Natural Product: NPC240838
Natural Product ID:   | NPC240838 |
Common Name*:   | Anguidin |
IUPAC Name:   | n.a. |
Synonyms:   | Anguidin; Diacetoxyscirpenol |
Standard InCHIKey:   | AUGQEEXBDZWUJY-NMAPUUFXSA-N |
Standard InCHI:   | InChI=1S/C19H26O7/c1-10-5-6-18(8-23-11(2)20)13(7-10)26-16-14(22)15(25-12(3)21)17(18,4)19(16)9-24-19/h7,13-16,22H,5-6,8-9H2,1-4H3/t13-,14-,15-,16-,17-,18-,19+/m1/s1 |
SMILES:   | CC(=O)OC[C@]12CCC(=C[C@H]1O[C@H]1[C@]3([C@]2(C)[C@H](OC(=O)C)[C@H]1O)CO3)C
|
Synthetic Gene Cluster:   |
n.a. |
ChEMBL Identifier:   |
CHEMBL433680 |
PubChem CID:   |
15571694 |
Chemical Classification**:   |
-
CHEMONTID:0000000 [Organic compounds]
-
[CHEMONTID:0000012] Lipids and lipid-like molecules
-
[CHEMONTID:0000259] Prenol lipids
[CHEMONTID:0001550] Sesquiterpenoids[CHEMONTID:0001789] Trichothecenes
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
  Species Source
Organism ID |
Organism Name |
Taxonomy Level |
Family |
SuperKingdom |
Isolation Part |
Collection Location |
Collection Time |
Reference |
NPO30443 |
Myrothecium verrucaria |
Species |
Stachybotryaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[10075777] |
NPO30443 |
Myrothecium verrucaria |
Species |
Stachybotryaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[13678412] |
NPO30443 |
Myrothecium verrucaria |
Species |
Stachybotryaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[21539317] |
NPO30443 |
Myrothecium verrucaria |
Species |
Stachybotryaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration
Organism ID |
NP ID |
Organism Material Preparation |
Organism Part |
NP Quantity (Standard) |
NP Quantity (Minimum) |
NP Quantity (Maximum) |
Quantity Unit |
Reference |
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  Biological Activity
Activity Type |
# Activity |
AC50 |
3 |
EC50 |
1 |
IC50 |
25 |
LD50 |
1 |
Others |
13 |
Potency |
41 |
Activity Type |
# Activity |
Cell Line |
24 |
CELL-LINE |
1 |
Individual Protein |
30 |
NON-MOLECULAR |
2 |
Organism |
9 |
Others |
16 |
Uncleic Acid |
2 |
Target ID |
Target Type |
Target Name |
Target Organism |
Activity Type |
Activity Relation |
Value |
Unit |
Reference |
NPT730 |
Cell Line |
MC-38 |
Mus musculus |
Selectivity |
= |
-150.0 |
zone unit |
PMID[471347] |
NPT730 |
Cell Line |
MC-38 |
Mus musculus |
Selectivity |
= |
0.0 |
zone unit |
PMID[471347] |
NPT137 |
Cell Line |
L1210 |
Mus musculus |
Selectivity |
= |
150.0 |
zone unit |
PMID[471347] |
NPT404 |
Cell Line |
CCRF-CEM |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT116 |
Cell Line |
HL-60 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT112 |
Cell Line |
MOLT-4 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT81 |
Cell Line |
A549 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT405 |
Cell Line |
NCI-H226 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT455 |
Cell Line |
NCI-H522 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT407 |
Cell Line |
COLO 205 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT393 |
Cell Line |
HCT-116 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT148 |
