34 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
9 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC99707
Formula: C21H26O5
Ingredient ID: NPC99707
| Common Name | n.a. |
| IUPAC Name | 4-[(2R,3S,4S,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol |
| Canonical SMILES | COc1cc(ccc1OC)[C@H]1O[C@H]([C@H]([C@@H]1C)C)c1ccc(c(c1)OC)O |
| Standard InCHI | InChI=1S/C21H26O5/c1-12-13(2)21(15-7-9-17(23-3)19(11-15)25-5)26-20(12)14-6-8-16(22)18(10-14)24-4/h6-13,20-22H,1-5H3/t12-,13-,20+,21-/m0/s1 |
| Standard InCHIKey | YPQNDHHCUQGPFN-IRTBSJMASA-N |
| Ingredient External Links |
PubChem CID: 9548904 ZINC ID: ZINC000014727695 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
 |
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC95468
Formula: C20H20O5
Ingredient ID: NPC95468
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COC1=C[C@]23C[C@H](OC2=CC1=O)C[C@H]([C@@H]3C)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C20H20O5/c1-11-14(12-3-4-16-17(5-12)24-10-23-16)6-13-8-20(11)9-18(22-2)15(21)7-19(20)25-13/h3-5,7,9,11,13-14H,6,8,10H2,1-2H3/t11-,13+,14+,20-/m0/s1 |
| Standard InCHIKey | SXHVHWXETMBKPP-ZBQLUDKISA-N |
| Ingredient External Links |
PubChem CID: 101820916 ZINC ID: ZINC000015249215 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC94245
Formula: C21H24O4
Ingredient ID: NPC94245
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=CCC1=C[C@]2(OC)[C@@H]([C@H]([C@H](C1=O)C2=O)c1ccc(c(c1)OC)C)C |
| Standard InCHI | InChI=1S/C21H24O4/c1-6-7-15-11-21(25-5)13(3)17(18(19(15)22)20(21)23)14-9-8-12(2)16(10-14)24-4/h6,8-11,13,17-18H,1,7H2,2-5H3/t13-,17+,18-,21+/m1/s1 |
| Standard InCHIKey | AVSXXIMSXZTQPO-FBRVAALWSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD58608] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC93850
Formula: C22H28O5
Ingredient ID: NPC93850
| Common Name | n.a. |
| IUPAC Name | (2R,3S,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolane |
| Canonical SMILES | COc1cc(ccc1OC)[C@@H]1O[C@@H]([C@H]([C@@H]1C)C)c1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3/t13-,14-,21-,22+/m0/s1 |
| Standard InCHIKey | JLJAVUZBHSLLJL-GKHNXXNSSA-N |
| Ingredient External Links |
PubChem CID: 443026 ZINC ID: ZINC000017836230 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Acorus gramineus | Acorus | Acoraceae |
 |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Acorus tatarinowii | Acorus | Acoraceae |
|
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC90185
Formula: C17H13NO4
Ingredient ID: NPC90185
| Common Name | Piperlactam S |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1c(O)cc2c3c1c1ccccc1cc3n(c2=O)OC |
| Standard InCHI | InChI=1S/C17H13NO4/c1-21-16-13(19)8-11-14-12(18(22-2)17(11)20)7-9-5-3-4-6-10(9)15(14)16/h3-8,19H,1-2H3 |
| Standard InCHIKey | LHSDJNRAZBFFLF-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 622222 ChEMBL ID: CHEMBL497039 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD149916] Database: NPASS [NPC90185] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC74914
Formula: C21H26O5
Ingredient ID: NPC74914
| Common Name | n.a. |
| IUPAC Name | 4-[(2S,3R,4R,5R)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol |
| Canonical SMILES | COc1cc(ccc1OC)[C@@H]1O[C@@H]([C@@H]([C@H]1C)C)c1ccc(c(c1)OC)O |
| Standard InCHI | InChI=1S/C21H26O5/c1-12-13(2)21(15-7-9-17(23-3)19(11-15)25-5)26-20(12)14-6-8-16(22)18(10-14)24-4/h6-13,20-22H,1-5H3/t12-,13-,20+,21-/m1/s1 |
| Standard InCHIKey | YPQNDHHCUQGPFN-WGOZBUGNSA-N |
| Ingredient External Links |
PubChem CID: 93061877 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD194064] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC64332
Formula: C21H24O5
Ingredient ID: NPC64332
| Common Name | n.a. |
| IUPAC Name | 5-[(2S,3R,4R,5R)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole |
| Canonical SMILES | COc1cc(ccc1OC)[C@@H]1O[C@@H]([C@@H]([C@H]1C)C)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C21H24O5/c1-12-13(2)21(15-6-8-17-19(10-15)25-11-24-17)26-20(12)14-5-7-16(22-3)18(9-14)23-4/h5-10,12-13,20-21H,11H2,1-4H3/t12-,13-,20-,21+/m1/s1 |
| Standard InCHIKey | HSMDOSKNXLVXIP-JRWOZQDASA-N |
| Ingredient External Links |
PubChem CID: 9548905 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD91467] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC57268
Formula: C22H28O5
Ingredient ID: NPC57268
| Common Name | 2,5-Bis-(3,4-Dimethoxy-Phenyl)-3,4-Dimethyl-Tetrahydro-Furan |
| IUPAC Name | (2S,3S,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolane |
| Canonical SMILES | COc1cc(ccc1OC)[C@H]1O[C@@H]([C@H]([C@@H]1C)C)c1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3/t13-,14-,21-,22-/m0/s1 |
| Standard InCHIKey | JLJAVUZBHSLLJL-WJWAULOUSA-N |
| Ingredient External Links |
PubChem CID: 11975378 ZINC ID: ZINC000014764634 ChEMBL ID: CHEMBL56917 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC57268] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Magnolia denudata | Magnolia | Magnoliaceae |
|
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC51681
Formula: C22H28O6
Ingredient ID: NPC51681
| Common Name | n.a. |
| IUPAC Name | (2S,3R,3aS,7aR)-2-(3,4-dimethoxyphenyl)-3a,7a-dimethoxy-3-methyl-5-prop-2-enyl-3,7-dihydro-2H-1-benzofuran-6-one |
| Canonical SMILES | C=CCC1=C[C@]2(OC)[C@H](C)[C@H](O[C@@]2(CC1=O)OC)c1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C22H28O6/c1-7-8-16-12-21(26-5)14(2)20(28-22(21,27-6)13-17(16)23)15-9-10-18(24-3)19(11-15)25-4/h7,9-12,14,20H,1,8,13H2,2-6H3/t14-,20+,21+,22-/m1/s1 |
| Standard InCHIKey | IYGFCSHMPLAHTK-WBBCYVCWSA-N |
| Ingredient External Links |
PubChem CID: 36406703 ZINC ID: ZINC000029220022 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC51681] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC33773
Formula: C21H24O5
Ingredient ID: NPC33773
| Common Name | n.a. |
