NPASS Compound

Natural Product: NPC473635

Natural Product ID	NPC473635
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	IFQUEPTUVAUUGK-MAGBKWLRSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL447745
PubChem CID	44567004
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001125] Steroid lactones [CHEMONTID:0001560] Withanolides and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 83 88 0 0 0 0 0 0 0 0999 V2000 -2.0885 -5.2707 1.4436 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3895 -4.1209 0.5588 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7043 -4.3374 -0.6486 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3319 -2.8170 1.0313 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6185 -1.7269 0.1877 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5393 -0.7026 0.2878 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1852 -1.0899 -0.0415 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3770 -2.3894 0.3204 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8574 -2.1223 0.1163 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0358 -0.5925 0.1569 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7359 -0.1026 0.6601 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5779 -0.2636 2.1524 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3176 1.2568 0.2185 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8781 1.4558 -0.5927 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8741 0.3731 -0.7674 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2952 0.7546 -0.8045 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1210 0.2744 0.3427 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8891 -1.0814 0.7352 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6400 0.0991 1.6048 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5319 0.7818 0.2651 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.1432 0.3504 -1.0145 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4317 0.0593 -2.0923 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9728 0.1657 -2.0256 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2421 -0.2255 -2.9730 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6431 2.1532 0.4913 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3169 2.6891 1.5511 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8849 1.9394 2.3965 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3726 4.1831 1.6967 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4759 2.2656 -1.0177 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2890 -0.2965 0.8495 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4557 -0.9383 0.0782 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6890 -0.3974 -1.2765 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8370 0.5518 -1.3997 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7507 0.7460 -0.4955 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6678 -0.0217 0.7605 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5188 0.1180 1.6767 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6351 -0.8904 0.8962 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8858 1.6898 -0.6264 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9247 1.3284 -2.6656 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2776 -1.1092 2.0404 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5837 1.0709 1.3119 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7459 -6.1100 0.8081 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0227 -5.6023 1.9587 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3094 -4.9853 2.1905 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8716 -2.0429 -0.8447 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7248 -0.1620 1.2384 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0917 -0.9510 -1.1400 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1213 -2.8614 1.2524 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1111 -3.1266 -0.4954 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3785 -2.5931 0.9748 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2683 -2.5592 -0.7924 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0649 -0.3198 -0.9299 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4167 -1.2922 2.4948 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3221 0.3153 2.5309 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4860 0.0946 2.7253 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2583 1.8989 1.1406 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2119 1.6924 -0.3246 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4597 2.3460 -0.1969 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5863 1.8352 -1.6222 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6198 -0.1580 -1.7360 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6244 -1.7118 1.2539 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0891 0.2664 1.1030 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2174 0.2600 -1.1027 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8744 -0.2556 -3.0270 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3470 4.5564 1.9363 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6470 4.6587 0.7337 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0185 4.4878 2.5256 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7288 2.5805 -1.7748 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4753 2.4568 -1.5097 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4372 2.8218 -0.0787 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2405 -2.0360 -0.0105 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9887 -1.2378 -1.9827 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7820 0.0124 -1.7574 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7724 2.4049 -1.4519 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0506 2.1999 0.3672 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8055 1.0518 -0.7604 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9091 2.4306 -2.4186 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0798 1.1619 -3.3389 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9173 1.1675 -3.1588 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1538 -0.9792 2.4522 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1959 1.0975 2.2658 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2344 1.6573 0.5944 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7361 1.7193 1.5050 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 17 20 1 0 20 21 1 0 21 22 2 0 22 23 1 0 23 24 2 0 20 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 16 29 1 6 10 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 2 0 34 35 1 0 35 36 2 0 35 37 1 0 34 38 1 0 33 39 1 0 30 40 1 1 30 41 1 0 18 5 1 0 37 31 1 0 15 6 1 0 23 16 1 0 11 7 1 0 17 19 1 1 1 42 1 0 1 43 1 0 1 44 1 0 5 45 1 6 6 46 1 1 7 47 1 6 8 48 1 0 8 49 1 0 9 50 1 0 9 51 1 0 10 52 1 6 12 53 1 0 12 54 1 0 12 55 1 0 13 56 1 0 13 57 1 0 14 58 1 0 14 59 1 0 15 60 1 6 18 61 1 1 20 62 1 1 21 63 1 0 22 64 1 0 28 65 1 0 28 66 1 0 28 67 1 0 29 68 1 0 29 69 1 0 29 70 1 0 31 71 1 6 32 72 1 0 32 73 1 0 38 74 1 0 38 75 1 0 38 76 1 0 39 77 1 0 39 78 1 0 39 79 1 0 40 80 1 0 41 81 1 0 41 82 1 0 41 83 1 0 M END

