NPASS Compound

Natural Product: NPC469757

Natural Product ID	NPC469757
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Antiaroside H
IUPAC Name	(3S,5S,8R,9S,10S,12R,13S,14S,17R)-5,12,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carboxylic acid
Synonyms	Antiaroside H
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1169853
PubChem CID	49799053
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001125] Steroid lactones [CHEMONTID:0001555] Cardenolides and derivatives [CHEMONTID:0001559] Cardenolide glycosides and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 83 88 0 0 0 0 0 0 0 0999 V2000 9.5370 -0.2367 1.6685 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3835 -0.6013 1.2658 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0430 -1.7941 0.6694 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6632 -1.7567 0.3961 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1410 -0.4521 0.8605 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1738 0.1958 1.3626 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7434 0.0006 0.7741 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5004 1.3552 1.4043 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2746 1.9101 0.6993 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2721 1.2778 -0.6705 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1971 0.0858 -0.6290 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3220 0.2901 -1.6532 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4970 -1.2070 -1.0144 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4584 -1.3893 -2.3803 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1981 -1.4005 -0.3071 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2914 -0.1947 -0.3048 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8928 0.8722 -1.1420 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0556 2.1594 -1.1417 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2002 1.9105 -0.3376 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8696 0.7030 -1.0090 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1102 -0.5466 -0.7664 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6933 -1.4231 0.3267 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1927 -1.5194 0.1442 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7533 -0.1555 0.4353 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3006 0.7367 -0.7002 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1263 -0.0952 0.4246 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7363 0.3518 1.5429 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4957 1.4747 1.2308 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4962 1.2511 0.3370 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8812 1.5515 0.8962 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5427 -0.1098 -0.2722 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3784 -1.2356 0.6999 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7451 -0.7209 1.9758 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1226 -1.7291 2.6984 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5930 -2.2702 0.1654 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8264 -0.2526 -0.8519 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0631 -1.4093 -2.0019 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5353 -2.5734 -2.0247 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5072 -0.9568 -3.1832 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7402 0.9819 -2.3952 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7137 2.2546 -1.5915 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1331 -2.6117 0.8824 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5839 -1.8818 -0.7238 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1456 1.1744 1.7876 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0628 -0.7051 1.3368 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3759 1.9868 1.1886 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3709 1.3133 2.4964 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3613 3.0075 0.6197 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4014 1.6747 1.3045 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2940 0.4487 -1.1754 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1067 1.1629 -2.3201 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4132 -0.5706 -2.3435 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1853 -2.0186 -0.6277 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4700 -2.3309 -2.6650 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6960 -2.2716 -0.7837 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4120 -1.7282 0.7318 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1714 0.1363 0.7618 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0340 0.4807 -2.1726 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7095 2.2991 -2.2054 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6143 3.0273 -0.7850 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9135 2.7586 -0.5123 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0387 1.7728 0.7288 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5211 -0.8999 1.2862 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1964 -2.4033 0.2649 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4254 -1.8188 -0.8872 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5490 -2.2984 0.8449 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3727 0.1869 1.4074 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9051 0.4250 -1.5938 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6225 1.7760 -0.4711 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0793 0.6345 2.3768 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3519 1.9804 -0.5142 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4846 0.6087 0.9958 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4739 2.1981 0.2141 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8424 2.0585 1.8706 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8426 -0.1933 -1.1548 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3565 -1.7135 0.9502 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5567 -0.2406 2.5573 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2859 -2.5882 2.2420 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4100 -2.0736 -0.7749 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0653 0.6418 -1.2576 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5409 -1.5485 -3.9988 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5256 0.7124 -2.8982 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2742 2.0985 -2.4816 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 6 11 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 21 37 1 6 37 38 2 0 37 39 1 0 20 40 1 6 10 41 1 6 6 2 1 0 11 7 1 0 21 16 1 0 33 27 1 0 17 10 1 0 25 20 1 0 4 42 1 0 4 43 1 0 6 44 1 0 7 45 1 1 8 46 1 0 8 47 1 0 9 48 1 0 9 49 1 0 12 50 1 0 12 51 1 0 12 52 1 0 13 53 1 1 14 54 1 0 15 55 1 0 15 56 1 0 16 57 1 1 17 58 1 6 18 59 1 0 18 60 1 0 19 61 1 0 19 62 1 0 22 63 1 0 22 64 1 0 23 65 1 0 23 66 1 0 24 67 1 1 25 68 1 0 25 69 1 0 27 70 1 1 29 71 1 6 30 72 1 0 30 73 1 0 30 74 1 0 31 75 1 6 32 76 1 1 33 77 1 1 34 78 1 0 35 79 1 0 36 80 1 0 39 81 1 0 40 82 1 0 41 83 1 0 M END

Standard InCHIKey	PQWNIWYZNGKIOH-RTUNVJFFSA-N
Standard InCHI	InChI=1S/C29H42O12/c1-13-21(32)22(33)23(34)24(40-13)41-15-3-7-28(25(35)36)18-10-19(30)26(2)16(14-9-20(31)39-12-14)5-8-29(26,38)17(18)4-6-27(28,37)11-15/h9,13,15-19,21-24,30,32-34,37-38H,3-8,10-12H2,1-2H3,(H,35,36)/t13-,15+,16-,17-,18+,19-,21+,22-,23-,24-,26+,27+,28-,29+/m1/s1
SMILES	O=C1OCC(=C1)[C@H]1CC[C@]2([C@]1(C)[C@H](O)C[C@H]1[C@H]2CC[C@]2([C@@]1(CC[C@@H](C2)O[C@H]1O[C@H](C)[C@@H]([C@H]([C@H]1O)O)O)C(=O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	582.27	Volume:	556.375 ? Van der Waals volume.
Dense:	1.047	LogP:	-1.345 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-0.078 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-1.004 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	33.0
TPSA:	203.44 ? Topological Polar Surface Area.	H-Bond Acceptor:	12.0
H-Bond Donor:	7.0	Rings:	6.0
Heavy Atoms:	12.0

