NPASS Compound

Natural Product: NPC484790

Natural Product ID	NPC484790
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GFDBSJQONAWUEC-ULUYUSSQSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	134149938
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001460] Vitamin D and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 87 91 0 0 0 0 0 0 0 0999 V2000 5.8554 -4.2962 -0.5769 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5520 -3.5892 -0.8350 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6804 -2.2539 -0.4662 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4720 -1.5528 -0.6943 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1213 -0.8902 0.5976 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3935 -0.0233 0.7441 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7995 0.1448 -0.7189 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0217 1.5461 -1.0794 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9500 2.2603 -0.4698 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8141 1.6881 0.6070 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1897 3.7007 -0.8293 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8168 -0.4706 -1.4870 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9955 0.0643 0.5882 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8582 0.5704 2.0292 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3678 0.5828 2.3322 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1953 0.7029 0.9415 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1532 2.0943 0.4796 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6166 0.3971 0.7961 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4683 0.8788 1.6644 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9288 0.6837 1.6856 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3264 -0.1807 0.5268 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7891 -0.1837 0.2497 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4021 -1.5782 0.3816 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4936 0.6634 1.3202 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2033 0.3648 -1.0664 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3789 -0.1062 -2.2291 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0819 -0.7315 -1.8140 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4736 0.0783 -0.7045 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3201 1.5227 -1.0280 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0939 -0.4526 -0.3322 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1641 -0.5033 -1.4838 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2724 -0.2992 -1.2128 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6519 -0.3625 0.2362 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3276 -1.7080 0.7954 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3484 1.7641 -1.0452 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6671 -3.5817 -0.2868 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7782 -5.0141 0.2814 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2219 -4.8810 -1.4353 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3774 -3.6015 -1.9331 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7287 -4.1017 -0.2793 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7719 -2.2561 -1.0977 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1448 -1.5554 1.4723 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1709 -0.5766 1.3153 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1690 0.9584 1.1574 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7733 -0.4097 -0.8507 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4299 2.0131 -1.8477 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0584 0.6378 0.4466 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7913 2.2411 0.6536 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3402 1.8784 1.6038 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1215 3.7870 -1.4305 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3281 4.3126 0.1040 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3191 4.1316 -1.3565 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2583 0.9756 -0.0254 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3407 1.5299 2.1857 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3069 -0.1491 2.7515 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1073 1.4904 2.9523 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0300 -0.2706 2.9113 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6011 2.7631 0.9940 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0397 2.2859 -0.5801 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1268 2.4406 0.8225 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0672 1.5062 2.4834 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4973 1.6303 1.7420 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1793 0.1286 2.6224 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0549 -1.2363 0.8366 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6687 -2.2629 0.8602 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3113 -1.5881 0.9791 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6432 -1.9954 -0.6212 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4332 1.7319 1.1089 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1869 0.3669 2.3363 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5808 0.3776 1.2378 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2547 -0.0072 -1.2604 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2442 0.7519 -2.9402 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9188 -0.8829 -2.8493 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4372 -0.8668 -2.6850 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3229 -1.7347 -1.3864 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7741 1.8119 -2.0051 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7520 2.1979 -0.2487 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2518 1.8303 -1.1161 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2890 -1.4582 0.0961 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3535 -1.4736 -2.0200 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5037 0.2758 -2.2253 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8357 -1.0665 -1.8246 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6313 0.6704 -1.6557 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2353 -2.1831 1.2482 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0864 -2.4042 0.0052 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4483 -1.7157 1.5872 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2514 2.0222 -0.7366 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 2 3 9 10 1 0 9 11 1 0 7 12 1 0 5 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 6 16 18 1 0 18 19 2 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 6 28 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 1 25 35 1 0 12 4 1 0 33 13 1 0 33 16 1 0 30 18 1 0 28 21 1 0 1 36 1 0 1 37 1 0 1 38 1 0 2 39 1 0 2 40 1 0 4 41 1 6 5 42 1 1 6 43 1 0 6 44 1 0 7 45 1 1 8 46 1 0 10 47 1 0 10 48 1 0 10 49 1 0 11 50 1 0 11 51 1 0 11 52 1 0 13 53 1 6 14 54 1 0 14 55 1 0 15 56 1 0 15 57 1 0 17 58 1 0 17 59 1 0 17 60 1 0 19 61 1 0 20 62 1 0 20 63 1 0 21 64 1 1 23 65 1 0 23 66 1 0 23 67 1 0 24 68 1 0 24 69 1 0 24 70 1 0 25 71 1 6 26 72 1 0 26 73 1 0 27 74 1 0 27 75 1 0 29 76 1 0 29 77 1 0 29 78 1 0 30 79 1 1 31 80 1 0 31 81 1 0 32 82 1 0 32 83 1 0 34 84 1 0 34 85 1 0 34 86 1 0 35 87 1 0 M END