Standard InCHIKey	IFQUEPTUVAUUGK-MAGBKWLRSA-N
Standard InCHI	InChI=1S/C32H42O9/c1-15-14-24(40-28(36)16(15)2)31(7,37)21-9-8-19-25-20(12-13-29(19,21)5)30(6)22(35)10-11-23(38-17(3)33)32(30)27(41-32)26(25)39-18(4)34/h10-11,19-21,23-27,37H,8-9,12-14H2,1-7H3/t19-,20-,21-,23-,24+,25-,26+,27+,29-,30-,31+,32+/m0/s1
SMILES	CC(=O)O[C@@H]1[C@H]2[C@@H]3CC[C@@H]([C@@]3(C)CC[C@@H]2[C@@]2([C@]3([C@@H]1O3)[C@H](C=CC2=O)OC(=O)C)C)[C@]([C@H]1CC(=C(C(=O)O1)C)C)(O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	570.28	Volume:	573.983 ? Van der Waals volume.
Dense:	0.994	LogP:	2.902 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.989 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.564 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	32.0
TPSA:	128.73 ? Topological Polar Surface Area.	H-Bond Acceptor:	9.0
H-Bond Donor:	1.0	Rings:	6.0
Heavy Atoms:	9.0

MedChem Properties

QED Drug-Likeness Score:	0.306	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.968	Fsp³:	0.75
MCE-18:	157.143 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.737	Fluc inhibitor:	0.068 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.174	Promiscuous compounds:	0.634

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.291	MDCK Permeability:	-4.96
Pgp-inhibitor:	0.496	Pgp-substrate:	0.039
PAMPA:	0.923 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.029	30% Bioavailability (F30%):	0.235
50% Bioavailability (F50%):	0.906

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.282	MRP1:	0.975
Plasma Protein Binding (PPB):	73.873%	Volume Distribution (VD):	-0.326
Fu:	22.413% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.967	BCRP inhibitor:	0.004
BSEP inhibitor:	0.999

ADMET: Metabolism

CYP1A2-inhibitor:	1.0	CYP1A2-substrate:	0.008
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.642	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.052	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.458	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.994 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

5.995

Half-life (T1/2):

1.129

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.044
Human Hepatotoxicity (H-HT):	0.706	Drug-induced Liver Injury (DILI):	0.82
AMES Toxicity:	0.948	Rat Oral Acute Toxicity:	0.452
Maximum Recommended Daily Dose:	0.595	Skin Sensitization:	1.0
Carcinogencity:	0.885	Eye Corrosion:	0.006
Eye Irritation:	0.371	Respiratory Toxicity:	0.182
Drug-induced Neurotoxicity:	0.083	Ototoxicity:	0.737
Hematotoxicity:	0.824	Drug-induced Nephrotoxicity:	0.994
Genotoxicity:	0.984	RPMI-8226 Immunitoxicity:	0.129
A549 Cytotoxicity:	0.173	Hek293 Cytotoxicity:	0.349
BCF:	0.598 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.515 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.142 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.512 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27252	Iochroma australe	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12027740]
NPO27252	Iochroma australe	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
CD	1
Ratio	1

Activity Type	# Activity
Individual protein	1
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT440	Individual protein	Quinone oxidoreductase	Mus musculus	CD	=	0.26	uM	PubChem BioAssay data set

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	Ratio	=	1.3	n.a.	PMID[15566301]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC473635 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19885
0.1-0.2	25983
0.2-0.3	3824
0.3-0.4	136
0.4-0.5	22
0.5-0.6	8
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.5823	Remote Similarity	NPC473627
0.5823	Remote Similarity	NPC293112
0.5823	Remote Similarity	NPC609580
0.5696	Remote Similarity	NPC170538
0.5238	Remote Similarity	NPC484745
0.5185	Remote Similarity	NPC37116
0.5185	Remote Similarity	NPC486565
0.5059	Remote Similarity	NPC67569

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC473635 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6707
0.1-0.2	2323
0.2-0.3	119
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data