Drug Information| Drug ID:   | NPD342 |
| Drug Name:   | "perillyl alcohol, University of Wisconsin" |
| Molecular Formula:   | C10H16O |
| Canonical SMILES:   | OCC1=CCC(CC1)C(=C)C |
| Standard InCHI:   | "InChI=1S/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,10-11H,1,4-7H2,2H3" |
| Standard InCHIKey:   | NDTYTMIUWGWIMO-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD342Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC148216 |
| High Similarity | 1.0 | NPC130209 |
| High Similarity | 1.0 | NPC148163 |
| High Similarity | 1.0 | NPC606432 |
| High Similarity | 1.0 | NPC606982 |
| Remote Similarity | 0.6296 | NPC66020 |
| Remote Similarity | 0.6071 | NPC157805 |
| Remote Similarity | 0.6071 | NPC217791 |
| Remote Similarity | 0.6 | NPC190810 |
| Remote Similarity | 0.6 | NPC34764 |
| Remote Similarity | 0.6 | NPC76145 |
| Remote Similarity | 0.6 | NPC19879 |
| Remote Similarity | 0.5588 | NPC508003 |
| Remote Similarity | 0.5172 | NPC100809 |
| Remote Similarity | 0.5172 | NPC209431 |
| Remote Similarity | 0.5172 | NPC95031 |
| Molecular Weight   | 152.12 |
| ALogP   | 1.0517 |
| MLogP   | 2.45 |
| XLogP   | 1.848 |
| HDA   | 1 |
| HBD   | 1 |
| Rotatable Bonds   | 4 |
| TPSA   | 20.23 |
| RO5 Violation   | 0 |