NPASS drugs

Drug Information

Drug ID:	NPD4058
Drug Name:	Exemestane
Molecular Formula:	C20H24O2
Canonical SMILES:	O=C1C=C[C@]2(C(=C1)C(=C)C[C@@H]1[C@@H]2CC[C@]2([C@H]1CCC2=O)C)C
Standard InCHI:	"InChI=1S/C20H24O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19/h6,8,11,14-16H,1,4-5,7,9-10H2,2-3H3/t14-,15-,16-,19+,20-/m0/s1"
Standard InCHIKey:	BFYIZQONLCFLEV-DAELLWKTSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD4058

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	111230
0.1-0.2	96454
0.2-0.3	3828
0.3-0.4	183
0.4-0.5	39
0.5-0.6	1
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC611645
Remote Similarity	0.68	NPC54123
Remote Similarity	0.68	NPC518947
Remote Similarity	0.68	NPC605505
Remote Similarity	0.6	NPC518780
Remote Similarity	0.5323	NPC490530

Drug Structure

NPD4058 OpenBabel08211704332D 22 25 0 0 1 0 0 0 0 0999 V2000 1.6725 -3.8938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5073 -0.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6700 -0.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6703 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1778 -1.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6714 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3425 -0.9634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8356 0.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8364 -2.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3431 -2.8933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6722 -2.8938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1781 -2.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8361 -1.4466 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0003 -0.9644 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6717 -0.9639 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5078 -2.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8358 0.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5075 -1.4461 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0443 -2.9102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8364 1.4822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 12 2 0 0 0 0 4 5 1 0 0 0 0 4 15 1 0 0 0 0 5 18 1 0 0 0 0 6 8 2 0 0 0 0 6 13 1 0 0 0 0 7 9 1 0 0 0 0 7 16 1 0 0 0 0 8 19 1 0 0 0 0 9 20 1 0 0 0 0 10 12 1 0 0 0 0 11 13 1 0 0 0 0 11 17 2 0 0 0 0 12 17 1 0 0 0 0 13 21 2 0 0 0 0 14 10 1 1 0 0 0 14 15 1 0 0 0 0 14 16 1 0 0 0 0 15 20 1 6 0 0 0 16 19 1 6 0 0 0 17 19 1 0 0 0 0 18 20 1 0 0 0 0 18 22 2 0 0 0 0 19 2 1 6 0 0 0 20 3 1 6 0 0 0 M END $$$$

External Identifiers

TTD	DAP000625
DrugBank	DB00990
ChEMBL	CHEMBL1200374
IUPHAR/BPS	7073
PharmaGKB	PA449563
KEGG Drug	D00963
PubChem CID	60198
ChEBI	4953
CAS Number	107868-30-4

Drug Properties

Molecular Weight	296.18
ALogP	1.6102
MLogP	3.44
XLogP	3.819
HDA	2
HBD	0
Rotatable Bonds	2
TPSA	34.14
RO5 Violation	0