NPASS Compound

Natural Product: NPC275910

Natural Product ID	NPC275910
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Inotodiol
IUPAC Name	(3S,5R,10S,13R,14R,17R)-17-[(2S,3R)-3-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol
Synonyms	Inotodiol
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL449088
PubChem CID	44422314
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 82 85 0 0 0 0 0 0 0 0999 V2000 7.0277 0.6823 -1.5109 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2259 -0.0718 -0.2606 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4619 0.1539 0.7799 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4010 1.1632 0.7037 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0015 0.6737 0.9580 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4715 -0.3533 0.0474 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1125 -0.8558 0.2653 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8459 -1.5185 1.6024 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3278 -1.7027 1.6162 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1157 -1.1937 0.2355 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9119 -0.0389 0.1113 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5424 0.8855 1.2421 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6523 0.6066 -1.1795 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7759 1.0388 -1.3339 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7675 0.3783 -0.4879 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4742 -0.6632 0.2487 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4563 -1.3835 1.1319 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6129 -0.4330 1.3621 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1016 -0.0265 -0.0078 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1449 0.9862 -0.5290 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0890 2.2597 0.2441 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5680 1.2693 -1.9655 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9084 1.9503 -1.8890 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9542 1.2029 -1.1723 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5303 0.3660 -0.0208 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3413 -0.9414 -0.0988 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9244 1.0089 1.3100 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8952 2.1436 -0.6855 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0467 -2.2384 -0.8043 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3803 -1.5467 -0.1521 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2317 1.8705 0.8595 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2946 -1.0888 -0.1830 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2544 1.7534 -1.2865 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6371 0.2696 -2.3177 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9575 0.5748 -1.8013 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5816 -0.3805 1.7301 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6460 1.9041 1.5292 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4659 1.7939 -0.2128 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9539 0.4257 2.0355 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4664 0.1477 -0.9777 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9951 -1.7285 -0.4605 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2194 -0.9651 2.4544 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2707 -2.5419 1.6491 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0252 -2.7455 1.7021 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1299 -1.0912 2.4214 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5243 0.7331 1.5990 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1273 0.7318 2.1643 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5070 1.9649 0.9150 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2626 1.5570 -1.2421 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9796 0.0336 -2.0720 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8760 2.1480 -1.1129 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0935 0.9997 -2.4265 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0165 -1.7470 2.0574 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8510 -2.2207 0.4847 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1632 0.4441 1.9155 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4108 -0.8937 1.9814 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9962 -0.9339 -0.6734 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4415 2.1848 1.1340 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5828 3.0210 -0.4203 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0788 2.7034 0.4687 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6793 0.3314 -2.5332 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8730 1.9966 -2.4568 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2248 2.1448 -2.9427 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7126 2.9803 -1.4678 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5416 0.6128 -1.9376 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3029 -1.3095 -1.1460 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9248 -1.7038 0.5625 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3573 -0.6865 0.2353 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6884 0.4205 1.8592 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3715 2.0164 1.1619 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0760 1.1357 1.9851 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4418 3.0435 -0.5972 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4508 -1.9106 -1.7682 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5601 -3.1651 -0.4098 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9891 -2.6256 -1.0495 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9871 -1.8072 0.7247 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7009 -2.4470 -0.2844 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9329 -1.5275 -1.1166 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3689 2.2068 -0.0743 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2167 -0.5799 0.2246 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0024 -1.8951 0.5324 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5027 -1.5196 -1.1771 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 25 27 1 0 24 28 1 0 10 29 1 6 6 30 1 0 5 31 1 0 2 32 1 0 11 7 1 0 20 15 1 0 16 10 1 0 25 19 1 0 1 33 1 0 1 34 1 0 1 35 1 0 3 36 1 0 4 37 1 0 4 38 1 0 5 39 1 1 6 40 1 6 7 41 1 6 8 42 1 0 8 43 1 0 9 44 1 0 9 45 1 0 12 46 1 0 12 47 1 0 12 48 1 0 13 49 1 0 13 50 1 0 14 51 1 0 14 52 1 0 17 53 1 0 17 54 1 0 18 55 1 0 18 56 1 0 19 57 1 6 21 58 1 0 21 59 1 0 21 60 1 0 22 61 1 0 22 62 1 0 23 63 1 0 23 64 1 0 24 65 1 6 26 66 1 0 26 67 1 0 26 68 1 0 27 69 1 0 27 70 1 0 27 71 1 0 28 72 1 0 29 73 1 0 29 74 1 0 29 75 1 0 30 76 1 0 30 77 1 0 30 78 1 0 31 79 1 0 32 80 1 0 32 81 1 0 32 82 1 0 M END