| IUPAC Name | 5-[(2R,3R,4S,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole |
| Canonical SMILES | COc1cc(ccc1OC)[C@H]1O[C@H]([C@@H]([C@@H]1C)C)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C21H24O5/c1-12-13(2)21(15-6-8-17-19(10-15)25-11-24-17)26-20(12)14-5-7-16(22-3)18(9-14)23-4/h5-10,12-13,20-21H,11H2,1-4H3/t12-,13+,20-,21+/m0/s1 |
| Standard InCHIKey | HSMDOSKNXLVXIP-WVGOSAFVSA-N |
| Ingredient External Links |
PubChem CID: 9548906 ZINC ID: ZINC000038792177 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC32411
Formula: C19H20O5
Ingredient ID: NPC32411
| Common Name | n.a. |
| IUPAC Name | (2S,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-3-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde |
| Canonical SMILES | O=Cc1cc(OC)c2c(c1)[C@H](C)[C@H](O2)c1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C19H20O5/c1-11-14-7-12(10-20)8-17(23-4)19(14)24-18(11)13-5-6-15(21-2)16(9-13)22-3/h5-11,18H,1-4H3/t11-,18-/m0/s1 |
| Standard InCHIKey | XBEUHOWSGYZENI-VOJFVSQTSA-N |
| Ingredient External Links |
PubChem CID: 208856 ZINC ID: ZINC000013339973 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Casuarina equisetifolia | Casuarina | Casuarinaceae |
|
| Mollugo pentaphylla | Mollugo | Molluginaceae |
|
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC295998
Formula: C20H20O5
Ingredient ID: NPC295998
| Common Name | n.a. |
| IUPAC Name | 5-[(2S,3S,4S,5S)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole |
| Canonical SMILES | C[C@@H]1[C@H](O[C@@H]([C@H]1C)c1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C20H20O5/c1-11-12(2)20(14-4-6-16-18(8-14)24-10-22-16)25-19(11)13-3-5-15-17(7-13)23-9-21-15/h3-8,11-12,19-20H,9-10H2,1-2H3/t11-,12-,19-,20-/m0/s1 |
| Standard InCHIKey | QFUXQRHAJWXPGP-HIGYNYDNSA-N |
| Ingredient External Links |
PubChem CID: 11175182 ZINC ID: ZINC000001531907 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Hyptis tomentosa | Hyptis | Lamiaceae |
|
| Cephalonoplos segetum | Cephanonoplos | Asteraceae |
|
| Lens phaseoloides | Lens | Fabaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Ipomoea cristulata | Ipomoea | Convolvulaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Lophozonia menziesii | Lophozonia | Nothofagaceae | |
| Myristica fragrans | Myristica | Myristicaceae |
 |
| Rhodotypos scandens | Rhodotypos | Rosaceae | |
| Acorus gramineus | Acorus | Acoraceae |
|
| Pancratium trianthum | Pancratium | Amaryllidaceae |
|
| Piper pedicellosum | Piper | Piperaceae |
|
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Xanthostemon oppositifolius | Xanthostemon | Myrtaceae | |
| Esenbeckia nesiotica | Esenbeckia | Rutaceae | |
| Catalpa bignonioides | Catalpa | Bignoniaceae |
|
| Helipterum tenellum | Helipterum | Asteraceae | |
| Acorus tatarinowii | Acorus | Acoraceae |
|
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC280399
Formula: C21H24O5
Ingredient ID: NPC280399
| Common Name | Kadsurenone |
| IUPAC Name | (2S,3R,3aS)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
| Canonical SMILES | C=CCC1=C[C@@]2(OC)C(=CC1=O)O[C@@H]([C@H]2C)c1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C21H24O5/c1-6-7-15-12-21(25-5)13(2)20(26-19(21)11-16(15)22)14-8-9-17(23-3)18(10-14)24-4/h6,8-13,20H,1,7H2,2-5H3/t13-,20+,21+/m1/s1 |
| Standard InCHIKey | VDYACOATPFOZIO-UBWHGVKJSA-N |
| Ingredient External Links |
PubChem CID: 122159 ZINC ID: ZINC000004098814 ChEMBL ID: CHEMBL296958 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC280399] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC26960
Formula: C20H40O
Ingredient ID: NPC26960
| Common Name | Trans-Phytol |
| IUPAC Name | (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol |
| Canonical SMILES | OC/C=C(/CCC[C@@H](CCC[C@@H](CCCC(C)C)C)C)C |
| Standard InCHI | InChI=1S/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/t18-,19-/m1/s1 |
| Standard InCHIKey | BOTWFXYSPFMFNR-PYDDKJGSSA-N |
| Ingredient External Links |
PubChem CID: 5280435 ZINC ID: ZINC000003861087 ChEMBL ID: CHEMBL1644111 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC26960] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Citrus unshiu | Citrus | Rutaceae |
 |
| Artemisia apiacea | Artemisia | Asteraceae |
|
| Tristania conferta | Tristania | Myrtaceae | |
| Plectranthus myrianthus | Plectranthus | Lamiaceae | |
| Pentaclethra macrophylla | Pentaclethra | Fabaceae |
|
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Veronica polita | Veronica | Plantaginaceae |
|
| Byrsonima microphylla | Byrsonima | Malpighiaceae | |
| Barbacenia flava | Barbacenia | Velloziaceae | |
| Crotalaria madurensis | Crotalaria | Fabaceae |
|
| Forsythia japonica | Forsythia | Oleaceae | |
| Glycosmis macrophylla | Glycosmis | Rutaceae | |
| Stephania zippeliana | Stephania | Menispermaceae | |
| Eucalyptus apodophylla | Eucalyptus | Myrtaceae |
|
| Cassipourea guianensis | Cassipourea | Rhizophoraceae | |
| Hypericum polyanthemum | Hypericum | Hypericaceae | |
| Distephanus angulifolius | Distephanus | Asteraceae | |
| Periploca sepium | Periploca | Apocynaceae |
|
| Thymus quinquecostatus | Thymus | Lamiaceae |
|
| Campylotropis hirtella | Campylotropis | Fabaceae |
|
| Senegalia catechu | Senegalia | Fabaceae |
|
| Pyrola japonica | Pyrola | Ericaceae |
|
| Taraxacum platycarpum | Taraxacum | Asteraceae |
|
| Lespedeza davidii | Lespedeza | Fabaceae | |
| Houttuynia cordata | Houttuynia | Saururaceae |
|
| Angiopteris evecta | Angiopteris | Marattiaceae |
|
| Taraxacum borealisinense | Taraxacum | Asteraceae | |
| Scutellaria barbata | Scutellaria | Lamiaceae |
|
| Prunella vulgaris | Prunella | Lamiaceae |
|
| Senecio flammeus | Senecio | Asteraceae | |
| Agrimonia pilosa | Agrimonia | Rosaceae |
|
| Breonia chinensis | Breonia | Rubiaceae |
|
| Tectona grandis | Tectona | Lamiaceae |
