NPASS drugs

Drug Information

Drug ID:	NPD4822
Drug Name:
Molecular Formula:	C21H36O5
Canonical SMILES:	CCCCC[C@@](/C=CC1[C@@H](O)C[C@H]([C@H]1C/C=C/CCCC(=O)O)O)(O)C
Standard InCHI:	"InChI=1S/C21H36O5/c1-3-4-9-13-21(2,26)14-12-17-16(18(22)15-19(17)23)10-7-5-6-8-11-20(24)25/h5,7,12,14,16-19,22-23,26H,3-4,6,8-11,13,15H2,1-2H3,(H,24,25)/b7-5+,14-12-/t16-,17?,18+,19-,21-/m0/s1"
Standard InCHIKey:	DLJKPYFALUEJCK-ZZYZZSCNSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD4822

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	72388
0.1-0.2	130368
0.2-0.3	7958
0.3-0.4	873
0.4-0.5	139
0.5-0.6	6
0.6-0.7	1
0.7-0.8	6
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7091	NPC260814
Intermediate Similarity	0.7091	NPC323249
Intermediate Similarity	0.7091	NPC27949
Intermediate Similarity	0.7091	NPC39547
Intermediate Similarity	0.7091	NPC561206
Intermediate Similarity	0.7091	NPC599790
Remote Similarity	0.6964	NPC27845
Remote Similarity	0.5862	NPC324411
Remote Similarity	0.5763	NPC328775
Remote Similarity	0.5246	NPC321240
Remote Similarity	0.5246	NPC181597
Remote Similarity	0.5156	NPC201225
Remote Similarity	0.5152	NPC562685

Drug Structure

NPD4822 OpenBabel08211705272D 30 30 0 0 1 0 0 0 0 0999 V2000 -5.0703 0.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7665 -0.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4825 1.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4880 1.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2981 -0.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2926 -0.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8913 -1.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6993 0.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0813 0.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8968 -1.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6938 0.3806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2788 -1.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0868 0.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2733 -1.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8090 0.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3090 -0.9511 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3090 -0.9511 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 1.6180 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.1006 1.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6800 -0.7420 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5691 0.3090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9511 0.3090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0951 1.3987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5128 2.1032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5936 -1.1487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7770 1.2872 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1590 1.2872 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9195 3.0167 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6981 -2.1433 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 3 4 1 0 0 0 0 4 9 1 0 0 0 0 5 6 1 0 0 0 0 5 7 2 0 0 0 0 6 8 1 0 0 0 0 7 10 1 0 0 0 0 8 11 1 0 0 0 0 9 13 1 0 0 0 0 11 20 1 0 0 0 0 12 14 2 0 0 0 0 12 17 1 0 0 0 0 13 21 1 0 0 0 0 14 21 1 0 0 0 0 15 18 1 0 0 0 0 15 19 1 0 0 0 0 16 10 1 1 0 0 0 16 17 1 0 0 0 0 16 18 1 0 0 0 0 17 19 1 0 0 0 0 18 22 1 1 0 0 0 19 23 1 1 0 0 0 20 24 2 0 0 0 0 20 25 1 0 0 0 0 21 2 1 6 0 0 0 21 26 1 0 0 0 0 22 27 1 0 0 0 0 23 28 1 0 0 0 0 25 29 1 0 0 0 0 26 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001215
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	6434572
ChEBI
CAS Number

Drug Properties

Molecular Weight	368.26
ALogP	-2.0238
MLogP	3.22
XLogP	3.313
HDA	5
HBD	4
Rotatable Bonds	18
TPSA	97.99
RO5 Violation	1