NPASS Compound

Natural Product: NPC87489

Natural Product ID	NPC87489
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Lanosta-8,23E-Diene-3Beta,22R,25-Triol
IUPAC Name	(E,5R,6S)-6-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-3-ene-2,5-diol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL456462
PubChem CID	44581566
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 83 86 0 0 0 0 0 0 0 0999 V2000 4.5153 -0.6480 1.7221 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4328 -0.8249 0.3484 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2086 -0.1987 -0.2761 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9992 -0.7902 0.3086 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9592 -0.5347 1.7991 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4735 -0.3724 2.1565 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2082 -0.8891 0.9407 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6732 -0.2814 -0.1661 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5273 1.1990 -0.0861 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2052 -0.8548 -1.4547 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2537 -1.1396 -1.5354 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0804 -0.4881 -0.5010 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5692 -0.3627 0.7200 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2728 0.2651 1.8573 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6271 0.8016 1.5197 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2425 -0.0711 0.4710 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4682 0.0233 -0.8109 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3187 1.4088 -1.3410 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0918 -0.8358 -1.8735 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5679 -0.6088 -1.9884 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2444 -0.8599 -0.6825 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7128 0.1457 0.3184 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1016 1.5515 0.0155 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3562 -0.2189 1.6643 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6301 -0.7478 -0.7994 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1433 -2.3853 0.9433 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3424 -0.3710 -1.7705 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6831 -0.3896 -0.3337 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2371 0.7389 0.0701 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4815 1.2061 -0.5833 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5475 0.8019 -1.9255 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4490 2.7191 -0.5890 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6514 0.6764 0.2008 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9104 -1.4347 2.1848 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3822 -1.9443 0.1976 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2641 0.9001 -0.0617 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0264 -1.8871 0.1355 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3554 -1.3490 2.4038 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5077 0.4019 2.0624 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2388 -0.9669 3.0759 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2971 0.6967 2.2894 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6652 1.6195 -1.1166 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1714 1.6800 0.6592 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5284 1.4872 0.1934 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4642 -0.1143 -2.2603 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7731 -1.7771 -1.7371 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4837 -2.2440 -1.5424 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6603 -0.7890 -2.5293 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7013 1.0852 2.3384 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3645 -0.5325 2.6502 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6417 1.8685 1.2901 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2602 0.6792 2.4477 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1150 -1.1357 0.8323 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5113 1.3678 -2.1309 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9950 2.1600 -0.6218 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2266 1.7536 -1.9096 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6496 -0.5101 -2.8612 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9275 -1.9210 -1.6990 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9653 -1.3789 -2.7131 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8019 0.3679 -2.4457 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9667 -1.8581 -0.3292 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2930 2.2942 0.1707 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4919 1.6516 -1.0185 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9470 1.9084 0.6745 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4871 0.7109 2.2731 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3675 -0.6391 1.5291 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6966 -0.8854 2.2428 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1163 -1.3816 -0.2182 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2286 -2.8399 0.0259 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5303 -2.7597 1.7695 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1574 -2.7781 1.2324 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1117 -1.3824 -2.1103 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8227 0.4317 -2.3388 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4386 -0.2104 -1.9984 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1285 -0.9810 -1.1400 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8121 1.3317 0.8611 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6756 0.8405 -2.3663 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4794 3.0993 -0.6914 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9377 3.0835 0.3284 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7969 3.0224 -1.4444 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5200 0.5494 -0.4799 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4453 -0.3165 0.6529 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8749 1.3613 1.0437 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 6 8 10 1 0 10 11 1 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 6 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 21 25 1 0 7 26 1 1 3 27 1 0 2 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 30 32 1 0 30 33 1 0 8 4 1 0 17 12 1 0 13 7 1 0 22 16 1 0 1 34 1 0 2 35 1 1 3 36 1 6 4 37 1 1 5 38 1 0 5 39 1 0 6 40 1 0 6 41 1 0 9 42 1 0 9 43 1 0 9 44 1 0 10 45 1 0 10 46 1 0 11 47 1 0 11 48 1 0 14 49 1 0 14 50 1 0 15 51 1 0 15 52 1 0 16 53 1 1 18 54 1 0 18 55 1 0 18 56 1 0 19 57 1 0 19 58 1 0 20 59 1 0 20 60 1 0 21 61 1 1 23 62 1 0 23 63 1 0 23 64 1 0 24 65 1 0 24 66 1 0 24 67 1 0 25 68 1 0 26 69 1 0 26 70 1 0 26 71 1 0 27 72 1 0 27 73 1 0 27 74 1 0 28 75 1 0 29 76 1 0 31 77 1 0 32 78 1 0 32 79 1 0 32 80 1 0 33 81 1 0 33 82 1 0 33 83 1 0 M END

Standard InCHIKey	KIWHRCNGJTUEHJ-IBDCHPIJSA-N
Standard InCHI	InChI=1S/C30H50O3/c1-19(23(31)13-15-26(2,3)33)20-11-17-30(8)22-9-10-24-27(4,5)25(32)14-16-28(24,6)21(22)12-18-29(20,30)7/h13,15,19-20,23-25,31-33H,9-12,14,16-18H2,1-8H3/b15-13+/t19-,20+,23+,24-,25-,28+,29+,30-/m0/s1
SMILES	O[C@@H]([C@H]([C@H]1CC[C@@]2([C@]1(C)CCC1=C2CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C)/C=C/C(O)(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	458.38	Volume:	514.308 ? Van der Waals volume.
Dense:	0.891	LogP:	3.93 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.72 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.956 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	21.0
TPSA:	60.69 ? Topological Polar Surface Area.	H-Bond Acceptor:	3.0
H-Bond Donor:	3.0	Rings:	4.0
Heavy Atoms:	3.0