Standard InCHIKey	GFDBSJQONAWUEC-ULUYUSSQSA-N
Standard InCHI	InChI=1S/C32H52O3/c1-9-34-28-22(19-21(35-28)18-20(2)3)23-12-16-32(8)25-10-11-26-29(4,5)27(33)14-15-30(26,6)24(25)13-17-31(23,32)7/h10,18,21-24,26-28,33H,9,11-17,19H2,1-8H3/t21-,22-,23-,24-,26-,27-,28+,30+,31-,32+/m0/s1
SMILES	CCO[C@H]1[C@@H](C[C@H](C=C(C)C)O1)[C@@H]1CC[C@]2(C)C3=CC[C@H]4C(C)(C)[C@H](CC[C@]4(C)[C@H]3CC[C@@]12C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	484.39	Volume:	540.343 ? Van der Waals volume.
Dense:	0.896	LogP:	6.938 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.843 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-7.344 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	26.0
TPSA:	38.69 ? Topological Polar Surface Area.	H-Bond Acceptor:	3.0
H-Bond Donor:	1.0	Rings:	5.0
Heavy Atoms:	3.0

MedChem Properties

QED Drug-Likeness Score:	0.416	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.132	Fsp³:	0.875
MCE-18:	94.8 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.921	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.012 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.321	Promiscuous compounds:	0.307

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.991	MDCK Permeability:	-4.815
Pgp-inhibitor:	0.949	Pgp-substrate:	0.148
PAMPA:	0.619 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.241	30% Bioavailability (F30%):	0.159
50% Bioavailability (F50%):	0.989

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.646	MRP1:	0.873
Plasma Protein Binding (PPB):	93.077%	Volume Distribution (VD):	-0.086
Fu:	7.355% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.996	BCRP inhibitor:	0.962
BSEP inhibitor:	0.987

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.974
CYP2C19-inhibitor:	0.984	CYP2C19-substrate:	0.079
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.315
CYP2D6-inhibitor:	0.009	CYP2D6-substrate:	0.657
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.999
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.997
HLM stability:	0.98 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

15.918

Half-life (T1/2):

0.993

ADMET: Toxicity

hERG Blockers:	0.097	hERG Blockers (10um):	0.401
Human Hepatotoxicity (H-HT):	0.575	Drug-induced Liver Injury (DILI):	0.469
AMES Toxicity:	0.487	Rat Oral Acute Toxicity:	0.348
Maximum Recommended Daily Dose:	0.78	Skin Sensitization:	0.919
Carcinogencity:	0.774	Eye Corrosion:	0.002
Eye Irritation:	0.326	Respiratory Toxicity:	0.646
Drug-induced Neurotoxicity:	0.061	Ototoxicity:	0.623
Hematotoxicity:	0.359	Drug-induced Nephrotoxicity:	0.46
Genotoxicity:	0.269	RPMI-8226 Immunitoxicity:	0.12
A549 Cytotoxicity:	0.256	Hek293 Cytotoxicity:	0.529
BCF:	2.871 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.721 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.621 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.542 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19586051]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	stems	n.a.	n.a.	PMID[20095629]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25506718]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27494664]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[30917277]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO8372	Picrasma quassioides	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Non-molecular	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	10000.0	nM	PMID[27494664]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	8300.0	nM	PMID[27494664]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	7900.0	nM	PMID[27494664]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC484790 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20253
0.1-0.2	23971
0.2-0.3	5002
0.3-0.4	513
0.4-0.5	74
0.5-0.6	24
0.6-0.7	11
0.7-0.8	0
0.8-0.85	0
0.85-0.9	5
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC484791
0.871	High Similarity	NPC484789
0.871	High Similarity	NPC484801
0.871	High Similarity	NPC484786
0.871	High Similarity	NPC484787
0.871	High Similarity	NPC484788
0.697	Remote Similarity	NPC470049
0.6957	Remote Similarity	NPC324598
0.6857	Remote Similarity	NPC5358
0.6857	Remote Similarity	NPC216260
0.6324	Remote Similarity	NPC470224
0.6143	Remote Similarity	NPC486523
0.6104	Remote Similarity	NPC189282
0.6104	Remote Similarity	NPC237402
0.6027	Remote Similarity	NPC471293
0.6	Remote Similarity	NPC125399
0.6	Remote Similarity	NPC486522
0.5797	Remote Similarity	NPC30166
0.5775	Remote Similarity	NPC470077
0.5753	Remote Similarity	NPC210268
0.5753	Remote Similarity	NPC190604
0.573	Remote Similarity	NPC250089
0.573	Remote Similarity	NPC157530
0.5696	Remote Similarity	NPC484792
0.5676	Remote Similarity	NPC472240
0.5676	Remote Similarity	NPC262858
0.56	Remote Similarity	NPC484782
0.5429	Remote Similarity	NPC1319
0.5426	Remote Similarity	NPC488572
0.5333	Remote Similarity	NPC142361
0.5333	Remote Similarity	NPC474684
0.5309	Remote Similarity	NPC85593
0.5309	Remote Similarity	NPC31430
0.5278	Remote Similarity	NPC328052
0.5269	Remote Similarity	NPC14630
0.525	Remote Similarity	NPC63023
0.525	Remote Similarity	NPC121566
0.525	Remote Similarity	NPC100955
0.525	Remote Similarity	NPC95243
0.5065	Remote Similarity	NPC470375
0.5065	Remote Similarity	NPC470376

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC484790 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7336
0.1-0.2	1739
0.2-0.3	72
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data