NPASS Compound

Natural Product: NPC289700

Natural Product ID	NPC289700
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	5Beta,14Beta-Dihydroxy-19-Oxo-3Beta-[(Beta-D-Glucopyranosyl)Oxy)]Bufa-20,22-Dienolide
IUPAC Name	(3S,5S,8R,9S,10S,13R,14S,17R)-5,14-dihydroxy-13-methyl-17-(6-oxopyran-3-yl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL446052
PubChem CID	3055779
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001125] Steroid lactones [CHEMONTID:0001557] Bufanolides and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 83 88 0 0 0 0 0 0 0 0999 V2000 9.2406 0.8253 -2.0991 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0543 0.0974 -2.1662 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1870 0.4601 -0.9707 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9849 -0.2451 -0.9933 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0863 0.4483 -0.1842 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8984 -0.2204 0.0133 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8117 0.4810 -0.4464 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1350 -0.2386 -1.5940 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6921 0.2454 -1.6141 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0179 -0.4639 -0.4777 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7293 -0.1802 0.7956 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8238 0.8463 0.6141 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3232 -1.3340 1.2857 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1838 0.3570 1.8936 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3920 -0.5316 2.0795 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1193 -0.6934 0.7940 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4659 -0.0438 -0.3850 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2219 -0.5555 -1.6049 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5889 0.0823 -1.5458 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3588 -0.2815 -0.3000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5458 -0.2511 0.9476 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0988 -1.0493 1.9506 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6675 1.1805 1.3986 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1771 1.4053 1.2408 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4278 0.7924 -0.1065 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7931 0.3140 -0.2963 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6166 0.7047 -1.3541 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8971 0.2002 -1.4395 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3723 -0.6814 -0.4973 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5536 -1.1571 -0.5618 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5747 -1.0263 0.4804 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3512 -0.5690 0.5968 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9928 -1.6340 -0.5780 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0173 -1.9154 -0.8002 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5193 -2.7728 -0.1112 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7248 0.6469 1.1838 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8975 -0.3295 1.3197 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9398 0.1515 0.3057 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5256 1.2888 0.8569 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4495 -1.5623 0.8509 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1769 1.9591 1.3500 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6343 0.7621 -1.1745 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2359 -0.9959 -2.2237 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5637 0.3852 -3.1165 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0210 1.5683 -1.0412 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9285 1.4457 -0.6877 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1994 1.4495 -0.8766 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1573 -1.3240 -1.3734 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6558 -0.0516 -2.5435 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2667 -0.0063 -2.5955 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6861 1.3206 -1.3888 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3587 1.8416 0.4648 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3387 0.9170 1.6152 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8474 -1.0748 2.0855 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4138 0.3244 2.8414 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5148 1.3841 1.6787 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0159 -1.5123 2.4924 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9960 -0.0909 2.8896 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1581 -1.7990 0.5699 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5748 1.0592 -0.3161 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3813 -1.6520 -1.4794 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7565 -0.2834 -2.5518 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1899 -0.1983 -2.4189 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4600 1.1890 -1.5301 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5550 -1.8549 2.1379 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1885 1.8479 0.6509 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3477 1.3635 2.4223 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3635 2.4962 1.2518 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6565 0.8664 2.0750 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2789 1.6188 -0.8641 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2333 1.3948 -2.0847 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5731 0.4750 -2.2437 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7866 -0.9229 1.4439 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3182 -2.2462 -1.2507 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1443 -2.2413 0.3173 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9359 -1.5579 -1.1467 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4565 -2.2242 -1.7490 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9978 0.4532 2.0034 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2836 -0.3523 2.3373 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7156 -0.6228 0.1297 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3202 2.1125 0.3136 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2160 -2.1474 0.6178 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2442 2.1329 2.3093 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 1 11 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 1 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 29 31 1 0 31 32 1 0 20 33 1 6 10 34 1 6 34 35 2 0 5 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 36 41 1 0 38 3 1 0 12 7 1 0 21 16 1 0 32 26 2 0 17 10 1 0 25 20 1 0 1 42 1 0 2 43 1 0 2 44 1 0 3 45 1 6 5 46 1 6 7 47 1 6 8 48 1 0 8 49 1 0 9 50 1 0 9 51 1 0 12 52 1 0 12 53 1 0 13 54 1 0 14 55 1 0 14 56 1 0 15 57 1 0 15 58 1 0 16 59 1 6 17 60 1 1 18 61 1 0 18 62 1 0 19 63 1 0 19 64 1 0 22 65 1 0 23 66 1 0 23 67 1 0 24 68 1 0 24 69 1 0 25 70 1 6 27 71 1 0 28 72 1 0 32 73 1 0 33 74 1 0 33 75 1 0 33 76 1 0 34 77 1 0 36 78 1 1 37 79 1 1 38 80 1 6 39 81 1 0 40 82 1 0 41 83 1 0 M END