MedChem Properties

QED Drug-Likeness Score:	0.426	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.974	Fsp³:	0.867
MCE-18:	86.214 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.923	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.019 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.385	Promiscuous compounds:	0.302

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.967	MDCK Permeability:	-4.82
Pgp-inhibitor:	0.125	Pgp-substrate:	0.103
PAMPA:	0.937 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.038
20% Bioavailability (F20%):	0.999	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.035	MRP1:	0.366
Plasma Protein Binding (PPB):	89.377%	Volume Distribution (VD):	-0.189
Fu:	7.808% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.761
BSEP inhibitor:	0.815

ADMET: Metabolism

CYP1A2-inhibitor:	0.155	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.979	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.003	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.025
CYP3A4-inhibitor:	0.005	CYP3A4-substrate:	0.221
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.583
HLM stability:	0.034 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

13.819

Half-life (T1/2):

0.619

ADMET: Toxicity

hERG Blockers:	0.03	hERG Blockers (10um):	0.111
Human Hepatotoxicity (H-HT):	0.688	Drug-induced Liver Injury (DILI):	0.121
AMES Toxicity:	0.551	Rat Oral Acute Toxicity:	0.392
Maximum Recommended Daily Dose:	0.61	Skin Sensitization:	0.987
Carcinogencity:	0.953	Eye Corrosion:	0.014
Eye Irritation:	0.605	Respiratory Toxicity:	0.884
Drug-induced Neurotoxicity:	0.038	Ototoxicity:	0.691
Hematotoxicity:	0.672	Drug-induced Nephrotoxicity:	0.888
Genotoxicity:	0.528	RPMI-8226 Immunitoxicity:	0.088
A549 Cytotoxicity:	0.781	Hek293 Cytotoxicity:	0.661
BCF:	1.849 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.153 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.592 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.923 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO18766	Inonotus obliquus	Species	Hymenochaetaceae	Eukaryota	sclerotia	n.a.	n.a.	PMID[17049251]
NPO18766	Inonotus obliquus	Species	Hymenochaetaceae	Eukaryota	sclerotia	n.a.	n.a.	PMID[18387711]
NPO18766	Inonotus obliquus	Species	Hymenochaetaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24359303]
NPO18766	Inonotus obliquus	Species	Hymenochaetaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18766	Inonotus obliquus	Species	Hymenochaetaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	5
IC50	1

Activity Type	# Activity
Cell line	1
Others	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT80	Cell line	Raji	Homo sapiens	Activity	=	70.0	%	PMID[18507473]
NPT2	Others	Unspecified	n.a.	Activity	=	89.2	%	PubChem BioAssay data set
NPT2	Others	Unspecified	n.a.	Activity	=	0.0	%	PMID[8988597]
NPT2	Others	Unspecified	n.a.	Activity	=	69.8	%	PMID[16252909]
NPT2	Others	Unspecified	n.a.	IC50	=	231.0	molar ratio	PMID[18955526]
NPT2	Others	Unspecified	n.a.	Activity	=	26.9	%	PMID[20691339]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC87489 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25468
0.1-0.2	21453
0.2-0.3	2609
0.3-0.4	240
0.4-0.5	50
0.5-0.6	16
0.6-0.7	16
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7455	Intermediate Similarity	NPC231477
0.7455	Intermediate Similarity	NPC123724
0.7273	Intermediate Similarity	NPC275910
0.6667	Remote Similarity	NPC46160
0.6667	Remote Similarity	NPC202642
0.661	Remote Similarity	NPC471724
0.65	Remote Similarity	NPC231310
0.6491	Remote Similarity	NPC118508
0.6491	Remote Similarity	NPC484086
0.6441	Remote Similarity	NPC214570
0.6441	Remote Similarity	NPC132635
0.6441	Remote Similarity	NPC601223
0.6271	Remote Similarity	NPC73875
0.623	Remote Similarity	NPC94755
0.619	Remote Similarity	NPC486193
0.6129	Remote Similarity	NPC308041
0.6129	Remote Similarity	NPC16350
0.6094	Remote Similarity	NPC486187
0.6032	Remote Similarity	NPC20388
0.5692	Remote Similarity	NPC471720
0.55	Remote Similarity	NPC606082
0.5455	Remote Similarity	NPC484084
0.5303	Remote Similarity	NPC259286
0.5303	Remote Similarity	NPC83216
0.5303	Remote Similarity	NPC471722
0.5303	Remote Similarity	NPC484085
0.5303	Remote Similarity	NPC605915
0.5224	Remote Similarity	NPC233836
0.5224	Remote Similarity	NPC159046
0.5224	Remote Similarity	NPC469400
0.5224	Remote Similarity	NPC187376
0.5147	Remote Similarity	NPC76895
0.5143	Remote Similarity	NPC474922
0.5075	Remote Similarity	NPC55309
0.5075	Remote Similarity	NPC28252

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC87489 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8043
0.1-0.2	1019
0.2-0.3	88
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data