Drug Information| Drug ID:   | NPD368 |
| Drug Name:   | Sobrerol |
| Molecular Formula:   | C10H18O2 |
| Canonical SMILES:   | CC1=CC[C@@H](C[C@@H]1O)C(O)(C)C |
| Standard InCHI:   | "InChI=1S/C10H18O2/c1-7-4-5-8(6-9(7)11)10(2,3)12/h4,8-9,11-12H,5-6H2,1-3H3/t8-,9-/m0/s1" |
| Standard InCHIKey:   | OMDMTHRBGUBUCO-IUCAKERBSA-N |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD368Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC321867 |
| High Similarity | 1.0 | NPC68679 |
| High Similarity | 1.0 | NPC608256 |
| High Similarity | 1.0 | NPC603323 |
| Remote Similarity | 0.625 | NPC513628 |
| Remote Similarity | 0.5926 | NPC172642 |
| Remote Similarity | 0.5714 | NPC232247 |
| Remote Similarity | 0.5714 | NPC251666 |
| Remote Similarity | 0.5714 | NPC75121 |
| Remote Similarity | 0.5714 | NPC154466 |
| Remote Similarity | 0.5714 | NPC86564 |
| Remote Similarity | 0.5714 | NPC236602 |
| Remote Similarity | 0.5526 | NPC538763 |
| Remote Similarity | 0.5405 | NPC227667 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 170.13 |
| ALogP   | 0.5492 |
| MLogP   | 2.34 |
| XLogP   | 0.761 |
| HDA   | 2 |
| HBD   | 2 |
| Rotatable Bonds   | 6 |
| TPSA   | 40.46 |
| RO5 Violation   | 0 |