Cell Line |
HCT-15 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT387 |
Cell Line |
M14 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT147 |
Cell Line |
SK-MEL-2 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT398 |
Cell Line |
UACC-62 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT401 |
Cell Line |
786-0 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT376 |
Cell Line |
A498 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT406 |
Cell Line |
RXF 393 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT83 |
Cell Line |
MCF7 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT400 |
Cell Line |
MDA-MB-435 |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT367 |
Cell Line |
MDA-N |
Homo sapiens |
IC50 |
< |
1.0 |
nM |
PMID[471347] |
NPT1864 |
Cell Line |
L5178Y |
Mus musculus |
LC50 |
= |
0.002 |
ug.mL-1 |
PMID[471348] |
NPT111 |
Cell Line |
K562 |
Homo sapiens |
EC50 |
= |
2.7 |
nM |
PMID[471349] |
NPT1197 |
Individual Protein |
Huntingtin |
Homo sapiens |
Potency |
= |
100.0 |
nM |
PMID[471351] |
NPT537 |
Individual Protein |
Ras-related protein Rab-9A |
Homo sapiens |
Potency |
= |
1995.3 |
nM |
PMID[471351] |
NPT531 |
Individual Protein |
Nuclear receptor ROR-gamma |
Mus musculus |
Potency |
= |
1.6 |
nM |
PMID[471351] |
NPT54 |
Individual Protein |
Nonstructural protein 1 |
Influenza A virus |
Potency |
= |
7943.3 |
nM |
PMID[471351] |
NPT538 |
Individual Protein |
Niemann-Pick C1 protein |
Homo sapiens |
Potency |
= |
89.1 |
nM |
PMID[471351] |
NPT531 |
Individual Protein |
Nuclear receptor ROR-gamma |
Mus musculus |
Potency |
= |
31.6 |
nM |
PMID[471351] |
NPT152 |
Individual Protein |
Nuclear factor erythroid 2-related factor 2 |
Homo sapiens |
Potency |
n.a. |
18.4 |
nM |
PMID[471351] |
NPT2892 |
Individual Protein |
X-box-binding protein 1 |
Homo sapiens |
IC50 |
= |
160.0 |
nM |
PMID[471351] |
NPT539 |
Individual Protein |
Cellular tumor antigen p53 |
Homo sapiens |
Potency |
n.a. |
31622.8 |
nM |
PMID[471351] |
NPT5 |
Individual Protein |
Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 |
Homo sapiens |
Potency |
n.a. |
794.3 |
nM |
PMID[471351] |
NPT2893 |
Individual Protein |
DNA damage-inducible transcript 3 protein |
Mus musculus |
IC50 |
> |
160.0 |
nM |
PMID[471351] |
NPT64 |
Individual Protein |
ATPase family AAA domain-containing protein 5 |
Homo sapiens |
Potency |
n.a. |
18.3 |
nM |
PMID[471351] |
NPT1861 |
Individual Protein |
Mitochondrial import inner membrane translocase subunit TIM10 |
Saccharomyces cerevisiae S288c |
IC50 |
= |
30800.0 |
nM |
PMID[471351] |
NPT15 |
Cell Line |
Jurkat |
Homo sapiens |
IC50 |
< |
160.0 |
nM |
PMID[471351] |
NPT64 |
Individual Protein |
ATPase family AAA domain-containing protein 5 |
Homo sapiens |
Potency |
n.a. |
17.7 |
nM |
PMID[471351] |
NPT64 |
Individual Protein |
ATPase family AAA domain-containing protein 5 |
Homo sapiens |
Potency |
n.a. |
44.5 |
nM |
PMID[471351] |
NPT10 |
Individual Protein |
Geminin |
Homo sapiens |
Potency |
n.a. |
58.0 |
nM |
PMID[471351] |
NPT64 |
Individual Protein |
