NPASS Compound

Natural Product: NPC470779

Natural Product ID	NPC470779
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Javanicolide F
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2228450
PubChem CID	46182898
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001283] Terpene lactones [CHEMONTID:0002119] Quassinoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 83 87 0 0 0 0 0 0 0 0999 V2000 -5.0090 -1.9006 -3.2534 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8864 -1.7641 -1.7461 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2061 -0.4113 -1.4881 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9956 -0.3832 -2.3197 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9118 0.5912 -1.9189 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7374 0.7673 -0.4609 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8248 2.1798 0.0387 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3264 2.0715 1.3192 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2851 1.1009 1.2761 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2394 0.6308 -0.1127 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3408 -0.6373 -0.4900 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0061 -0.8658 -1.9396 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4224 -1.9271 -2.4388 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7432 0.1015 -2.5467 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7734 -0.5115 -0.5141 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5972 -1.4969 0.0098 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0321 -2.5011 0.5052 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0570 -1.3865 -0.0064 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7118 -0.3834 -0.4996 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9757 0.7497 -1.0980 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1870 -0.3614 -0.4694 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7756 -1.5976 0.1732 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7142 -0.3956 -1.9214 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6948 0.7710 0.1952 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3497 0.9725 1.5126 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6068 0.2216 2.1832 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8875 2.1677 2.2175 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8143 -0.0432 2.1230 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2358 -0.3879 1.7526 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5386 -0.2281 0.2997 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9995 -0.1715 -0.0076 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6363 -1.3599 0.7333 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0716 -1.4502 0.3139 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0177 -1.2913 1.0290 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2784 -1.7719 -1.1471 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7750 -3.0664 -1.2914 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7444 1.0342 0.3768 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0572 0.3318 2.6054 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7276 0.3736 3.4513 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9363 1.6357 1.8659 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9644 0.9400 1.9574 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9780 2.9384 2.3397 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1763 3.4602 2.9169 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0385 -2.3058 -3.6553 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7640 -2.6980 -3.4371 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2971 -0.9594 -3.7462 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2635 -2.6064 -1.4066 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9345 0.3353 -1.9254 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5704 -1.4240 -2.3582 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2736 -0.1460 -3.3702 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1401 1.5809 -2.4293 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7441 2.6992 -0.0698 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0452 2.7561 -0.5458 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2442 1.4407 -0.7356 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0323 -1.5617 0.0136 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6046 -2.2321 0.4390 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3581 0.3941 -1.9752 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6475 1.5174 -1.5333 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3042 1.2726 -0.4137 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4446 -2.4918 -0.3957 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4078 -1.7164 1.2058 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8816 -1.5821 0.1631 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7544 0.6624 -2.2719 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7365 -0.8243 -1.9069 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0680 -1.0353 -2.5268 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0110 2.6625 2.7200 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5841 1.7574 3.0036 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3967 2.8314 1.5077 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1594 -0.9339 2.0346 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3688 -1.4675 2.0695 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2179 -1.2211 -0.1641 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6753 -1.1605 1.8371 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0803 -2.2843 0.5973 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8703 -1.0122 -1.6599 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5011 -3.0966 -1.9896 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8173 0.7381 0.5947 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8707 1.7045 -0.5261 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4278 1.6103 1.2299 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2085 -0.1361 3.4767 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8043 1.3547 3.5554 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7469 2.6809 3.4419 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9629 4.3211 3.5781 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7739 3.8301 2.0487 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 2 0 12 14 1 0 11 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 2 3 19 20 1 0 19 21 1 0 21 22 1 0 21 23 1 0 21 24 1 0 24 25 1 0 25 26 2 0 25 27 1 0 9 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 2 0 33 35 1 0 35 36 1 0 31 37 1 0 29 38 1 0 28 39 1 0 9 40 1 0 40 41 2 0 40 42 1 0 42 43 1 0 35 2 1 0 31 3 1 0 14 5 1 0 10 6 1 0 30 6 1 0 1 44 1 0 1 45 1 0 1 46 1 0 2 47 1 0 3 48 1 0 4 49 1 0 4 50 1 0 5 51 1 0 7 52 1 0 7 53 1 0 10 54 1 0 11 55 1 0 18 56 1 0 20 57 1 0 20 58 1 0 20 59 1 0 22 60 1 0 22 61 1 0 22 62 1 0 23 63 1 0 23 64 1 0 23 65 1 0 27 66 1 0 27 67 1 0 27 68 1 0 28 69 1 0 29 70 1 0 30 71 1 0 32 72 1 0 32 73 1 0 35 74 1 0 36 75 1 0 37 76 1 0 37 77 1 0 37 78 1 0 38 79 1 0 39 80 1 0 43 81 1 0 43 82 1 0 43 83 1 0 M END