|
| Clerodendranthus spicatus | Clerodendranthus | Lamiaceae | |
| Phlegmariurus fordii | Phlegmariurus | Lycopodiaceae |
|
| Ormosia flava | Ormosia | Fabaceae | |
| Thymus vulgaris | Thymus | Lamiaceae |
|
| Eclipta prostrata | Eclipta | Asteraceae |
|
| Buxus wallichiana | Buxus | Buxaceae |
|
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Patrinia scabiosifolia | Patrinia | Caprifoliaceae |
|
| Rhododendron dauricum | Rhododendron | Ericaceae |
|
| Pometia eximia | Pometia | Sapindaceae | |
| Hyperbaena columbica | Hyperbaena | Menispermaceae | |
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Sideritis romana | Sideritis | Lamiaceae | |
| Caulerpa racemosa | Caulerpa | Caulerpaceae |
|
| Mentha cardiaca | Mentha | Lamiaceae | |
| Cyperus rotundus | Cyperus | Cyperaceae |
|
| Leptosyne bigelovii | Leptosyne | Asteraceae | |
| Taraxacum coreanum | Taraxacum | Asteraceae | |
| Micranthemum umbrosum | Micranthemum | Plantaginaceae | |
| Rhodiola semenovii | Rhodiola | Crassulaceae | |
| Carpesium faberi | Carpesium | Asteraceae | |
| Leonurus japonicus | Leonurus | Lamiaceae |
|
| Stevia origanoides | Stevia | Asteraceae | |
| Linum usitatissimum | Linum | Linaceae |
|
| Citrus reticulata | Citrus | Rutaceae |
|
| Euphorbia hirta | Euphorbia | Euphorbiaceae |
|
| Viburnum grandifolium | Viburnum | Adoxaceae | |
| Artemisia annua | Artemisia | Asteraceae |
|
| Taraxacum officinale | Taraxacum | Asteraceae |
|
| Taraxacum mongolicum | Taraxacum | Asteraceae |
|
| Piper betle | Piper | Piperaceae |
|
| Veratrum sabadilla | Veratrum | Melanthiaceae | |
| Citrus maxima | Citrus | Rutaceae |
|
| Aster altaicus | Aster | Asteraceae | |
| Senna alexandrina | Senna | Fabaceae |
|
| Panax ginseng | Panax | Araliaceae |
|
| Polygonatum kingianum | Polygonatum | Asparagaceae |
|
| Dendrobium densiflorum | Dendrobium | Orchidaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| tripolium vulgare | Tripolium | Asteraceae | |
| Hymenoxys scaposa | Hymenoxys | Asteraceae | |
| Anemone narcissiflora | Anemone | Ranunculaceae |
|
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
| Andrographis paniculata | Andrographis | Acanthaceae |
|
| Eleutherococcus giraldii | Eleutherococcus | Araliaceae | |
| Solanum aethiopicum | Solanum | Solanaceae |
|
| Amomum neoaurantiacum | Amomum | Zingiberaceae | |
| Trichilia claussenii | Trichilia | Meliaceae | |
| Crotalaria candicans | Crotalaria | Fabaceae | |
| Chlamydomonas reinhardtii | Chlamydomonas | Chlamydomonadaceae | |
| Hypericum perforatum | Hypericum | Hypericaceae |
|
| Lindera aggregata | Lindera | Lauraceae | |
| Cassia roxburghii | Cassia | Fabaceae | |
| Eria japonica | Eria | Orchidaceae | |
| Cecropia pachystachya | Cecropia | Urticaceae |
|
| Salvia sessei | Salvia | Lamiaceae | |
| Juniperus drupacea | Juniperus | Cupressaceae |
|
| Ceropegia dichotoma | Ceropegia | Apocynaceae |
|
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Ononis spinosa | Ononis | Fabaceae |
|
| Crinum moorei | Crinum | Amaryllidaceae | |
| Eucalyptus globulus subsp. bicostata | Eucalyptus | Myrtaceae |
|
| Artocarpus altilis | Artocarpus | Moraceae |
|
| Magnolia officinalis rehd et wils | Magnolia | Magnoliaceae | |
| Dendrobium loddigesii | Dendrobium | Orchidaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
| Glehnia littoralis | Glehnia | Apiaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
| Gypsophila perfoliata | Gypsophila | Caryophyllaceae | |
| Lomatia silaifolia | Lomatia | Proteaceae | |
| Patrinia villosa | Patrinia | Caprifoliaceae |
|
| Asclepias curassavica | Asclepias | Apocynaceae |
|
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Pterocaulon virgatum | Pterocaulon | Asteraceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Vernonia cistifolia | Vernonia | Asteraceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Sonneratia caseolaris | Sonneratia | Lythraceae |
|
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC267077
Formula: C21H24O5
Ingredient ID: NPC267077
| Common Name | n.a. |
| IUPAC Name | 5-[(2R,3S,4S,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole |
| Canonical SMILES | COc1cc(ccc1OC)[C@H]1O[C@H]([C@H]([C@@H]1C)C)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C21H24O5/c1-12-13(2)21(15-6-8-17-19(10-15)25-11-24-17)26-20(12)14-5-7-16(22-3)18(9-14)23-4/h5-10,12-13,20-21H,11H2,1-4H3/t12-,13-,20-,21+/m0/s1 |
| Standard InCHIKey | HSMDOSKNXLVXIP-BKOMJCAWSA-N |
| Ingredient External Links |
PubChem CID: 26113495 ZINC ID: ZINC000014488312 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC26544
Formula: C21H24O5
Ingredient ID: NPC26544
| Common Name | n.a. |
| IUPAC Name | 5-[(2R,3R,4S,5R)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole |
| Canonical SMILES | COc1cc(ccc1OC)[C@@H]1O[C@H]([C@@H]([C@@H]1C)C)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C21H24O5/c1-12-13(2)21(15-6-8-17-19(10-15)25-11-24-17)26-20(12)14-5-7-16(22-3)18(9-14)23-4/h5-10,12-13,20-21H,11H2,1-4H3/t12-,13+,20+,21+/m0/s1 |
| Standard InCHIKey | HSMDOSKNXLVXIP-GQSHPZAJSA-N |
| Ingredient External Links |
PubChem CID: 188429 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD74656] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC257790
Formula: C18H23NO3
Ingredient ID: NPC257790
| Common Name | n.a. |
| IUPAC Name | (2E,6E)-7-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)hepta-2,6-dienamide |
| Canonical SMILES | CC(CN=C(/C=C/CC/C=C/c1ccc2c(c1)OCO2)O)C |
| Standard InCHI | InChI=1S/C18H23NO3/c1-14(2)12-19-18(20)8-6-4-3-5-7-15-9-10-16-17(11-15)22-13-21-16/h5-11,14H,3-4,12-13H2,1-2H3,(H,19,20)/b7-5+,8-6+ |
| Standard InCHIKey | MRUXVACSRPRMSN-KQQUZDAGSA-N |
| Ingredient External Links |
PubChem CID: 15596445 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD41317] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC253714
