NPASS Compound

Natural Product: NPC303613

Natural Product ID	NPC303613
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	24-Ethylcholesta-4,24(28)-Dien-3,6-Dione
IUPAC Name	(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(E,2R)-5-propan-2-ylhept-5-en-2-yl]-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,6-dione
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL527206
PubChem CID	10502463
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0002031] Stigmastanes and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 75 78 0 0 0 0 0 0 0 0999 V2000 6.8776 -2.0112 0.0511 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4737 -0.8003 -0.6944 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3510 -0.1103 -0.3429 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5827 -0.6028 0.7693 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2572 -1.1767 0.8169 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0793 -0.4779 0.2980 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1738 -0.3296 -1.1836 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7666 -1.0304 0.7152 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6597 -1.0329 2.2543 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7979 -1.1766 2.5592 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4648 -1.0031 1.2687 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7220 -0.1834 1.2930 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6432 -0.8868 2.2799 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0133 -0.3382 2.1404 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7151 -0.2433 3.1794 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5589 0.0858 0.8584 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8928 0.1390 0.6996 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3350 0.5716 -0.6143 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3025 1.3473 -0.7595 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6040 0.0646 -1.7916 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1370 0.1898 -1.6093 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6389 0.4599 -0.2223 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4168 1.9573 -0.1293 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2952 -0.2814 -0.0984 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3670 0.1937 -1.1631 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9363 -0.2294 -1.0032 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4650 -0.2442 0.4210 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2725 1.1711 0.9197 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1398 1.1794 -1.0098 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3643 1.5427 -1.8753 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0095 2.3063 0.0362 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6456 -2.5443 -0.5447 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3349 -1.7903 1.0329 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0225 -2.7266 0.1315 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0416 -0.4516 -1.5170 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2680 -1.3283 1.4067 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5505 0.2534 1.5907 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1040 -1.4963 1.9121 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2326 -2.2377 0.3347 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1189 0.5794 0.7239 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0126 0.6727 -1.5836 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1602 -0.7951 -1.5595 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4495 -1.0054 -1.7466 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6056 -2.0762 0.4080 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0330 -0.1212 2.7092 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2357 -1.9242 2.6076 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1477 -0.5039 3.3676 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9847 -2.2139 2.9692 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6589 -1.9730 0.7697 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5859 0.8244 1.6748 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6122 -1.9618 2.0297 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2674 -0.6589 3.2913 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5656 -0.1170 1.4984 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8994 0.6052 -2.7243 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8564 -1.0372 -1.9185 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7661 1.0027 -2.3185 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6704 -0.7287 -2.0494 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6447 2.2349 0.5903 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1675 2.4130 -1.1084 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4131 2.3957 0.1657 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5541 -1.3500 -0.2537 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4636 1.2967 -1.2252 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7120 -0.1976 -2.1415 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3251 0.4849 -1.5586 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7747 -1.2372 -1.4200 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2014 1.7256 0.5736 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5429 1.7060 0.3909 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2507 1.2830 1.9991 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2945 1.1882 -1.6767 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1869 2.6287 -2.1625 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2468 1.4767 -1.2496 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3500 0.9040 -2.7477 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2890 3.2504 -0.4856 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6916 2.1173 0.8657 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9476 2.3834 0.3137 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 14 16 1 0 16 17 2 0 17 18 1 0 18 19 2 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 6 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 1 3 29 1 0 29 30 1 0 29 31 1 0 27 8 1 0 27 11 1 0 24 12 1 0 22 16 1 0 1 32 1 0 1 33 1 0 1 34 1 0 2 35 1 0 4 36 1 0 4 37 1 0 5 38 1 0 5 39 1 0 6 40 1 1 7 41 1 0 7 42 1 0 7 43 1 0 8 44 1 6 9 45 1 0 9 46 1 0 10 47 1 0 10 48 1 0 11 49 1 6 12 50 1 1 13 51 1 0 13 52 1 0 17 53 1 0 20 54 1 0 20 55 1 0 21 56 1 0 21 57 1 0 23 58 1 0 23 59 1 0 23 60 1 0 24 61 1 6 25 62 1 0 25 63 1 0 26 64 1 0 26 65 1 0 28 66 1 0 28 67 1 0 28 68 1 0 29 69 1 0 30 70 1 0 30 71 1 0 30 72 1 0 31 73 1 0 31 74 1 0 31 75 1 0 M END

