Drug Information| Drug ID:   | NPD5360 |
| Drug Name:   | Ganaxolone |
| Molecular Formula:   | C22H36O2 |
| Canonical SMILES:   | CC(=O)[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CC[C@@H]2[C@]1(C)CC[C@@](C2)(C)O |
| Standard InCHI:   | "InChI=1S/C22H36O2/c1-14(23)17-7-8-18-16-6-5-15-13-20(2,24)11-12-21(15,3)19(16)9-10-22(17,18)4/h15-19,24H,5-13H2,1-4H3/t15-,16-,17+,18-,19-,20+,21-,22+/m0/s1" |
| Standard InCHIKey:   | PGTVWKLGGCQMBR-FLBATMFCSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5360Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6304 | NPC320549 |
| Remote Similarity | 0.6304 | NPC156277 |
| Remote Similarity | 0.6304 | NPC326136 |
| Remote Similarity | 0.6304 | NPC58057 |
| Remote Similarity | 0.6304 | NPC151018 |
| Remote Similarity | 0.6304 | NPC608270 |
| Remote Similarity | 0.6304 | NPC609574 |
| Remote Similarity | 0.6304 | NPC611848 |
| Remote Similarity | 0.6 | NPC143597 |
| Remote Similarity | 0.6 | NPC151464 |
| Remote Similarity | 0.587 | NPC561272 |
| Remote Similarity | 0.5745 | NPC110615 |
| Remote Similarity | 0.5625 | NPC56044 |
| Remote Similarity | 0.5625 | NPC532962 |
| Remote Similarity | 0.54 | NPC319629 |
| Remote Similarity | 0.54 | NPC546223 |
| Remote Similarity | 0.5294 | NPC254340 |
| Remote Similarity | 0.5294 | NPC602630 |
| Remote Similarity | 0.5192 | NPC75909 |
| Remote Similarity | 0.5098 | NPC507647 |
| TTD   | |
| DrugBank   | DB05087 |
| ChEMBL   | CHEMBL1568698 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   | 38398-32-2 |
| Molecular Weight   | 332.27 |
| ALogP   | 0.8801 |
| MLogP   | 3.66 |
| XLogP   | 6.515 |
| HDA   | 2 |
| HBD   | 1 |
| Rotatable Bonds   | 6 |
| TPSA   | 37.3 |
| RO5 Violation   | 1 |