Formula: C21H22O5
Ingredient ID: NPC253714
| Common Name | n.a. |
| IUPAC Name | (4S)-4-[(E)-1-(1,3-benzodioxol-5-yl)prop-1-en-2-yl]-4,5-dimethoxy-2-prop-2-enylcyclohexa-2,5-dien-1-one |
| Canonical SMILES | C=CCC1=C[C@@](OC)(C(=CC1=O)OC)/C(=C/c1ccc2c(c1)OCO2)/C |
| Standard InCHI | InChI=1S/C21H22O5/c1-5-6-16-12-21(24-4,20(23-3)11-17(16)22)14(2)9-15-7-8-18-19(10-15)26-13-25-18/h5,7-12H,1,6,13H2,2-4H3/b14-9+/t21-/m0/s1 |
| Standard InCHIKey | AOZTYYBGNNXAOI-PBAKHKOTSA-N |
| Ingredient External Links |
PubChem CID: 101833872 ZINC ID: ZINC000018103090 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC24238
Formula: C21H26O5
Ingredient ID: NPC24238
| Common Name | n.a. |
| IUPAC Name | 4-[(2R,3R,4S,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol |
| Canonical SMILES | COc1cc(ccc1OC)[C@H]1O[C@H]([C@@H]([C@@H]1C)C)c1ccc(c(c1)OC)O |
| Standard InCHI | InChI=1S/C21H26O5/c1-12-13(2)21(15-7-9-17(23-3)19(11-15)25-5)26-20(12)14-6-8-16(22)18(10-14)24-4/h6-13,20-22H,1-5H3/t12-,13+,20-,21+/m1/s1 |
| Standard InCHIKey | YPQNDHHCUQGPFN-QVEMZERUSA-N |
| Ingredient External Links |
PubChem CID: 156516 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD153356] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC233529
Formula: C21H26O5
Ingredient ID: NPC233529
| Common Name | n.a. |
| IUPAC Name | (1S,5R,6R,7R,8S)-7-(3,4-dimethoxyphenyl)-8-hydroxy-5-methoxy-6-methyl-3-prop-2-enylbicyclo[3.2.1]oct-3-en-2-one |
| Canonical SMILES | C=CCC1=C[C@@]2(OC)[C@H]([C@@H](C1=O)[C@@H]([C@H]2C)c1ccc(c(c1)OC)OC)O |
| Standard InCHI | InChI=1S/C21H26O5/c1-6-7-14-11-21(26-5)12(2)17(18(19(14)22)20(21)23)13-8-9-15(24-3)16(10-13)25-4/h6,8-12,17-18,20,23H,1,7H2,2-5H3/t12-,17+,18-,20+,21+/m1/s1 |
| Standard InCHIKey | YYEUHNBQISBESB-VMTAUAMDSA-N |
| Ingredient External Links |
PubChem CID: 44470608 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD142187] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC233224
Formula: C20H20O5
Ingredient ID: NPC233224
| Common Name | 5-[(2R,3S,4R,5R)-5-(1,3-Benzodioxol-5-Yl)-3,4-Dimethyloxolan-2-Yl]-1,3-Benzodioxole |
| IUPAC Name | 5-[(2R,3S,4R,5R)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole |
| Canonical SMILES | C[C@@H]1[C@@H](O[C@H]([C@@H]1C)c1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C20H20O5/c1-11-12(2)20(14-4-6-16-18(8-14)24-10-22-16)25-19(11)13-3-5-15-17(7-13)23-9-21-15/h3-8,11-12,19-20H,9-10H2,1-2H3/t11-,12+,19-,20-/m1/s1 |
| Standard InCHIKey | QFUXQRHAJWXPGP-BINDOVRGSA-N |
| Ingredient External Links |
PubChem CID: 338287 ZINC ID: ZINC000005519433 ChEMBL ID: CHEMBL1980140 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC233224] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC226762
Formula: C20H40O
Ingredient ID: NPC226762
| Common Name | n.a. |
| IUPAC Name | (E,7S,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol |
| Canonical SMILES | OC/C=C(/CCC[C@H](CCC[C@@H](CCCC(C)C)C)C)C |
| Standard InCHI | InChI=1S/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/t18-,19+/m1/s1 |
| Standard InCHIKey | BOTWFXYSPFMFNR-IHKHCKEISA-N |
| Ingredient External Links |
PubChem CID: 6474938 ZINC ID: ZINC000003861089 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Ephedra herba | Ephedra | Ephedraceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC204120
Formula: C12H16O3
Ingredient ID: NPC204120
| Common Name | n.a. |
| IUPAC Name | 1,2,3-trimethoxy-5-prop-2-enylbenzene |
| Canonical SMILES | C=CCc1cc(OC)c(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C12H16O3/c1-5-6-9-7-10(13-2)12(15-4)11(8-9)14-3/h5,7-8H,1,6H2,2-4H3 |
| Standard InCHIKey | BPLQKQKXWHCZSS-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10248 ZINC ID: ZINC000000899845 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC204120] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Artemisia hanseniana | Artemisia | Asteraceae | |
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Kopsia grandifolia | Kopsia | Apocynaceae | |
| Forsythia japonica | Forsythia | Oleaceae | |
| Ledebouria socialis | Ledebouria | Hyacinthaceae | |
| Lycopus europaeus | Lycopus | Lamiaceae |
|
| Asarum heterotropoides | Asarum | Aristolochiaceae | |
| Asarum heterotropoides f. schm. var. mandshuricum (maxim.) kitag. | Asarum | Aristolochiaceae | |
| Dipterocarpus dyeri | Dipterocarpus | Dipterocarpaceae | |
| Cornus officinalis | Cornus | Cornaceae |
|
| Ipomoea cairica | Ipomoea | Convolvulaceae |
|
| Ceanothus velutinus | Ceanothus | Rhamnaceae |
|
| Hyptis tomentosa | Hyptis | Lamiaceae |
|
| Garcinia scortechinii | Garcinia | Clusiaceae | |
| Apollonias barbujana | Apollonias | Lauraceae | |
| Garcinia oligantha | Garcinia | Clusiaceae | |
| Chlorophytum borivilianum | Chlorophytum | Asparagaceae |
|
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Actaea dahurica | Actaea | Ranunculaceae |
|
| Actaea cimicifuga | Actaea | Ranunculaceae |
|
| Iris spuria | Iris | Iridaceae |
|
| Scutellaria barbata | Scutellaria | Lamiaceae |
|
| Atractylodes lancea | Atractylodes | Asteraceae |
|
| Eucalyptus hybrid | Eucalyptus | Myrtaceae | |
| Daucus carota | Daucus | Apiaceae |
|
| Isodon lophanthoides | Isodon | Lamiaceae |
|
| Aconitum episcopale | Aconitum | Ranunculaceae | |
| Cephalonoplos segetum | Cephanonoplos | Asteraceae |
|
| Fragaria vesca | Fragaria | Rosaceae |
|
| Pinellia ternata | Pinellia | Araceae |
|
| Lasianthus fordii | Lasianthus | Rubiaceae | |
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Polygala sibirica | Polygala | Polygalaceae |
|
| Angelica pubescens | Angelica | Apiaceae |
|
| Acorus calamus | Acorus | Acoraceae |
|
| Saussurea costus | Saussurea | Asteraceae |
|
| Artemisia annua | Artemisia | Asteraceae |
|
| Polygala tenuifolia | Polygala | Polygalaceae |
|
| Actaea simplex | Actaea | Ranunculaceae | |
