Natural Product: NPC4370
Natural Product ID:   | NPC4370 |
Common Name*:   | Polygodial |
IUPAC Name:   | (1R,4aS,8aS)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarbaldehyde |
Synonyms:   | Polygodial |
Standard InCHIKey:   | AZJUJOFIHHNCSV-KCQAQPDRSA-N |
Standard InCHI:   | InChI=1S/C15H22O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h5,9-10,12-13H,4,6-8H2,1-3H3/t12-,13-,15+/m0/s1 |
SMILES:   | O=C[C@H]1C(=CC[C@@H]2[C@]1(C)CCCC2(C)C)C=O
|
Synthetic Gene Cluster:   |
n.a. |
ChEMBL Identifier:   |
CHEMBL254550 |
PubChem CID:   |
72503 |
Chemical Classification**:   |
-
CHEMONTID:0000000 [Organic compounds]
-
[CHEMONTID:0004603] Organic oxygen compounds
-
[CHEMONTID:0003940] Organic oxides
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
  Species Source
Organism ID |
Organism Name |
Taxonomy Level |
Family |
SuperKingdom |
Isolation Part |
Collection Location |
Collection Time |
Reference |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[10993146] |
NPO30670 |
Dysidea |
Genus |
Dysideidae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[11374954] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
n.a. |
Tsukuba, Japan |
1998-JUN |
PMID[12381108] |
NPO18783 |
Garcinia fusca |
Species |
Clusiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[12608849] |
NPO19593 |
Placida dendritica |
Species |
Limapontiidae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[14575447] |
NPO19593 |
Placida dendritica |
Species |
Limapontiidae |
Eukaryota |
n.a. |
Mediterranean |
n.a. |
PMID[14575447] |
NPO40876 |
Licaria puchuri-major |
Species |
n.a. |
n.a. |
n.a. |
n.a. |
n.a. |
PMID[1517735] |
NPO16566 |
Cinnamosma madagascariensis |
Species |
Canellaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[18179176] |
NPO30670 |
Dysidea |
Genus |
Dysideidae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[21214221] |
NPO26380 |
Tacca plantaginea |
Species |
Taccaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[23031596] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
n.a. |
leaf |
n.a. |
PMID[24197199] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[24254087] |
NPO23467 |
Lobaria scrobiculata |
Species |
Lobariaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[24725159] |
NPO20351 |
Emericella variecolor |
Species |
Aspergillaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[26394166] |
NPO27061 |
Drimys winteri |
Species |
Winteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[29634269] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
n.a. |
n.a. |
|
PMID[31861466] |
NPO12307 |
Elaeocarpus dolichostylus |
Species |
Elaeocarpaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[6549470] |
NPO30670 |
Dysidea |
Genus |
Dysideidae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[9392880] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
Oil |
n.a. |
n.a. |
Database[FooDB] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
Plant |
n.a. |
n.a. |
Database[FooDB] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
Root |
n.a. |
n.a. |
Database[FooDB] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
Seed |
n.a. |
n.a. |
Database[FooDB] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
Shoot |
n.a. |
n.a. |
Database[FooDB] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
|
n.a. |
n.a. |
Database[FooDB] |
NPO20535 |
Podocarpus spicatus |
Species |
Podocarpaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO26380 |
Tacca plantaginea |
Species |
Taccaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO17862 |
Zanthoxylum planispinum |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[Phenol-Explorer] |
NPO17862 |
Zanthoxylum planispinum |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO17965 |
Helenium arizonicum |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO20351 |
Emericella variecolor |
Species |
Aspergillaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO20535 |
Podocarpus spicatus |
Species |
Podocarpaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO12878 |
Cupressus sempervirens |
Species |
Cupressaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO26380 |
Tacca plantaginea |
Species |
Taccaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO17862 |
Zanthoxylum planispinum |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO26380 |
Tacca plantaginea |
Species |
Taccaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO20535 |
Podocarpus spicatus |
Species |
Podocarpaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO21662 |
Geranium bellum |
Species |
Geraniaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO17965 |
Helenium arizonicum |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO5929 |
Neoscopelus microchir |
Species |
Neoscopelidae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO14437 |
Rimularia gibbosa |
Species |
Trapeliaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO26380 |
Tacca plantaginea |
Species |
Taccaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO20535 |
Podocarpus spicatus |
Species |
Podocarpaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO20351 |
Emericella variecolor |
Species |
Aspergillaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO17862 |
Zanthoxylum planispinum |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO12878 |
Cupressus sempervirens |
Species |
Cupressaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO23467 |
Lobaria scrobiculata |
Species |
Lobariaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO27061 |
Drimys winteri |
Species |
Winteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO7341 |
Lilium medeoloides |
Species |
Liliaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO12996 |
Limonia crenulata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO18783 |
Garcinia fusca |
Species |
Clusiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO9508 |
Lamna ditropis |
Species |
Alopiidae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO12307 |
Elaeocarpus dolichostylus |
Species |
Elaeocarpaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO22984 |
Aframomum sceptrum |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO6252 |
Roccella tinctoria |
Species |
Roccellaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO10145 |
Diospyros heterotricha |
Species |
Ebenaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO19652 |
Pittosporum phillyraeoides |
Species |
Pittosporaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO13734 |
Piper excelsum |
Species |
Piperaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO16566 |
Cinnamosma madagascariensis |
Species |
Canellaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO19593 |
Placida dendritica |
Species |
Limapontiidae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO4929 |
Pyropia perforata |
Species |
Bangiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO8589 |
Triticum aestivum |
Species |
Poaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration
Organism ID |
NP ID |
Organism Material Preparation |
Organism Part |
NP Quantity (Standard) |
NP Quantity (Minimum) |
NP Quantity (Maximum) |
Quantity Unit |
Reference |
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  Biological Activity
Activity Type |
# Activity |
EC50 |
1 |
ED50 |
1 |
GI50 |
62 |
IC50 |
14 |
MIC |
60 |
Others |
12 |
Activity Type |
# Activity |
Cell Line |
68 |
Individual Protein |
3 |
NON-MOLECULAR |
3 |
Organism |
72 |
Others |
2 |
Protein Complex |
2 |
Target ID |
Target Type |
Target Name |
Target Organism |
Activity Type |
Activity Relation |
Value |
Unit |
Reference |
NPT168 |
Cell Line |
P388 |
Mus musculus |
IC50 |
= |
1.2 |
ug.mL-1 |
PMID[518808] |
NPT81 |
Cell Line |
A549 |
Homo sapiens |
IC50 |
= |
2.5 |
ug.mL-1 |
PMID[518808] |
NPT139 |
Cell Line |
HT-29 |
Homo sapiens |
IC50 |
= |
2.5 |
ug.mL-1 |
PMID[518808] |
NPT346 |
Individual Protein |
Transient receptor potential cation channel subfamily A member 1 |
Homo sapiens |
EC50 |
= |
59.0 |
nM |
PMID[518809] |
NPT367 |
Cell Line |
MDA-N |
Homo sapiens |
GI50 |
n.a. |
13551.89 |
nM |
PMID[518810] |
NPT368 |
Cell Line |
SN12C |
Homo sapiens |
GI50 |
n.a. |
20606.3 |
nM |
