Drug Information| Drug ID:   | NPD5363 |
| Drug Name:   | Limaprost |
| Molecular Formula:   | C22H36O5 |
| Canonical SMILES:   | CCCC[C@@H](C[C@@H](/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCC/C=C/C(=O)O)O)C |
| Standard InCHI:   | "InChI=1S/C22H36O5/c1-3-4-9-16(2)14-17(23)12-13-19-18(20(24)15-21(19)25)10-7-5-6-8-11-22(26)27/h8,11-13,16-19,21,23,25H,3-7,9-10,14-15H2,1-2H3,(H,26,27)/b11-8+,13-12+/t16-,17+,18+,19+,21+/m0/s1" |
| Standard InCHIKey:   | OJZYRQPMEIEQFC-UAWLTFRCSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | TTD; DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD5363Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.623 | NPC7414 |
| Remote Similarity | 0.623 | NPC292220 |
| Remote Similarity | 0.623 | NPC599781 |
| Remote Similarity | 0.5556 | NPC12355 |
| TTD   | DNAP001487 |
| DrugBank   | DB09211 |
| ChEMBL   | CHEMBL2107456 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | D02722 |
| PubChem CID   | 6438378 |
| ChEBI   | 135594 |
| CAS Number   | 74397-12-9 |
| Molecular Weight   | 380.26 |
| ALogP   | -1.057 |
| MLogP   | 3.33 |
| XLogP   | 4.272 |
| HDA   | 5 |
| HBD   | 3 |
| Rotatable Bonds   | 18 |
| TPSA   | 94.83 |
| RO5 Violation   | 1 |