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Lens phaseoloides | Lens | Fabaceae | |
| Isodon rubescens | Isodon | Lamiaceae | |
| Panax ginseng | Panax | Araliaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Agastache rugosus | Agastache | Lamiaceae |
|
| Aconitum leucostomum | Aconitum | Ranunculaceae |
|
| Ardisia arborescens | Ardisia | Primulaceae |
|
| Aquilegia ecalcarata | Aquilegia | Ranunculaceae |
|
| Ipomoea cristulata | Ipomoea | Convolvulaceae | |
| Persea mexicana | Persea | Lauraceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Lophozonia menziesii | Lophozonia | Nothofagaceae | |
| Myristica fragrans | Myristica | Myristicaceae |
|
| Rhodotypos scandens | Rhodotypos | Rosaceae | |
| Campsis flos | Campsis | Bignoniaceae | |
| Acorus gramineus | Acorus | Acoraceae |
|
| Pancratium trianthum | Pancratium | Amaryllidaceae |
|
| Piper pedicellosum | Piper | Piperaceae |
|
| Asarum sieboldii | Asarum | Aristolochiaceae |
|
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Gardenia tubifera | Gardenia | Rubiaceae |
|
| Xanthostemon oppositifolius | Xanthostemon | Myrtaceae | |
| Esenbeckia nesiotica | Esenbeckia | Rutaceae | |
| Rubus trifidus | Rubus | Rosaceae |
|
| Panax innovans | Panax | Araliaceae | |
| Blumea mollis | Blumea | Asteraceae |
|
| Schisandra chinensis | Schisandra | Schisandraceae |
|
| Catalpa bignonioides | Catalpa | Bignoniaceae |
|
| Helipterum tenellum | Helipterum | Asteraceae | |
| Perilla frutescens | Perilla | Lamiaceae |
|
| Acorus tatarinowii | Acorus | Acoraceae |
|
| Schizonepeta tenuifolia | Schizonepeta | Lamiaceae |
|
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC203468
Formula: C11H12N2O2
Ingredient ID: NPC203468
| Common Name | Tryptophan |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid |
| Canonical SMILES | OC(=O)[C@H](Cc1c[nH]c2c1cccc2)N |
| Standard InCHI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1 |
| Standard InCHIKey | QIVBCDIJIAJPQS-VIFPVBQESA-N |
| Ingredient External Links |
PubChem CID: 6305;6923516 ChEMBL ID: CHEMBL54976 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD149555] Database: NPASS [NPC203468] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Centaurea solstitialis | Centaurea | Asteraceae |
|
| Flacourtia jangomas | Flacourtia | Salicaceae |
|
| Xanthorrhoea resinosa | Xanthorrhoea | Asphodelaceae |
|
| Moringa oleifera | Moringa | Moringaceae |
|
| Ocimum pilosum | Ocimum | Lamiaceae |
|
| Polygonum cuspidatum | Polygonum | Polygonaceae |
|
| Forsythia japonica | Forsythia | Oleaceae | |
| Onobrychis arenaria | Onobrychis | Fabaceae | |
| Eria mollis | Eria | Orchidaceae | |
| Rhododendron ungerni | Rhododendron | Ericaceae | |
| Dysoxylum cumingianum | Dysoxylum | Meliaceae | |
| Lagochilus leiacanthus | Lagochilus | Lamiaceae | |
| Psychotria stachyoides | Psychotria | Rubiaceae | |
| Dodonaea viscosa | Dodonaea | Sapindaceae |
|
| Strychnos tricalysioides | Strychnos | Loganiaceae | |
| Piptostigma fugax | Piptostigma | Annonaceae | |
| Chara ceratophylla | Chara | Characeae | |
| Teucrium yemense | Teucrium | Lamiaceae | |
| Neobalanocarpus heimii | Neobalanocarpus | Dipterocarpaceae | |
| Cosmos diversifolius | Cosmos | Asteraceae | |
| Aconitum tasiromontanum | Aconitum | Ranunculaceae | |
| Humulus lupulus | Humulus | Cannabaceae |
|
| Trichodesma incanum | Trichodesma | Boraginaceae | |
| Dendriopoterium menendezii | Dendriopoterium | Rosaceae | |
| Adansonia grandidieri | Adansonia | Malvaceae |
|
| Rhododendron mucronatum | Rhododendron | Ericaceae |
|
| Physalis alkekengi | Physalis | Solanaceae |
|
| Onobrychis viciifolia | Onobrychis | Fabaceae |
|
| Aphyllocladus denticulatus | Aphyllocladus | Asteraceae | |
| Bassia muricata | Bassia | Chenopodiaceae |
|
| Senecio subdentatus | Senecio | Asteraceae | |
| Ficus simplicissima | Ficus | Moraceae |
|
| Aconitum seravschanicum | Aconitum | Ranunculaceae | |
| Onobrychis bobrovii | Onobrychis | Fabaceae | |
| Inga velutina | Inga | Fabaceae |
|
| Curcuma caesia | Curcuma | Zingiberaceae |
|
| Vellozia candida | Vellozia | Velloziaceae | |
| Pinellia ternata | Pinellia | Araceae |
|
| Cathormion altissimum | Cathormion | Fabaceae | |
| Urochloa decumbens | Urochloa | Poaceae | |
| Justicia secunda | Justicia | Acanthaceae | |
| Erythrophleum couminga | Erythrophleum | Fabaceae |
|
| Trifolium strepens | Trifolium | Fabaceae | |
| Persicaria orientalis | Persicaria | Polygonaceae |
|
| Ginkgo biloba | Ginkgo | Ginkgoaceae |
|
| Aster sedifolius | Aster | Asteraceae | |
| Petteria ramentacea | Petteria | Fabaceae | |
| Brassica juncea | Brassica | Brassicaceae |
|
| Aesculus chinensis | Aesculus | Sapindaceae |
|
| Erythrina pallida | Erythrina | Fabaceae | |
| Isatis indigotica | Isatis | Brassicaceae |
|
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lavandula vera | Lavandula | Lamiaceae |
|
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
| Medinilla magnifica | Medinilla | Melastomataceae |
|
| Laggera alata | Laggera | Asteraceae |
|
| Allium macrostemon | Allium | Amaryllidaceae |
|
| Isatis tinctoria | Isatis | Brassicaceae |
|
| Baphicacanthus cusia | Baphicacanthus | Acanthaceae |
|
| Lindera aggregata | Lindera | Lauraceae | |
| Helipterum gnaphaloides | Helipterum | Asteraceae | |
| Daemonorops draco | Daemonorops | Arecaceae |
|
| Eucalyptus australiana | Eucalyptus | Myrtaceae | |
| Papaver persicum | Papaver | Papaveraceae |
|
| Garrya laurifolia | Garrya | Garryaceae | |
| Sequoia sempervirens | Sequoia | Cupressaceae |
|
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Hedysarum polybotrys | Hedysarum | Fabaceae |
|
| Mesua ferrea | Mesua | Calophyllaceae |
|
| Allium sativum | Allium | Amaryllidaceae |
|
| Goupia glabra | Goupia | Goupiaceae | |