PMID[518810] |
NPT370 |
Cell Line |
NCI-H23 |
Homo sapiens |
GI50 |
n.a. |
27989.81 |
nM |
PMID[518810] |
NPT369 |
Cell Line |
ACHN |
Homo sapiens |
GI50 |
n.a. |
16943.38 |
nM |
PMID[518810] |
NPT371 |
Cell Line |
UO-31 |
Homo sapiens |
GI50 |
n.a. |
16368.17 |
nM |
PMID[518810] |
NPT372 |
Cell Line |
HOP-92 |
Homo sapiens |
GI50 |
n.a. |
20606.3 |
nM |
PMID[518810] |
NPT116 |
Cell Line |
HL-60 |
Homo sapiens |
GI50 |
n.a. |
18365.38 |
nM |
PMID[518810] |
NPT90 |
Cell Line |
DU-145 |
Homo sapiens |
GI50 |
n.a. |
18450.15 |
nM |
PMID[518810] |
NPT374 |
Cell Line |
SF-539 |
Homo sapiens |
GI50 |
n.a. |
19319.68 |
nM |
PMID[518810] |
NPT375 |
Cell Line |
Malme-3M |
Homo sapiens |
GI50 |
n.a. |
15205.48 |
nM |
PMID[518810] |
NPT373 |
Cell Line |
SK-MEL-5 |
Homo sapiens |
GI50 |
n.a. |
15631.48 |
nM |
PMID[518810] |
NPT377 |
Cell Line |
OVCAR-3 |
Homo sapiens |
GI50 |
n.a. |
14859.36 |
nM |
PMID[518810] |
NPT376 |
Cell Line |
A498 |
Homo sapiens |
GI50 |
n.a. |
40926.07 |
nM |
PMID[518810] |
NPT379 |
Cell Line |
HOP-62 |
Homo sapiens |
GI50 |
n.a. |
30619.63 |
nM |
PMID[518810] |
NPT112 |
Cell Line |
MOLT-4 |
Homo sapiens |
GI50 |
n.a. |
9332.54 |
nM |
PMID[518810] |
NPT380 |
Cell Line |
U-251 |
Homo sapiens |
GI50 |
n.a. |
19010.78 |
nM |
PMID[518810] |
NPT378 |
Cell Line |
NCI/ADR-RES |
Homo sapiens |
GI50 |
n.a. |
18620.87 |
nM |
PMID[518810] |
NPT381 |
Cell Line |
OVCAR-8 |
Homo sapiens |
GI50 |
n.a. |
16405.9 |
nM |
PMID[518810] |
NPT382 |
Cell Line |
OVCAR-5 |
Homo sapiens |
GI50 |
n.a. |
16368.17 |
nM |
PMID[518810] |
NPT383 |
Cell Line |
SNB-19 |
Homo sapiens |
GI50 |
n.a. |
18155.16 |
nM |
PMID[518810] |
NPT385 |
Cell Line |
SR |
Homo sapiens |
GI50 |
n.a. |
18155.16 |
nM |
PMID[518810] |
NPT82 |
Cell Line |
MDA-MB-231 |
Homo sapiens |
GI50 |
n.a. |
10568.18 |
nM |
PMID[518810] |
NPT384 |
Cell Line |
TK-10 |
Homo sapiens |
GI50 |
n.a. |
25941.79 |
nM |
PMID[518810] |
NPT323 |
Cell Line |
SW-620 |
Homo sapiens |
GI50 |
n.a. |
35399.73 |
nM |
PMID[518810] |
NPT455 |
Cell Line |
NCI-H522 |
Homo sapiens |
GI50 |
n.a. |
15848.93 |
nM |
PMID[518810] |
NPT387 |
Cell Line |
M14 |
Homo sapiens |
GI50 |
n.a. |
17458.22 |
nM |
PMID[518810] |
NPT386 |
Cell Line |
KM12 |
Homo sapiens |
GI50 |
n.a. |
14655.48 |
nM |
PMID[518810] |
NPT388 |
Cell Line |
NCI-H322M |
Homo sapiens |
GI50 |
n.a. |
50933.09 |
nM |
PMID[518810] |
NPT389 |
Cell Line |
RPMI-8226 |
Homo sapiens |
GI50 |
n.a. |
10739.89 |
nM |
PMID[518810] |
NPT456 |
Cell Line |
OVCAR-4 |
Homo sapiens |
GI50 |
n.a. |
15848.93 |
nM |
PMID[518810] |
NPT390 |
Cell Line |
LOX IMVI |
Homo sapiens |
GI50 |
n.a. |
19054.61 |
nM |
PMID[518810] |
NPT457 |
Cell Line |
BT-549 |
Homo sapiens |
GI50 |
n.a. |
25882.13 |
nM |
PMID[518810] |
NPT147 |
Cell Line |
SK-MEL-2 |
Homo sapiens |
GI50 |
n.a. |
18113.4 |
nM |
PMID[518810] |
NPT81 |
Cell Line |
A549 |
Homo sapiens |
GI50 |
n.a. |
37497.3 |
nM |
PMID[518810] |
NPT391 |
Cell Line |
HCC 2998 |
Homo sapiens |
GI50 |
n.a. |
18365.38 |
nM |
PMID[518810] |
NPT148 |
Cell Line |
HCT-15 |
Homo sapiens |
GI50 |
n.a. |
17021.59 |
nM |
PMID[518810] |
NPT395 |
Cell Line |
SF-268 |
Homo sapiens |
GI50 |
n.a. |
15275.66 |
nM |
PMID[518810] |
NPT393 |
Cell Line |
HCT-116 |
Homo sapiens |
GI50 |
n.a. |
28575.91 |
nM |
PMID[518810] |
NPT83 |
Cell Line |
MCF7 |
Homo sapiens |
GI50 |
n.a. |
14655.48 |
nM |
PMID[518810] |
NPT394 |
Cell Line |
EKVX |
Homo sapiens |
GI50 |
n.a. |
24774.22 |
nM |
PMID[518810] |
NPT306 |
Cell Line |
PC-3 |
Homo sapiens |
GI50 |
n.a. |
27669.42 |
nM |
PMID[518810] |
NPT396 |
Cell Line |
T47D |
Homo sapiens |
GI50 |
n.a. |
19815.27 |
nM |
PMID[518810] |
NPT146 |
Cell Line |
SK-OV-3 |
Homo sapiens |
GI50 |
n.a. |
30760.97 |
nM |
PMID[518810] |
NPT398 |
Cell Line |
UACC-62 |
Homo sapiens |
GI50 |
n.a. |
18407.72 |
nM |
PMID[518810] |
NPT400 |
Cell Line |
MDA-MB-435 |
Homo sapiens |
GI50 |
n.a. |
36559.48 |
nM |
PMID[518810] |
NPT308 |
Cell Line |
CAKI-1 |
Homo sapiens |
GI50 |
n.a. |
6823.39 |
nM |
PMID[518810] |
NPT399 |
Cell Line |
SF-295 |
Homo sapiens |
GI50 |
n.a. |
21928.05 |
nM |
PMID[518810] |
NPT458 |
