NPASS drugs

Drug Information

Drug ID:	NPD3495
Drug Name:	miltirone
Molecular Formula:	C19H22O2
Canonical SMILES:	CC(C1=Cc2ccc3c(c2C(=O)C1=O)CCCC3(C)C)C
Standard InCHI:	"InChI=1S/C19H22O2/c1-11(2)14-10-12-7-8-15-13(6-5-9-19(15,3)4)16(12)18(21)17(14)20/h7-8,10-11H,5-6,9H2,1-4H3"
Standard InCHIKey:	FEFAIBOZOKSLJR-UHFFFAOYSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD3495

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	115592
0.1-0.2	95251
0.2-0.3	811
0.3-0.4	42
0.4-0.5	19
0.5-0.6	19
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC239185
Remote Similarity	0.64	NPC109514
Remote Similarity	0.64	NPC603393
Remote Similarity	0.6154	NPC229734
Remote Similarity	0.6154	NPC64464
Remote Similarity	0.5962	NPC310942
Remote Similarity	0.5926	NPC247976
Remote Similarity	0.5818	NPC85152
Remote Similarity	0.566	NPC260233
Remote Similarity	0.566	NPC501083
Remote Similarity	0.566	NPC602410
Remote Similarity	0.5614	NPC252747
Remote Similarity	0.5614	NPC283173
Remote Similarity	0.5614	NPC184460
Remote Similarity	0.5556	NPC153885
Remote Similarity	0.5556	NPC90172
Remote Similarity	0.5556	NPC602408
Remote Similarity	0.5455	NPC100767
Remote Similarity	0.5333	NPC238861
Remote Similarity	0.5333	NPC77000
Remote Similarity	0.5333	NPC602938
Remote Similarity	0.5273	NPC134882
Remote Similarity	0.5091	NPC100928
Remote Similarity	0.5088	NPC143768

Drug Structure

NPD3495 OpenBabel08211703112D 21 23 0 0 0 0 0 0 0 0999 V2000 -3.4641 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 3.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2321 3.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 11 1 0 0 0 0 2 11 1 0 0 0 0 3 19 1 0 0 0 0 4 19 1 0 0 0 0 5 6 1 0 0 0 0 5 9 1 0 0 0 0 6 13 1 0 0 0 0 7 8 2 0 0 0 0 7 12 1 0 0 0 0 8 15 1 0 0 0 0 9 19 1 0 0 0 0 10 12 1 0 0 0 0 10 14 2 0 0 0 0 11 14 1 0 0 0 0 12 16 2 0 0 0 0 13 15 2 0 0 0 0 13 16 1 0 0 0 0 14 17 1 0 0 0 0 15 19 1 0 0 0 0 16 18 1 0 0 0 0 17 18 1 0 0 0 0 17 20 2 0 0 0 0 18 21 2 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB007353
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	282.16
ALogP	1.0685
MLogP	3.33
XLogP	6.171
HDA	2
HBD	0
Rotatable Bonds	5
TPSA	34.14
RO5 Violation	1