Drug Information| Drug ID:   | NPD6683 |
| Drug Name:   | Inecalcitol |
| Molecular Formula:   | C26H40O3 |
| Canonical SMILES:   | O[C@H]1C[C@H](O)CC(=C/C=C/2CCC[C@]3([C@@H]2CC[C@@H]3[C@@H](CC#CC(O)(C)C)C)C)C1 |
| Standard InCHI:   | "InChI=1S/C26H40O3/c1-18(7-5-13-25(2,3)29)23-11-12-24-20(8-6-14-26(23,24)4)10-9-19-15-21(27)17-22(28)16-19/h9-10,18,21-24,27-29H,6-8,11-12,14-17H2,1-4H3/b20-10+/t18-,21-,22-,23-,24-,26-/m1/s1" |
| Standard InCHIKey:   | HHGRMHMXKPQNGF-WNSNRMDMSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6683Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5385 | NPC63893 |
| Remote Similarity | 0.5385 | NPC324772 |
| Remote Similarity | 0.5385 | NPC611865 |
| Remote Similarity | 0.5303 | NPC320525 |
| Remote Similarity | 0.5303 | NPC320548 |
| Remote Similarity | 0.5072 | NPC23466 |
| TTD   | DIB015725 |
| DrugBank   | DB04796 |
| ChEMBL   | CHEMBL2105107 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 6915835 |
| ChEBI   | |
| CAS Number   | 163217-09-2 |
| Molecular Weight   | 400.3 |
| ALogP   | 0.9936 |
| MLogP   | 3.99 |
| XLogP   | 5.538 |
| HDA   | 3 |
| HBD   | 3 |
| Rotatable Bonds   | 10 |
| TPSA   | 60.69 |
| RO5 Violation   | 1 |