Standard InCHIKey	KKWJCGCIAHLFNE-KFPHZHIMSA-N
Standard InCHI	InChI=1S/C30H50O2/c1-19(2)9-11-24(31)20(3)21-13-17-30(8)23-10-12-25-27(4,5)26(32)15-16-28(25,6)22(23)14-18-29(21,30)7/h9,20-21,24-26,31-32H,10-18H2,1-8H3/t20-,21+,24+,25-,26-,28+,29+,30-/m0/s1
SMILES	CC(=CC[C@H]([C@H]([C@H]1CC[C@@]2([C@]1(C)CCC1=C2CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	442.38	Volume:	505.518 ? Van der Waals volume.
Dense:	0.875	LogP:	4.512 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.97 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.164 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	21.0
TPSA:	40.46 ? Topological Polar Surface Area.	H-Bond Acceptor:	2.0
H-Bond Donor:	2.0	Rings:	4.0
Heavy Atoms:	2.0

MedChem Properties

QED Drug-Likeness Score:	0.444	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.83	Fsp³:	0.867
MCE-18:	81.143 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.972	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.078 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.585	Promiscuous compounds:	0.219

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.172	MDCK Permeability:	-4.962
Pgp-inhibitor:	0.103	Pgp-substrate:	0.63
PAMPA:	0.986 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.643	30% Bioavailability (F30%):	0.223
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.334	MRP1:	0.636
Plasma Protein Binding (PPB):	92.166%	Volume Distribution (VD):	0.017
Fu:	8.042% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.947	BCRP inhibitor:	0.417
BSEP inhibitor:	0.523

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.995	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.001	CYP2C9-substrate:	0.002
CYP2D6-inhibitor:	0.036	CYP2D6-substrate:	0.002
CYP3A4-inhibitor:	0.098	CYP3A4-substrate:	0.007
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.896
HLM stability:	0.523 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

14.405

Half-life (T1/2):

0.779

ADMET: Toxicity

hERG Blockers:	0.031	hERG Blockers (10um):	0.184
Human Hepatotoxicity (H-HT):	0.551	Drug-induced Liver Injury (DILI):	0.019
AMES Toxicity:	0.151	Rat Oral Acute Toxicity:	0.071
Maximum Recommended Daily Dose:	0.085	Skin Sensitization:	0.989
Carcinogencity:	0.729	Eye Corrosion:	0.177
Eye Irritation:	0.899	Respiratory Toxicity:	0.441
Drug-induced Neurotoxicity:	0.003	Ototoxicity:	0.841
Hematotoxicity:	0.436	Drug-induced Nephrotoxicity:	0.744
Genotoxicity:	0.003	RPMI-8226 Immunitoxicity:	0.042
A549 Cytotoxicity:	0.346	Hek293 Cytotoxicity:	0.132
BCF:	2.299 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.531 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.623 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.272 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO18766	Inonotus obliquus	Species	Hymenochaetaceae	Eukaryota	sclerotia	n.a.	n.a.	PMID[17049251]
NPO18766	Inonotus obliquus	Species	Hymenochaetaceae	Eukaryota	sclerotia	n.a.	n.a.	PMID[18387711]
NPO18766	Inonotus obliquus	Species	Hymenochaetaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24359303]
NPO18766	Inonotus obliquus	Species	Hymenochaetaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18766	Inonotus obliquus	Species	Hymenochaetaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	5
Activity	2
IC50	4
Survival	3