Cell Line |
IGROV-1 |
Homo sapiens |
GI50 |
n.a. |
19010.78 |
nM |
PMID[518810] |
NPT402 |
Cell Line |
Hs-578T |
Homo sapiens |
GI50 |
n.a. |
27861.21 |
nM |
PMID[518810] |
NPT401 |
Cell Line |
786-0 |
Homo sapiens |
GI50 |
n.a. |
36982.82 |
nM |
PMID[518810] |
NPT403 |
Cell Line |
UACC-257 |
Homo sapiens |
GI50 |
n.a. |
17100.15 |
nM |
PMID[518810] |
NPT404 |
Cell Line |
CCRF-CEM |
Homo sapiens |
GI50 |
n.a. |
20323.57 |
nM |
PMID[518810] |
NPT405 |
Cell Line |
NCI-H226 |
Homo sapiens |
GI50 |
n.a. |
19952.62 |
nM |
PMID[518810] |
NPT139 |
Cell Line |
HT-29 |
Homo sapiens |
GI50 |
n.a. |
16405.9 |
nM |
PMID[518810] |
NPT170 |
Cell Line |
SK-MEL-28 |
Homo sapiens |
GI50 |
n.a. |
43151.91 |
nM |
PMID[518810] |
NPT406 |
Cell Line |
RXF 393 |
Homo sapiens |
GI50 |
n.a. |
17100.15 |
nM |
PMID[518810] |
NPT407 |
Cell Line |
COLO 205 |
Homo sapiens |
GI50 |
n.a. |
18197.01 |
nM |
PMID[518810] |
NPT170 |
Cell Line |
SK-MEL-28 |
Homo sapiens |
IC50 |
= |
2.5 |
ug.mL-1 |
PMID[518812] |
NPT139 |
Cell Line |
HT-29 |
Homo sapiens |
IC50 |
= |
2.5 |
ug.mL-1 |
PMID[518812] |
NPT81 |
Cell Line |
A549 |
Homo sapiens |
IC50 |
= |
2.5 |
ug.mL-1 |
PMID[518812] |
NPT168 |
Cell Line |
P388 |
Mus musculus |
IC50 |
= |
1.2 |
ug.mL-1 |
PMID[518812] |
NPT81 |
Cell Line |
A549 |
Homo sapiens |
GI50 |
= |
90000.0 |
nM |
PMID[518813] |
NPT170 |
Cell Line |
SK-MEL-28 |
Homo sapiens |
GI50 |
= |
65000.0 |
nM |
PMID[518813] |
NPT83 |
Cell Line |
MCF7 |
Homo sapiens |
GI50 |
= |
75000.0 |
nM |
PMID[518813] |
NPT468 |
Individual Protein |
Vanilloid receptor |
Rattus norvegicus |
Inhibition |
= |
76.0 |
% |
PMID[518813] |
NPT83 |
Cell Line |
MCF7 |
Homo sapiens |
IC50 |
= |
12400.0 |
nM |
PMID[518814] |
NPT410 |
Individual Protein |
Neuronal acetylcholine receptor protein alpha-7 subunit |
Homo sapiens |
IC50 |
> |
100000.0 |
nM |
PMID[518815] |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Inhibition |
= |
23.5 |
% |
PMID[518801] |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Inhibition |
= |
50.0 |
% |
PMID[518801] |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Inhibition |
= |
71.2 |
% |
PMID[518801] |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Inhibition |
= |
82.8 |
% |
PMID[518801] |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Inhibition |
= |
92.6 |
% |
PMID[518801] |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Inhibition |
= |
100.0 |
% |
PMID[518801] |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
ED50 |
= |
0.028 |
mg.kg-1 |
PMID[518801] |
NPT2 |
Others |
Unspecified |
|
Inhibition |
= |
2.1 |
% |
PMID[518802] |
NPT312 |
Organism |
Saccharomyces cerevisiae |
Saccharomyces cerevisiae |
MIC |
= |
0.78 |
ug.mL-1 |
PMID[518803] |
NPT312 |
Organism |
Saccharomyces cerevisiae |
Saccharomyces cerevisiae |
MIC |
= |
0.2 |
ug.mL-1 |
PMID[518803] |
NPT765 |
Organism |
Schizosaccharomyces pombe |
Schizosaccharomyces pombe |
MIC |
= |
6.25 |
ug.mL-1 |
PMID[518803] |
NPT16 |
Organism |
Staphylococcus aureus |
Staphylococcus aureus |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518803] |
NPT79 |
Organism |
Bacillus subtilis |
Bacillus subtilis |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518803] |
NPT729 |
Organism |
Micrococcus luteus |
Micrococcus luteus |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518803] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518803] |
NPT766 |
Organism |
Proteus vulgaris |
Proteus vulgaris |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518803] |
NPT18 |
Organism |
Pseudomonas aeruginosa |
Pseudomonas aeruginosa |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518803] |
NPT767 |
Organism |
Pichia jadinii |
Cyberlindnera jadinii |
MIC |
= |
1.56 |
ug.mL-1 |
PMID[518803] |
NPT768 |
Organism |
Sclerotinia |
Sclerotinia |
MIC |
= |
1.56 |
ug.mL-1 |
PMID[518803] |
NPT769 |
Organism |
Mucor mucedo |
Mucor mucedo |
MIC |
= |
6.25 |
ug.mL-1 |
PMID[518803] |
NPT770 |
Organism |
Rhizopus microsporus var. chinensis |
Rhizopus microsporus var. chinensis |
MIC |
= |
12.5 |
ug.mL-1 |
PMID[518803] |
NPT21 |
Organism |