ATPase family AAA domain-containing protein 5 |
Homo sapiens |
Potency |
n.a. |
39.7 |
nM |
PMID[471351] |
NPT159 |
Individual Protein |
Aberrant vpr protein |
Human immunodeficiency virus 1 |
Potency |
n.a. |
3162.3 |
nM |
PMID[471351] |
NPT64 |
Individual Protein |
ATPase family AAA domain-containing protein 5 |
Homo sapiens |
Potency |
n.a. |
28.1 |
nM |
PMID[471351] |
NPT64 |
Individual Protein |
ATPase family AAA domain-containing protein 5 |
Homo sapiens |
Potency |
n.a. |
56.1 |
nM |
PMID[471351] |
NPT66 |
Individual Protein |
Acetylcholinesterase |
Electrophorus electricus |
Inhibition |
= |
23.78 |
% |
PMID[471352] |
NPT50 |
Individual Protein |
Tyrosyl-DNA phosphodiesterase 1 |
Homo sapiens |
Potency |
n.a. |
16.4 |
nM |
PMID[471351] |
NPT160 |
Individual Protein |
TAR DNA-binding protein 43 |
Homo sapiens |
Potency |
n.a. |
35481.3 |
nM |
PMID[471351] |
NPT50 |
Individual Protein |
Tyrosyl-DNA phosphodiesterase 1 |
Homo sapiens |
Potency |
n.a. |
20.6 |
nM |
PMID[471351] |
NPT154 |
Individual Protein |
Mothers against decapentaplegic homolog 3 |
Homo sapiens |
Potency |
n.a. |
36.6 |
nM |
PMID[471351] |
NPT152 |
Individual Protein |
Nuclear factor erythroid 2-related factor 2 |
Homo sapiens |
Potency |
n.a. |
2592.9 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
Relative activity |
= |
423.0 |
n.a. |
PMID[471347] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
Concentration |
= |
0.24 |
ug ml-1 |
PMID[471347] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
Selectivity |
= |
-100.0 |
zone unit |
PMID[471347] |
NPT22117 |
CELL-LINE |
NCI-H125 |
Homo sapiens |
Selectivity |
= |
0.0 |
zone unit |
PMID[471347] |
NPT32 |
Organism |
Mus musculus |
Mus musculus |
LD50 |
= |
23.0 |
mg.kg-1 |
PMID[471349] |
NPT32 |
Organism |
Mus musculus |
Mus musculus |
Activity |
= |
23.0 |
n.a. |
PMID[471349] |
NPT312 |
Organism |
Saccharomyces cerevisiae |
Saccharomyces cerevisiae |
Ratio |
= |
342.9 |
n.a. |
PMID[471350] |
NPT312 |
Organism |
Saccharomyces cerevisiae |
Saccharomyces cerevisiae |
Activity |
= |
342.9 |
n.a. |
PMID[471350] |
NPT312 |
Organism |
Saccharomyces cerevisiae |
Saccharomyces cerevisiae |
Potency |
= |
6309.6 |
nM |
PMID[471351] |
NPT536 |
Uncleic Acid |
microRNA 21 |
Homo sapiens |
Potency |
= |
4.6 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
Potency |
= |
51.7 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
16.4 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
IC50 |
< |
160.0 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
IC50 |
> |
80000.0 |
nM |
PMID[471351] |
NPT6 |
Organism |
Plasmodium falciparum |
Plasmodium falciparum |
Potency |
n.a. |
4653.5 |
nM |
PMID[471351] |
NPT586 |
Organism |
Giardia |
Giardia |
Potency |
n.a. |
130.9 |
nM |
PMID[471351] |
NPT6 |
Organism |
Plasmodium falciparum |
Plasmodium falciparum |
Potency |
n.a. |
3.3 |
nM |
PMID[471351] |
NPT586 |
Organism |
Giardia |
Giardia |
Potency |
n.a. |
5160.9 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
AC50 |
> |
70000.0 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
AC50 |
< |