Standard InCHIKey	BQLTVAOKAIIXRW-VRHCSSKCSA-N
Standard InCHI	InChI=1S/C30H40O13/c1-12(27(4,5)43-14(3)31)8-18(33)42-21-23-29-11-40-30(23,26(38)39-7)24(36)20(35)22(29)28(6)10-16(32)19(34)13(2)15(28)9-17(29)41-25(21)37/h8,13,15,17,19-24,34-36H,9-11H2,1-7H3/b12-8+/t13-,15-,17+,19+,20+,21+,22+,23+,24-,28-,29+,30+/m0/s1
SMILES	CC1C2CC3C45COC(C4C(C(=O)O3)OC(=O)C=C(C)C(C)(C)OC(=O)C)(C(C(C5C2(CC(=O)C1O)C)O)O)C(=O)OC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	608.25	Volume:	583.108 ? Van der Waals volume.
Dense:	1.043	LogP:	1.375 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.903 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.408 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	29.0
TPSA:	192.19 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	3.0	Rings:	5.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.215	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.809	Fsp³:	0.767
MCE-18:	149.774 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.03	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.03 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.381 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.042	Promiscuous compounds:	0.001

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.687	MDCK Permeability:	-4.996
Pgp-inhibitor:	0.014	Pgp-substrate:	0.954
PAMPA:	0.989 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.375
20% Bioavailability (F20%):	0.17	30% Bioavailability (F30%):	0.917
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	1.0
Plasma Protein Binding (PPB):	41.034%	Volume Distribution (VD):	-0.397
Fu:	61.312% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.021
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.017
BSEP inhibitor:	0.802

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.758	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.008	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.994	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.809
HLM stability:	0.006 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.124

Half-life (T1/2):

3.134

ADMET: Toxicity

hERG Blockers:	0.022	hERG Blockers (10um):	0.257
Human Hepatotoxicity (H-HT):	0.531	Drug-induced Liver Injury (DILI):	0.843
AMES Toxicity:	0.723	Rat Oral Acute Toxicity:	0.757
Maximum Recommended Daily Dose:	0.933	Skin Sensitization:	0.076
Carcinogencity:	0.1	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.159
Drug-induced Neurotoxicity:	0.883	Ototoxicity:	0.984
Hematotoxicity:	0.049	Drug-induced Nephrotoxicity:	0.748
Genotoxicity:	0.999	RPMI-8226 Immunitoxicity:	0.266
A549 Cytotoxicity:	0.036	Hek293 Cytotoxicity:	0.55
BCF:	0.477 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.288 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.473 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.508 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	seed	n.a.	DOI[10.1016/0031-9422(96)00258-0]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	fruit	n.a.	DOI[10.1016/S1383-5769(99)00023-9]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10086989]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1512598]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	Seeds	n.a.	n.a.	PMID[15165151]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	fruit	Indonesia	n.a.	PMID[17896817]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	Vietnam	n.a.	PMID[19026551]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	seeds	n.a.	n.a.	PMID[20050684]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	Seeds	n.a.	n.a.	PMID[22506620]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[6481366]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[7561896]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO14948	Brucea javanica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1

Activity Type	# Activity
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT786	Organism	Tobacco mosaic virus	Tobacco mosaic virus	Inhibition	=	52.1	%	PMID[17850214]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC470779 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	16056
0.1-0.2	32014
0.2-0.3	1715
0.3-0.4	22
0.4-0.5	10
0.5-0.6	24
0.6-0.7	11
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8767	High Similarity	NPC146432
0.8767	High Similarity	NPC470778
0.7349	Intermediate Similarity	NPC480786
0.7262	Intermediate Similarity	NPC105926
0.7089	Intermediate Similarity	NPC479018
0.6875	Remote Similarity	NPC89929
0.6824	Remote Similarity	NPC480777
0.65	Remote Similarity	NPC213084
0.6235	Remote Similarity	NPC18945
0.6235	Remote Similarity	NPC152301
0.6224	Remote Similarity	NPC471089
0.6162	Remote Similarity	NPC480778
0.6092	Remote Similarity	NPC480785
0.6092	Remote Similarity	NPC480787
0.6092	Remote Similarity	NPC480784
0.6023	Remote Similarity	NPC265557
0.5955	Remote Similarity	NPC476729
0.5833	Remote Similarity	NPC143268
0.5747	Remote Similarity	NPC476008
0.5747	Remote Similarity	NPC24651
0.5682	Remote Similarity	NPC480783
0.5667	Remote Similarity	NPC94509
0.5618	Remote Similarity	NPC190185
0.5556	Remote Similarity	NPC67251
0.5529	Remote Similarity	NPC470776
0.5529	Remote Similarity	NPC17772
0.5517	Remote Similarity	NPC323821
0.5465	Remote Similarity	NPC470777
0.5455	Remote Similarity	NPC16081
0.54	Remote Similarity	NPC262813
0.5354	Remote Similarity	NPC190065
0.5326	Remote Similarity	NPC479017
0.5248	Remote Similarity	NPC141215
0.5196	Remote Similarity	NPC479019
0.5192	Remote Similarity	NPC251998
0.5169	Remote Similarity	NPC485623
0.5146	Remote Similarity	NPC480779
0.5146	Remote Similarity	NPC295885
0.5096	Remote Similarity	NPC140045
0.5051	Remote Similarity	NPC87662

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC470779 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6604
0.1-0.2	2514
0.2-0.3	32
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data