Drug Information| Drug ID:   | NPD7239 |
| Drug Name:   | NCX-1015 |
| Molecular Formula:   | C29H33NO9 |
| Canonical SMILES:   | O=N(=O)OCc1ccc(cc1)C(=O)OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)C=C[C@]12C |
| Standard InCHI:   | "InChI=1S/C29H33NO9/c1-27-11-9-20(31)13-19(27)7-8-21-22-10-12-29(35,28(22,2)14-23(32)25(21)27)24(33)16-38-26(34)18-5-3-17(4-6-18)15-39-30(36)37/h3-6,9,11,13,21-23,25,32,35H,7-8,10,12,14-16H2,1-2H3/t21-,22-,23-,25+,27-,28-,29-/m0/s1" |
| Standard InCHIKey:   | MJHYBJOMJPGNMM-KGWLDMEJSA-N |
| Max Developmental Stage:   | Suspended |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7239Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6375 | NPC44063 |
| Remote Similarity | 0.6375 | NPC235800 |
| Remote Similarity | 0.6375 | NPC611921 |
| Remote Similarity | 0.5556 | NPC334061 |
| Remote Similarity | 0.5556 | NPC611819 |
| Molecular Weight   | 539.22 |
| ALogP   | -0.4911 |
| MLogP   | 3.55 |
| XLogP   | 3.377 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 12 |
| TPSA   | 155.95 |
| RO5 Violation   | 0 |