Aspergillus niger |
Aspergillus niger |
MIC |
= |
25.0 |
ug.mL-1 |
PMID[518803] |
NPT771 |
Organism |
Penicillium crustosum |
Penicillium crustosum |
MIC |
= |
25.0 |
ug.mL-1 |
PMID[518803] |
NPT772 |
Organism |
Pichia anomala |
Wickerhamomyces anomalus |
MIC |
= |
1.56 |
ug.mL-1 |
PMID[518803] |
NPT312 |
Organism |
Saccharomyces cerevisiae |
Saccharomyces cerevisiae |
MIC |
= |
1.56 |
ug.mL-1 |
PMID[518803] |
NPT767 |
Organism |
Pichia jadinii |
Cyberlindnera jadinii |
MIC |
= |
3.13 |
ug.mL-1 |
PMID[518803] |
NPT765 |
Organism |
Schizosaccharomyces pombe |
Schizosaccharomyces pombe |
MIC |
= |
25.0 |
ug.mL-1 |
PMID[518803] |
NPT312 |
Organism |
Saccharomyces cerevisiae |
Saccharomyces cerevisiae |
MIC |
> |
25.0 |
ug.mL-1 |
PMID[518803] |
NPT767 |
Organism |
Pichia jadinii |
Cyberlindnera jadinii |
MIC |
> |
25.0 |
ug.mL-1 |
PMID[518803] |
NPT765 |
Organism |
Schizosaccharomyces pombe |
Schizosaccharomyces pombe |
MIC |
> |
25.0 |
ug.mL-1 |
PMID[518803] |
NPT767 |
Organism |
Pichia jadinii |
Cyberlindnera jadinii |
MIC |
= |
0.78 |
ug.mL-1 |
PMID[518803] |
NPT772 |
Organism |
Pichia anomala |
Wickerhamomyces anomalus |
MIC |
= |
6.25 |
ug.mL-1 |
PMID[518803] |
NPT772 |
Organism |
Pichia anomala |
Wickerhamomyces anomalus |
MIC |
> |
25.0 |
ug.mL-1 |
PMID[518803] |
NPT312 |
Organism |
Saccharomyces cerevisiae |
Saccharomyces cerevisiae |
MIC |
= |
3.13 |
ug.mL-1 |
PMID[518804] |
NPT767 |
Organism |
Pichia jadinii |
Cyberlindnera jadinii |
MIC |
= |
6.25 |
ug.mL-1 |
PMID[518804] |
NPT523 |
Organism |
Malassezia furfur |
Malassezia furfur |
MIC |
= |
50.0 |
ug.mL-1 |
PMID[518804] |
NPT167 |
Organism |
Propionibacterium acnes |
Propionibacterium acnes |
MIC |
= |
25.0 |
ug.mL-1 |
PMID[518805] |
NPT773 |
Organism |
Photobacterium leiognathi |
Photobacterium leiognathi |
IC50 |
= |
11400.0 |
nM |
PMID[518806] |
NPT773 |
Organism |
Photobacterium leiognathi |
Photobacterium leiognathi |
IZ |
= |
8.0 |
mm |
PMID[518806] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
82000.0 |
nM |
PMID[518806] |
NPT21 |
Organism |
Aspergillus niger |
Aspergillus niger |
MIC |
= |
25.0 |
ug.mL-1 |
PMID[518807] |
NPT770 |
Organism |
Rhizopus microsporus var. chinensis |
Rhizopus microsporus var. chinensis |
MIC |
= |
12.5 |
ug.mL-1 |
PMID[518807] |
NPT768 |
Organism |
Sclerotinia |
Sclerotinia |
MIC |
= |
1.56 |
ug.mL-1 |
PMID[518807] |
NPT772 |
Organism |
Pichia anomala |
Wickerhamomyces anomalus |
MIC |
= |
1.56 |
ug.mL-1 |
PMID[518807] |
NPT765 |
Organism |
Schizosaccharomyces pombe |
Schizosaccharomyces pombe |
MIC |
= |
6.25 |
ug.mL-1 |
PMID[518807] |
NPT766 |
Organism |
Proteus vulgaris |
Proteus vulgaris |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518807] |
NPT729 |
Organism |
Micrococcus luteus |
Micrococcus luteus |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518807] |
NPT771 |
Organism |
Penicillium crustosum |
Penicillium crustosum |
MIC |
= |
25.0 |
ug.mL-1 |
PMID[518807] |
NPT769 |
Organism |
Mucor mucedo |
Mucor mucedo |
MIC |
= |
6.25 |
ug.mL-1 |
PMID[518807] |
NPT767 |
Organism |
Pichia jadinii |
Cyberlindnera jadinii |
MIC |
= |
1.56 |
ug.mL-1 |
PMID[518807] |
NPT312 |
Organism |
Saccharomyces cerevisiae |
Saccharomyces cerevisiae |
MIC |
= |
0.78 |
ug.mL-1 |
PMID[518807] |
NPT18 |
Organism |
Pseudomonas aeruginosa |
Pseudomonas aeruginosa |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518807] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518807] |
NPT79 |
Organism |
Bacillus subtilis |
Bacillus subtilis |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518807] |
NPT16 |
Organism |
Staphylococcus aureus |
Staphylococcus aureus |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518807] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
IC50 |
= |
2.5 |
ug.mL-1 |
PMID[518808] |
NPT774 |
Organism |
Zygosaccharomyces bailii |
Zygosaccharomyces bailii |
MIC |
= |
50.0 |
ug.mL-1 |
PMID[518811] |
NPT774 |
Organism |
Zygosaccharomyces bailii |
Zygosaccharomyces bailii |
MFC |
= |
50.0 |
ug ml-1 |
PMID[518811] |
NPT85 |
Organism |
Filobasidiella neoformans |