| Allium azureum ledeb | Allium | Amaryllidaceae | |
| Phelline lucida | Phelline | Phellinaceae | |
| Glycine max | Glycine | Fabaceae |
|
| Lactuca serriola | Lactuca | Asteraceae |
|
| Sinapis alba | Sinapis | Brassicaceae |
|
| Excoecaria acerifolia | Excoecaria | Euphorbiaceae |
|
| Artocarpus altilis | Artocarpus | Moraceae |
|
| Senecio cathcartensis | Senecio | Asteraceae | |
| Allium chinense | Allium | Amaryllidaceae |
|
| Enceliopsis argophylla | Enceliopsis | Asteraceae | |
| Perilla frutescens | Perilla | Lamiaceae |
|
| Monopteryx uaucu | Monopteryx | Fabaceae |
|
| Cryptocarya oblata | Cryptocarya | Lauraceae | |
| Glehnia littoralis | Glehnia | Apiaceae |
|
| Persicaria tinctoria | Persicaria | Polygonaceae |
|
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Solenopsis punctaticeps | Solenopsis | Campanulaceae | |
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Miliusa velutina | Miliusa | Annonaceae |
|
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC195986
Formula: C14H25NO
Ingredient ID: NPC195986
| Common Name | Pellitorin |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)deca-2,4-dienamide |
| Canonical SMILES | CCCCC/C=C/C=C/C(=NCC(C)C)O |
| Standard InCHI | InChI=1S/C14H25NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h8-11,13H,4-7,12H2,1-3H3,(H,15,16)/b9-8+,11-10+ |
| Standard InCHIKey | MAGQQZHFHJDIRE-BNFZFUHLSA-N |
| Ingredient External Links |
PubChem CID: 5318516 ZINC ID: ZINC000013838505 ChEMBL ID: CHEMBL271242 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC195986] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Brickellia longifolia | Brickellia | Asteraceae | |
| Verbesina virginica | Verbesina | Asteraceae | |
| Bellardia viscosa | Bellardia | Orobanchaceae | |
| Dichotomanthes tristaniicarpa | Dichotomanthes | Rosaceae | |
| Cochlearia officinalis | Cochlearia | Brassicaceae |
|
| Forsythia japonica | Forsythia | Oleaceae | |
| Frullania brasiliensis | Frullania | Frullaniaceae |
|
| Bupleurum rigidum | Bupleurum | Apiaceae |
|
| Cornus officinalis | Cornus | Cornaceae |
|
| Abies webbiana | Abies | Pinaceae |
|
| Garcinia oligantha | Garcinia | Clusiaceae | |
| Iris spuria | Iris | Iridaceae |
|
| Eucalyptus hybrid | Eucalyptus | Myrtaceae | |
| Aconitum episcopale | Aconitum | Ranunculaceae | |
| Kopsia lapidilecta | Kopsia | Apocynaceae | |
| Dryopteris arguta | Dryopteris | Dryopteridaceae |
|
| Plenckia populnea | Plenckia | Celastraceae | |
| Dryobalanops camphora | Dryobalanops | Dipterocarpaceae |
|
| Lophocolea bidentata | Lophocolea | Lophocoleaceae | |
| Acanthosyris paulo-alvinii | Acanthosyris | Cervantesiaceae |
|
| Phytolacca thyrsiflora | Phytolacca | Phytolaccaceae | |
| Corydalis thalictrifolia | Corydalis | Papaveraceae |
|
| Corymbia scabrida | Corymbia | Myrtaceae | |
| Calliandra eriophylla | Calliandra | Fabaceae | |
| Pinus aristata | Pinus | Pinaceae |
|
| Palisota barteri | Palisota | Commelinaceae | |
| Matsumurella chinensis | Matsumurella | Lamiaceae | |
| Piper longum | Piper | Piperaceae |
|
| Silene banksia | Silene | Caryophyllaceae | |
| Podocarpus minor | Podocarpus | Podocarpaceae | |
| Piper sarmentosum | Piper | Piperaceae |
|
| Piper nigrum | Piper | Piperaceae |
|
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Ardisia japonica | Ardisia | Primulaceae |
|
| Ardisia arborescens | Ardisia | Primulaceae |
|
| Dracontium loretense | Dracontium | Araceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Aglaia perviridis | Aglaia | Meliaceae |
|
| Piper kadsura | Piper | Piperaceae | |
| Oocystis polymorpha | Oocystis | Oocystaceae | |
| Phoebe grandis | Phoebe | Lauraceae | |
| Euphorbia wangii | Euphorbia | Euphorbiaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Carpesium longifolium | Carpesium | Asteraceae |
|
| Rubus pileatus | Rubus | Rosaceae | |
| Piper retrofractum | Piper | Piperaceae |
|
| Crocus corsicus | Crocus | Iridaceae | |
| Schefflera venulosa | Schefflera | Araliaceae |
|
| Rubus trifidus | Rubus | Rosaceae |
|
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Homalium laurifolium | Homalium | Salicaceae | |
| Hippocrepis emerus | Hippocrepis | Fabaceae | |
| Betula alnoides | Betula | Betulaceae |
|
| Rhododendron latoucheae | Rhododendron | Ericaceae | |
| Coelogyne nitida | Coelogyne | Orchidaceae |
Ingredient ID: NPC183987
Formula: C20H22O5
Ingredient ID: NPC183987
| Common Name | n.a. |
| IUPAC Name | 4-[(2R,3R,4S,5S)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol |
| Canonical SMILES | COc1cc(ccc1O)[C@@H]1O[C@@H]([C@H]([C@H]1C)C)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C20H22O5/c1-11-12(2)20(14-5-7-16-18(9-14)24-10-23-16)25-19(11)13-4-6-15(21)17(8-13)22-3/h4-9,11-12,19-21H,10H2,1-3H3/t11-,12+,19-,20+/m1/s1 |
| Standard InCHIKey | JPDORDSJPIKURD-VTLGYEHRSA-N |
| Ingredient External Links |
PubChem CID: 10450045 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD171175] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Hyptis tomentosa | Hyptis | Lamiaceae |
|
| Cephalonoplos segetum | Cephanonoplos | Asteraceae |
|
| Lens phaseoloides | Lens | Fabaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Ipomoea cristulata | Ipomoea | Convolvulaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Lophozonia menziesii | Lophozonia | Nothofagaceae | |
| Myristica fragrans | Myristica | Myristicaceae |
|
| Rhodotypos scandens | Rhodotypos | Rosaceae | |
| Pancratium trianthum | Pancratium | Amaryllidaceae |
|
| Piper pedicellosum | Piper | Piperaceae |
|
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Xanthostemon oppositifolius | Xanthostemon | Myrtaceae | |
| Esenbeckia nesiotica | Esenbeckia | Rutaceae | |
| Catalpa bignonioides | Catalpa | Bignoniaceae |
|
| Helipterum tenellum | Helipterum | Asteraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC174191
