NPASS Compound

Natural Product: NPC201852

Natural Product ID	NPC201852
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Suberosol
IUPAC Name	(3S,5R,10S,13R,14R,15S,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,15-diol
Synonyms	suberosol
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL456314
PubChem CID	21592340
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0003567] Ergostane steroids [CHEMONTID:0001403] Ergosterols and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 83 86 0 0 0 0 0 0 0 0999 V2000 7.0162 1.0894 0.8925 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1159 -0.4029 0.7572 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2135 -0.6339 -0.2854 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8182 -0.9697 0.3617 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8415 -1.5451 -0.8730 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5802 -1.0875 1.0981 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7069 0.0307 1.4181 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0778 0.8689 0.3910 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0220 1.6023 -0.5466 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9353 0.4398 -0.3902 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0208 -0.7645 -1.2743 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5557 -0.9048 -1.7547 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2184 0.1797 -1.0385 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1363 1.4572 -1.8331 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6024 -0.1651 -0.6840 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3363 -0.8525 -1.5540 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7696 -1.2058 -1.1864 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2695 -0.0325 -0.3571 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7247 0.1259 -0.2923 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5216 -1.1741 -0.3087 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1826 0.8598 -1.5708 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2337 0.9533 0.8417 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0371 1.7315 1.4004 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1509 0.6683 2.0380 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5070 -0.0958 0.9448 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4145 -1.5523 1.4404 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1078 0.2657 0.6221 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3409 0.9325 1.4653 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0911 1.2863 1.1350 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6178 0.2271 0.2579 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4166 -1.1162 0.8870 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8337 0.1967 1.8479 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4773 -0.6602 -3.1358 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0377 1.4444 1.1976 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2386 1.4408 1.5572 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8531 1.5206 -0.1418 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5145 -0.7991 1.7057 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0143 -0.0402 -1.1757 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4566 -1.6873 -0.4332 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1316 -0.1675 0.1826 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7263 -1.5753 -1.4865 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9107 -1.9766 -1.2123 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0261 -2.0151 0.7264 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9302 -1.5273 2.1286 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2071 0.6523 2.2342 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8874 -0.4339 2.1020 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6835 1.7769 1.0100 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3286 2.2319 -1.1920 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5547 0.9796 -1.2509 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6140 2.3747 -0.0166 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7487 1.2881 -1.1342 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3814 -1.6821 -0.8453 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6375 -0.5442 -2.1954 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1746 -1.9115 -1.5941 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1693 1.5870 -2.2824 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5148 1.3588 -2.7449 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0366 2.3648 -1.2630 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9259 -1.1499 -2.4918 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3454 -1.2376 -2.1180 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7903 -2.1657 -0.6436 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8616 0.8784 -0.8965 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5955 -1.6662 0.6563 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5688 -0.8607 -0.6016 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1431 -1.7920 -1.1395 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5403 1.7338 -1.6877 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2490 1.1035 -1.5178 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0059 0.1514 -2.3985 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9798 1.7217 0.5432 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5579 2.2265 0.5567 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4007 2.3945 2.1988 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8925 -0.0211 2.5605 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5348 1.0460 2.8430 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1364 -1.4612 2.5333 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5960 -2.1057 0.9880 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3704 -2.0680 1.4199 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6649 1.2718 2.4350 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0772 2.3055 0.7596 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6447 1.3153 2.0967 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3372 -1.7647 0.8922 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0051 -1.0317 1.9371 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3296 -1.7612 0.3723 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7610 0.0212 1.5380 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6269 -1.4959 -3.6630 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 2 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 6 13 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 19 21 1 0 19 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 25 27 1 0 27 28 2 0 28 29 1 0 29 30 1 0 30 31 1 1 22 32 1 0 12 33 1 0 30 10 1 0 30 13 1 0 27 15 1 0 25 18 1 0 1 34 1 0 1 35 1 0 1 36 1 0 2 37 1 0 3 38 1 0 3 39 1 0 3 40 1 0 5 41 1 0 5 42 1 0 6 43 1 0 6 44 1 0 7 45 1 0 7 46 1 0 8 47 1 1 9 48 1 0 9 49 1 0 9 50 1 0 10 51 1 6 11 52 1 0 11 53 1 0 12 54 1 6 14 55 1 0 14 56 1 0 14 57 1 0 16 58 1 0 17 59 1 0 17 60 1 0 18 61 1 6 20 62 1 0 20 63 1 0 20 64 1 0 21 65 1 0 21 66 1 0 21 67 1 0 22 68 1 6 23 69 1 0 23 70 1 0 24 71 1 0 24 72 1 0 26 73 1 0 26 74 1 0 26 75 1 0 28 76 1 0 29 77 1 0 29 78 1 0 31 79 1 0 31 80 1 0 31 81 1 0 32 82 1 0 33 83 1 0 M END