Cryptococcus neoformans |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518812] |
NPT20 |
Organism |
Candida albicans |
Candida albicans |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518812] |
NPT312 |
Organism |
Saccharomyces cerevisiae |
Saccharomyces cerevisiae |
MIC |
= |
100.0 |
ug.mL-1 |
PMID[518812] |
NPT18 |
Organism |
Pseudomonas aeruginosa |
Pseudomonas aeruginosa |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518812] |
NPT566 |
Organism |
Salmonella typhimurium |
Salmonella enterica subsp. enterica serovar Typhimurium |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518812] |
NPT775 |
Organism |
Proteus |
Proteus |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518812] |
NPT16 |
Organism |
Staphylococcus aureus |
Staphylococcus aureus |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518812] |
NPT79 |
Organism |
Bacillus subtilis |
Bacillus subtilis |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518812] |
NPT175 |
Organism |
Enterococcus faecalis |
Enterococcus faecalis |
MIC |
> |
100.0 |
ug.mL-1 |
PMID[518812] |
NPT776 |
Organism |
Spodoptera littoralis |
Spodoptera littoralis |
AFI |
= |
24.9 |
% |
PMID[518812] |
NPT776 |
Organism |
Spodoptera littoralis |
Spodoptera littoralis |
AFI |
= |
7.4 |
% |
PMID[518812] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
GI50 |
> |
100000.0 |
nM |
PMID[518813] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
GI50 |
= |
95000.0 |
nM |
PMID[518813] |
NPT409 |
Protein Complex |
Neuronal acetylcholine receptor; alpha4/beta2 |
Homo sapiens |
IC50 |
= |
62500.0 |
nM |
PMID[518815] |
NPT411 |
Protein Complex |
Neuronal acetylcholine receptor; alpha3/beta4 |
Homo sapiens |
IC50 |
= |
48200.0 |
nM |
PMID[518815] |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
  Chemically structural similarity: I. Similar Active Natural Products in NPASS
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC4370 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 188 |
0.1-0.2 | 2104 |
0.2-0.3 | 12097 |
0.3-0.4 | 14633 |
0.4-0.5 | 7973 |
0.5-0.6 | 4252 |
0.6-0.7 | 1234 |
0.7-0.8 | 187 |
0.8-0.85 | 18 |
0.85-0.9 | 5 |
0.9-0.95 | 2 |
0.95-1 | 4 |
  Chemically structural similarity: II. Similar Clinical/Approved Drugs
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC4370 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 177 |
0.1-0.2 | 2356 |
0.2-0.3 | 4423 |
0.3-0.4 | 1576 |
0.4-0.5 | 362 |
0.5-0.6 | 192 |
0.6-0.7 | 57 |
0.7-0.8 | 7 |
0.8-0.85 | 0 |
0.85-0.9 | 0 |
0.9-0.95 | 0 |
0.95-1 | 0 |
Similarity Score |
Similarity Level |
Drug ID |
Developmental Stage |
0.8143 |
Intermediate Similarity |
NPD4691 |
Approved |
0.8 |
Intermediate Similarity |
NPD4137 |
Phase 3 |
0.7887 |
Intermediate Similarity |
NPD4747 |
Approved |
0.7808 |
Intermediate Similarity |
NPD4058 |
Approved |
0.7576 |
Intermediate Similarity |
NPD287 |
Approved |
0.7568 |
Intermediate Similarity |
NPD4687 |
Approved |
0.7568 |
Intermediate Similarity |
NPD5733 |
Approved |
0.7534 |
Intermediate Similarity |
NPD5276 |
Approved |
0.7361 |
Intermediate Similarity |
NPD3621 |
Clinical (unspecified phase) |
0.7073 |
Intermediate Similarity |
NPD3133 |
Approved |
0.7073 |
Intermediate Similarity |
NPD3666 |
Approved |
0.7073 |
Intermediate Similarity |
NPD3665 |
Phase 1 |
0.7037 |
Intermediate Similarity |
NPD4752 |
Clinical (unspecified phase) |
0.7 |
Intermediate Similarity |
NPD4695 |
Discontinued |
0.6951 |
Remote Similarity |
NPD3527 |
Clinical (unspecified phase) |
0.6914 |
Remote Similarity |
NPD8028 |
Phase 2 |
0.6905 |
Remote Similarity |
NPD7521 |
Approved |
0.6905 |
Remote Similarity |
NPD3618 |
Phase 1 |
0.6905 |
Remote Similarity |
NPD6684 |
Approved |
0.6905 |
Remote Similarity |
NPD6409 |
Approved |
0.6905 |
Remote Similarity |
NPD7334 |
Approved |
0.6905 |
Remote Similarity |
NPD5330 |
Approved |
0.6905 |
Remote Similarity |
NPD7146 |
Approved |
0.6829 |
Remote Similarity |
NPD4223 |
Phase 3 |
0.6829 |
Remote Similarity |
NPD3667 |
Approved |
0.6829 |
Remote Similarity |
NPD4221 |
Approved |
0.6778 |
Remote Similarity |
NPD4697 |
Phase 3 |
0.6744 |