Formula: C21H26O6
Ingredient ID: NPC174191
| Common Name | n.a. |
| IUPAC Name | (2S,3R,3aS,6S,7aR)-2-(1,3-benzodioxol-5-yl)-3a,7a-dimethoxy-3-methyl-5-prop-2-enyl-2,3,6,7-tetrahydro-1-benzofuran-6-ol |
| Canonical SMILES | C=CCC1=C[C@]2(OC)[C@H](C)[C@H](O[C@@]2(C[C@@H]1O)OC)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C21H26O6/c1-5-6-15-10-20(23-3)13(2)19(27-21(20,24-4)11-16(15)22)14-7-8-17-18(9-14)26-12-25-17/h5,7-10,13,16,19,22H,1,6,11-12H2,2-4H3/t13-,16+,19+,20+,21-/m1/s1 |
| Standard InCHIKey | MIFKVSCIPCYASV-JXCXWWAUSA-N |
| Ingredient External Links |
PubChem CID: 10022290 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD46935] Database: NPASS [NPC174191] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC164023
Formula: C20H22O5
Ingredient ID: NPC164023
| Common Name | n.a. |
| IUPAC Name | 4-[(2R,3S,4R,5R)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol |
| Canonical SMILES | COc1cc(ccc1O)[C@@H]1O[C@H]([C@@H]([C@@H]1C)C)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C20H22O5/c1-11-12(2)20(14-5-7-16-18(9-14)24-10-23-16)25-19(11)13-4-6-15(21)17(8-13)22-3/h4-9,11-12,19-21H,10H2,1-3H3/t11-,12+,19+,20+/m0/s1 |
| Standard InCHIKey | JPDORDSJPIKURD-OCBHBYCGSA-N |
| Ingredient External Links |
PubChem CID: 11078392 ZINC ID: ZINC000095910078 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Leucas aspera | Leucas | Lamiaceae |
|
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC162994
Formula: C20H22O5
Ingredient ID: NPC162994
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=CCC1=C[C@@]2(OC)[C@@H]([C@@H](C1=O)[C@@H]([C@H]2C)c1ccc2c(c1)OCO2)O |
| Standard InCHI | InChI=1S/C20H22O5/c1-4-5-13-9-20(23-3)11(2)16(17(18(13)21)19(20)22)12-6-7-14-15(8-12)25-10-24-14/h4,6-9,11,16-17,19,22H,1,5,10H2,2-3H3/t11-,16+,17-,19-,20+/m1/s1 |
| Standard InCHIKey | ARFBOYDNJXQGTO-MZERNFPUSA-N |
| Ingredient External Links |
ZINC ID: ZINC000070454347 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC157944
Formula: C10H12O4
Ingredient ID: NPC157944
| Common Name | Asaraldehyde |
| IUPAC Name | 2,4,5-trimethoxybenzaldehyde |
| Canonical SMILES | COc1cc(C=O)c(cc1OC)OC |
| Standard InCHI | InChI=1S/C10H12O4/c1-12-8-5-10(14-3)9(13-2)4-7(8)6-11/h4-6H,1-3H3 |
| Standard InCHIKey | IAJBQAYHSQIQRE-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 20525 ChEMBL ID: CHEMBL1164301 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD27277] Database: NPASS [NPC157944] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Arctium lappa | Arctium | Asteraceae |
|
| Piper cubeba | Piper | Piperaceae |
|
| Forsythia japonica | Forsythia | Oleaceae | |
| Daucus carota | Daucus | Apiaceae |
|
| Acorus calamus | Acorus | Acoraceae |
|
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Acorus gramineus | Acorus | Acoraceae |
|
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Acorus tatarinowii | Acorus | Acoraceae |
|
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC15743
Formula: C21H24O6
Ingredient ID: NPC15743
| Common Name | n.a. |
| IUPAC Name | (2S,3R,3aS,7aR)-2-(1,3-benzodioxol-5-yl)-3a,7a-dimethoxy-3-methyl-5-prop-2-enyl-3,7-dihydro-2H-1-benzofuran-6-one |
| Canonical SMILES | C=CCC1=C[C@]2(OC)[C@H](C)[C@H](O[C@@]2(CC1=O)OC)c1ccc2c(c1)OCO2 |
| Standard InCHI | InChI=1S/C21H24O6/c1-5-6-15-10-20(23-3)13(2)19(27-21(20,24-4)11-16(15)22)14-7-8-17-18(9-14)26-12-25-17/h5,7-10,13,19H,1,6,11-12H2,2-4H3/t13-,19+,20+,21-/m1/s1 |
| Standard InCHIKey | YVRYZXAHRGGELT-MZNUGIIHSA-N |
| Ingredient External Links |
PubChem CID: 442885 ZINC ID: ZINC000004098815 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC15743] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Helenium autumnale | Helenium | Asteraceae |
|
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC139209
Formula: C23H28O6
Ingredient ID: NPC139209
| Common Name | n.a. |
| IUPAC Name | [(1S,5R,6R,7R,8S)-7-(3,4-dimethoxyphenyl)-5-methoxy-6-methyl-2-oxo-3-prop-2-enyl-8-bicyclo[3.2.1]oct-3-enyl] acetate |
| Canonical SMILES | C=CCC1=C[C@@]2(OC)[C@H]([C@@H](C1=O)[C@@H]([C@H]2C)c1ccc(c(c1)OC)OC)OC(=O)C |
| Standard InCHI | InChI=1S/C23H28O6/c1-7-8-16-12-23(28-6)13(2)19(20(21(16)25)22(23)29-14(3)24)15-9-10-17(26-4)18(11-15)27-5/h7,9-13,19-20,22H,1,8H2,2-6H3/t13-,19+,20-,22+,23+/m1/s1 |
| Standard InCHIKey | TVDQUJSTRADHSU-WWDCKHPPSA-N |
| Ingredient External Links |
PubChem CID: 3083437 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD187786] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC126935
Formula: C22H28O5
Ingredient ID: NPC126935
| Common Name | Galgravin |
| IUPAC Name | (2S,3S,4R,5R)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolane |
| Canonical SMILES | COc1cc(ccc1OC)[C@@H]1O[C@@H]([C@H]([C@H]1C)C)c1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3/t13-,14+,21-,22+ |
| Standard InCHIKey | JLJAVUZBHSLLJL-DQEHQXCCSA-N |
| Ingredient External Links |
PubChem CID: 101749 ZINC ID: ZINC000018269677 ChEMBL ID: CHEMBL418309 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC126935] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Machilus thunbergii | Machilus | Lauraceae |
|
| Forsythia japonica | Forsythia | Oleaceae | |
| Magnolia denudata | Magnolia | Magnoliaceae |
|
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Acorus gramineus | Acorus | Acoraceae |
|
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Acorus tatarinowii | Acorus | Acoraceae |
|
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Ingredient ID: NPC116711
Formula: C21H24O5
Ingredient ID: NPC116711
| Common Name | n.a. |
| IUPAC Name | (2R,3S,3aS)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
| Canonical SMILES | C=CCC1=C[C@@]2(OC)C(=CC1=O)O[C@H]([C@@H]2C)c1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C21H24O5/c1-6-7-15-12-21(25-5)13(2)20(26-19(21)11-16(15)22)14-8-9-17(23-3)18(10-14)24-4/h6,8-13,20H,1,7H2,2-5H3/t13-,20+,21-/m0/s1 |