Standard InCHIKey	AXUYMUBJXHVZEL-DBOUUHTQSA-N
Standard InCHI	InChI=1S/C30H42O11/c1-27-8-5-19-20(30(27,38)11-7-18(27)16-2-3-22(33)39-14-16)6-10-29(37)12-17(4-9-28(19,29)15-32)40-26-25(36)24(35)23(34)21(13-31)41-26/h2-3,14-15,17-21,23-26,31,34-38H,4-13H2,1H3/t17-,18+,19-,20+,21+,23+,24-,25+,26+,27+,28-,29-,30-/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@](C2)(O)CC[C@@H]2[C@@H]3CC[C@]3([C@]2(O)CC[C@@H]3c2ccc(=O)oc2)C)C=O)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	578.27	Volume:	562.244 ? Van der Waals volume.
Dense:	1.029	LogP:	-0.248 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.537 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-1.99 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	5.0	Rigid Bonds:	34.0
TPSA:	187.12 ? Topological Polar Surface Area.	H-Bond Acceptor:	11.0
H-Bond Donor:	6.0	Rings:	6.0
Heavy Atoms:	11.0

MedChem Properties

QED Drug-Likeness Score:	0.209	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.248	Fsp³:	0.8
MCE-18:	156.407 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.731	Fluc inhibitor:	0.003 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.214 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.009 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.075	Promiscuous compounds:	0.362

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.215	MDCK Permeability:	-5.209
Pgp-inhibitor:	0.0	Pgp-substrate:	0.389
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.006
20% Bioavailability (F20%):	0.907	30% Bioavailability (F30%):	0.981
50% Bioavailability (F50%):	0.987

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.846
Plasma Protein Binding (PPB):	77.662%	Volume Distribution (VD):	-0.377
Fu:	21.498% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.064

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.006	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.076
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.054

Half-life (T1/2):

3.57

ADMET: Toxicity

hERG Blockers:	0.031	hERG Blockers (10um):	0.081
Human Hepatotoxicity (H-HT):	0.705	Drug-induced Liver Injury (DILI):	0.358
AMES Toxicity:	0.771	Rat Oral Acute Toxicity:	0.275
Maximum Recommended Daily Dose:	0.64	Skin Sensitization:	0.999
Carcinogencity:	0.878	Eye Corrosion:	0.0
Eye Irritation:	0.006	Respiratory Toxicity:	0.114
Drug-induced Neurotoxicity:	0.006	Ototoxicity:	0.883
Hematotoxicity:	0.122	Drug-induced Nephrotoxicity:	0.892
Genotoxicity:	0.972	RPMI-8226 Immunitoxicity:	0.165
A549 Cytotoxicity:	0.672	Hek293 Cytotoxicity:	0.815
BCF:	0.51 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.235 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.781 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.884 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO6205	Helleborus orientalis	Species	Ranunculaceae	Eukaryota	rhizomes	n.a.	n.a.	PMID[12608856]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	3
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT924	Cell line	HSC-2	Homo sapiens	IC50	=	0.0029	ug.mL-1	DrugMatrix in vitro pharmacology data
NPT1083	Cell line	A-375	Homo sapiens	IC50	=	0.0086	ug.mL-1	DrugMatrix in vitro pharmacology data
NPT65	Cell line	HepG2	Homo sapiens	IC50	=	0.23	ug.mL-1	PMID[23398362]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	0.082	ug.mL-1	PMID[12608856]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC289700 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15439
0.1-0.2	30388
0.2-0.3	3742
0.3-0.4	202
0.4-0.5	60
0.5-0.6	16
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.908	High Similarity	NPC603497
0.9024	High Similarity	NPC62172
0.7444	Intermediate Similarity	NPC75616
0.6947	Remote Similarity	NPC155529
0.6512	Remote Similarity	NPC184555
0.6484	Remote Similarity	NPC233041
0.6477	Remote Similarity	NPC488753
0.6444	Remote Similarity	NPC55602
0.6055	Remote Similarity	NPC127656
0.5859	Remote Similarity	NPC611669
0.5727	Remote Similarity	NPC179261
0.5686	Remote Similarity	NPC601014
0.5686	Remote Similarity	NPC602022
0.5618	Remote Similarity	NPC137462
0.5579	Remote Similarity	NPC154815
0.5435	Remote Similarity	NPC73050
0.5435	Remote Similarity	NPC605625
0.5421	Remote Similarity	NPC158350
0.5417	Remote Similarity	NPC247760
0.5165	Remote Similarity	NPC603706
0.5149	Remote Similarity	NPC47870
0.5109	Remote Similarity	NPC304276
0.5109	Remote Similarity	NPC171014
0.5096	Remote Similarity	NPC145074
0.5096	Remote Similarity	NPC114939

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC289700 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3952
0.1-0.2	5119
0.2-0.3	71
0.3-0.4	6
0.4-0.5	1
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5859	Remote Similarity	NPD7503	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data