260.0 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
7079.5 |
nM |
PMID[471351] |
NPT67 |
Individual Protein |
Cholinesterase |
Equus caballus |
Inhibition |
= |
12.32 |
% |
PMID[471352] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
206.0 |
nM |
PMID[471351] |
NPT920 |
Individual Protein |
Alpha-synuclein |
Homo sapiens |
Potency |
n.a. |
5623.4 |
nM |
PMID[471351] |
NPT861 |
Individual Protein |
Isocitrate dehydrogenase [NADP] cytoplasmic |
Homo sapiens |
Potency |
n.a. |
730.8 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
89125.1 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
145.8 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
31622.8 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
3162.3 |
nM |
PMID[471351] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
562.3 |
nM |
PMID[471351] |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
  Chemically structural similarity: I. Similar Active Natural Products in NPASS
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC240838 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 176 |
0.1-0.2 | 1289 |
0.2-0.3 | 4953 |
0.3-0.4 | 13540 |
0.4-0.5 | 9389 |
0.5-0.6 | 7176 |
0.6-0.7 | 5412 |
0.7-0.8 | 690 |
0.8-0.85 | 14 |
0.85-0.9 | 21 |
0.9-0.95 | 23 |
0.95-1 | 14 |
  Chemically structural similarity: II. Similar Clinical/Approved Drugs
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC240838 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 142 |
0.1-0.2 | 1628 |
0.2-0.3 | 4058 |
0.3-0.4 | 2358 |
0.4-0.5 | 536 |
0.5-0.6 | 271 |
0.6-0.7 | 154 |
0.7-0.8 | 3 |
0.8-0.85 | 0 |
0.85-0.9 | 0 |
0.9-0.95 | 0 |
0.95-1 | 0 |
Similarity Score |
Similarity Level |
Drug ID |
Developmental Stage |
0.7374 |
Intermediate Similarity |
NPD6698 |
Approved |
0.7374 |
Intermediate Similarity |
NPD46 |
Approved |
0.7345 |
Intermediate Similarity |
NPD7328 |
Approved |
0.7345 |
Intermediate Similarity |
NPD7327 |
Approved |
0.7304 |
Intermediate Similarity |
NPD7503 |
Approved |
0.7304 |
Intermediate Similarity |
NPD8033 |
Approved |
0.7281 |
Intermediate Similarity |
NPD7516 |
Approved |
0.7217 |
Intermediate Similarity |
NPD8377 |
Approved |
0.7217 |
Intermediate Similarity |
NPD8294 |
Approved |
0.7212 |
Intermediate Similarity |
NPD7638 |
Approved |
0.72 |
Intermediate Similarity |
NPD7838 |
Discovery |
0.7155 |
Intermediate Similarity |
NPD8296 |
Approved |
0.7155 |
Intermediate Similarity |
NPD8335 |
Approved |
0.7155 |
Intermediate Similarity |
NPD8380 |
Approved |
0.7155 |
Intermediate Similarity |
NPD8378 |
Approved |
0.7155 |
Intermediate Similarity |
NPD8379 |
Approved |
0.7143 |
Intermediate Similarity |
NPD7640 |
Approved |
0.7143 |
Intermediate Similarity |
NPD7639 |
Approved |
0.71 |
Intermediate Similarity |
NPD6051 |
Approved |
0.7091 |
Intermediate Similarity |
NPD4061 |
Clinical (unspecified phase) |
0.7075 |
Intermediate Similarity |
NPD5344 |
Discontinued |
0.7064 |
Intermediate Similarity |
NPD6412 |
Phase 2 |
0.7054 |
Intermediate Similarity |
NPD6053 |
Discontinued |
0.7027 |
Intermediate Similarity |
NPD6371 |
Approved |
