0 7 47 1 1 8 48 1 1 10 49 1 0 10 50 1 0 10 51 1 0 11 52 1 0 11 53 1 0 11 54 1 0 12 55 1 0 13 56 1 0 15 57 1 1 16 58 1 0 16 59 1 0 17 60 1 0 17 61 1 0 19 62 1 0 19 63 1 0 19 64 1 0 21 65 1 0 22 66 1 0 22 67 1 0 23 68 1 6 25 69 1 0 25 70 1 0 25 71 1 0 26 72 1 0 26 73 1 0 26 74 1 0 29 75 1 0 29 76 1 0 30 77 1 0 30 78 1 0 32 79 1 0 32 80 1 0 32 81 1 0 33 82 1 6 34 83 1 0 34 84 1 0 35 85 1 0 35 86 1 0 37 87 1 0 37 88 1 0 37 89 1 0 M END

Standard InCHIKey	IMIFPTNQMZAQRL-GFYVDCOPSA-N
Standard InCHI	InChI=1S/C32H52O5/c1-9-36-27-19(18-23(37-27)26(34)29(4,5)35)20-12-16-32(8)22-10-11-24-28(2,3)25(33)14-15-30(24,6)21(22)13-17-31(20,32)7/h10,19-21,23-24,26-27,34-35H,9,11-18H2,1-8H3/t19-,20-,21-,23+,24-,26-,27-,30+,31-,32+/m0/s1
SMILES	CCO[C@@H]1[C@@H](C[C@H]([C@@H](C(C)(C)O)O)O1)[C@@H]1CC[C@]2(C)C3=CC[C@H]4C(C)(C)C(=O)CC[C@]4(C)[C@H]3CC[C@@]12C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	516.38	Volume:	557.924 ? Van der Waals volume.
Dense:	0.926	LogP:	3.646 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.622 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.754 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	5.0	Rigid Bonds:	26.0
TPSA:	75.99 ? Topological Polar Surface Area.	H-Bond Acceptor:	5.0
H-Bond Donor:	2.0	Rings:	5.0
Heavy Atoms:	5.0

MedChem Properties

QED Drug-Likeness Score:	0.435	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.152	Fsp³:	0.906
MCE-18:	101.016 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.88	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.261	Promiscuous compounds:	0.505

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.72	MDCK Permeability:	-4.829
Pgp-inhibitor:	0.199	Pgp-substrate:	0.001
PAMPA:	0.411 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.001	30% Bioavailability (F30%):	0.001
50% Bioavailability (F50%):	0.314

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.253	MRP1:	0.63
Plasma Protein Binding (PPB):	89.753%	Volume Distribution (VD):	0.234
Fu:	12.15% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.749
BSEP inhibitor:	0.999

ADMET: Metabolism

CYP1A2-inhibitor:	0.924	CYP1A2-substrate:	0.009
CYP2C19-inhibitor:	0.99	CYP2C19-substrate:	0.093
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.999
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.743 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

10.728

Half-life (T1/2):

0.628

ADMET: Toxicity

hERG Blockers:	0.161	hERG Blockers (10um):	0.442
Human Hepatotoxicity (H-HT):	0.72	Drug-induced Liver Injury (DILI):	0.609
AMES Toxicity:	0.502	Rat Oral Acute Toxicity:	0.619
Maximum Recommended Daily Dose:	0.75	Skin Sensitization:	0.663
Carcinogencity:	0.737	Eye Corrosion:	0.003
Eye Irritation:	0.397	Respiratory Toxicity:	0.481
Drug-induced Neurotoxicity:	0.192	Ototoxicity:	0.686
Hematotoxicity:	0.599	Drug-induced Nephrotoxicity:	0.825
Genotoxicity:	0.974	RPMI-8226 Immunitoxicity:	0.086
A549 Cytotoxicity:	0.173	Hek293 Cytotoxicity:	0.51
BCF:	1.792 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.137 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.538 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.951 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19586051]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	stems	n.a.	n.a.	PMID[20095629]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25506718]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27494664]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[30917277]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Non-molecular	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	10000.0	nM	PMID[27494664]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC237402 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	17991
0.1-0.2	25207
0.2-0.3	6153
0.3-0.4	399
0.4-0.5	53
0.5-0.6	32
0.6-0.7	16
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC189282
0.8824	High Similarity	NPC121566
0.8824	High Similarity	NPC100955
0.7568	Intermediate Similarity	NPC484792
0.7534	Intermediate Similarity	NPC63023
0.7534	Intermediate Similarity	NPC95243
0.6757	Remote Similarity	NPC5358
0.6757	Remote Similarity	NPC216260
0.6667	Remote Similarity	NPC85593
0.6667	Remote Similarity	NPC31430
0.6667	Remote Similarity	NPC484794
0.6486	Remote Similarity	NPC67831
0.6486	Remote Similarity	NPC174051
0.6389	Remote Similarity	NPC260992
0.6265	Remote Similarity	NPC101450
0.6164	Remote Similarity	NPC90652
0.6164	Remote Similarity	NPC155255
0.6104	Remote Similarity	NPC484791
0.6104	Remote Similarity	NPC484790
0.6026	Remote Similarity	NPC273669
0.6026	Remote Similarity	NPC484802
0.6026	Remote Similarity	NPC118647
0.5946	Remote Similarity	NPC470417
0.5921	Remote Similarity	NPC486521
0.5921	Remote Similarity	NPC262870
0.589	Remote Similarity	NPC470223
0.5802	Remote Similarity	NPC484793
0.5769	Remote Similarity	NPC479667
0.5769	Remote Similarity	NPC605437
0.5658	Remote Similarity	NPC470047
0.5658	Remote Similarity	NPC470046
0.5641	Remote Similarity	NPC470050
0.5641	Remote Similarity	NPC470051
0.561	Remote Similarity	NPC484795
0.557	Remote Similarity	NPC471293
0.5513	Remote Similarity	NPC471224
0.5405	Remote Similarity	NPC470078
0.5366	Remote Similarity	NPC484797
0.5325	Remote Similarity	NPC470052
0.525	Remote Similarity	NPC472239
0.525	Remote Similarity	NPC484798
0.525	Remote Similarity	NPC484789
0.525	Remote Similarity	NPC484801
0.525	Remote Similarity	NPC484786
0.525	Remote Similarity	NPC484787
0.525	Remote Similarity	NPC484788
0.5195	Remote Similarity	NPC82902
0.5195	Remote Similarity	NPC474218
0.5185	Remote Similarity	NPC154101
0.5185	Remote Similarity	NPC324598
0.5181	Remote Similarity	NPC73506
0.5122	Remote Similarity	NPC107243
0.5063	Remote Similarity	NPC2983
0.506	Remote Similarity	NPC474327

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC237402 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6731
0.1-0.2	2245
0.2-0.3	173
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data