Standard InCHIKey	MJRURUDEESYVHI-UJZFCZBUSA-N
Standard InCHI	InChI=1S/C31H50O2/c1-19(2)20(3)10-11-21(4)24-18-27(33)31(9)23-12-13-25-28(5,6)26(32)15-16-29(25,7)22(23)14-17-30(24,31)8/h12,14,19,21,24-27,32-33H,3,10-11,13,15-18H2,1-2,4-9H3/t21-,24-,25+,26+,27+,29-,30-,31-/m1/s1
SMILES	CC(C)C(=C)CC[C@@H](C)[C@H]1C[C@@H]([C@@]2(C)C3=CC[C@H]4C(C)(C)[C@H](CC[C@]4(C)C3=CC[C@]12C)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	454.38	Volume:	520.177 ? Van der Waals volume.
Dense:	0.874	LogP:	5.568 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.376 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.471 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	5.0	Rigid Bonds:	21.0
TPSA:	40.46 ? Topological Polar Surface Area.	H-Bond Acceptor:	2.0
H-Bond Donor:	2.0	Rings:	4.0
Heavy Atoms:	2.0

MedChem Properties

QED Drug-Likeness Score:	0.423	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.07	Fsp³:	0.806
MCE-18:	81.321 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.874	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.05 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.505	Promiscuous compounds:	0.054

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.129	MDCK Permeability:	-4.759
Pgp-inhibitor:	0.189	Pgp-substrate:	0.108
PAMPA:	0.378 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.532	30% Bioavailability (F30%):	0.528
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.321	MRP1:	0.843
Plasma Protein Binding (PPB):	91.652%	Volume Distribution (VD):	-0.019
Fu:	7.388% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.925
BSEP inhibitor:	0.707

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.989
CYP2C19-inhibitor:	0.983	CYP2C19-substrate:	0.982
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.634
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.79
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.999 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

12.597

Half-life (T1/2):

0.66

ADMET: Toxicity

hERG Blockers:	0.062	hERG Blockers (10um):	0.327
Human Hepatotoxicity (H-HT):	0.544	Drug-induced Liver Injury (DILI):	0.062
AMES Toxicity:	0.252	Rat Oral Acute Toxicity:	0.391
Maximum Recommended Daily Dose:	0.723	Skin Sensitization:	0.834
Carcinogencity:	0.657	Eye Corrosion:	0.006
Eye Irritation:	0.549	Respiratory Toxicity:	0.746
Drug-induced Neurotoxicity:	0.106	Ototoxicity:	0.762
Hematotoxicity:	0.287	Drug-induced Nephrotoxicity:	0.476
Genotoxicity:	0.254	RPMI-8226 Immunitoxicity:	0.125
A549 Cytotoxicity:	0.218	Hek293 Cytotoxicity:	0.264
BCF:	2.285 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.248 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.475 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.034 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO4296	Polyalthia suberosa	Species	Annonaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[38609961]
NPO4296	Polyalthia suberosa	Species	Annonaceae	Eukaryota	n.a.	leaf	n.a.	PMID[8377018]
NPO4296	Polyalthia suberosa	Species	Annonaceae	Eukaryota	n.a.	stem	n.a.	PMID[8377018]
NPO4296	Polyalthia suberosa	Species	Annonaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO4296	Polyalthia suberosa	Species	Annonaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO4296	Polyalthia suberosa	Species	Annonaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	1
IC50	1

Activity Type	# Activity
Cell line	1
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT759	Cell line	H9	Homo sapiens	IC50	=	20.0	ug.mL-1	PMID[8377018]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC50	=	3.0	ug.mL-1	PMID[8377018]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC201852 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25369
0.1-0.2	20997
0.2-0.3	3103
0.3-0.4	334
0.4-0.5	29
0.5-0.6	22
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7857	Intermediate Similarity	NPC147568
0.6875	Remote Similarity	NPC138536
0.6364	Remote Similarity	NPC203035
0.5714	Remote Similarity	NPC205455
0.5652	Remote Similarity	NPC77168
0.5625	Remote Similarity	NPC6707
0.5571	Remote Similarity	NPC477812
0.5556	Remote Similarity	NPC489791
0.5455	Remote Similarity	NPC202389
0.5312	Remote Similarity	NPC20853
0.5294	Remote Similarity	NPC475772
0.5286	Remote Similarity	NPC472942
0.5286	Remote Similarity	NPC69622
0.5286	Remote Similarity	NPC250575
0.5286	Remote Similarity	NPC607637
0.5263	Remote Similarity	NPC94393
0.5231	Remote Similarity	NPC186191
0.5211	Remote Similarity	NPC45324
0.5211	Remote Similarity	NPC162001
0.5156	Remote Similarity	NPC118508
0.5135	Remote Similarity	NPC285702
0.5135	Remote Similarity	NPC166745
0.5135	Remote Similarity	NPC235464
0.507	Remote Similarity	NPC212948
0.5068	Remote Similarity	NPC484968

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC201852 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8045
0.1-0.2	1041
0.2-0.3	64
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data