0.7 |
Intermediate Similarity |
NPD6686 |
Approved |
0.697 |
Remote Similarity |
NPD4249 |
Approved |
0.6917 |
Remote Similarity |
NPD7507 |
Approved |
0.69 |
Remote Similarity |
NPD4251 |
Approved |
0.69 |
Remote Similarity |
NPD4250 |
Approved |
0.69 |
Remote Similarity |
NPD7524 |
Approved |
0.6875 |
Remote Similarity |
NPD4821 |
Approved |
0.6875 |
Remote Similarity |
NPD4819 |
Approved |
0.6875 |
Remote Similarity |
NPD5790 |
Clinical (unspecified phase) |
0.6875 |
Remote Similarity |
NPD4822 |
Approved |
0.6875 |
Remote Similarity |
NPD4820 |
Approved |
0.6869 |
Remote Similarity |
NPD6082 |
Clinical (unspecified phase) |
0.681 |
Remote Similarity |
NPD7115 |
Discovery |
0.678 |
Remote Similarity |
NPD6319 |
Approved |
0.6768 |
Remote Similarity |
NPD7338 |
Clinical (unspecified phase) |
0.6757 |
Remote Similarity |
NPD7899 |
Clinical (unspecified phase) |
0.6748 |
Remote Similarity |
NPD7319 |
Approved |
0.6729 |
Remote Similarity |
NPD4225 |
Approved |
0.6726 |
Remote Similarity |
NPD5955 |
Clinical (unspecified phase) |
0.6696 |
Remote Similarity |
NPD4632 |
Approved |
0.6667 |
Remote Similarity |
NPD6648 |
Approved |
0.6667 |
Remote Similarity |
NPD4271 |
Approved |
0.6667 |
Remote Similarity |
NPD4268 |
Approved |
0.6667 |
Remote Similarity |
NPD6695 |
Phase 3 |
0.6636 |
Remote Similarity |
NPD6084 |
Phase 2 |
0.6636 |
Remote Similarity |
NPD6083 |
Phase 2 |
0.6635 |
Remote Similarity |
NPD7637 |
Suspended |
0.6606 |
Remote Similarity |
NPD4159 |
Approved |
0.6604 |
Remote Similarity |
NPD5695 |
Phase 3 |
0.66 |
Remote Similarity |
NPD6400 |
Clinical (unspecified phase) |
0.6574 |
Remote Similarity |
NPD8029 |
Clinical (unspecified phase) |
0.6569 |
Remote Similarity |
NPD4751 |
Clinical (unspecified phase) |
0.6566 |
Remote Similarity |
NPD6435 |
Approved |
0.6552 |
Remote Similarity |
NPD8133 |
Approved |
0.6545 |
Remote Similarity |
NPD7632 |
Discontinued |
0.6522 |
Remote Similarity |
NPD8413 |
Clinical (unspecified phase) |
0.6518 |
Remote Similarity |
NPD6675 |
Approved |
0.6518 |
Remote Similarity |
NPD6008 |
Approved |
0.6518 |
Remote Similarity |
NPD6402 |
Approved |
0.6518 |
Remote Similarity |
NPD7128 |
Approved |
0.6518 |
Remote Similarity |
NPD5739 |
Approved |
0.6466 |
Remote Similarity |
NPD8297 |
Approved |
0.646 |
Remote Similarity |
NPD5697 |
Approved |
0.646 |
Remote Similarity |
NPD5701 |
Approved |
0.646 |
Remote Similarity |
NPD5954 |
Clinical (unspecified phase) |
0.6458 |
Remote Similarity |
NPD3701 |
Clinical (unspecified phase) |
0.6444 |
Remote Similarity |
NPD2685 |
Clinical (unspecified phase) |
0.6442 |
Remote Similarity |
NPD1695 |
Approved |
0.6423 |
Remote Similarity |
NPD7492 |
Approved |
0.6422 |
Remote Similarity |
NPD5696 |
Approved |
0.6415 |
Remote Similarity |
NPD6399 |
Phase 3 |
0.6408 |
Remote Similarity |
NPD7750 |
Discontinued |
0.6404 |
Remote Similarity |
NPD6881 |
Approved |
0.6404 |
Remote Similarity |
NPD6899 |
Approved |
0.6404 |
Remote Similarity |
NPD7320 |
Approved |
0.6389 |
Remote Similarity |
NPD4792 |
Clinical (unspecified phase) |
0.6387 |