Activity Type	# Activity
Cell line	7
Organism	5
Non-molecular	1
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT80	Cell line	Raji	Homo sapiens	Activity	=	70.0	%	PMID[19805565]
NPT407	Cell line	COLO 205	Homo sapiens	IC50	=	171000.0	nM	PMID[23634786]
NPT137	Cell line	L1210	Mus musculus	IC50	=	110000.0	nM	PMID[26034885]
NPT168	Cell line	P388	Mus musculus	IC50	=	13900.0	nM	PMID[26034885]
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	25000.0	nM	PMID[26034885]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Inhibition	=	56.3	%	PMID[24359303]
NPT164	Organism	Human herpesvirus 4	Human herpesvirus 4	Inhibition	=	2.4	%	PMID[18955526]
NPT164	Organism	Human herpesvirus 4	Human herpesvirus 4	Inhibition	=	37.6	%	PMID[18955526]
NPT164	Organism	Human herpesvirus 4	Human herpesvirus 4	Inhibition	=	66.1	%	PMID[19805565]
NPT164	Organism	Human herpesvirus 4	Human herpesvirus 4	Inhibition	=	93.1	%	PMID[19805565]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT168	Cell line	P388	Mus musculus	Survival	=	20.8	%	PMID[26034885]
NPT168	Cell line	P388	Mus musculus	Survival	=	9.7	%	PMID[26034885]
NPT32	Organism	Mus musculus	Mus musculus	Activity	<	30.0	%	PMID[18955526]
NPT2	Others	Unspecified	n.a.	Survival	=	86.0	%	PMID[20566763]

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC275910 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24904
0.1-0.2	21848
0.2-0.3	2719
0.3-0.4	293
0.4-0.5	57
0.5-0.6	16
0.6-0.7	12
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7407	Intermediate Similarity	NPC46160
0.7407	Intermediate Similarity	NPC202642
0.7273	Intermediate Similarity	NPC87489
0.7241	Intermediate Similarity	NPC471722
0.7241	Intermediate Similarity	NPC605915
0.7143	Intermediate Similarity	NPC214570
0.7018	Intermediate Similarity	NPC471724
0.6897	Remote Similarity	NPC94755
0.6667	Remote Similarity	NPC231477
0.6667	Remote Similarity	NPC123724
0.6607	Remote Similarity	NPC118508
0.6607	Remote Similarity	NPC484086
0.6406	Remote Similarity	NPC474922
0.6379	Remote Similarity	NPC73875
0.629	Remote Similarity	NPC486193
0.6271	Remote Similarity	NPC132635
0.6271	Remote Similarity	NPC601223
0.623	Remote Similarity	NPC308041
0.623	Remote Similarity	NPC16350
0.5938	Remote Similarity	NPC486187
0.5873	Remote Similarity	NPC20388
0.5781	Remote Similarity	NPC233836
0.5781	Remote Similarity	NPC159046
0.5781	Remote Similarity	NPC471720
0.5781	Remote Similarity	NPC187376
0.5593	Remote Similarity	NPC73428
0.5593	Remote Similarity	NPC606082
0.5455	Remote Similarity	NPC76895
0.5294	Remote Similarity	NPC489792
0.5231	Remote Similarity	NPC275740
0.5231	Remote Similarity	NPC86319
0.5152	Remote Similarity	NPC55309
0.5152	Remote Similarity	NPC28252
0.5077	Remote Similarity	NPC171789
0.5075	Remote Similarity	NPC469400

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC275910 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8081
0.1-0.2	994
0.2-0.3	74
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data