Standard InCHIKey	QCHAAVBXLBQKTJ-FPIWNRGUSA-N
Standard InCHI	InChI=1S/C29H44O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-22-17-27(31)26-16-21(30)12-14-29(26,6)25(22)13-15-28(23,24)5/h7,16,18-19,22-25H,8-15,17H2,1-6H3/b20-7+/t19-,22+,23-,24+,25+,28-,29-/m1/s1
SMILES	C/C=C(CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC(=O)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C)/C(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	424.33	Volume:	482.949 ? Van der Waals volume.
Dense:	0.879	LogP:	6.913 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.815 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-7.068 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	5.0	Rigid Bonds:	23.0
TPSA:	34.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	2.0
H-Bond Donor:	0.0	Rings:	4.0
Heavy Atoms:	2.0

MedChem Properties

QED Drug-Likeness Score:	0.433	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.554	Fsp³:	0.793
MCE-18:	70.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.845	Fluc inhibitor:	0.024 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.54	Promiscuous compounds:	0.284

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.923	MDCK Permeability:	-4.965
Pgp-inhibitor:	0.806	Pgp-substrate:	0.0
PAMPA:	0.001 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.037	30% Bioavailability (F30%):	0.839
50% Bioavailability (F50%):	0.983

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.03
Plasma Protein Binding (PPB):	96.199%	Volume Distribution (VD):	0.082
Fu:	4.589% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.66
BSEP inhibitor:	0.894

ADMET: Metabolism

CYP1A2-inhibitor:	0.003	CYP1A2-substrate:	0.542
CYP2C19-inhibitor:	0.974	CYP2C19-substrate:	0.002
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.989
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.604 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

10.096

Half-life (T1/2):

0.395

ADMET: Toxicity

hERG Blockers:	0.126	hERG Blockers (10um):	0.461
Human Hepatotoxicity (H-HT):	0.763	Drug-induced Liver Injury (DILI):	0.429
AMES Toxicity:	0.186	Rat Oral Acute Toxicity:	0.228
Maximum Recommended Daily Dose:	0.429	Skin Sensitization:	0.804
Carcinogencity:	0.65	Eye Corrosion:	0.065
Eye Irritation:	0.857	Respiratory Toxicity:	0.812
Drug-induced Neurotoxicity:	0.438	Ototoxicity:	0.413
Hematotoxicity:	0.74	Drug-induced Nephrotoxicity:	0.693
Genotoxicity:	0.555	RPMI-8226 Immunitoxicity:	0.108
A549 Cytotoxicity:	0.158	Hek293 Cytotoxicity:	0.504
BCF:	2.672 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.988 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.22 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	6.074 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO16318	Turbinaria conoides	Species	Sargassaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10075746]
NPO16318	Turbinaria conoides	Species	Sargassaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15720	Russula flavida	Species	Russulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6567	Aesculus x carnea	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO15720	Russula flavida	Species	Russulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20447	Ichthyothere rufa	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO18754	Agathosma capensis	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO27825	Diospyros sapota	Species	Ebenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO16768	Tortella inclinata	Species	Pottiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO6567	Aesculus x carnea	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO21457	Schefflera taiwaniana	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO16318	Turbinaria conoides	Species	Sargassaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	4

Activity Type	# Activity
Cell line	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT168	Cell line	P388	Mus musculus	ED50	=	0.6	ug ml-1	PMID[10075746]
NPT91	Cell line	KB	Homo sapiens	ED50	=	5.9	ug ml-1	PMID[10075746]
NPT81	Cell line	A549	Homo sapiens	ED50	=	3.1	ug ml-1	PMID[10075746]
NPT139	Cell line	HT-29	Homo sapiens	ED50	=	0.4	ug ml-1	PMID[10075746]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC303613 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21554
0.1-0.2	25559
0.2-0.3	2509
0.3-0.4	192
0.4-0.5	25
0.5-0.6	11
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.78	Intermediate Similarity	NPC255021
0.78	Intermediate Similarity	NPC474228
0.7451	Intermediate Similarity	NPC282593
0.6724	Remote Similarity	NPC489872
0.6667	Remote Similarity	NPC159577
0.6552	Remote Similarity	NPC309603
0.6071	Remote Similarity	NPC35734
0.6071	Remote Similarity	NPC602429
0.5965	Remote Similarity	NPC149203
0.5818	Remote Similarity	NPC2634
0.5818	Remote Similarity	NPC265782
0.5818	Remote Similarity	NPC251929
0.5397	Remote Similarity	NPC320514
0.5357	Remote Similarity	NPC307176
0.5357	Remote Similarity	NPC321874
0.5254	Remote Similarity	NPC115023
0.5085	Remote Similarity	NPC214043
0.5085	Remote Similarity	NPC85774
0.5082	Remote Similarity	NPC249312

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC303613 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6564
0.1-0.2	2363
0.2-0.3	159
0.3-0.4	51
0.4-0.5	11
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5818	Remote Similarity	NPD4691	Approved
0.5357	Remote Similarity	NPD4747	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data