Remote Similarity |
NPD6009 |
Approved |
0.6381 |
Remote Similarity |
NPD5785 |
Approved |
0.6371 |
Remote Similarity |
NPD6616 |
Approved |
0.6364 |
Remote Similarity |
NPD6059 |
Approved |
0.6364 |
Remote Similarity |
NPD5368 |
Approved |
0.6364 |
Remote Similarity |
NPD6930 |
Phase 2 |
0.6364 |
Remote Similarity |
NPD6931 |
Approved |
0.6364 |
Remote Similarity |
NPD6054 |
Approved |
0.6348 |
Remote Similarity |
NPD6013 |
Approved |
0.6348 |
Remote Similarity |
NPD6372 |
Approved |
0.6348 |
Remote Similarity |
NPD6014 |
Approved |
0.6348 |
Remote Similarity |
NPD6012 |
Approved |
0.6348 |
Remote Similarity |
NPD6373 |
Approved |
0.6341 |
Remote Similarity |
NPD7604 |
Phase 2 |
0.6337 |
Remote Similarity |
NPD5362 |
Discontinued |
0.6337 |
Remote Similarity |
NPD7154 |
Phase 3 |
0.6321 |
Remote Similarity |
NPD7983 |
Approved |
0.6321 |
Remote Similarity |
NPD5693 |
Phase 1 |
0.632 |
Remote Similarity |
NPD7078 |
Approved |
0.632 |
Remote Similarity |
NPD8293 |
Discontinued |
0.6311 |
Remote Similarity |
NPD6015 |
Approved |
0.6311 |
Remote Similarity |
NPD5983 |
Phase 2 |
0.6311 |
Remote Similarity |
NPD7521 |
Approved |
0.6311 |
Remote Similarity |
NPD7334 |
Approved |
0.6311 |
Remote Similarity |
NPD8515 |
Approved |
0.6311 |
Remote Similarity |
NPD8513 |
Phase 3 |
0.6311 |
Remote Similarity |
NPD5330 |
Approved |
0.6311 |
Remote Similarity |
NPD7146 |
Approved |
0.6311 |
Remote Similarity |
NPD6409 |
Approved |
0.6311 |
Remote Similarity |
NPD6684 |
Approved |
0.6311 |
Remote Similarity |
NPD8516 |
Approved |
0.6311 |
Remote Similarity |
NPD8517 |
Approved |
0.6311 |
Remote Similarity |
NPD6016 |
Approved |
0.6293 |
Remote Similarity |
NPD6883 |
Approved |
0.6293 |
Remote Similarity |
NPD7102 |
Approved |
0.6293 |
Remote Similarity |
NPD7290 |
Approved |
0.6293 |
Remote Similarity |
NPD4634 |
Approved |
0.6289 |
Remote Similarity |
NPD6933 |
Approved |
0.6286 |
Remote Similarity |
NPD4753 |
Phase 2 |
0.6275 |
Remote Similarity |
NPD3133 |
Approved |
0.6275 |
Remote Similarity |
NPD3665 |
Phase 1 |
0.6275 |
Remote Similarity |
NPD3666 |
Approved |
0.627 |
Remote Similarity |
NPD7736 |
Approved |
0.6263 |
Remote Similarity |
NPD6929 |
Approved |
0.6262 |
Remote Similarity |
NPD5778 |
Approved |
0.6262 |
Remote Similarity |
NPD5779 |
Approved |
0.6261 |
Remote Similarity |
NPD5345 |
Clinical (unspecified phase) |
0.6261 |
Remote Similarity |
NPD6011 |
Approved |
0.626 |
Remote Similarity |
NPD5988 |
Approved |
0.626 |
Remote Similarity |
NPD6370 |
Approved |
0.6239 |
Remote Similarity |
NPD6617 |
Approved |
0.6239 |
Remote Similarity |
NPD8130 |
Phase 1 |
0.6239 |
Remote Similarity |
NPD6847 |
Approved |
0.6239 |
Remote Similarity |
NPD6650 |
Approved |
0.6239 |
Remote Similarity |
NPD6649 |
Approved |
0.6239 |
Remote Similarity |
NPD6869 |
Approved |
0.6214 |
Remote Similarity |
NPD1733 |
Clinical (unspecified phase) |
0.62 |
Remote Similarity |
NPD7514 |
Phase 3 |
0.62 |
Remote Similarity |
NPD7525 |
Registered |
0.619 |
Remote Similarity |
NPD6903 |
Approved |
0.619 |
Remote Similarity |
NPD7513 |
Clinical (unspecified phase) |