MedChem Properties

QED Drug-Likeness Score:	0.167	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.515	Fsp³:	0.862
MCE-18:	122.63 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.562	Fluc inhibitor:	0.003 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.026 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.123	Promiscuous compounds:	0.348

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.373	MDCK Permeability:	-5.31
Pgp-inhibitor:	0.0	Pgp-substrate:	1.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.094
20% Bioavailability (F20%):	0.482	30% Bioavailability (F30%):	0.129
50% Bioavailability (F50%):	0.984

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.977
Plasma Protein Binding (PPB):	27.562%	Volume Distribution (VD):	-0.645
Fu:	74.049% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.852
OATP1B3 inhibitor:	0.46	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.005	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.001
HLM stability:	0.008 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.591

Half-life (T1/2):

4.412

ADMET: Toxicity

hERG Blockers:	0.085	hERG Blockers (10um):	0.322
Human Hepatotoxicity (H-HT):	0.746	Drug-induced Liver Injury (DILI):	0.448
AMES Toxicity:	0.583	Rat Oral Acute Toxicity:	0.988
Maximum Recommended Daily Dose:	1.0	Skin Sensitization:	1.0
Carcinogencity:	0.912	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.999
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.869
Hematotoxicity:	0.523	Drug-induced Nephrotoxicity:	0.992
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.853
A549 Cytotoxicity:	0.466	Hek293 Cytotoxicity:	0.944
BCF:	0.352 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.005 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.325 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.503 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20553004]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	latex	Xishuangbanna Tropical Botanical Garden, Chinese Academy of Sciences, Yunnan Province, China	2011-Mar	PMID[24033101]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	trunk bark	Yunnan, China	n.a.	PMID[24582402]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	4
Ratio	2
ED50	10

Activity Type	# Activity
Cell line	7
Non-molecular	9

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT147	Cell line	SK-MEL-2	Homo sapiens	ED50	=	1.3	ug ml-1	PMID[23527875]
NPT308	Cell line	CAKI-1	Homo sapiens	ED50	=	1.5	ug ml-1	PMID[23527875]
NPT309	Cell line	1A9	Homo sapiens	ED50	=	1.4	ug ml-1	PMID[23527875]
NPT306	Cell line	PC-3	Homo sapiens	ED50	=	1.8	ug ml-1	PMID[23647825]
NPT83	Cell line	MCF7	Homo sapiens	ED50	=	3.1	ug ml-1	PMID[23647825]
NPT81	Cell line	A549	Homo sapiens	ED50	=	0.76	ug ml-1	PMID[23527875]
NPT91	Cell line	KB	Homo sapiens	ED50	=	5.9	ug ml-1	PMID[16309323]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	7.5	uM	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	8.33	uM	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	144.0	%	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	260.0	%	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Ratio	=	7.5	n.a.	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Ratio	=	9.7	n.a.	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	=	2.5	ug ml-1	PMID[24582402]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	=	7.3	ug ml-1	PMID[24582402]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	=	7.1	ug ml-1	PMID[24582402]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC469757 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15102
0.1-0.2	29797
0.2-0.3	4655
0.3-0.4	224
0.4-0.5	46
0.5-0.6	17
0.6-0.7	14
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC471357
1.0	High Similarity	NPC117702
0.6374	Remote Similarity	NPC77319
0.6374	Remote Similarity	NPC471351
0.6374	Remote Similarity	NPC471355
0.6304	Remote Similarity	NPC9499
0.6304	Remote Similarity	NPC471360
0.6304	Remote Similarity	NPC469751
0.6304	Remote Similarity	NPC471361
0.6304	Remote Similarity	NPC86159
0.6304	Remote Similarity	NPC469752
0.6304	Remote Similarity	NPC469754
0.6304	Remote Similarity	NPC70542
0.6237	Remote Similarity	NPC471354
0.6237	Remote Similarity	NPC27507
0.6146	Remote Similarity	NPC27363
0.5789	Remote Similarity	NPC179412
0.5789	Remote Similarity	NPC471356
0.5789	Remote Similarity	NPC471353
0.5426	Remote Similarity	NPC99728
0.5426	Remote Similarity	NPC87250
0.5426	Remote Similarity	NPC244402
0.5426	Remote Similarity	NPC50305
0.5368	Remote Similarity	NPC309034
0.5312	Remote Similarity	NPC157376
0.5312	Remote Similarity	NPC17896
0.5312	Remote Similarity	NPC469755
0.5312	Remote Similarity	NPC284406
0.5312	Remote Similarity	NPC197707
0.5312	Remote Similarity	NPC251866
0.5312	Remote Similarity	NPC142066
0.5312	Remote Similarity	NPC603972
0.5204	Remote Similarity	NPC83287

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC469757 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5201
0.1-0.2	3865
0.2-0.3	69
0.3-0.4	6
0.4-0.5	6
0.5-0.6	3
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5312	Remote Similarity	NPD7319	Approved
0.5204	Remote Similarity	NPD7327	Approved
0.5204	Remote Similarity	NPD7328	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data