Remote Similarity |
NPD7513 |
Clinical (unspecified phase) |
0.6744 |
Remote Similarity |
NPD6672 |
Approved |
0.6744 |
Remote Similarity |
NPD6903 |
Approved |
0.6744 |
Remote Similarity |
NPD5737 |
Approved |
0.6706 |
Remote Similarity |
NPD5279 |
Phase 3 |
0.6706 |
Remote Similarity |
NPD5690 |
Phase 2 |
0.6705 |
Remote Similarity |
NPD6079 |
Approved |
0.6667 |
Remote Similarity |
NPD4753 |
Phase 2 |
0.6667 |
Remote Similarity |
NPD3668 |
Phase 3 |
0.6667 |
Remote Similarity |
NPD5328 |
Approved |
0.6667 |
Remote Similarity |
NPD4786 |
Approved |
0.6667 |
Remote Similarity |
NPD4197 |
Approved |
0.6628 |
Remote Similarity |
NPD3573 |
Approved |
0.6588 |
Remote Similarity |
NPD5329 |
Approved |
0.6588 |
Remote Similarity |
NPD1694 |
Approved |
0.6556 |
Remote Similarity |
NPD7900 |
Approved |
0.6556 |
Remote Similarity |
NPD7901 |
Clinical (unspecified phase) |
0.6543 |
Remote Similarity |
NPD3617 |
Approved |
0.6517 |
Remote Similarity |
NPD7515 |
Phase 2 |
0.6512 |
Remote Similarity |
NPD4623 |
Approved |
0.6512 |
Remote Similarity |
NPD3574 |
Clinical (unspecified phase) |
0.6512 |
Remote Similarity |
NPD5205 |
Approved |
0.6512 |
Remote Similarity |
NPD4688 |
Approved |
0.6512 |
Remote Similarity |
NPD4694 |
Approved |
0.6512 |
Remote Similarity |
NPD4690 |
Approved |
0.6512 |
Remote Similarity |
NPD4519 |
Discontinued |
0.6512 |
Remote Similarity |
NPD4138 |
Approved |
0.6512 |
Remote Similarity |
NPD4693 |
Phase 3 |
0.6512 |
Remote Similarity |
NPD4689 |
Approved |
0.6512 |
Remote Similarity |
NPD5280 |
Approved |
0.6484 |
Remote Similarity |
NPD5210 |
Approved |
0.6484 |
Remote Similarity |
NPD4629 |
Approved |
0.6444 |
Remote Similarity |
NPD4202 |
Approved |
0.6413 |
Remote Similarity |
NPD5222 |
Approved |
0.6413 |
Remote Similarity |
NPD5221 |
Approved |
0.6413 |
Remote Similarity |
NPD5220 |
Clinical (unspecified phase) |
0.6374 |
Remote Similarity |
NPD7748 |
Approved |
0.6364 |
Remote Similarity |
NPD5208 |
Approved |
0.6344 |
Remote Similarity |
NPD7902 |
Approved |
0.6344 |
Remote Similarity |
NPD5173 |
Approved |
0.6304 |
Remote Similarity |
NPD5695 |
Phase 3 |
0.6292 |
Remote Similarity |
NPD6673 |
Approved |
0.6292 |
Remote Similarity |
NPD6080 |
Approved |
0.6292 |
Remote Similarity |
NPD6904 |
Approved |
0.6265 |
Remote Similarity |
NPD4195 |
Approved |
0.6264 |
Remote Similarity |
NPD6399 |
Phase 3 |
0.6222 |
Remote Similarity |
NPD5207 |
Approved |
0.6222 |
Remote Similarity |
NPD5692 |
Phase 3 |
0.6211 |
Remote Similarity |
NPD5286 |
Approved |
0.6211 |
Remote Similarity |
NPD4696 |
Approved |
0.6211 |
Remote Similarity |
NPD5285 |
Approved |
0.619 |
Remote Similarity |
NPD8259 |
Clinical (unspecified phase) |
0.6184 |
Remote Similarity |
NPD7331 |
Phase 2 |
0.6173 |
Remote Similarity |
NPD8039 |
Approved |
0.617 |
Remote Similarity |
NPD4755 |
Approved |
0.617 |
Remote Similarity |
NPD6083 |
Phase 2 |
0.617 |
Remote Similarity |
NPD6084 |
Phase 2 |
0.6163 |
Remote Similarity |
NPD4788 |
Approved |
0.6154 |
Remote Similarity |
NPD6050 |
Approved |
0.6154 |
Remote Similarity |
NPD5281 |
Approved |
0.6154 |
Remote Similarity |
NPD5284 |
Approved |
0.6154 |
Remote Similarity |
NPD5694 |
Approved |
0.6154 |
Remote Similarity |
NPD5693 |
Phase 1 |
0.6146 |
Remote Similarity |
NPD5223 |
Approved |
0.6136 |
Remote Similarity |
NPD6098 |
Approved |
0.6129 |
Remote Similarity |
NPD6356 |
Clinical (unspecified phase) |
0.6111 |
Remote Similarity |
NPD7285 |
Clinical (unspecified phase) |
0.6105 |
Remote Similarity |
NPD5696 |
Approved |
0.6087 |
Remote Similarity |
NPD7631 |
Approved |
0.6082 |
Remote Similarity |
NPD5225 |
Approved |
0.6082 |
Remote Similarity |
NPD4633 |
Approved |
0.6082 |
Remote Similarity |
NPD5224 |
Approved |
0.6082 |
Remote Similarity |
NPD5211 |
Phase 2 |
0.6082 |
Remote Similarity |
NPD5226 |
Approved |
0.6081 |
Remote Similarity |
NPD4191 |
Approved |
0.6081 |
Remote Similarity |
NPD4193 |
Approved |
0.6081 |
Remote Similarity |
NPD4194 |
Approved |
0.6081 |
Remote Similarity |
NPD4192 |
Approved |
0.6064 |
Remote Similarity |
NPD7732 |
Phase 3 |
0.6044 |