0.6186 |
Remote Similarity |
NPD6882 |
Approved |
0.6182 |
Remote Similarity |
NPD4755 |
Approved |
0.6176 |
Remote Similarity |
NPD5331 |
Approved |
0.6176 |
Remote Similarity |
NPD5332 |
Approved |
0.6168 |
Remote Similarity |
NPD5281 |
Approved |
0.6168 |
Remote Similarity |
NPD5284 |
Approved |
0.6168 |
Remote Similarity |
NPD6411 |
Approved |
0.6168 |
Remote Similarity |
NPD7087 |
Discontinued |
0.6162 |
Remote Similarity |
NPD5784 |
Clinical (unspecified phase) |
0.6139 |
Remote Similarity |
NPD5369 |
Approved |
0.6139 |
Remote Similarity |
NPD4790 |
Discontinued |
0.6139 |
Remote Similarity |
NPD6902 |
Approved |
0.6111 |
Remote Similarity |
NPD4202 |
Approved |
0.6111 |
Remote Similarity |
NPD6336 |
Discontinued |
0.6106 |
Remote Similarity |
NPD5211 |
Phase 2 |
0.6102 |
Remote Similarity |
NPD6401 |
Clinical (unspecified phase) |
0.61 |
Remote Similarity |
NPD4195 |
Approved |
0.6082 |
Remote Similarity |
NPD6926 |
Approved |
0.6082 |
Remote Similarity |
NPD6924 |
Approved |
0.6078 |
Remote Similarity |
NPD4270 |
Approved |
0.6078 |
Remote Similarity |
NPD4752 |
Clinical (unspecified phase) |
0.6078 |
Remote Similarity |
NPD4269 |
Approved |
0.6078 |
Remote Similarity |
NPD3667 |
Approved |
0.6071 |
Remote Similarity |
NPD5285 |
Approved |
0.6071 |
Remote Similarity |
NPD5286 |
Approved |
0.6071 |
Remote Similarity |
NPD4700 |
Approved |
0.6071 |
Remote Similarity |
NPD4696 |
Approved |
0.6068 |
Remote Similarity |
NPD8132 |
Clinical (unspecified phase) |
0.6063 |
Remote Similarity |
NPD8074 |
Phase 3 |
0.6061 |
Remote Similarity |
NPD5776 |
Phase 2 |
0.6061 |
Remote Similarity |
NPD6932 |
Approved |
0.6061 |
Remote Similarity |
NPD6925 |
Approved |
0.6058 |
Remote Similarity |
NPD6893 |
Approved |
0.6058 |
Remote Similarity |
NPD1694 |
Approved |
0.6055 |
Remote Similarity |
NPD5282 |
Discontinued |
0.6042 |
Remote Similarity |
NPD4243 |
Approved |
0.604 |
Remote Similarity |
NPD7332 |
Phase 2 |
0.6034 |
Remote Similarity |
NPD6685 |
Approved |
0.6033 |
Remote Similarity |
NPD6274 |
Approved |
0.602 |
Remote Similarity |
NPD6942 |
Approved |
0.602 |
Remote Similarity |
NPD7339 |
Approved |
0.6 |
Remote Similarity |
NPD5786 |
Approved |
0.6 |
Remote Similarity |
NPD6356 |
Clinical (unspecified phase) |
0.6 |
Remote Similarity |
NPD1698 |
Clinical (unspecified phase) |
0.6 |
Remote Similarity |
NPD4629 |
Approved |
0.6 |
Remote Similarity |
NPD7260 |
Phase 2 |
0.6 |
Remote Similarity |
NPD5141 |
Approved |
0.6 |
Remote Similarity |
NPD6098 |
Approved |
0.6 |
Remote Similarity |
NPD5210 |
Approved |
0.6 |
Remote Similarity |
NPD7145 |
Approved |
0.5981 |
Remote Similarity |
NPD6080 |
Approved |
0.5981 |
Remote Similarity |
NPD5764 |
Clinical (unspecified phase) |
0.5981 |
Remote Similarity |
NPD6904 |
Approved |
0.5981 |
Remote Similarity |
NPD6101 |
Approved |
0.5981 |
Remote Similarity |
NPD6673 |
Approved |
0.5965 |
Remote Similarity |
NPD5225 |
Approved |
0.5965 |
Remote Similarity |
NPD4633 |
Approved |
0.5965 |
Remote Similarity |
NPD5224 |
Approved |
0.5965
|
Remote Similarity |
NPD5226 |
Approved |