| Standard InCHIKey | VDYACOATPFOZIO-DYXDTQHNSA-N |
| Ingredient External Links |
PubChem CID: 10915273 ZINC ID: ZINC000000900137 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Forsythia japonica | Forsythia | Oleaceae | |
| Castilleja sulphurea | Castilleja | Orobanchaceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Piper kadsura | Piper | Piperaceae | |
| Gymnosporia trigyna | Gymnosporia | Celastraceae | |
| Dioscorea sativa | Dioscorea | Dioscoreaceae |
|
| Huperzia miyoshiana | Huperzia | Lycopodiaceae | |
| Pseudobrickellia brasiliensis | Pseudobrickellia | Asteraceae | |
| Rhododendron latoucheae | Rhododendron | Ericaceae |
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC116711 | C21H24O5 | (2R,3S,3aS)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one | 356.1623739 | 0.44 | 3.22 | 3.065 | 3 | 0 | 53.99 | 6 | 3 | 26 | 0 |
| NPC126935 | C22H28O5 | Galgravin | 372.19 | -0.1953 | 3.33 | 3.968 | 1 | 0 | 46.15 | 12 | 3 | 27 | 0 |
| NPC139209 | C23H28O6 | [(1S,5R,6R,7R,8S)-7-(3,4-dimethoxyphenyl)-5-methoxy-6-methyl-2-oxo-3-prop-2-enyl-8-bicyclo[3.2.1]oct-3-enyl] acetate | 400.1885886 | 0.323 | 3.33 | 2.718 | 4 | 0 | 71.06 | 8 | 3 | 29 | 0 |
| NPC15743 | C21H24O6 | 372.1572885 | 0.3296 | 3.11 | 2.3 | 4 | 0 | 63.22 | 8 | 4 | 27 | 0 | |
| NPC157944 | C10H12O4 | Asaraldehyde | 196.07 | -0.3478 | 2.12 | 1.115 | 1 | 0 | 44.76 | 7 | 1 | 14 | 0 |
| NPC162994 | C20H22O5 | 342.1467238 | -0.2552 | 3.11 | 1.905 | 3 | 1 | 64.99 | 4 | 4 | 25 | 0 | |
| NPC164023 | C20H22O5 | 4-[(2R,3S,4R,5R)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol | 342.1467238 | -0.8029 | 3.11 | 3.376 | 1 | 1 | 57.15 | 3 | 4 | 25 | 0 |
| NPC174191 | C21H26O6 | 374.1729386 | -0.2401 | 3.11 | 2.243 | 4 | 1 | 66.38 | 9 | 4 | 27 | 0 | |
| NPC183987 | C20H22O5 | 4-[(2R,3R,4S,5S)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol | 342.1467238 | -0.8029 | 3.11 | 3.376 | 1 | 1 | 57.15 | 3 | 4 | 25 | 0 |
| NPC195986 | C14H25NO | Pellitorin | 223.19 | 0.5505 | 2.78 | 4.887 | 2 | 1 | 32.59 | 12 | 0 | 16 | 0 |
| NPC203468 | C11H12N2O2 | Tryptophan | 204.09 | -1.5048 | 2.23 | -0.96 | 4 | 3 | 79.11 | 5 | 2 | 15 | 0 |
| NPC204120 | C12H16O3 | 208.1099444 | 0.8733 | 2.45 | 2.559 | 0 | 0 | 27.69 | 8 | 1 | 15 | 0 | |
| NPC226762 | C20H40O | (E,7S,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol | 296.3079159 | 1.7816 | 3.55 | 8.949 | 1 | 1 | 20.23 | 13 | 0 | 21 | 2 |
| NPC233224 | C20H20O5 | 5-[(2R,3S,4R,5R)-5-(1,3-Benzodioxol-5-Yl)-3,4-Dimethyloxolan-2-Yl]-1,3-Benzodioxole | 340.13 | -0.5935 | 3.11 | 3.822 | 1 | 0 | 46.15 | 4 | 5 | 25 | 0 |
| NPC233529 | C21H26O5 | (1S,5R,6R,7R,8S)-7-(3,4-dimethoxyphenyl)-8-hydroxy-5-methoxy-6-methyl-3-prop-2-enylbicyclo[3.2.1]oct-3-en-2-one | 358.1780239 | -0.0561 | 3.22 | 1.978 | 3 | 1 | 64.99 | 6 | 3 | 26 | 0 |
| NPC24238 | C21H26O5 | 4-[(2R,3R,4S,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol | 358.1780239 | -0.6038 | 3.22 | 3.449 | 1 | 1 | 57.15 | 5 | 3 | 26 | 0 |
| NPC253714 | C21H22O5 | (4S)-4-[(E)-1-(1,3-benzodioxol-5-yl)prop-1-en-2-yl]-4,5-dimethoxy-2-prop-2-enylcyclohexa-2,5-dien-1-one | 354.1467238 | 1.1744 | 3.22 | 3.293 | 3 | 0 | 53.99 | 6 | 3 | 26 | 0 |
| NPC257790 | C18H23NO3 | (2E,6E)-7-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)hepta-2,6-dienamide | 301.1677936 | 1.3161 | 3 | 4.723 | 2 | 1 | 51.05 | 7 | 2 | 22 | 0 |
| NPC26544 | C21H24O5 | 5-[(2R,3R,4S,5R)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole | 356.1623739 | -0.3944 | 3.22 | 3.895 | 1 | 0 | 46.15 | 4 | 4 | 26 | 0 |
| NPC267077 | C21H24O5 | 5-[(2R,3S,4S,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole | 356.1623739 | -0.3944 | 3.22 | 3.895 | 1 | 0 | 46.15 | 4 | 4 | 26 | 0 |
| NPC26960 | C20H40O | Trans-Phytol | 296.31 | 1.7816 | 3.55 | 8.949 | 1 | 1 | 20.23 | 19 | 0 | 21 | 2 |
| NPC280399 | C21H24O5 | Kadsurenone | 356.16 | 0.44 | 3.22 | 3.065 | 3 | 0 | 53.99 | 10 | 3 | 26 | 0 |
| NPC295998 | C20H20O5 | 5-[(2S,3S,4S,5S)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole | 340.1310737 | -0.5935 | 3.11 | 3.822 | 1 | 0 | 46.15 | 2 | 5 | 25 | 0 |
| NPC32411 | C19H20O5 | (2S,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-3-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde | 328.1310737 | -0.4189 | 3 | 3.117 | 1 | 0 | 53.99 | 5 | 3 | 24 | 0 |
| NPC33773 | C21H24O5 | 5-[(2R,3R,4S,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole | 356.1623739 | -0.3944 | 3.22 | 3.895 | 1 | 0 | 46.15 | 4 | 4 | 26 | 0 |
| NPC51681 | C22H28O6 | 388.1885886 | 0.5287 | 3.22 | 2.373 | 4 | 0 | 63.22 | 12 | 3 | 28 | 0 | |
| NPC57268 | C22H28O5 | 2,5-Bis-(3,4-Dimethoxy-Phenyl)-3,4-Dimethyl-Tetrahydro-Furan | 372.19 | -0.1953 | 3.33 | 3.968 | 1 | 0 | 46.15 | 12 | 3 | 27 | 0 |
| NPC64332 | C21H24O5 | 5-[(2S,3R,4R,5R)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole | 356.1623739 | -0.3944 | 3.22 | 3.895 | 1 | 0 | 46.15 | 4 | 4 | 26 | 0 |
| NPC74914 | C21H26O5 | 4-[(2S,3R,4R,5R)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol | 358.1780239 | -0.6038 | 3.22 | 3.449 | 1 | 1 | 57.15 | 5 | 3 | 26 | 0 |
| NPC90185 | C17H13NO4 | Piperlactam S | 295.08 | -1.1987 | 2.78 | 2.911 | 1 | 1 | 59 | 5 | 4 | 22 | 0 |
| NPC93850 | C22H28O5 | (2R,3S,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolane | 372.193674 | -0.1953 | 3.33 | 3.968 | 1 | 0 | 46.15 | 6 | 3 | 27 | 0 |
| NPC94245 | C21H24O4 | 340.1674592 | 0.8846 | 3.33 | 2.812 | 3 | 0 | 52.6 | 5 | 3 | 25 | 0 | |
| NPC95468 | C20H20O5 | 340.1310737 | -0.8402 | 3.11 | 3.603 | 3 | 0 | 53.99 | 2 | 5 | 25 | 0 | |
| NPC99707 | C21H26O5 | 4-[(2R,3S,4S,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-2-methoxyphenol | 358.1780239 | -0.6038 | 3.22 | 3.449 | 1 | 1 | 57.15 | 5 | 3 | 26 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