Remote Similarity |
NPD4096 |
Approved |
0.6042 |
Remote Similarity |
NPD4700 |
Approved |
0.6032 |
Remote Similarity |
NPD1799 |
Clinical (unspecified phase) |
0.6023 |
Remote Similarity |
NPD1696 |
Phase 3 |
0.6022 |
Remote Similarity |
NPD6001 |
Approved |
0.602 |
Remote Similarity |
NPD5174 |
Approved |
0.602 |
Remote Similarity |
NPD5175 |
Approved |
0.6 |
Remote Similarity |
NPD3495 |
Discontinued |
0.5978 |
Remote Similarity |
NPD7609 |
Phase 3 |
0.596 |
Remote Similarity |
NPD5141 |
Approved |
0.593 |
Remote Similarity |
NPD4139 |
Approved |
0.593 |
Remote Similarity |
NPD4692 |
Approved |
0.5921 |
Remote Similarity |
NPD5325 |
Clinical (unspecified phase) |
0.5915 |
Remote Similarity |
NPD4627 |
Clinical (unspecified phase) |
0.5914 |
Remote Similarity |
NPD5133 |
Approved |
0.5904 |
Remote Similarity |
NPD3701 |
Clinical (unspecified phase) |
0.5895 |
Remote Similarity |
NPD7614 |
Phase 1 |
0.5889 |
Remote Similarity |
NPD650 |
Approved |
0.5876 |
Remote Similarity |
NPD6404 |
Discontinued |
0.5859 |
Remote Similarity |
NPD4754 |
Approved |
0.5844 |
Remote Similarity |
NPD7341 |
Phase 2 |
0.5842 |
Remote Similarity |
NPD5697 |
Approved |
0.5833 |
Remote Similarity |
NPD4219 |
Approved |
0.5824 |
Remote Similarity |
NPD4518 |
Approved |
0.5789 |
Remote Similarity |
NPD5654 |
Approved |
0.5784 |
Remote Similarity |
NPD4730 |
Approved |
0.5784 |
Remote Similarity |
NPD6881 |
Approved |
0.5784 |
Remote Similarity |
NPD6899 |
Approved |
0.5784 |
Remote Similarity |
NPD6011 |
Approved |
0.5784 |
Remote Similarity |
NPD4729 |
Approved |
0.5784 |
Remote Similarity |
NPD5168 |
Approved |
0.5784 |
Remote Similarity |
NPD5128 |
Approved |
0.5783 |
Remote Similarity |
NPD7339 |
Approved |
0.5783 |
Remote Similarity |
NPD6942 |
Approved |
0.5769 |
Remote Similarity |
NPD6108 |
Clinical (unspecified phase) |
0.5769 |
Remote Similarity |
NPD6650 |
Approved |
0.5769 |
Remote Similarity |
NPD6649 |
Approved |
0.5758 |
Remote Similarity |
NPD5091 |
Approved |
0.5743 |
Remote Similarity |
NPD4767 |
Approved |
0.5743 |
Remote Similarity |
NPD4768 |
Approved |
0.5743 |
Remote Similarity |
NPD6008 |
Approved |
0.5743 |
Remote Similarity |
NPD5739 |
Approved |
0.5743 |
Remote Similarity |
NPD6675 |
Approved |
0.5743 |
Remote Similarity |
NPD6402 |
Approved |
0.5743 |
Remote Similarity |
NPD7128 |
Approved |
0.5728 |
Remote Similarity |
NPD6014 |
Approved |
0.5728 |
Remote Similarity |
NPD6013 |
Approved |
0.5728 |
Remote Similarity |
NPD6372 |
Approved |
0.5728 |
Remote Similarity |
NPD6012 |
Approved |
0.5728 |
Remote Similarity |
NPD6373 |
Approved |
0.5698 |
Remote Similarity |
NPD7645 |
Phase 2 |
0.5686 |
Remote Similarity |
NPD5701 |
Approved |
0.5686 |
Remote Similarity |
NPD6412 |
Phase 2 |
0.5673 |
Remote Similarity |
NPD5251 |
Approved |
0.5673 |
Remote Similarity |
NPD6883 |
Approved |
0.5673 |
Remote Similarity |
NPD5134 |
Clinical (unspecified phase) |
0.5673 |
Remote Similarity |
NPD5169 |
Approved |
0.5673 |
Remote Similarity |
NPD7290 |
Approved |
0.5673 |
Remote Similarity |
NPD5249 |
Phase 3 |
0.5673 |
Remote Similarity |
NPD7102 |
Approved |
0.5673 |
Remote Similarity |
NPD4634 |
Approved |
0.5673 |
Remote Similarity |
NPD5248 |
Approved |
0.5673 |
Remote Similarity |
NPD5247 |
Approved |
0.5673 |
Remote Similarity |
NPD5135 |
Approved |
0.5673 |
Remote Similarity |
NPD5250 |
Approved |
0.567 |
Remote Similarity |
NPD5959 |
Approved |
0.5667 |
Remote Similarity |
NPD7520 |
Clinical (unspecified phase) |
0.5638 |
Remote Similarity |
NPD6411 |
Approved |
0.5631 |
Remote Similarity |
NPD7320 |
Approved |
0.5619 |
Remote Similarity |
NPD8130 |
Phase 1 |
0.5619 |
Remote Similarity |
NPD5216 |
Approved |
0.5619 |
Remote Similarity |
NPD5127 |
Approved |
0.5619 |
Remote Similarity |
NPD6869 |
Approved |
0.5619 |
Remote Similarity |
NPD6847 |
Approved |
0.5619 |
Remote Similarity |
NPD5215 |
Approved |
0.5619 |
Remote Similarity |
NPD5217 |
Approved |
0.5619 |
Remote Similarity |
NPD6617 |
Approved |
0.5612 |
Remote Similarity |
NPD7638 |
Approved |
0.561
|
Remote Similarity |
NPD4243 |
Approved |